diff --git a/.eslintrc b/.eslintrc index 6e483a13b7d6c5..fdfdaf0833045d 100644 --- a/.eslintrc +++ b/.eslintrc @@ -2,6 +2,9 @@ env: node: true es6: true +parserOptions: + ecmaVersion: 2016 + rules: # Possible Errors # http://eslint.org/docs/rules/#possible-errors @@ -63,6 +66,12 @@ rules: object: assert, property: deepEqual, message: Please use assert.deepStrictEqual(). + }, { + property: __defineGetter__, + message: __defineGetter__ is deprecated. + }, { + property: __defineSetter__, + message: __defineSetter__ is deprecated. }] # Stylistic Issues @@ -112,7 +121,6 @@ rules: align-multiline-assignment: 2 assert-fail-single-argument: 2 new-with-error: [2, Error, RangeError, TypeError, SyntaxError, ReferenceError] - no-definegetter-definesetter: 2 # Global scoped method and vars globals: diff --git a/.github/ISSUE_TEMPLATE.md b/.github/ISSUE_TEMPLATE.md index 4c115cb593573f..375a6aa8a24eff 100644 --- a/.github/ISSUE_TEMPLATE.md +++ b/.github/ISSUE_TEMPLATE.md @@ -1,5 +1,11 @@ + +AsyncKit provides harness for `parallel` and `serial` iterators over list of items represented by arrays or objects. +Optionally it accepts abort function (should be synchronously return by iterator for each item), and terminates left over jobs upon an error event. For specific iteration order built-in (`ascending` and `descending`) and custom sort helpers also supported, via `asynckit.serialOrdered` method. + +It ensures async operations to keep behavior more stable and prevent `Maximum call stack size exceeded` errors, from sync iterators. + +| compression | size | +| :----------------- | -------: | +| asynckit.js | 12.34 kB | +| asynckit.min.js | 4.11 kB | +| asynckit.min.js.gz | 1.47 kB | + + +## Install + +```sh +$ npm install --save asynckit +``` + +## Examples + +### Parallel Jobs + +Runs iterator over provided array in parallel. Stores output in the `result` array, +on the matching positions. In unlikely event of an error from one of the jobs, +will terminate rest of the active jobs (if abort function is provided) +and return error along with salvaged data to the main callback function. + +#### Input Array + +```javascript +var parallel = require('asynckit').parallel + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ] + , target = [] + ; + +parallel(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// async job accepts one element from the array +// and a callback function +function asyncJob(item, cb) +{ + // different delays (in ms) per item + var delay = item * 25; + + // pretend different jobs take different time to finish + // and not in consequential order + var timeoutId = setTimeout(function() { + target.push(item); + cb(null, item * 2); + }, delay); + + // allow to cancel "leftover" jobs upon error + // return function, invoking of which will abort this job + return clearTimeout.bind(null, timeoutId); +} +``` + +More examples could be found in [test/test-parallel-array.js](test/test-parallel-array.js). + +#### Input Object + +Also it supports named jobs, listed via object. + +```javascript +var parallel = require('asynckit/parallel') + , assert = require('assert') + ; + +var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 } + , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 } + , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ] + , expectedKeys = [ 'first', 'one', 'two', 'four', 'eight', 'sixteen', 'thirtyTwo', 'sixtyFour' ] + , target = [] + , keys = [] + ; + +parallel(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); + assert.deepEqual(keys, expectedKeys); +}); + +// supports full value, key, callback (shortcut) interface +function asyncJob(item, key, cb) +{ + // different delays (in ms) per item + var delay = item * 25; + + // pretend different jobs take different time to finish + // and not in consequential order + var timeoutId = setTimeout(function() { + keys.push(key); + target.push(item); + cb(null, item * 2); + }, delay); + + // allow to cancel "leftover" jobs upon error + // return function, invoking of which will abort this job + return clearTimeout.bind(null, timeoutId); +} +``` + +More examples could be found in [test/test-parallel-object.js](test/test-parallel-object.js). + +### Serial Jobs + +Runs iterator over provided array sequentially. Stores output in the `result` array, +on the matching positions. In unlikely event of an error from one of the jobs, +will not proceed to the rest of the items in the list +and return error along with salvaged data to the main callback function. + +#### Input Array + +```javascript +var serial = require('asynckit/serial') + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ] + , target = [] + ; + +serial(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// extended interface (item, key, callback) +// also supported for arrays +function asyncJob(item, key, cb) +{ + target.push(key); + + // it will be automatically made async + // even it iterator "returns" in the same event loop + cb(null, item * 2); +} +``` + +More examples could be found in [test/test-serial-array.js](test/test-serial-array.js). + +#### Input Object + +Also it supports named jobs, listed via object. + +```javascript +var serial = require('asynckit').serial + , assert = require('assert') + ; + +var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ] + , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ] + , target = [] + ; + +var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 } + , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 } + , expectedTarget = [ 1, 1, 4, 16, 64, 32, 8, 2 ] + , target = [] + ; + + +serial(source, asyncJob, function(err, result) +{ + assert.deepEqual(result, expectedResult); + assert.deepEqual(target, expectedTarget); +}); + +// shortcut interface (item, callback) +// works for object as well as for the arrays +function asyncJob(item, cb) +{ + target.push(item); + + // it will be automatically made async + // even it iterator "returns" in the same event loop + cb(null, item * 2); +} +``` + +More examples could be found in [test/test-serial-object.js](test/test-serial-object.js). + +_Note: Since _object_ is an _unordered_ collection of properties, +it may produce unexpected results with sequential iterations. +Whenever order of the jobs' execution is important please use `serialOrdered` method._ + +### Ordered Serial Iterations + +TBD + +For example [compare-property](compare-property) package. + +### Streaming interface + +TBD + +## Want to Know More? + +More examples can be found in [test folder](test/). + +Or open an [issue](https://github.com/alexindigo/asynckit/issues) with questions and/or suggestions. + +## License + +AsyncKit is licensed under the MIT license. diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/bench.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/bench.js new file mode 100644 index 00000000000000..c612f1a55fda02 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/bench.js @@ -0,0 +1,76 @@ +/* eslint no-console: "off" */ + +var asynckit = require('./') + , async = require('async') + , assert = require('assert') + , expected = 0 + ; + +var Benchmark = require('benchmark'); +var suite = new Benchmark.Suite; + +var source = []; +for (var z = 1; z < 100; z++) +{ + source.push(z); + expected += z; +} + +suite +// add tests + +.add('async.map', function(deferred) +{ + var total = 0; + + async.map(source, + function(i, cb) + { + setImmediate(function() + { + total += i; + cb(null, total); + }); + }, + function(err, result) + { + assert.ifError(err); + assert.equal(result[result.length - 1], expected); + deferred.resolve(); + }); +}, {'defer': true}) + + +.add('asynckit.parallel', function(deferred) +{ + var total = 0; + + asynckit.parallel(source, + function(i, cb) + { + setImmediate(function() + { + total += i; + cb(null, total); + }); + }, + function(err, result) + { + assert.ifError(err); + assert.equal(result[result.length - 1], expected); + deferred.resolve(); + }); +}, {'defer': true}) + + +// add listeners +.on('cycle', function(ev) +{ + console.log(String(ev.target)); +}) +.on('complete', function() +{ + console.log('Fastest is ' + this.filter('fastest').map('name')); +}) +// run async +.run({ 'async': true }); diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/index.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/index.js new file mode 100644 index 00000000000000..455f9454ee6483 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/index.js @@ -0,0 +1,6 @@ +module.exports = +{ + parallel : require('./parallel.js'), + serial : require('./serial.js'), + serialOrdered : require('./serialOrdered.js') +}; diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/abort.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/abort.js new file mode 100644 index 00000000000000..114367e5fbf144 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/abort.js @@ -0,0 +1,29 @@ +// API +module.exports = abort; + +/** + * Aborts leftover active jobs + * + * @param {object} state - current state object + */ +function abort(state) +{ + Object.keys(state.jobs).forEach(clean.bind(state)); + + // reset leftover jobs + state.jobs = {}; +} + +/** + * Cleans up leftover job by invoking abort function for the provided job id + * + * @this state + * @param {string|number} key - job id to abort + */ +function clean(key) +{ + if (typeof this.jobs[key] == 'function') + { + this.jobs[key](); + } +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/async.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/async.js new file mode 100644 index 00000000000000..7f1288a4ce9ae0 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/async.js @@ -0,0 +1,34 @@ +var defer = require('./defer.js'); + +// API +module.exports = async; + +/** + * Runs provided callback asynchronously + * even if callback itself is not + * + * @param {function} callback - callback to invoke + * @returns {function} - augmented callback + */ +function async(callback) +{ + var isAsync = false; + + // check if async happened + defer(function() { isAsync = true; }); + + return function async_callback(err, result) + { + if (isAsync) + { + callback(err, result); + } + else + { + defer(function nextTick_callback() + { + callback(err, result); + }); + } + }; +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/defer.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/defer.js new file mode 100644 index 00000000000000..b67110c7ad6e55 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/defer.js @@ -0,0 +1,26 @@ +module.exports = defer; + +/** + * Runs provided function on next iteration of the event loop + * + * @param {function} fn - function to run + */ +function defer(fn) +{ + var nextTick = typeof setImmediate == 'function' + ? setImmediate + : ( + typeof process == 'object' && typeof process.nextTick == 'function' + ? process.nextTick + : null + ); + + if (nextTick) + { + nextTick(fn); + } + else + { + setTimeout(fn, 0); + } +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/iterate.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/iterate.js new file mode 100644 index 00000000000000..5d2839a590b2ba --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/iterate.js @@ -0,0 +1,75 @@ +var async = require('./async.js') + , abort = require('./abort.js') + ; + +// API +module.exports = iterate; + +/** + * Iterates over each job object + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {object} state - current job status + * @param {function} callback - invoked when all elements processed + */ +function iterate(list, iterator, state, callback) +{ + // store current index + var key = state['keyedList'] ? state['keyedList'][state.index] : state.index; + + state.jobs[key] = runJob(iterator, key, list[key], function(error, output) + { + // don't repeat yourself + // skip secondary callbacks + if (!(key in state.jobs)) + { + return; + } + + // clean up jobs + delete state.jobs[key]; + + if (error) + { + // don't process rest of the results + // stop still active jobs + // and reset the list + abort(state); + } + else + { + state.results[key] = output; + } + + // return salvaged results + callback(error, state.results); + }); +} + +/** + * Runs iterator over provided job element + * + * @param {function} iterator - iterator to invoke + * @param {string|number} key - key/index of the element in the list of jobs + * @param {mixed} item - job description + * @param {function} callback - invoked after iterator is done with the job + * @returns {function|mixed} - job abort function or something else + */ +function runJob(iterator, key, item, callback) +{ + var aborter; + + // allow shortcut if iterator expects only two arguments + if (iterator.length == 2) + { + aborter = iterator(item, async(callback)); + } + // otherwise go with full three arguments + else + { + aborter = iterator(item, key, async(callback)); + } + + return aborter; +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_asynckit.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_asynckit.js new file mode 100644 index 00000000000000..78ad240f0afd80 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_asynckit.js @@ -0,0 +1,91 @@ +var streamify = require('./streamify.js') + , defer = require('./defer.js') + ; + +// API +module.exports = ReadableAsyncKit; + +/** + * Base constructor for all streams + * used to hold properties/methods + */ +function ReadableAsyncKit() +{ + ReadableAsyncKit.super_.apply(this, arguments); + + // list of active jobs + this.jobs = {}; + + // add stream methods + this.destroy = destroy; + this._start = _start; + this._read = _read; +} + +/** + * Destroys readable stream, + * by aborting outstanding jobs + * + * @returns {void} + */ +function destroy() +{ + if (this.destroyed) + { + return; + } + + this.destroyed = true; + + if (typeof this.terminator == 'function') + { + this.terminator(); + } +} + +/** + * Starts provided jobs in async manner + * + * @private + */ +function _start() +{ + // first argument – runner function + var runner = arguments[0] + // take away first argument + , args = Array.prototype.slice.call(arguments, 1) + // second argument - input data + , input = args[0] + // last argument - result callback + , endCb = streamify.callback.call(this, args[args.length - 1]) + ; + + args[args.length - 1] = endCb; + // third argument - iterator + args[1] = streamify.iterator.call(this, args[1]); + + // allow time for proper setup + defer(function() + { + if (!this.destroyed) + { + this.terminator = runner.apply(null, args); + } + else + { + endCb(null, Array.isArray(input) ? [] : {}); + } + }.bind(this)); +} + + +/** + * Implement _read to comply with Readable streams + * Doesn't really make sense for flowing object mode + * + * @private + */ +function _read() +{ + +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_parallel.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_parallel.js new file mode 100644 index 00000000000000..5d2929f7a67750 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_parallel.js @@ -0,0 +1,25 @@ +var parallel = require('../parallel.js'); + +// API +module.exports = ReadableParallel; + +/** + * Streaming wrapper to `asynckit.parallel` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableParallel(list, iterator, callback) +{ + if (!(this instanceof ReadableParallel)) + { + return new ReadableParallel(list, iterator, callback); + } + + // turn on object mode + ReadableParallel.super_.call(this, {objectMode: true}); + + this._start(parallel, list, iterator, callback); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_serial.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_serial.js new file mode 100644 index 00000000000000..78226982041ce4 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_serial.js @@ -0,0 +1,25 @@ +var serial = require('../serial.js'); + +// API +module.exports = ReadableSerial; + +/** + * Streaming wrapper to `asynckit.serial` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableSerial(list, iterator, callback) +{ + if (!(this instanceof ReadableSerial)) + { + return new ReadableSerial(list, iterator, callback); + } + + // turn on object mode + ReadableSerial.super_.call(this, {objectMode: true}); + + this._start(serial, list, iterator, callback); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_serial_ordered.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_serial_ordered.js new file mode 100644 index 00000000000000..3de89c47291b40 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/readable_serial_ordered.js @@ -0,0 +1,29 @@ +var serialOrdered = require('../serialOrdered.js'); + +// API +module.exports = ReadableSerialOrdered; +// expose sort helpers +module.exports.ascending = serialOrdered.ascending; +module.exports.descending = serialOrdered.descending; + +/** + * Streaming wrapper to `asynckit.serialOrdered` + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {stream.Readable#} + */ +function ReadableSerialOrdered(list, iterator, sortMethod, callback) +{ + if (!(this instanceof ReadableSerialOrdered)) + { + return new ReadableSerialOrdered(list, iterator, sortMethod, callback); + } + + // turn on object mode + ReadableSerialOrdered.super_.call(this, {objectMode: true}); + + this._start(serialOrdered, list, iterator, sortMethod, callback); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/state.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/state.js new file mode 100644 index 00000000000000..cbea7ad8f6bc63 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/state.js @@ -0,0 +1,37 @@ +// API +module.exports = state; + +/** + * Creates initial state object + * for iteration over list + * + * @param {array|object} list - list to iterate over + * @param {function|null} sortMethod - function to use for keys sort, + * or `null` to keep them as is + * @returns {object} - initial state object + */ +function state(list, sortMethod) +{ + var isNamedList = !Array.isArray(list) + , initState = + { + index : 0, + keyedList: isNamedList || sortMethod ? Object.keys(list) : null, + jobs : {}, + results : isNamedList ? {} : [], + size : isNamedList ? Object.keys(list).length : list.length + } + ; + + if (sortMethod) + { + // sort array keys based on it's values + // sort object's keys just on own merit + initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) + { + return sortMethod(list[a], list[b]); + }); + } + + return initState; +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/streamify.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/streamify.js new file mode 100644 index 00000000000000..f56a1c92bf5c21 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/streamify.js @@ -0,0 +1,141 @@ +var async = require('./async.js'); + +// API +module.exports = { + iterator: wrapIterator, + callback: wrapCallback +}; + +/** + * Wraps iterators with long signature + * + * @this ReadableAsyncKit# + * @param {function} iterator - function to wrap + * @returns {function} - wrapped function + */ +function wrapIterator(iterator) +{ + var stream = this; + + return function(item, key, cb) + { + var aborter + , wrappedCb = async(wrapIteratorCallback.call(stream, cb, key)) + ; + + stream.jobs[key] = wrappedCb; + + // it's either shortcut (item, cb) + if (iterator.length == 2) + { + aborter = iterator(item, wrappedCb); + } + // or long format (item, key, cb) + else + { + aborter = iterator(item, key, wrappedCb); + } + + return aborter; + }; +} + +/** + * Wraps provided callback function + * allowing to execute snitch function before + * real callback + * + * @this ReadableAsyncKit# + * @param {function} callback - function to wrap + * @returns {function} - wrapped function + */ +function wrapCallback(callback) +{ + var stream = this; + + var wrapped = function(error, result) + { + return finisher.call(stream, error, result, callback); + }; + + return wrapped; +} + +/** + * Wraps provided iterator callback function + * makes sure snitch only called once, + * but passes secondary calls to the original callback + * + * @this ReadableAsyncKit# + * @param {function} callback - callback to wrap + * @param {number|string} key - iteration key + * @returns {function} wrapped callback + */ +function wrapIteratorCallback(callback, key) +{ + var stream = this; + + return function(error, output) + { + // don't repeat yourself + if (!(key in stream.jobs)) + { + callback(error, output); + return; + } + + // clean up jobs + delete stream.jobs[key]; + + return streamer.call(stream, error, {key: key, value: output}, callback); + }; +} + +/** + * Stream wrapper for iterator callback + * + * @this ReadableAsyncKit# + * @param {mixed} error - error response + * @param {mixed} output - iterator output + * @param {function} callback - callback that expects iterator results + */ +function streamer(error, output, callback) +{ + if (error && !this.error) + { + this.error = error; + this.pause(); + this.emit('error', error); + // send back value only, as expected + callback(error, output && output.value); + return; + } + + // stream stuff + this.push(output); + + // back to original track + // send back value only, as expected + callback(error, output && output.value); +} + +/** + * Stream wrapper for finishing callback + * + * @this ReadableAsyncKit# + * @param {mixed} error - error response + * @param {mixed} output - iterator output + * @param {function} callback - callback that expects final results + */ +function finisher(error, output, callback) +{ + // signal end of the stream + // only for successfully finished streams + if (!error) + { + this.push(null); + } + + // back to original track + callback(error, output); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/terminator.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/terminator.js new file mode 100644 index 00000000000000..d6eb99219f3d9d --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/lib/terminator.js @@ -0,0 +1,29 @@ +var abort = require('./abort.js') + , async = require('./async.js') + ; + +// API +module.exports = terminator; + +/** + * Terminates jobs in the attached state context + * + * @this AsyncKitState# + * @param {function} callback - final callback to invoke after termination + */ +function terminator(callback) +{ + if (!Object.keys(this.jobs).length) + { + return; + } + + // fast forward iteration index + this.index = this.size; + + // abort jobs + abort(this); + + // send back results we have so far + async(callback)(null, this.results); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/package.json b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/package.json new file mode 100644 index 00000000000000..ac7a956bf84863 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/package.json @@ -0,0 +1,126 @@ +{ + "_args": [ + [ + { + "raw": "asynckit@^0.4.0", + "scope": null, + "escapedName": "asynckit", + "name": "asynckit", + "rawSpec": "^0.4.0", + "spec": ">=0.4.0 <0.5.0", + "type": "range" + }, + "/Users/rebecca/code/npm/node_modules/request/node_modules/form-data" + ] + ], + "_from": "asynckit@>=0.4.0 <0.5.0", + "_id": "asynckit@0.4.0", + "_inCache": true, + "_location": "/request/form-data/asynckit", + "_nodeVersion": "0.12.11", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/asynckit-0.4.0.tgz_1465928940169_0.8008207362145185" + }, + "_npmUser": { + "name": "alexindigo", + "email": "iam@alexindigo.com" + }, + "_npmVersion": "2.15.6", + "_phantomChildren": {}, + "_requested": { + "raw": "asynckit@^0.4.0", + "scope": null, + "escapedName": "asynckit", + "name": "asynckit", + "rawSpec": "^0.4.0", + "spec": ">=0.4.0 <0.5.0", + "type": "range" + }, + "_requiredBy": [ + "/request/form-data" + ], + "_resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "_shasum": "c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79", + "_shrinkwrap": null, + "_spec": "asynckit@^0.4.0", + "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/form-data", + "author": { + "name": "Alex Indigo", + "email": "iam@alexindigo.com" + }, + "bugs": { + "url": "https://github.com/alexindigo/asynckit/issues" + }, + "dependencies": {}, + "description": "Minimal async jobs utility library, with streams support", + "devDependencies": { + "browserify": "^13.0.0", + "browserify-istanbul": "^2.0.0", + "coveralls": "^2.11.9", + "eslint": "^2.9.0", + "istanbul": "^0.4.3", + "obake": "^0.1.2", + "phantomjs-prebuilt": "^2.1.7", + "pre-commit": "^1.1.3", + "reamde": "^1.1.0", + "rimraf": "^2.5.2", + "size-table": "^0.2.0", + "tap-spec": "^4.1.1", + "tape": "^4.5.1" + }, + "directories": {}, + "dist": { + "shasum": "c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79", + "tarball": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz" + }, + "gitHead": "583a75ed4fe41761b66416bb6e703ebb1f8963bf", + "homepage": "https://github.com/alexindigo/asynckit#readme", + "keywords": [ + "async", + "jobs", + "parallel", + "serial", + "iterator", + "array", + "object", + "stream", + "destroy", + "terminate", + "abort" + ], + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "alexindigo", + "email": "iam@alexindigo.com" + } + ], + "name": "asynckit", + "optionalDependencies": {}, + "pre-commit": [ + "clean", + "lint", + "test", + "browser", + "report", + "size" + ], + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/alexindigo/asynckit.git" + }, + "scripts": { + "browser": "browserify -t browserify-istanbul test/lib/browserify_adjustment.js test/test-*.js | obake --coverage | tap-spec", + "clean": "rimraf coverage", + "debug": "tape test/test-*.js", + "lint": "eslint *.js lib/*.js test/*.js", + "report": "istanbul report", + "size": "browserify index.js | size-table asynckit", + "test": "istanbul cover --reporter=json tape -- 'test/test-*.js' | tap-spec", + "win-test": "tape test/test-*.js" + }, + "version": "0.4.0" +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/parallel.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/parallel.js new file mode 100644 index 00000000000000..3c50344d8515f8 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/parallel.js @@ -0,0 +1,43 @@ +var iterate = require('./lib/iterate.js') + , initState = require('./lib/state.js') + , terminator = require('./lib/terminator.js') + ; + +// Public API +module.exports = parallel; + +/** + * Runs iterator over provided array elements in parallel + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function parallel(list, iterator, callback) +{ + var state = initState(list); + + while (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, function(error, result) + { + if (error) + { + callback(error, result); + return; + } + + // looks like it's the last one + if (Object.keys(state.jobs).length === 0) + { + callback(null, state.results); + return; + } + }); + + state.index++; + } + + return terminator.bind(state, callback); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/serial.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/serial.js new file mode 100644 index 00000000000000..6cd949a6777137 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/serial.js @@ -0,0 +1,17 @@ +var serialOrdered = require('./serialOrdered.js'); + +// Public API +module.exports = serial; + +/** + * Runs iterator over provided array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serial(list, iterator, callback) +{ + return serialOrdered(list, iterator, null, callback); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/serialOrdered.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/serialOrdered.js new file mode 100644 index 00000000000000..607eafea56cb06 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/serialOrdered.js @@ -0,0 +1,75 @@ +var iterate = require('./lib/iterate.js') + , initState = require('./lib/state.js') + , terminator = require('./lib/terminator.js') + ; + +// Public API +module.exports = serialOrdered; +// sorting helpers +module.exports.ascending = ascending; +module.exports.descending = descending; + +/** + * Runs iterator over provided sorted array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serialOrdered(list, iterator, sortMethod, callback) +{ + var state = initState(list, sortMethod); + + iterate(list, iterator, state, function iteratorHandler(error, result) + { + if (error) + { + callback(error, result); + return; + } + + state.index++; + + // are we there yet? + if (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, iteratorHandler); + return; + } + + // done here + callback(null, state.results); + }); + + return terminator.bind(state, callback); +} + +/* + * -- Sort methods + */ + +/** + * sort helper to sort array elements in ascending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function ascending(a, b) +{ + return a < b ? -1 : a > b ? 1 : 0; +} + +/** + * sort helper to sort array elements in descending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function descending(a, b) +{ + return -1 * ascending(a, b); +} diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/stream.js b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/stream.js new file mode 100644 index 00000000000000..7b77116ebab733 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/asynckit/stream.js @@ -0,0 +1,21 @@ +var inherits = require('util').inherits + , Readable = require('stream').Readable + , ReadableAsyncKit = require('./lib/readable_asynckit.js') + , ReadableParallel = require('./lib/readable_parallel.js') + , ReadableSerial = require('./lib/readable_serial.js') + , ReadableSerialOrdered = require('./lib/readable_serial_ordered.js') + ; + +// API +module.exports = +{ + parallel : ReadableParallel, + serial : ReadableSerial, + serialOrdered : ReadableSerialOrdered, +}; + +inherits(ReadableAsyncKit, Readable); + +inherits(ReadableParallel, ReadableAsyncKit); +inherits(ReadableSerial, ReadableAsyncKit); +inherits(ReadableSerialOrdered, ReadableAsyncKit); diff --git a/deps/npm/node_modules/request/node_modules/form-data/package.json b/deps/npm/node_modules/request/node_modules/form-data/package.json index 5c4375edfe0207..a8b4839b7c7e69 100644 --- a/deps/npm/node_modules/request/node_modules/form-data/package.json +++ b/deps/npm/node_modules/request/node_modules/form-data/package.json @@ -2,49 +2,48 @@ "_args": [ [ { - "raw": "form-data@~1.0.0-rc4", + "raw": "form-data@~2.0.0", "scope": null, "escapedName": "form-data", "name": "form-data", - "rawSpec": "~1.0.0-rc4", - "spec": ">=1.0.0-rc4 <1.1.0", + "rawSpec": "~2.0.0", + "spec": ">=2.0.0 <2.1.0", "type": "range" }, "/Users/rebecca/code/npm/node_modules/request" ] ], - "_from": "form-data@>=1.0.0-rc4 <1.1.0", - "_id": "form-data@1.0.0-rc4", + "_from": "form-data@>=2.0.0 <2.1.0", + "_id": "form-data@2.0.0", "_inCache": true, - "_installable": true, "_location": "/request/form-data", - "_nodeVersion": "0.12.11", + "_nodeVersion": "4.5.0", "_npmOperationalInternal": { "host": "packages-12-west.internal.npmjs.com", - "tmp": "tmp/form-data-1.0.0-rc4.tgz_1458059747097_0.14101114077493548" + "tmp": "tmp/form-data-2.0.0.tgz_1474092617403_0.5404838663525879" }, "_npmUser": { "name": "alexindigo", "email": "iam@alexindigo.com" }, - "_npmVersion": "2.14.9", + "_npmVersion": "2.15.9", "_phantomChildren": {}, "_requested": { - "raw": "form-data@~1.0.0-rc4", + "raw": "form-data@~2.0.0", "scope": null, "escapedName": "form-data", "name": "form-data", - "rawSpec": "~1.0.0-rc4", - "spec": ">=1.0.0-rc4 <1.1.0", + "rawSpec": "~2.0.0", + "spec": ">=2.0.0 <2.1.0", "type": "range" }, "_requiredBy": [ "/request" ], - "_resolved": "https://registry.npmjs.org/form-data/-/form-data-1.0.0-rc4.tgz", - "_shasum": "05ac6bc22227b43e4461f488161554699d4f8b5e", + "_resolved": "https://registry.npmjs.org/form-data/-/form-data-2.0.0.tgz", + "_shasum": "6f0aebadcc5da16c13e1ecc11137d85f9b883b25", "_shrinkwrap": null, - "_spec": "form-data@~1.0.0-rc4", + "_spec": "form-data@~2.0.0", "_where": "/Users/rebecca/code/npm/node_modules/request", "author": { "name": "Felix Geisendörfer", @@ -56,60 +55,54 @@ "url": "https://github.com/form-data/form-data/issues" }, "dependencies": { - "async": "^1.5.2", + "asynckit": "^0.4.0", "combined-stream": "^1.0.5", - "mime-types": "^2.1.10" + "mime-types": "^2.1.11" }, "description": "A library to create readable \"multipart/form-data\" streams. Can be used to submit forms and file uploads to other web applications.", "devDependencies": { - "codacy-coverage": "^1.1.3", - "coveralls": "^2.11.8", - "cross-spawn": "^2.1.5", - "eslint": "^2.4.0", + "coveralls": "^2.11.13", + "cross-spawn": "^4.0.0", + "eslint": "^3.5.0", "fake": "^0.2.2", "far": "^0.0.7", "formidable": "^1.0.17", - "istanbul": "^0.4.2", - "pre-commit": "^1.1.2", - "request": "^2.69.0", - "rimraf": "^2.5.2" + "in-publish": "^2.0.0", + "is-node-modern": "^1.0.0", + "istanbul": "^0.4.5", + "pkgfiles": "^2.3.0", + "pre-commit": "^1.1.3", + "request": "^2.74.0", + "rimraf": "^2.5.4" }, "directories": {}, "dist": { - "shasum": "05ac6bc22227b43e4461f488161554699d4f8b5e", - "tarball": "https://registry.npmjs.org/form-data/-/form-data-1.0.0-rc4.tgz" + "shasum": "6f0aebadcc5da16c13e1ecc11137d85f9b883b25", + "tarball": "https://registry.npmjs.org/form-data/-/form-data-2.0.0.tgz" }, "engines": { - "node": ">= 0.10" + "node": ">= 0.12" }, - "gitHead": "f73996e0508ee2d4b2b376276adfac1de4188ac2", + "gitHead": "652b16ff5b9077bdf65eb66b67286c823c2a1040", "homepage": "https://github.com/form-data/form-data#readme", "license": "MIT", "main": "./lib/form_data", "maintainers": [ - { - "name": "felixge", - "email": "felix@debuggable.com" - }, - { - "name": "idralyuk", - "email": "igor@buran.us" - }, { "name": "alexindigo", "email": "iam@alexindigo.com" }, { - "name": "mikeal", - "email": "mikeal.rogers@gmail.com" + "name": "dylanpiercey", + "email": "pierceydylan@gmail.com" }, { - "name": "celer", - "email": "dtyree77@gmail.com" + "name": "felixge", + "email": "felix@debuggable.com" }, { - "name": "dylanpiercey", - "email": "pierceydylan@gmail.com" + "name": "mikeal", + "email": "mikeal.rogers@gmail.com" } ], "name": "form-data", @@ -126,13 +119,19 @@ }, "scripts": { "check": "istanbul check-coverage coverage/coverage*.json", - "coverage": "codacy-coverage < ./coverage/lcov.info; true", + "ci-lint": "is-node-modern && npm run lint || is-node-not-modern", "debug": "verbose=1 ./test/run.js", - "lint": "eslint lib/*.js test/*.js test/**/*.js", - "posttest": "istanbul report", + "files": "pkgfiles --sort=name", + "get-version": "node -e \"console.log(require('./package.json').version)\"", + "lint": "eslint lib/*.js test/*.js test/integration/*.js", + "postpublish": "npm run restore-readme", + "posttest": "istanbul report lcov text", "predebug": "rimraf coverage test/tmp", + "prepublish": "in-publish && npm run update-readme || not-in-publish", "pretest": "rimraf coverage test/tmp", - "test": "istanbul cover --report none test/run.js" + "restore-readme": "mv README.md.bak README.md", + "test": "istanbul cover test/run.js", + "update-readme": "sed -i.bak 's/\\/master\\.svg/\\/v'$(npm --silent run get-version)'.svg/g' README.md" }, - "version": "1.0.0-rc4" + "version": "2.0.0" } diff --git a/deps/npm/node_modules/request/node_modules/form-data/wercker.yml b/deps/npm/node_modules/request/node_modules/form-data/wercker.yml deleted file mode 100644 index 6b118d1e31aa73..00000000000000 --- a/deps/npm/node_modules/request/node_modules/form-data/wercker.yml +++ /dev/null @@ -1,36 +0,0 @@ -# This references the default nodejs container from -# the Docker Hub: https://registry.hub.docker.com/_/node/ -# If you want Nodesource's container you would reference nodesource/node -# Read more about containers on our dev center -# http://devcenter.wercker.com/docs/containers/index.html -box: node -# This is the build pipeline. Pipelines are the core of wercker -# Read more about pipelines on our dev center -# http://devcenter.wercker.com/docs/pipelines/index.html - -# You can also use services such as databases. Read more on our dev center: -# http://devcenter.wercker.com/docs/services/index.html -# services: - # - postgres - # http://devcenter.wercker.com/docs/services/postgresql.html - - # - mongodb - # http://devcenter.wercker.com/docs/services/mongodb.html -build: - # The steps that will be executed on build - # Steps make up the actions in your pipeline - # Read more about steps on our dev center: - # http://devcenter.wercker.com/docs/steps/index.html - steps: - # A step that executes `npm install` command - - npm-install - # A step that executes `npm test` command - - npm-test - - # A custom script step, name value is used in the UI - # and the code value contains the command that get executed - - script: - name: echo nodejs information - code: | - echo "node version $(node -v) running" - echo "npm version $(npm -v) running" diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js index f929bb75394944..779cfe20bf6009 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js @@ -514,15 +514,23 @@ var compile = function(schema, cache, root, reporter, opts) { } if (node.minimum !== undefined) { + if (type !== 'number' && type !== 'integer') validate('if (%s) {', types.number(name)) + validate('if (%s %s %d) {', name, node.exclusiveMinimum ? '<=' : '<', node.minimum) error('is less than minimum') validate('}') + + if (type !== 'number' && type !== 'integer') validate('}') } if (node.maximum !== undefined) { + if (type !== 'number' && type !== 'integer') validate('if (%s) {', types.number(name)) + validate('if (%s %s %d) {', name, node.exclusiveMaximum ? '>=' : '>', node.maximum) error('is more than maximum') validate('}') + + if (type !== 'number' && type !== 'integer') validate('}') } if (properties) { @@ -540,6 +548,8 @@ var compile = function(schema, cache, root, reporter, opts) { var validate = genfun ('function validate(data) {') + // Since undefined is not a valid JSON value, we coerce to null and other checks will catch this + ('if (data === undefined) data = null') ('validate.errors = null') ('var errors = 0') diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml index 9338bf147031df..7f56324f5c870d 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml @@ -1,10 +1,7 @@ language: "node_js" node_js: - - 0.6 - - 0.8 - 0.10 - 0.11 - 0.12 - - iojs-v1.0 - - iojs-v2.0 - - iojs + - 4.0 + - node diff --git a/tools/eslint/node_modules/xregexp/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/LICENSE.md similarity index 89% rename from tools/eslint/node_modules/xregexp/LICENSE rename to deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/LICENSE.md index 5561edc5d2ffce..ce3647904d79b9 100644 --- a/tools/eslint/node_modules/xregexp/LICENSE +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/LICENSE.md @@ -1,6 +1,6 @@ -The MIT License +The MIT License (MIT) -Copyright (c) 2007-2016 Steven Levithan +Copyright (c) 2011-2015 Jan Lehnardt & Marc Bachmann Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md index e096dfa5d62a77..bc7aa153dd863b 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md @@ -3,17 +3,24 @@ This is an implementation of [JSON Pointer](http://tools.ietf.org/html/draft-ietf-appsawg-json-pointer-08). ## Usage +```javascript +var jsonpointer = require('jsonpointer'); +var obj = { foo: 1, bar: { baz: 2}, qux: [3, 4, 5]}; - var jsonpointer = require("jsonpointer"); - var obj = { foo: 1, bar: { baz: 2}, qux: [3, 4, 5]}; - var one = jsonpointer.get(obj, "/foo"); - var two = jsonpointer.get(obj, "/bar/baz"); - var three = jsonpointer.get(obj, "/qux/0"); - var four = jsonpointer.get(obj, "/qux/1"); - var five = jsonpointer.get(obj, "/qux/2"); - var notfound = jsonpointer.get(obj, "/quo"); // returns null +jsonpointer.get(obj, '/foo'); // returns 1 +jsonpointer.get(obj, '/bar/baz'); // returns 2 +jsonpointer.get(obj, '/qux/0'); // returns 3 +jsonpointer.get(obj, '/qux/1'); // returns 4 +jsonpointer.get(obj, '/qux/2'); // returns 5 +jsonpointer.get(obj, '/quo'); // returns null - jsonpointer.set(obj, "/foo", 6); // obj.foo = 6; +jsonpointer.set(obj, '/foo', 6); // sets obj.foo = 6; +jsonpointer.set(obj, '/qux/-', 6) // sets obj.qux = [3, 4, 5, 6] + +var pointer = jsonpointer.compile('/foo') +pointer.get(obj) // returns 1 +pointer.set(obj, 1) // sets obj.foo = 1 +``` ## Testing @@ -25,7 +32,7 @@ This is an implementation of [JSON Pointer](http://tools.ietf.org/html/draft-iet ## Author -(c) 2011 Jan Lehnardt +(c) 2011-2015 Jan Lehnardt & Marc Bachmann ## License diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/benchmark.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/benchmark.js new file mode 100644 index 00000000000000..8a95636deee0b9 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/benchmark.js @@ -0,0 +1,56 @@ +var jsonpointer = require('./') + +var i +var obj = { + a: 1, + b: { + c: 2 + }, + d: { + e: [{ a: 3 }, { b: 4 }, { c: 5 }] + } +} + +// Get +console.time('get first level property') +for (i = 0; i < 1e6; i++) { + jsonpointer.get(obj, '/a') +} +console.timeEnd('get first level property') + +console.time('get second level property') +for (i = 0; i < 1e6; i++) { + jsonpointer.get(obj, '/d/e') +} +console.timeEnd('get second level property') + +console.time('get third level property') +for (i = 0; i < 1e6; i++) { + jsonpointer.get(obj, '/d/e/0') +} +console.timeEnd('get third level property') + +// Set +console.time('set first level property') +for (i = 0; i < 1e6; i++) { + jsonpointer.set(obj, '/a', 'bla') +} +console.timeEnd('set first level property') + +console.time('set second level property') +for (i = 0; i < 1e6; i++) { + jsonpointer.set(obj, '/d/e', 'bla') +} +console.timeEnd('set second level property') + +console.time('set third level property') +for (i = 0; i < 1e6; i++) { + jsonpointer.set(obj, '/d/e/0', 'bla') +} +console.timeEnd('set third level property') + +console.time('push property into array') +for (i = 0; i < 1e6; i++) { + jsonpointer.set(obj, '/d/e/-', 'bla') +} +console.timeEnd('push property into array') diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js index 006f85ef3a5489..7cfaec0fbda968 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js @@ -1,76 +1,93 @@ -var untilde = function(str) { - return str.replace(/~./g, function(m) { - switch (m) { - case "~0": - return "~"; - case "~1": - return "/"; - } - throw new Error("Invalid tilde escape: " + m); - }); +var hasExcape = /~/ +var escapeMatcher = /~[01]/g +function escapeReplacer (m) { + switch (m) { + case '~1': return '/' + case '~0': return '~' + } + throw new Error('Invalid tilde escape: ' + m) } -var traverse = function(obj, pointer, value) { - // assert(isArray(pointer)) - var part = untilde(pointer.shift()); - if(!obj.hasOwnProperty(part)) { - return null; - } - if(pointer.length !== 0) { // keep traversin! - return traverse(obj[part], pointer, value); - } - // we're done - if(typeof value === "undefined") { - // just reading - return obj[part]; - } - // set new value, return old value - var old_value = obj[part]; - if(value === null) { - delete obj[part]; - } else { - obj[part] = value; - } - return old_value; +function untilde (str) { + if (!hasExcape.test(str)) return str + return str.replace(escapeMatcher, escapeReplacer) } -var validate_input = function(obj, pointer) { - if(typeof obj !== "object") { - throw new Error("Invalid input object."); - } +function setter (obj, pointer, value) { + var part + var hasNextPart - if(pointer === "") { - return []; - } + for (var p = 1, len = pointer.length; p < len;) { + part = untilde(pointer[p++]) + hasNextPart = len > p + + if (typeof obj[part] === 'undefined') { + // support setting of /- + if (Array.isArray(obj) && part === '-') { + part = obj.length + } - if(!pointer) { - throw new Error("Invalid JSON pointer."); + // support nested objects/array when setting values + if (hasNextPart) { + if ((pointer[p] !== '' && pointer[p] < Infinity) || pointer[p] === '-') obj[part] = [] + else obj[part] = {} + } + } + + if (!hasNextPart) break + obj = obj[part] } - pointer = pointer.split("/"); - var first = pointer.shift(); - if (first !== "") { - throw new Error("Invalid JSON pointer."); + var oldValue = obj[part] + if (value === undefined) delete obj[part] + else obj[part] = value + return oldValue +} + +function compilePointer (pointer) { + if (typeof pointer === 'string') { + pointer = pointer.split('/') + if (pointer[0] === '') return pointer + throw new Error('Invalid JSON pointer.') + } else if (Array.isArray(pointer)) { + return pointer } - return pointer; + throw new Error('Invalid JSON pointer.') } -var get = function(obj, pointer) { - pointer = validate_input(obj, pointer); - if (pointer.length === 0) { - return obj; +function get (obj, pointer) { + if (typeof obj !== 'object') throw new Error('Invalid input object.') + pointer = compilePointer(pointer) + var len = pointer.length + if (len === 1) return obj + + for (var p = 1; p < len;) { + obj = obj[untilde(pointer[p++])] + if (len === p) return obj + if (typeof obj !== 'object') return undefined } - return traverse(obj, pointer); } -var set = function(obj, pointer, value) { - pointer = validate_input(obj, pointer); - if (pointer.length === 0) { - throw new Error("Invalid JSON pointer for set.") +function set (obj, pointer, value) { + if (typeof obj !== 'object') throw new Error('Invalid input object.') + pointer = compilePointer(pointer) + if (pointer.length === 0) throw new Error('Invalid JSON pointer for set.') + return setter(obj, pointer, value) +} + +function compile (pointer) { + var compiled = compilePointer(pointer) + return { + get: function (object) { + return get(object, compiled) + }, + set: function (object, value) { + return set(object, compiled, value) + } } - return traverse(obj, pointer, value); } exports.get = get exports.set = set +exports.compile = compile diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json index c90dcced7caae7..b2fe8c6ee36903 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json @@ -2,45 +2,48 @@ "_args": [ [ { - "raw": "jsonpointer@2.0.0", + "raw": "jsonpointer@^4.0.0", "scope": null, "escapedName": "jsonpointer", "name": "jsonpointer", - "rawSpec": "2.0.0", - "spec": "2.0.0", - "type": "version" + "rawSpec": "^4.0.0", + "spec": ">=4.0.0 <5.0.0", + "type": "range" }, "/Users/rebecca/code/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid" ] ], - "_from": "jsonpointer@2.0.0", - "_id": "jsonpointer@2.0.0", + "_from": "jsonpointer@>=4.0.0 <5.0.0", + "_id": "jsonpointer@4.0.0", "_inCache": true, - "_installable": true, "_location": "/request/har-validator/is-my-json-valid/jsonpointer", - "_nodeVersion": "0.10.36", + "_nodeVersion": "6.1.0", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/jsonpointer-4.0.0.tgz_1463651460494_0.02921536797657609" + }, "_npmUser": { "name": "marcbachmann", "email": "marc.brookman@gmail.com" }, - "_npmVersion": "2.10.1", + "_npmVersion": "3.8.6", "_phantomChildren": {}, "_requested": { - "raw": "jsonpointer@2.0.0", + "raw": "jsonpointer@^4.0.0", "scope": null, "escapedName": "jsonpointer", "name": "jsonpointer", - "rawSpec": "2.0.0", - "spec": "2.0.0", - "type": "version" + "rawSpec": "^4.0.0", + "spec": ">=4.0.0 <5.0.0", + "type": "range" }, "_requiredBy": [ "/request/har-validator/is-my-json-valid" ], - "_resolved": "https://registry.npmjs.org/jsonpointer/-/jsonpointer-2.0.0.tgz", - "_shasum": "3af1dd20fe85463910d469a385e33017d2a030d9", + "_resolved": "https://registry.npmjs.org/jsonpointer/-/jsonpointer-4.0.0.tgz", + "_shasum": "6661e161d2fc445f19f98430231343722e1fcbd5", "_shrinkwrap": null, - "_spec": "jsonpointer@2.0.0", + "_spec": "jsonpointer@^4.0.0", "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid", "author": { "name": "Jan Lehnardt", @@ -53,20 +56,26 @@ { "name": "Joe Hildebrand", "email": "joe-github@cursive.net" + }, + { + "name": "Marc Bachmann", + "email": "marc.brookman@gmail.com" } ], "dependencies": {}, "description": "Simple JSON Addressing.", - "devDependencies": {}, + "devDependencies": { + "standard": "^5.3.1" + }, "directories": {}, "dist": { - "shasum": "3af1dd20fe85463910d469a385e33017d2a030d9", - "tarball": "https://registry.npmjs.org/jsonpointer/-/jsonpointer-2.0.0.tgz" + "shasum": "6661e161d2fc445f19f98430231343722e1fcbd5", + "tarball": "https://registry.npmjs.org/jsonpointer/-/jsonpointer-4.0.0.tgz" }, "engines": { - "node": ">=0.6.0" + "node": ">=0.10.0" }, - "gitHead": "26ea4a5c0fcb6d9a2e87f733403791dd05637af8", + "gitHead": "2d46030ba6df41b566934c7202e31fb65058de71", "homepage": "https://github.com/janl/node-jsonpointer#readme", "license": "MIT", "main": "./jsonpointer", @@ -88,7 +97,7 @@ "url": "git+ssh://git@github.com/janl/node-jsonpointer.git" }, "scripts": { - "test": "node test.js" + "test": "standard && node test.js" }, "tags": [ "util", @@ -96,5 +105,5 @@ "util", "utility" ], - "version": "2.0.0" + "version": "4.0.0" } diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js index 1c67d7f7efc898..e3d99630f0a903 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js @@ -1,5 +1,5 @@ -var assert = require("assert"); -var jsonpointer = require("./jsonpointer"); +var assert = require('assert') +var jsonpointer = require('./jsonpointer') var obj = { a: 1, @@ -7,92 +7,125 @@ var obj = { c: 2 }, d: { - e: [{a:3}, {b:4}, {c:5}] + e: [{ a: 3 }, { b: 4 }, { c: 5 }] } -}; +} -assert.equal(jsonpointer.get(obj, "/a"), 1); -assert.equal(jsonpointer.get(obj, "/b/c"), 2); -assert.equal(jsonpointer.get(obj, "/d/e/0/a"), 3); -assert.equal(jsonpointer.get(obj, "/d/e/1/b"), 4); -assert.equal(jsonpointer.get(obj, "/d/e/2/c"), 5); +assert.equal(jsonpointer.get(obj, '/a'), 1) +assert.equal(jsonpointer.get(obj, '/b/c'), 2) +assert.equal(jsonpointer.get(obj, '/d/e/0/a'), 3) +assert.equal(jsonpointer.get(obj, '/d/e/1/b'), 4) +assert.equal(jsonpointer.get(obj, '/d/e/2/c'), 5) // set returns old value -assert.equal(jsonpointer.set(obj, "/a", 2), 1); -assert.equal(jsonpointer.set(obj, "/b/c", 3), 2); -assert.equal(jsonpointer.set(obj, "/d/e/0/a", 4), 3); -assert.equal(jsonpointer.set(obj, "/d/e/1/b", 5), 4); -assert.equal(jsonpointer.set(obj, "/d/e/2/c", 6), 5); - -assert.equal(jsonpointer.get(obj, "/a"), 2); -assert.equal(jsonpointer.get(obj, "/b/c"), 3); -assert.equal(jsonpointer.get(obj, "/d/e/0/a"), 4); -assert.equal(jsonpointer.get(obj, "/d/e/1/b"), 5); -assert.equal(jsonpointer.get(obj, "/d/e/2/c"), 6); - -assert.equal(jsonpointer.get(obj, ""), obj); -assert.throws(function(){ jsonpointer.get(obj, "a"); }, validateError); -assert.throws(function(){ jsonpointer.get(obj, "a/"); }, validateError); - -function validateError(err) { - if ( (err instanceof Error) && /Invalid JSON pointer/.test(err.message) ) { - return true; +assert.equal(jsonpointer.set(obj, '/a', 2), 1) +assert.equal(jsonpointer.set(obj, '/b/c', 3), 2) +assert.equal(jsonpointer.set(obj, '/d/e/0/a', 4), 3) +assert.equal(jsonpointer.set(obj, '/d/e/1/b', 5), 4) +assert.equal(jsonpointer.set(obj, '/d/e/2/c', 6), 5) + +// set nested properties +assert.equal(jsonpointer.set(obj, '/f/g/h/i', 6), undefined) +assert.equal(jsonpointer.get(obj, '/f/g/h/i'), 6) + +// set an array +assert.equal(jsonpointer.set(obj, '/f/g/h/foo/-', 'test'), undefined) +var arr = jsonpointer.get(obj, '/f/g/h/foo') +assert(Array.isArray(arr), 'set /- creates an array.') +assert.equal(arr[0], 'test') + +assert.equal(jsonpointer.get(obj, '/a'), 2) +assert.equal(jsonpointer.get(obj, '/b/c'), 3) +assert.equal(jsonpointer.get(obj, '/d/e/0/a'), 4) +assert.equal(jsonpointer.get(obj, '/d/e/1/b'), 5) +assert.equal(jsonpointer.get(obj, '/d/e/2/c'), 6) + +// can set `null` as a value +assert.equal(jsonpointer.set(obj, '/f/g/h/foo/0', null), 'test') +assert.strictEqual(jsonpointer.get(obj, '/f/g/h/foo/0'), null) +assert.equal(jsonpointer.set(obj, '/b/c', null), 3) +assert.strictEqual(jsonpointer.get(obj, '/b/c'), null) + +assert.equal(jsonpointer.get(obj, ''), obj) +assert.throws(function () { jsonpointer.get(obj, 'a') }, validateError) +assert.throws(function () { jsonpointer.get(obj, 'a/') }, validateError) + +// can unset values with `undefined` +jsonpointer.set(obj, '/a', undefined) +assert.strictEqual(jsonpointer.get(obj, '/a'), undefined) +jsonpointer.set(obj, '/d/e/1', undefined) +assert.strictEqual(jsonpointer.get(obj, '/d/e/1'), undefined) + +// returns `undefined` when path extends beyond any existing objects +assert.strictEqual(jsonpointer.get(obj, '/x/y/z'), undefined) + +function validateError (err) { + if ((err instanceof Error) && /Invalid JSON pointer/.test(err.message)) { + return true } } var complexKeys = { - "a/b": { + 'a/b': { c: 1 }, d: { - "e/f": 2 + 'e/f': 2 }, - "~1": 3, - "01": 4 + '~1': 3, + '01': 4 } -assert.equal(jsonpointer.get(complexKeys, "/a~1b/c"), 1); -assert.equal(jsonpointer.get(complexKeys, "/d/e~1f"), 2); -assert.equal(jsonpointer.get(complexKeys, "/~01"), 3); -assert.equal(jsonpointer.get(complexKeys, "/01"), 4); -assert.equal(jsonpointer.get(complexKeys, "/a/b/c"), null); -assert.equal(jsonpointer.get(complexKeys, "/~1"), null); +assert.equal(jsonpointer.get(complexKeys, '/a~1b/c'), 1) +assert.equal(jsonpointer.get(complexKeys, '/d/e~1f'), 2) +assert.equal(jsonpointer.get(complexKeys, '/~01'), 3) +assert.equal(jsonpointer.get(complexKeys, '/01'), 4) +assert.equal(jsonpointer.get(complexKeys, '/a/b/c'), null) +assert.equal(jsonpointer.get(complexKeys, '/~1'), null) // draft-ietf-appsawg-json-pointer-08 has special array rules -var ary = [ "zero", "one", "two" ]; -assert.equal(jsonpointer.get(ary, "/01"), null); +var ary = [ 'zero', 'one', 'two' ] +assert.equal(jsonpointer.get(ary, '/01'), null) -//assert.equal(jsonpointer.set(ary, "/-", "three"), null); -//assert.equal(ary[3], "three"); +assert.equal(jsonpointer.set(ary, '/-', 'three'), null) +assert.equal(ary[3], 'three') // Examples from the draft: var example = { - "foo": ["bar", "baz"], - "": 0, - "a/b": 1, - "c%d": 2, - "e^f": 3, - "g|h": 4, - "i\\j": 5, - "k\"l": 6, - " ": 7, - "m~n": 8 -}; - -assert.equal(jsonpointer.get(example, ""), example); -var ans = jsonpointer.get(example, "/foo"); -assert.equal(ans.length, 2); -assert.equal(ans[0], "bar"); -assert.equal(ans[1], "baz"); -assert.equal(jsonpointer.get(example, "/foo/0"), "bar"); -assert.equal(jsonpointer.get(example, "/"), 0); -assert.equal(jsonpointer.get(example, "/a~1b"), 1); -assert.equal(jsonpointer.get(example, "/c%d"), 2); -assert.equal(jsonpointer.get(example, "/e^f"), 3); -assert.equal(jsonpointer.get(example, "/g|h"), 4); -assert.equal(jsonpointer.get(example, "/i\\j"), 5); -assert.equal(jsonpointer.get(example, "/k\"l"), 6); -assert.equal(jsonpointer.get(example, "/ "), 7); -assert.equal(jsonpointer.get(example, "/m~0n"), 8); - -console.log("All tests pass."); + 'foo': ['bar', 'baz'], + '': 0, + 'a/b': 1, + 'c%d': 2, + 'e^f': 3, + 'g|h': 4, + 'i\\j': 5, + 'k\'l': 6, + ' ': 7, + 'm~n': 8 +} + +assert.equal(jsonpointer.get(example, ''), example) +var ans = jsonpointer.get(example, '/foo') +assert.equal(ans.length, 2) +assert.equal(ans[0], 'bar') +assert.equal(ans[1], 'baz') +assert.equal(jsonpointer.get(example, '/foo/0'), 'bar') +assert.equal(jsonpointer.get(example, '/'), 0) +assert.equal(jsonpointer.get(example, '/a~1b'), 1) +assert.equal(jsonpointer.get(example, '/c%d'), 2) +assert.equal(jsonpointer.get(example, '/e^f'), 3) +assert.equal(jsonpointer.get(example, '/g|h'), 4) +assert.equal(jsonpointer.get(example, '/i\\j'), 5) +assert.equal(jsonpointer.get(example, '/k\'l'), 6) +assert.equal(jsonpointer.get(example, '/ '), 7) +assert.equal(jsonpointer.get(example, '/m~0n'), 8) + +// jsonpointer.compile(path) +var a = {foo: 'bar'} +var pointer = jsonpointer.compile('/foo') +assert.equal(pointer.get(a), 'bar') +assert.equal(pointer.set(a, 'test'), 'bar') +assert.equal(pointer.get(a), 'test') +assert.deepEqual(a, {foo: 'test'}) + +console.log('All tests pass.') diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json index aedffd1037d5fc..a38d59e52afa2b 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json @@ -14,20 +14,19 @@ ] ], "_from": "is-my-json-valid@>=2.12.4 <3.0.0", - "_id": "is-my-json-valid@2.13.1", + "_id": "is-my-json-valid@2.15.0", "_inCache": true, - "_installable": true, "_location": "/request/har-validator/is-my-json-valid", - "_nodeVersion": "4.2.3", + "_nodeVersion": "4.2.6", "_npmOperationalInternal": { - "host": "packages-5-east.internal.npmjs.com", - "tmp": "tmp/is-my-json-valid-2.13.1.tgz_1456180270224_0.17748022079467773" + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/is-my-json-valid-2.15.0.tgz_1475420473174_0.8758093405049294" }, "_npmUser": { "name": "mafintosh", "email": "mathiasbuus@gmail.com" }, - "_npmVersion": "2.14.7", + "_npmVersion": "2.14.12", "_phantomChildren": {}, "_requested": { "raw": "is-my-json-valid@^2.12.4", @@ -41,8 +40,8 @@ "_requiredBy": [ "/request/har-validator" ], - "_resolved": "https://registry.npmjs.org/is-my-json-valid/-/is-my-json-valid-2.13.1.tgz", - "_shasum": "d55778a82feb6b0963ff4be111d5d1684e890707", + "_resolved": "https://registry.npmjs.org/is-my-json-valid/-/is-my-json-valid-2.15.0.tgz", + "_shasum": "936edda3ca3c211fd98f3b2d3e08da43f7b2915b", "_shrinkwrap": null, "_spec": "is-my-json-valid@^2.12.4", "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/har-validator", @@ -55,7 +54,7 @@ "dependencies": { "generate-function": "^2.0.0", "generate-object-property": "^1.1.0", - "jsonpointer": "2.0.0", + "jsonpointer": "^4.0.0", "xtend": "^4.0.0" }, "description": "A JSONSchema validator that uses code generation to be extremely fast", @@ -64,10 +63,10 @@ }, "directories": {}, "dist": { - "shasum": "d55778a82feb6b0963ff4be111d5d1684e890707", - "tarball": "https://registry.npmjs.org/is-my-json-valid/-/is-my-json-valid-2.13.1.tgz" + "shasum": "936edda3ca3c211fd98f3b2d3e08da43f7b2915b", + "tarball": "https://registry.npmjs.org/is-my-json-valid/-/is-my-json-valid-2.15.0.tgz" }, - "gitHead": "5bacc71441750bc6e79829abcfc21d4f2f0c4396", + "gitHead": "c4da71bf1e57083d2dac6e7d123d2e8bd6b9255e", "homepage": "https://github.com/mafintosh/is-my-json-valid", "keywords": [ "json", @@ -78,6 +77,14 @@ "license": "MIT", "main": "index.js", "maintainers": [ + { + "name": "emilbay", + "email": "github@tixz.dk" + }, + { + "name": "emilbayes", + "email": "github@tixz.dk" + }, { "name": "freeall", "email": "freeall@gmail.com" @@ -105,5 +112,5 @@ "scripts": { "test": "tape test/*.js" }, - "version": "2.13.1" + "version": "2.15.0" } diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js index 275f2ac72f3877..4ea36d51b0c736 100644 --- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js +++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js @@ -20,6 +20,14 @@ tape('simple', function(t) { t.end() }) +tape('data is undefined', function (t) { + var validate = validator({type: 'string'}) + + t.notOk(validate(null)) + t.notOk(validate(undefined)) + t.end() +}) + tape('advanced', function(t) { var validate = validator(cosmic.schema) @@ -194,6 +202,22 @@ tape('exclusiveMinimum/exclusiveMaximum', function(t) { t.end() }) +tape('minimum/maximum number type', function(t) { + var validate = validator({ + type: ['integer', 'null'], + minimum: 1, + maximum: 100 + }) + + t.notOk(validate(-1)) + t.notOk(validate(0)) + t.ok(validate(null)) + t.ok(validate(1)) + t.ok(validate(100)) + t.notOk(validate(101)) + t.end() +}) + tape('custom format', function(t) { var validate = validator({ type: 'object', diff --git a/deps/npm/node_modules/request/node_modules/hawk/.npmignore b/deps/npm/node_modules/request/node_modules/hawk/.npmignore index 70febc05e4f360..ab108bf92f34a7 100644 --- a/deps/npm/node_modules/request/node_modules/hawk/.npmignore +++ b/deps/npm/node_modules/request/node_modules/hawk/.npmignore @@ -17,4 +17,3 @@ config.json */*/._* coverage.* lib-cov - diff --git a/deps/npm/node_modules/request/node_modules/hawk/.travis.yml b/deps/npm/node_modules/request/node_modules/hawk/.travis.yml index 047f7e3d5e1e39..77795c6a9b47df 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/.travis.yml +++ b/deps/npm/node_modules/request/node_modules/hawk/.travis.yml @@ -2,4 +2,3 @@ language: node_js node_js: - 0.10 - diff --git a/deps/npm/node_modules/request/node_modules/hawk/README.md b/deps/npm/node_modules/request/node_modules/hawk/README.md index 4aff23f3a3f7c5..63725034fc5e72 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/README.md +++ b/deps/npm/node_modules/request/node_modules/hawk/README.md @@ -75,12 +75,12 @@ and the server. ## Replay Protection -Without replay protection, an attacker can use a compromised (but otherwise valid and authenticated) request more -than once, gaining access to a protected resource. To mitigate this, clients include both a nonce and a timestamp when +Without replay protection, an attacker can use a compromised (but otherwise valid and authenticated) request more +than once, gaining access to a protected resource. To mitigate this, clients include both a nonce and a timestamp when making requests. This gives the server enough information to prevent replay attacks. The nonce is generated by the client, and is a string unique across all requests with the same timestamp and -key identifier combination. +key identifier combination. The timestamp enables the server to restrict the validity period of the credentials where requests occuring afterwards are rejected. It also removes the need for the server to retain an unbounded number of nonce values for future checks. @@ -373,7 +373,7 @@ and for a finite period of time. Both the client and server can issue bewit cred credentials as the client to maintain clear traceability as to who issued which credentials. In order to simplify implementation, bewit credentials do not support single-use policy and can be replayed multiple times within -the granted access timeframe. +the granted access timeframe. ## Bewit Usage Example @@ -496,7 +496,7 @@ which can often affect how the request body is interpreted by the server. If the or value of such headers, an attacker can manipulate the request headers without being detected. Implementers should use the `ext` feature to pass application-specific information via the `Authorization` header which is protected by the request MAC. -The response authentication, when performed, only covers the response payload, content-type, and the request information +The response authentication, when performed, only covers the response payload, content-type, and the request information provided by the client in it's request (method, resource, timestamp, nonce, etc.). It does not cover the HTTP status code or any other response header field (e.g. Location) which can affect the client's behaviour. diff --git a/deps/npm/node_modules/request/node_modules/hawk/example/usage.js b/deps/npm/node_modules/request/node_modules/hawk/example/usage.js index 13b860b4c5ad8a..64fe17674a5753 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/example/usage.js +++ b/deps/npm/node_modules/request/node_modules/hawk/example/usage.js @@ -75,4 +75,3 @@ credentialsFunc('dh37fgj492je', function (err, credentials) { process.exit(0); }); }); - diff --git a/deps/npm/node_modules/request/node_modules/hawk/lib/client.js b/deps/npm/node_modules/request/node_modules/hawk/lib/client.js index b3e8649e3a6215..f9ae69171343bd 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/lib/client.js +++ b/deps/npm/node_modules/request/node_modules/hawk/lib/client.js @@ -364,6 +364,3 @@ exports.message = function (host, port, message, options) { return result; }; - - - diff --git a/deps/npm/node_modules/request/node_modules/hawk/lib/index.js b/deps/npm/node_modules/request/node_modules/hawk/lib/index.js index a883882c8c538c..911b906aabdaed 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/lib/index.js +++ b/deps/npm/node_modules/request/node_modules/hawk/lib/index.js @@ -12,4 +12,3 @@ exports.uri = { authenticate: exports.server.authenticateBewit, getBewit: exports.client.getBewit }; - diff --git a/deps/npm/node_modules/request/node_modules/hawk/lib/utils.js b/deps/npm/node_modules/request/node_modules/hawk/lib/utils.js index 28a35118ff8c00..2da3343904aeab 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/lib/utils.js +++ b/deps/npm/node_modules/request/node_modules/hawk/lib/utils.js @@ -181,4 +181,3 @@ exports.unauthorized = function (message, attributes) { return Boom.unauthorized(message, 'Hawk', attributes); }; - diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.npmignore b/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.npmignore index 77ba16cb055ca5..b0939eabe34d2d 100644 --- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.npmignore +++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.npmignore @@ -15,4 +15,3 @@ config.json */*/._* coverage.* lib-cov - diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.travis.yml b/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.travis.yml index dd1b24f13ac1f8..7a64dd2210cb10 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.travis.yml +++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/.travis.yml @@ -5,4 +5,3 @@ node_js: - 4.0 sudo: false - diff --git a/deps/npm/node_modules/request/node_modules/hawk/test/readme.js b/deps/npm/node_modules/request/node_modules/hawk/test/readme.js index a466264667ee64..7a343f5e219c61 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/test/readme.js +++ b/deps/npm/node_modules/request/node_modules/hawk/test/readme.js @@ -92,4 +92,3 @@ describe('README', function () { }); }); }); - diff --git a/deps/npm/node_modules/request/node_modules/hawk/test/server.js b/deps/npm/node_modules/request/node_modules/hawk/test/server.js index 1d3405a9ecc11e..0fdf13d435913e 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/test/server.js +++ b/deps/npm/node_modules/request/node_modules/hawk/test/server.js @@ -1326,4 +1326,3 @@ describe('Server', function () { }); }); }); - diff --git a/deps/npm/node_modules/request/node_modules/hawk/test/uri.js b/deps/npm/node_modules/request/node_modules/hawk/test/uri.js index f3c6ba2d629a65..3dc8e6a1c51042 100755 --- a/deps/npm/node_modules/request/node_modules/hawk/test/uri.js +++ b/deps/npm/node_modules/request/node_modules/hawk/test/uri.js @@ -835,4 +835,3 @@ describe('Uri', function () { }); }); }); - diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/CHANGES.md b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/CHANGES.md index ab3a66417a6fa6..3e152ab804377d 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/CHANGES.md +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/CHANGES.md @@ -4,6 +4,10 @@ None yet. +## v1.3.1 (2016-09-12) + +* #13 Incompatible with webpack + ## v1.3.0 (2016-06-22) * #14 add safer version of hasOwnProperty() diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/README.md b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/README.md index 4de0124476e98c..78b81d39683251 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/README.md +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/README.md @@ -1,5 +1,5 @@ JSON Schema is a repository for the JSON Schema specification, reference schemas and a CommonJS implementation of JSON Schema (not the only JavaScript implementation of JSON Schema, JSV is another excellent JavaScript validator). -Code is licensed under the AFL or BSD license as part of the Persevere +Code is licensed under the AFL or BSD license as part of the Persevere project which is administered under the Dojo foundation, and all contributions require a Dojo CLA. \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/hyper-schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/hyper-schema index de80b918b671c7..36a85ccd244926 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/hyper-schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/hyper-schema @@ -8,61 +8,61 @@ "items" : {"$ref" : "http://json-schema.org/draft-00/links#"}, "optional" : true }, - + "fragmentResolution" : { "type" : "string", "optional" : true, "default" : "dot-delimited" }, - + "root" : { "type" : "boolean", "optional" : true, "default" : false }, - + "readonly" : { "type" : "boolean", "optional" : true, "default" : false }, - + "pathStart" : { "type" : "string", "optional" : true, "format" : "uri" }, - + "mediaType" : { "type" : "string", "optional" : true, "format" : "media-type" }, - + "alternate" : { "type" : "array", "items" : {"$ref" : "#"}, "optional" : true } }, - + "links" : [ { "href" : "{$ref}", "rel" : "full" }, - + { "href" : "{$schema}", "rel" : "describedby" }, - + { "href" : "{id}", "rel" : "self" } ], - + "fragmentResolution" : "dot-delimited", "extends" : {"$ref" : "http://json-schema.org/draft-00/schema#"} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/json-ref b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/json-ref index 3a872a71c973dc..5d1f76b6a694a4 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/json-ref +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/json-ref @@ -1,26 +1,26 @@ { "$schema" : "http://json-schema.org/draft-00/hyper-schema#", "id" : "http://json-schema.org/draft-00/json-ref#", - + "items" : {"$ref" : "#"}, "additionalProperties" : {"$ref" : "#"}, - + "links" : [ { "href" : "{$ref}", "rel" : "full" }, - + { "href" : "{$schema}", "rel" : "describedby" }, - + { "href" : "{id}", "rel" : "self" } ], - + "fragmentResolution" : "dot-delimited" } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/links b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/links index 8a5e7807250cf9..cbef326dd3de5b 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/links +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/links @@ -2,28 +2,28 @@ "$schema" : "http://json-schema.org/draft-00/hyper-schema#", "id" : "http://json-schema.org/draft-00/links#", "type" : "object", - + "properties" : { "href" : { "type" : "string" }, - + "rel" : { "type" : "string" }, - + "method" : { "type" : "string", "default" : "GET", "optional" : true }, - + "enctype" : { "type" : "string", "requires" : "method", "optional" : true }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "http://json-schema.org/draft-00/hyper-schema#"}, diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/schema index 9aa2fbc57a4054..d452b023ee484a 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-00/schema @@ -2,7 +2,7 @@ "$schema" : "http://json-schema.org/draft-00/hyper-schema#", "id" : "http://json-schema.org/draft-00/schema#", "type" : "object", - + "properties" : { "type" : { "type" : ["string", "array"], @@ -12,136 +12,136 @@ "optional" : true, "default" : "any" }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "#"}, "optional" : true, "default" : {} }, - + "items" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, "optional" : true, "default" : {} }, - + "optional" : { "type" : "boolean", "optional" : true, "default" : false }, - + "additionalProperties" : { "type" : [{"$ref" : "#"}, "boolean"], "optional" : true, "default" : {} }, - + "requires" : { "type" : ["string", {"$ref" : "#"}], "optional" : true }, - + "minimum" : { "type" : "number", "optional" : true }, - + "maximum" : { "type" : "number", "optional" : true }, - + "minimumCanEqual" : { "type" : "boolean", "optional" : true, "requires" : "minimum", "default" : true }, - + "maximumCanEqual" : { "type" : "boolean", "optional" : true, "requires" : "maximum", "default" : true }, - + "minItems" : { "type" : "integer", "optional" : true, "minimum" : 0, "default" : 0 }, - + "maxItems" : { "type" : "integer", "optional" : true, "minimum" : 0 }, - + "pattern" : { "type" : "string", "optional" : true, "format" : "regex" }, - + "minLength" : { "type" : "integer", "optional" : true, "minimum" : 0, "default" : 0 }, - + "maxLength" : { "type" : "integer", "optional" : true }, - + "enum" : { "type" : "array", "optional" : true, "minItems" : 1 }, - + "title" : { "type" : "string", "optional" : true }, - + "description" : { "type" : "string", "optional" : true }, - + "format" : { "type" : "string", "optional" : true }, - + "contentEncoding" : { "type" : "string", "optional" : true }, - + "default" : { "type" : "any", "optional" : true }, - + "maxDecimal" : { "type" : "integer", "optional" : true, "minimum" : 0 }, - + "disallow" : { "type" : ["string", "array"], "items" : {"type" : "string"}, "optional" : true }, - + "extends" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, @@ -149,7 +149,7 @@ "default" : {} } }, - + "optional" : true, "default" : {} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/hyper-schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/hyper-schema index 3f6c6cc2c012df..b0fb5e157ef9bd 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/hyper-schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/hyper-schema @@ -8,61 +8,61 @@ "items" : {"$ref" : "http://json-schema.org/draft-01/links#"}, "optional" : true }, - + "fragmentResolution" : { "type" : "string", "optional" : true, "default" : "dot-delimited" }, - + "root" : { "type" : "boolean", "optional" : true, "default" : false }, - + "readonly" : { "type" : "boolean", "optional" : true, "default" : false }, - + "pathStart" : { "type" : "string", "optional" : true, "format" : "uri" }, - + "mediaType" : { "type" : "string", "optional" : true, "format" : "media-type" }, - + "alternate" : { "type" : "array", "items" : {"$ref" : "#"}, "optional" : true } }, - + "links" : [ { "href" : "{$ref}", "rel" : "full" }, - + { "href" : "{$schema}", "rel" : "describedby" }, - + { "href" : "{id}", "rel" : "self" } ], - + "fragmentResolution" : "dot-delimited", "extends" : {"$ref" : "http://json-schema.org/draft-01/schema#"} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/json-ref b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/json-ref index 4d26174ef17ad9..cbac1ba2e53286 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/json-ref +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/json-ref @@ -1,26 +1,26 @@ { "$schema" : "http://json-schema.org/draft-01/hyper-schema#", "id" : "http://json-schema.org/draft-01/json-ref#", - + "items" : {"$ref" : "#"}, "additionalProperties" : {"$ref" : "#"}, - + "links" : [ { "href" : "{$ref}", "rel" : "full" }, - + { "href" : "{$schema}", "rel" : "describedby" }, - + { "href" : "{id}", "rel" : "self" } ], - + "fragmentResolution" : "dot-delimited" } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/links b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/links index 52430a5d94ac75..ebc7b7b58b1326 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/links +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/links @@ -2,28 +2,28 @@ "$schema" : "http://json-schema.org/draft-01/hyper-schema#", "id" : "http://json-schema.org/draft-01/links#", "type" : "object", - + "properties" : { "href" : { "type" : "string" }, - + "rel" : { "type" : "string" }, - + "method" : { "type" : "string", "default" : "GET", "optional" : true }, - + "enctype" : { "type" : "string", "requires" : "method", "optional" : true }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "http://json-schema.org/draft-01/hyper-schema#"}, diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/schema index 7a208e680e631b..a0f3801f840cca 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-01/schema @@ -2,7 +2,7 @@ "$schema" : "http://json-schema.org/draft-01/hyper-schema#", "id" : "http://json-schema.org/draft-01/schema#", "type" : "object", - + "properties" : { "type" : { "type" : ["string", "array"], @@ -12,136 +12,136 @@ "optional" : true, "default" : "any" }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "#"}, "optional" : true, "default" : {} }, - + "items" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, "optional" : true, "default" : {} }, - + "optional" : { "type" : "boolean", "optional" : true, "default" : false }, - + "additionalProperties" : { "type" : [{"$ref" : "#"}, "boolean"], "optional" : true, "default" : {} }, - + "requires" : { "type" : ["string", {"$ref" : "#"}], "optional" : true }, - + "minimum" : { "type" : "number", "optional" : true }, - + "maximum" : { "type" : "number", "optional" : true }, - + "minimumCanEqual" : { "type" : "boolean", "optional" : true, "requires" : "minimum", "default" : true }, - + "maximumCanEqual" : { "type" : "boolean", "optional" : true, "requires" : "maximum", "default" : true }, - + "minItems" : { "type" : "integer", "optional" : true, "minimum" : 0, "default" : 0 }, - + "maxItems" : { "type" : "integer", "optional" : true, "minimum" : 0 }, - + "pattern" : { "type" : "string", "optional" : true, "format" : "regex" }, - + "minLength" : { "type" : "integer", "optional" : true, "minimum" : 0, "default" : 0 }, - + "maxLength" : { "type" : "integer", "optional" : true }, - + "enum" : { "type" : "array", "optional" : true, "minItems" : 1 }, - + "title" : { "type" : "string", "optional" : true }, - + "description" : { "type" : "string", "optional" : true }, - + "format" : { "type" : "string", "optional" : true }, - + "contentEncoding" : { "type" : "string", "optional" : true }, - + "default" : { "type" : "any", "optional" : true }, - + "maxDecimal" : { "type" : "integer", "optional" : true, "minimum" : 0 }, - + "disallow" : { "type" : ["string", "array"], "items" : {"type" : "string"}, "optional" : true }, - + "extends" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, @@ -149,7 +149,7 @@ "default" : {} } }, - + "optional" : true, "default" : {} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/hyper-schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/hyper-schema index 4ec1b7569137c3..0771e2b31e8eef 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/hyper-schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/hyper-schema @@ -8,61 +8,61 @@ "items" : {"$ref" : "http://json-schema.org/draft-02/links#"}, "optional" : true }, - + "fragmentResolution" : { "type" : "string", "optional" : true, "default" : "slash-delimited" }, - + "root" : { "type" : "boolean", "optional" : true, "default" : false }, - + "readonly" : { "type" : "boolean", "optional" : true, "default" : false }, - + "pathStart" : { "type" : "string", "optional" : true, "format" : "uri" }, - + "mediaType" : { "type" : "string", "optional" : true, "format" : "media-type" }, - + "alternate" : { "type" : "array", "items" : {"$ref" : "#"}, "optional" : true } }, - + "links" : [ { "href" : "{$ref}", "rel" : "full" }, - + { "href" : "{$schema}", "rel" : "describedby" }, - + { "href" : "{id}", "rel" : "self" } ], - + "fragmentResolution" : "slash-delimited", "extends" : {"$ref" : "http://json-schema.org/draft-02/schema#"} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/json-ref b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/json-ref index 6526c394556665..1a6c56d04b665a 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/json-ref +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/json-ref @@ -1,26 +1,26 @@ { "$schema" : "http://json-schema.org/draft-02/hyper-schema#", "id" : "http://json-schema.org/draft-02/json-ref#", - + "items" : {"$ref" : "#"}, "additionalProperties" : {"$ref" : "#"}, - + "links" : [ { "href" : "{$ref}", "rel" : "full" }, - + { "href" : "{$schema}", "rel" : "describedby" }, - + { "href" : "{id}", "rel" : "self" } ], - + "fragmentResolution" : "dot-delimited" } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/links b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/links index 1b176178a2c333..dacc53a1a4adb6 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/links +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/links @@ -2,30 +2,30 @@ "$schema" : "http://json-schema.org/draft-02/hyper-schema#", "id" : "http://json-schema.org/draft-02/links#", "type" : "object", - + "properties" : { "href" : { "type" : "string" }, - + "rel" : { "type" : "string" }, - + "targetSchema" : {"$ref" : "http://json-schema.org/draft-02/hyper-schema#"}, - + "method" : { "type" : "string", "default" : "GET", "optional" : true }, - + "enctype" : { "type" : "string", "requires" : "method", "optional" : true }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "http://json-schema.org/draft-02/hyper-schema#"}, diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/schema index 61b8de15483962..a4998abea2065e 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-02/schema @@ -2,7 +2,7 @@ "$schema" : "http://json-schema.org/draft-02/hyper-schema#", "id" : "http://json-schema.org/draft-02/schema#", "type" : "object", - + "properties" : { "type" : { "type" : ["string", "array"], @@ -13,131 +13,131 @@ "uniqueItems" : true, "default" : "any" }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "#"}, "optional" : true, "default" : {} }, - + "items" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, "optional" : true, "default" : {} }, - + "optional" : { "type" : "boolean", "optional" : true, "default" : false }, - + "additionalProperties" : { "type" : [{"$ref" : "#"}, "boolean"], "optional" : true, "default" : {} }, - + "requires" : { "type" : ["string", {"$ref" : "#"}], "optional" : true }, - + "minimum" : { "type" : "number", "optional" : true }, - + "maximum" : { "type" : "number", "optional" : true }, - + "minimumCanEqual" : { "type" : "boolean", "optional" : true, "requires" : "minimum", "default" : true }, - + "maximumCanEqual" : { "type" : "boolean", "optional" : true, "requires" : "maximum", "default" : true }, - + "minItems" : { "type" : "integer", "optional" : true, "minimum" : 0, "default" : 0 }, - + "maxItems" : { "type" : "integer", "optional" : true, "minimum" : 0 }, - + "uniqueItems" : { "type" : "boolean", "optional" : true, "default" : false }, - + "pattern" : { "type" : "string", "optional" : true, "format" : "regex" }, - + "minLength" : { "type" : "integer", "optional" : true, "minimum" : 0, "default" : 0 }, - + "maxLength" : { "type" : "integer", "optional" : true }, - + "enum" : { "type" : "array", "optional" : true, "minItems" : 1, "uniqueItems" : true }, - + "title" : { "type" : "string", "optional" : true }, - + "description" : { "type" : "string", "optional" : true }, - + "format" : { "type" : "string", "optional" : true }, - + "contentEncoding" : { "type" : "string", "optional" : true }, - + "default" : { "type" : "any", "optional" : true }, - + "divisibleBy" : { "type" : "number", "minimum" : 0, @@ -145,14 +145,14 @@ "optional" : true, "default" : 1 }, - + "disallow" : { "type" : ["string", "array"], "items" : {"type" : "string"}, "optional" : true, "uniqueItems" : true }, - + "extends" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, @@ -160,7 +160,7 @@ "default" : {} } }, - + "optional" : true, "default" : {} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/calendar b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/calendar index 463cfb314b6431..d8fb5335f081b4 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/calendar +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/calendar @@ -12,12 +12,12 @@ "type":"string", "required":true }, - "location" : { - "type" : "string" + "location" : { + "type" : "string" }, "url" : { - "type" : "string", - "format" : "url" + "type" : "string", + "format" : "url" }, "dtend" : { "format" : "date-time", @@ -47,7 +47,3 @@ "geo" : { "$ref" : "http://json-schema.org/draft-03/geo" } } } - - - - diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/interfaces b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/interfaces index 288a19856b7263..84ebf83a993f6d 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/interfaces +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/examples/interfaces @@ -6,18 +6,18 @@ "type":"object", "description":"This defines the set of methods available to the class instances", "additionalProperties":{ - "type":"object", - "description":"The definition of the method", - "properties":{ - "parameters":{ - "type":"array", - "description":"The set of parameters that should be passed to the method when it is called", - "items":{"$ref":"#"}, - "required": true - }, - "returns":{"$ref":"#"} - } + "type":"object", + "description":"The definition of the method", + "properties":{ + "parameters":{ + "type":"array", + "description":"The set of parameters that should be passed to the method when it is called", + "items":{"$ref":"#"}, + "required": true + }, + "returns":{"$ref":"#"} + } } - } + } } } diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/json-ref b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/json-ref index 7e491a8e882347..388476323a08ab 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/json-ref +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/json-ref @@ -1,26 +1,26 @@ { "$schema" : "http://json-schema.org/draft-03/hyper-schema#", "id" : "http://json-schema.org/draft-03/json-ref#", - + "additionalItems" : {"$ref" : "#"}, "additionalProperties" : {"$ref" : "#"}, - + "links" : [ { "href" : "{id}", "rel" : "self" }, - + { "href" : "{$ref}", "rel" : "full" }, - + { "href" : "{$schema}", "rel" : "describedby" } ], - + "fragmentResolution" : "dot-delimited" } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/links b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/links index 6b0a85a6295b25..3dbcdba73cc4e8 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/links +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/links @@ -2,31 +2,31 @@ "$schema" : "http://json-schema.org/draft-03/hyper-schema#", "id" : "http://json-schema.org/draft-03/links#", "type" : "object", - + "properties" : { "href" : { "type" : "string", "required" : true, "format" : "link-description-object-template" }, - + "rel" : { "type" : "string", "required" : true }, - + "targetSchema" : {"$ref" : "http://json-schema.org/draft-03/hyper-schema#"}, - + "method" : { "type" : "string", "default" : "GET" }, - + "enctype" : { "type" : "string", "requires" : "method" }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "http://json-schema.org/draft-03/hyper-schema#"} diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/schema index 55ae47d808c0ab..361456d8a7e89e 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-03/schema @@ -2,7 +2,7 @@ "$schema" : "http://json-schema.org/draft-03/schema#", "id" : "http://json-schema.org/draft-03/schema#", "type" : "object", - + "properties" : { "type" : { "type" : ["string", "array"], @@ -12,40 +12,40 @@ "uniqueItems" : true, "default" : "any" }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "#"}, "default" : {} }, - + "patternProperties" : { "type" : "object", "additionalProperties" : {"$ref" : "#"}, "default" : {} }, - + "additionalProperties" : { "type" : [{"$ref" : "#"}, "boolean"], "default" : {} }, - + "items" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, "default" : {} }, - + "additionalItems" : { "type" : [{"$ref" : "#"}, "boolean"], "default" : {} }, - + "required" : { "type" : "boolean", "default" : false }, - + "dependencies" : { "type" : "object", "additionalProperties" : { @@ -56,85 +56,85 @@ }, "default" : {} }, - + "minimum" : { "type" : "number" }, - + "maximum" : { "type" : "number" }, - + "exclusiveMinimum" : { "type" : "boolean", "default" : false }, - + "exclusiveMaximum" : { "type" : "boolean", "default" : false }, - + "minItems" : { "type" : "integer", "minimum" : 0, "default" : 0 }, - + "maxItems" : { "type" : "integer", "minimum" : 0 }, - + "uniqueItems" : { "type" : "boolean", "default" : false }, - + "pattern" : { "type" : "string", "format" : "regex" }, - + "minLength" : { "type" : "integer", "minimum" : 0, "default" : 0 }, - + "maxLength" : { "type" : "integer" }, - + "enum" : { "type" : "array", "minItems" : 1, "uniqueItems" : true }, - + "default" : { "type" : "any" }, - + "title" : { "type" : "string" }, - + "description" : { "type" : "string" }, - + "format" : { "type" : "string" }, - + "divisibleBy" : { "type" : "number", "minimum" : 0, "exclusiveMinimum" : true, "default" : 1 }, - + "disallow" : { "type" : ["string", "array"], "items" : { @@ -142,33 +142,33 @@ }, "uniqueItems" : true }, - + "extends" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, "default" : {} }, - + "id" : { "type" : "string", "format" : "uri" }, - + "$ref" : { "type" : "string", "format" : "uri" }, - + "$schema" : { "type" : "string", "format" : "uri" } }, - + "dependencies" : { "exclusiveMinimum" : "minimum", "exclusiveMaximum" : "maximum" }, - + "default" : {} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/links b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/links index de272cc4513d0a..7cf7c92c20965c 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/links +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/links @@ -2,7 +2,7 @@ "$schema" : "http://json-schema.org/draft-04/hyper-schema#", "id" : "http://json-schema.org/draft-04/links#", "type" : "object", - + "properties" : { "rel" : { "type" : "string" @@ -15,26 +15,26 @@ "template" : { "type" : "string" }, - + "targetSchema" : {"$ref" : "http://json-schema.org/draft-04/hyper-schema#"}, - + "method" : { "type" : "string", "default" : "GET" }, - + "enctype" : { "type" : "string" }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "http://json-schema.org/draft-04/hyper-schema#"} } }, - + "required" : ["rel", "href"], - + "dependencies" : { "enctype" : "method" } diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/schema b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/schema index 598951e57d2eb7..e9c90699fda128 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/schema +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-04/schema @@ -2,7 +2,7 @@ "$schema" : "http://json-schema.org/draft-04/schema#", "id" : "http://json-schema.org/draft-04/schema#", "type" : "object", - + "properties" : { "type" : { "type" : [ @@ -10,19 +10,19 @@ "id" : "#simple-type", "type" : "string", "enum" : ["object", "array", "string", "number", "boolean", "null", "any"] - }, + }, "array" ], "items" : { "type" : [ - {"$ref" : "#simple-type"}, + {"$ref" : "#simple-type"}, {"$ref" : "#"} ] }, "uniqueItems" : true, "default" : "any" }, - + "disallow" : { "type" : ["string", "array"], "items" : { @@ -30,7 +30,7 @@ }, "uniqueItems" : true }, - + "extends" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, @@ -42,108 +42,108 @@ "minItems" : 1, "uniqueItems" : true }, - + "minimum" : { "type" : "number" }, - + "maximum" : { "type" : "number" }, - + "exclusiveMinimum" : { "type" : "boolean", "default" : false }, - + "exclusiveMaximum" : { "type" : "boolean", "default" : false }, - + "divisibleBy" : { "type" : "number", "minimum" : 0, "exclusiveMinimum" : true, "default" : 1 }, - + "minLength" : { "type" : "integer", "minimum" : 0, "default" : 0 }, - + "maxLength" : { "type" : "integer" }, - + "pattern" : { "type" : "string" }, - + "items" : { "type" : [{"$ref" : "#"}, "array"], "items" : {"$ref" : "#"}, "default" : {} }, - + "additionalItems" : { "type" : [{"$ref" : "#"}, "boolean"], "default" : {} }, - + "minItems" : { "type" : "integer", "minimum" : 0, "default" : 0 }, - + "maxItems" : { "type" : "integer", "minimum" : 0 }, - + "uniqueItems" : { "type" : "boolean", "default" : false }, - + "properties" : { "type" : "object", "additionalProperties" : {"$ref" : "#"}, "default" : {} }, - + "patternProperties" : { "type" : "object", "additionalProperties" : {"$ref" : "#"}, "default" : {} }, - + "additionalProperties" : { "type" : [{"$ref" : "#"}, "boolean"], "default" : {} }, - + "minProperties" : { "type" : "integer", "minimum" : 0, "default" : 0 }, - + "maxProperties" : { "type" : "integer", "minimum" : 0 }, - + "required" : { "type" : "array", "items" : { "type" : "string" } }, - + "dependencies" : { "type" : "object", "additionalProperties" : { @@ -154,36 +154,36 @@ }, "default" : {} }, - + "id" : { "type" : "string" }, - + "$ref" : { "type" : "string" }, - + "$schema" : { "type" : "string" }, - + "title" : { "type" : "string" }, - + "description" : { "type" : "string" }, - + "default" : { "type" : "any" } }, - + "dependencies" : { "exclusiveMinimum" : "minimum", "exclusiveMaximum" : "maximum" }, - + "default" : {} } \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-03.xml b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-03.xml index c28f40dcd6ee44..1cf715910b5a83 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-03.xml +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-03.xml @@ -24,7 +24,7 @@ A JSON Media Type for Describing the Structure and Meaning of JSON Documents - + SitePen (USA)
@@ -37,7 +37,7 @@ kris@sitepen.com
- +
@@ -48,7 +48,7 @@ gary.court@gmail.com
- + Internet Engineering Task Force JSON @@ -58,59 +58,59 @@ Notation Hyper Schema Hypermedia - + - JSON (JavaScript Object Notation) Schema defines the media type "application/schema+json", - a JSON based format for defining - the structure of JSON data. JSON Schema provides a contract for what JSON - data is required for a given application and how to interact with it. JSON - Schema is intended to define validation, documentation, hyperlink - navigation, and interaction control of JSON data. + JSON (JavaScript Object Notation) Schema defines the media type "application/schema+json", + a JSON based format for defining + the structure of JSON data. JSON Schema provides a contract for what JSON + data is required for a given application and how to interact with it. JSON + Schema is intended to define validation, documentation, hyperlink + navigation, and interaction control of JSON data.
- +
- JSON (JavaScript Object Notation) Schema is a JSON media type for defining - the structure of JSON data. JSON Schema provides a contract for what JSON - data is required for a given application and how to interact with it. JSON - Schema is intended to define validation, documentation, hyperlink - navigation, and interaction control of JSON data. + JSON (JavaScript Object Notation) Schema is a JSON media type for defining + the structure of JSON data. JSON Schema provides a contract for what JSON + data is required for a given application and how to interact with it. JSON + Schema is intended to define validation, documentation, hyperlink + navigation, and interaction control of JSON data.
- +
- - - The key words "MUST", "MUST NOT", "REQUIRED", "SHALL", "SHALL NOT", "SHOULD", + + The key words "MUST", "MUST NOT", "REQUIRED", "SHALL", "SHALL NOT", "SHOULD", "SHOULD NOT", "RECOMMENDED", "MAY", and "OPTIONAL" in this document are to be interpreted as described in RFC 2119.
- + - +
- JSON Schema defines the media type "application/schema+json" for + JSON Schema defines the media type "application/schema+json" for describing the structure of other - JSON documents. JSON Schema is JSON-based and includes facilities + JSON documents. JSON Schema is JSON-based and includes facilities for describing the structure of JSON documents in terms of allowable values, descriptions, and interpreting relations with other resources. - JSON Schema format is organized into several separate definitions. The first - definition is the core schema specification. This definition is primary + JSON Schema format is organized into several separate definitions. The first + definition is the core schema specification. This definition is primary concerned with describing a JSON structure and specifying valid elements in the structure. The second definition is the Hyper Schema specification which is intended define elements in a structure that can be interpreted as hyperlinks. - Hyper Schema builds on JSON Schema to describe the hyperlink structure of + Hyper Schema builds on JSON Schema to describe the hyperlink structure of other JSON documents and elements of interaction. This allows user agents to be able to successfully navigate JSON documents based on their schemas. @@ -118,12 +118,12 @@ Cumulatively JSON Schema acts as a meta-document that can be used to define the required type and constraints on property values, as well as define the meaning of the property values for the purpose of describing a resource and determining hyperlinks - within the representation. + within the representation.
An example JSON Schema that describes products might look like: - - This schema defines the properties of the instance JSON documents, + This schema defines the properties of the instance JSON documents, the required properties (id, name, and price), as well as an optional property (tags). This also defines the link relations of the instance JSON documents.
- +
- For this specification, schema will be used to denote a JSON Schema - definition, and an instance refers to a JSON value that the schema + For this specification, schema will be used to denote a JSON Schema + definition, and an instance refers to a JSON value that the schema will be describing and validating.
- +
The JSON Schema media type does not attempt to dictate the structure of JSON @@ -194,7 +194,7 @@ This specification is protocol agnostic. The underlying protocol (such as HTTP) should sufficiently define the semantics of the client-server interface, the retrieval of resource - representations linked to by JSON representations, and modification of + representations linked to by JSON representations, and modification of those resources. The goal of this format is to sufficiently describe JSON structures such that one can utilize existing information available in existing JSON @@ -203,7 +203,7 @@
- +
JSON Schema instances are correlated to their schema by the "describedby" @@ -217,22 +217,22 @@ representation and messages may retain the self-descriptive characteristic, avoiding the need for out-of-band information about instance data. Two approaches are recommended for declaring the - relation to the schema that describes the meaning of a JSON instance's (or collection + relation to the schema that describes the meaning of a JSON instance's (or collection of instances) structure. A MIME type parameter named "profile" or a relation of "describedby" (which could be defined by a Link header) may be used: - +
-
- + or if the content is being transferred by a protocol (such as HTTP) that provides headers, a Link header can be used: - +
; rel="describedby" ]]>
- - Instances MAY specify multiple schemas, to indicate all the schemas that - are applicable to the data, and the data SHOULD be valid by all the schemas. - The instance data MAY have multiple schemas - that it is defined by (the instance data SHOULD be valid for those schemas). - Or if the document is a collection of instances, the collection MAY contain - instances from different schemas. When collections contain heterogeneous - instances, the "pathStart" attribute MAY be specified in the - schema to disambiguate which schema should be applied for each item in the + + Instances MAY specify multiple schemas, to indicate all the schemas that + are applicable to the data, and the data SHOULD be valid by all the schemas. + The instance data MAY have multiple schemas + that it is defined by (the instance data SHOULD be valid for those schemas). + Or if the document is a collection of instances, the collection MAY contain + instances from different schemas. When collections contain heterogeneous + instances, the "pathStart" attribute MAY be specified in the + schema to disambiguate which schema should be applied for each item in the collection. However, ultimately, the mechanism for referencing a schema is up to the media type of the instance documents (if they choose to specify that schemas can be referenced).
- +
- JSON Schemas can themselves be described using JSON Schemas. + JSON Schemas can themselves be described using JSON Schemas. A self-describing JSON Schema for the core JSON Schema can - be found at http://json-schema.org/schema for the latest version or - http://json-schema.org/draft-03/schema for the draft-03 version. The hyper schema - self-description can be found at http://json-schema.org/hyper-schema + be found at http://json-schema.org/schema for the latest version or + http://json-schema.org/draft-03/schema for the draft-03 version. The hyper schema + self-description can be found at http://json-schema.org/hyper-schema or http://json-schema.org/draft-03/hyper-schema. All schemas used within a protocol with media type definitions SHOULD include a MIME parameter that refers to the self-descriptive hyper schema or another schema that extends this hyper schema: - +
- @@ -277,15 +277,15 @@ Content-Type: application/json;
- +
- A JSON Schema is a JSON Object that defines various attributes + A JSON Schema is a JSON Object that defines various attributes (including usage and valid values) of a JSON value. JSON Schema has recursive capabilities; there are a number of elements in the structure that allow for nested JSON Schemas. - +
An example JSON Schema definition could look like: @@ -307,15 +307,15 @@ Content-Type: application/json; ]]>
- + A JSON Schema object may have any of the following properties, called schema attributes (all attributes are optional): - +
- This attribute defines what the primitive type or the schema of the instance MUST be in order to validate. + This attribute defines what the primitive type or the schema of the instance MUST be in order to validate. This attribute can take one of two forms: @@ -332,19 +332,19 @@ Content-Type: application/json; Value MUST be null. Note this is mainly for purpose of being able use union types to define nullability. If this type is not included in a union, null values are not allowed (the primitives listed above do not allow nulls on their own). Value MAY be of any type including null. - - If the property is not defined or is not in this list, then any type of value is acceptable. - Other type values MAY be used for custom purposes, but minimal validators of the specification + + If the property is not defined or is not in this list, then any type of value is acceptable. + Other type values MAY be used for custom purposes, but minimal validators of the specification implementation can allow any instance value on unknown type values. - + An array of two or more simple type definitions. Each item in the array MUST be a simple type definition or a schema. - The instance value is valid if it is of the same type as one of the simple type definitions, or valid by one of the schemas, in the array. + The instance value is valid if it is of the same type as one of the simple type definitions, or valid by one of the schemas, in the array. - +
For example, a schema that defines if an instance can be a string or a number would be: @@ -355,38 +355,38 @@ Content-Type: application/json; ]]>
- +
This attribute is an object with property definitions that define the valid values of instance object property values. When the instance value is an object, the property values of the instance object MUST conform to the property definitions in this object. In this object, each property definition's value MUST be a schema, and the property's name MUST be the name of the instance property that it defines. The instance property value MUST be valid according to the schema from the property definition. Properties are considered unordered, the order of the instance properties MAY be in any order.
- +
This attribute is an object that defines the schema for a set of property names of an object instance. The name of each property of this attribute's object is a regular expression pattern in the ECMA 262/Perl 5 format, while the value is a schema. If the pattern matches the name of a property on the instance object, the value of the instance's property MUST be valid against the pattern name's schema value.
- +
This attribute defines a schema for all properties that are not explicitly defined in an object type definition. If specified, the value MUST be a schema or a boolean. If false is provided, no additional properties are allowed beyond the properties defined in the schema. The default value is an empty schema which allows any value for additional properties.
- +
This attribute defines the allowed items in an instance array, and MUST be a schema or an array of schemas. The default value is an empty schema which allows any value for items in the instance array. When this attribute value is a schema and the instance value is an array, then all the items in the array MUST be valid according to the schema. When this attribute value is an array of schemas and the instance value is an array, each position in the instance array MUST conform to the schema in the corresponding position for this array. This called tuple typing. When tuple typing is used, additional items are allowed, disallowed, or constrained by the "additionalItems" attribute using the same rules as "additionalProperties" for objects.
- +
This provides a definition for additional items in an array instance when tuple definitions of the items is provided. This can be false to indicate additional items in the array are not allowed, or it can be a schema that defines the schema of the additional items.
- +
This attribute indicates if the instance must have a value, and not be undefined. This is false by default, making the instance optional.
- +
This attribute is an object that defines the requirements of a property on an instance object. If an object instance has a property with the same name as a property in this attribute's object, then the instance must be valid against the attribute's property value (hereafter referred to as the "dependency value"). The dependency value can take one of two forms: - + If the dependency value is a string, then the instance object MUST have a property with the same name as the dependency value. @@ -398,36 +398,36 @@ Content-Type: application/json;
- +
This attribute defines the minimum value of the instance property when the type of the instance value is a number.
- +
This attribute defines the maximum value of the instance property when the type of the instance value is a number.
- +
This attribute indicates if the value of the instance (if the instance is a number) can not equal the number defined by the "minimum" attribute. This is false by default, meaning the instance value can be greater then or equal to the minimum value.
- +
This attribute indicates if the value of the instance (if the instance is a number) can not equal the number defined by the "maximum" attribute. This is false by default, meaning the instance value can be less then or equal to the maximum value.
- +
This attribute defines the minimum number of values in an array when the array is the instance value.
- +
This attribute defines the maximum number of values in an array when the array is the instance value.
- +
This attribute indicates that all items in an array instance MUST be unique (contains no two identical values). Two instance are consider equal if they are both of the same type and: - + are null; or are booleans/numbers/strings and have the same value; or @@ -436,41 +436,41 @@ Content-Type: application/json;
- +
When the instance value is a string, this provides a regular expression that a string instance MUST match in order to be valid. Regular expressions SHOULD follow the regular expression specification from ECMA 262/Perl 5
- +
When the instance value is a string, this defines the minimum length of the string.
- +
When the instance value is a string, this defines the maximum length of the string.
- +
This provides an enumeration of all possible values that are valid for the instance property. This MUST be an array, and each item in the array represents a possible value for the instance value. If this attribute is defined, the instance value MUST be one of the values in the array in order for the schema to be valid. Comparison of enum values uses the same algorithm as defined in "uniqueItems".
- +
This attribute defines the default value of the instance when the instance is undefined.
- +
This attribute is a string that provides a short description of the instance property.
- +
This attribute is a string that provides a full description of the of purpose the instance property.
- +
This property defines the type of data, content type, or microformat to be expected in the instance property values. A format attribute MAY be one of the values listed below, and if so, SHOULD adhere to the semantics describing for the format. A format SHOULD only be used to give meaning to primitive types (string, integer, number, or boolean). Validators MAY (but are not required to) validate that the instance values conform to a format. - + The following formats are predefined: - + This SHOULD be a date in ISO 8601 format of YYYY-MM-DDThh:mm:ssZ in UTC time. This is the recommended form of date/timestamp. This SHOULD be a date in the format of YYYY-MM-DD. It is recommended that you use the "date-time" format instead of "date" unless you need to transfer only the date part. @@ -487,18 +487,18 @@ Content-Type: application/json; This SHOULD be a host-name. - + Additional custom formats MAY be created. These custom formats MAY be expressed as an URI, and this URI MAY reference a schema of that format.
- +
This attribute defines what value the number instance must be divisible by with no remainder (the result of the division must be an integer.) The value of this attribute SHOULD NOT be 0.
- +
This attribute takes the same values as the "type" attribute, however if the instance matches the type or if this value is an array and the instance matches any type or schema in the array, then this instance is not valid.
- +
The value of this property MUST be another schema which will provide a base schema which the current schema will inherit from. The inheritance rules are such that any instance that is valid according to the current schema MUST be valid according to the referenced schema. This MAY also be an array, in which case, the instance MUST be valid for all the schemas in the array. A schema that extends another schema MAY define additional attributes, constrain existing attributes, or add other constraints. @@ -506,7 +506,7 @@ Content-Type: application/json; instance against all constraints in the extending schema as well as the extended schema(s). More optimized implementations that merge schemas are possible, but are not required. Some examples of using "extends": - +
- +
- +
This attribute defines the current URI of this schema (this attribute is @@ -553,28 +553,28 @@ Content-Type: application/json; is also used to construct relative references such as for $ref.
- +
- This attribute defines a URI of a schema that contains the full representation of this schema. - When a validator encounters this attribute, it SHOULD replace the current schema with the schema referenced by the value's URI (if known and available) and re-validate the instance. + This attribute defines a URI of a schema that contains the full representation of this schema. + When a validator encounters this attribute, it SHOULD replace the current schema with the schema referenced by the value's URI (if known and available) and re-validate the instance. This URI MAY be relative or absolute, and relative URIs SHOULD be resolved against the URI of the current schema.
- +
- This attribute defines a URI of a JSON Schema that is the schema of the current schema. + This attribute defines a URI of a JSON Schema that is the schema of the current schema. When this attribute is defined, a validator SHOULD use the schema referenced by the value's URI (if known and available) when resolving Hyper Schemalinks. - + - A validator MAY use this attribute's value to determine which version of JSON Schema the current schema is written in, and provide the appropriate validation features and behavior. + A validator MAY use this attribute's value to determine which version of JSON Schema the current schema is written in, and provide the appropriate validation features and behavior. Therefore, it is RECOMMENDED that all schema authors include this attribute in their schemas to prevent conflicts with future JSON Schema specification changes.
- +
The following attributes are specified in addition to those @@ -586,28 +586,28 @@ Content-Type: application/json; essentially describes plain JSON (no constraints on the structures). Addition of attributes provides additive information for user agents. - +
- The value of the links property MUST be an array, where each item + The value of the links property MUST be an array, where each item in the array is a link description object which describes the link relations of the instances. - +
- A link description object is used to describe link relations. In - the context of a schema, it defines the link relations of the + A link description object is used to describe link relations. In + the context of a schema, it defines the link relations of the instances of the schema, and can be parameterized by the instance values. The link description format can be used on its own in regular (non-schema documents), and use of this format can be declared by referencing the normative link description - schema as the the schema for the data structure that uses the - links. The URI of the normative link description schema is: + schema as the the schema for the data structure that uses the + links. The URI of the normative link description schema is: http://json-schema.org/links (latest version) or http://json-schema.org/draft-03/links (draft-03 version). - +
The value of the "href" link description property @@ -615,19 +615,19 @@ Content-Type: application/json; of the instance property SHOULD be resolved as a URI-Reference per RFC 3986 and MAY be a relative URI. The base URI to be used for relative resolution SHOULD be the URI used to retrieve the instance object (not the schema) - when used within a schema. Also, when links are used within a schema, the URI - SHOULD be parametrized by the property values of the instance + when used within a schema. Also, when links are used within a schema, the URI + SHOULD be parametrized by the property values of the instance object, if property values exist for the corresponding variables in the template (otherwise they MAY be provided from alternate sources, like user input). - + Instance property values SHOULD be substituted into the URIs where matching braces ('{', '}') are found surrounding zero or more characters, creating an expanded URI. Instance property value substitutions are resolved by using the text between the braces to denote the property name - from the instance to get the value to substitute. - + from the instance to get the value to substitute. +
For example, if an href value is defined: @@ -637,7 +637,7 @@ http://somesite.com/{id} Then it would be resolved by replace the value of the "id" property value from the instance object.
- +
If the value of the "id" property was "45", the expanded URI would be: @@ -646,23 +646,23 @@ http://somesite.com/45 ]]>
- - If matching braces are found with the string "@" (no quotes) between the braces, then the + + If matching braces are found with the string "@" (no quotes) between the braces, then the actual instance value SHOULD be used to replace the braces, rather than a property value. - This should only be used in situations where the instance is a scalar (string, + This should only be used in situations where the instance is a scalar (string, boolean, or number), and not for objects or arrays.
- +
- The value of the "rel" property indicates the name of the + The value of the "rel" property indicates the name of the relation to the target resource. The relation to the target SHOULD be interpreted as specifically from the instance object that the schema (or sub-schema) applies to, not just the top level resource that contains the object within its hierarchy. If a resource JSON representation contains a sub object with a property interpreted as a link, that sub-object holds the relation with the target. A relation to target from the top level resource MUST be indicated with the schema describing the top level JSON representation. - + Relationship definitions SHOULD NOT be media type dependent, and users are encouraged to utilize existing accepted relation definitions, including those in existing relation registries (see RFC 4287). However, we define these relations here for clarity of normative interpretation within the context of JSON hyper schema defined relations: - + If the relation value is "self", when this property is encountered in @@ -670,15 +670,15 @@ http://somesite.com/45 treated as a full representation of the target resource identified by the specified URI. - + This indicates that the target of the link is the full representation for the instance object. The object that contains this link possibly may not be the full representation. - + This indicates the target of the link is the schema for the instance object. This MAY be used to specifically denote the schemas of objects within a JSON object hierarchy, facilitating polymorphic type data structures. - + This relation indicates that the target of the link SHOULD be treated as the root or the body of the representation for the @@ -688,7 +688,7 @@ http://somesite.com/45 - + The following relations are applicable for schemas (the schema as the "from" resource in the relation): @@ -697,7 +697,7 @@ http://somesite.com/45 This indicates a target to use for creating new instances of a schema. This link definition SHOULD be a submission link with a non-safe method (like POST). - +
For example, if a schema is defined: @@ -718,7 +718,7 @@ http://somesite.com/45 ]]>
- +
And if a collection of instance resource's JSON representation was retrieved: @@ -742,37 +742,37 @@ GET /Resource/ The "children" collection would be located at "/Resource/?upId=thing".
- +
This property value is a schema that defines the expected structure of the JSON representation of the target of the link.
- +
- The following properties also apply to link definition objects, and - provide functionality analogous to HTML forms, in providing a + The following properties also apply to link definition objects, and + provide functionality analogous to HTML forms, in providing a means for submitting extra (often user supplied) information to send to a server. - +
- This attribute defines which method can be used to access the target resource. - In an HTTP environment, this would be "GET" or "POST" (other HTTP methods - such as "PUT" and "DELETE" have semantics that are clearly implied by - accessed resources, and do not need to be defined here). + This attribute defines which method can be used to access the target resource. + In an HTTP environment, this would be "GET" or "POST" (other HTTP methods + such as "PUT" and "DELETE" have semantics that are clearly implied by + accessed resources, and do not need to be defined here). This defaults to "GET".
- +
If present, this property indicates a query media type format that the server - supports for querying or posting to the collection of instances at the target - resource. The query can be + supports for querying or posting to the collection of instances at the target + resource. The query can be suffixed to the target URI to query the collection with property-based constraints on the resources that SHOULD be returned from the server or used to post data to the resource (depending on the method). - +
For example, with the following schema: @@ -793,7 +793,7 @@ GET /Resource/ This indicates that the client can query the server for instances that have a specific name.
- +
For example: @@ -803,23 +803,23 @@ GET /Resource/
- If no enctype or method is specified, only the single URI specified by - the href property is defined. If the method is POST, "application/json" is + If no enctype or method is specified, only the single URI specified by + the href property is defined. If the method is POST, "application/json" is the default media type.
- +
This attribute contains a schema which defines the acceptable structure of the submitted - request (for a GET request, this schema would define the properties for the query string + request (for a GET request, this schema would define the properties for the query string and for a POST request, this would define the body).
- +
This property indicates the fragment resolution protocol to use for @@ -829,12 +829,12 @@ GET /Resource/ protocol is "slash-delimited", which is defined below. Other fragment resolution protocols MAY be used, but are not defined in this document. - + The fragment identifier is based on RFC 2396, Sec 5, and defines the mechanism for resolving references to entities within a document. - +
With the slash-delimited fragment resolution protocol, the fragment @@ -852,15 +852,15 @@ GET /Resource/ item in array the array with the index defined by the next property reference token (which MUST be a number). The target is successively updated for each property reference token, until the entire fragment has - been traversed. + been traversed. - + - Property names SHOULD be URI-encoded. In particular, any "/" in a - property name MUST be encoded to avoid being interpreted as a property + Property names SHOULD be URI-encoded. In particular, any "/" in a + property name MUST be encoded to avoid being interpreted as a property delimiter. - +
For example, for the following JSON representation: @@ -879,7 +879,7 @@ GET /Resource/ ]]>
- +
The following fragment identifiers would be resolved: @@ -889,10 +889,10 @@ fragment identifier resolution # self, the root of the resource itself #/foo the object referred to by the foo property #/foo/another%20prop the object referred to by the "another prop" - property of the object referred to by the + property of the object referred to by the "foo" property #/foo/another%20prop/baz the string referred to by the value of "baz" - property of the "another prop" property of + property of the "another prop" property of the object referred to by the "foo" property #/foo/anArray/0 the first object in the "anArray" array ]]> @@ -900,61 +900,61 @@ fragment identifier resolution
- +
- The dot-delimited fragment resolution protocol is the same as - slash-delimited fragment resolution protocol except that the "." character - (\x2E) is used as the delimiter between property names (instead of "/") and + The dot-delimited fragment resolution protocol is the same as + slash-delimited fragment resolution protocol except that the "." character + (\x2E) is used as the delimiter between property names (instead of "/") and the path does not need to start with a ".". For example, #.foo and #foo are a valid fragment identifiers for referencing the value of the foo propery.
- +
This attribute indicates that the instance property SHOULD NOT be changed. Attempts by a user agent to modify the value of this property are expected to be rejected by a server.
- +
If the instance property value is a string, this attribute defines that the string SHOULD be interpreted as binary data and decoded using the encoding named by this schema property. RFC 2045, Sec 6.1 lists the possible values for this property.
- +
- This attribute is a URI that defines what the instance's URI MUST start with in order to validate. - The value of the "pathStart" attribute MUST be resolved as per RFC 3986, Sec 5, + This attribute is a URI that defines what the instance's URI MUST start with in order to validate. + The value of the "pathStart" attribute MUST be resolved as per RFC 3986, Sec 5, and is relative to the instance's URI. - + - When multiple schemas have been referenced for an instance, the user agent - can determine if this schema is applicable for a particular instance by + When multiple schemas have been referenced for an instance, the user agent + can determine if this schema is applicable for a particular instance by determining if the URI of the instance begins with the the value of the "pathStart" - attribute. If the URI of the instance does not start with this URI, - or if another schema specifies a starting URI that is longer and also matches the - instance, this schema SHOULD NOT be applied to the instance. Any schema - that does not have a pathStart attribute SHOULD be considered applicable + attribute. If the URI of the instance does not start with this URI, + or if another schema specifies a starting URI that is longer and also matches the + instance, this schema SHOULD NOT be applied to the instance. Any schema + that does not have a pathStart attribute SHOULD be considered applicable to all the instances for which it is referenced.
- +
This attribute defines the media type of the instance representations that this schema is defining.
- +
- This specification is a sub-type of the JSON format, and - consequently the security considerations are generally the same as RFC 4627. + This specification is a sub-type of the JSON format, and + consequently the security considerations are generally the same as RFC 4627. However, an additional issue is that when link relation of "self" - is used to denote a full representation of an object, the user agent + is used to denote a full representation of an object, the user agent SHOULD NOT consider the representation to be the authoritative representation of the resource denoted by the target URI if the target URI is not - equivalent to or a sub-path of the the URI used to request the resource + equivalent to or a sub-path of the the URI used to request the resource representation which contains the target URI with the "self" link. - +
For example, if a hyper schema was defined: @@ -968,7 +968,7 @@ fragment identifier resolution ]]>
- +
And a resource was requested from somesite.com: @@ -1005,22 +1005,22 @@ Content-Type: application/json; profile=/schema-for-this-data
- +
The proposed MIME media type for JSON Schema is "application/schema+json". Type name: application Subtype name: schema+json Required parameters: profile - The value of the profile parameter SHOULD be a URI (relative or absolute) that - refers to the schema used to define the structure of this structure (the + The value of the profile parameter SHOULD be a URI (relative or absolute) that + refers to the schema used to define the structure of this structure (the meta-schema). Normally the value would be http://json-schema.org/draft-03/hyper-schema, but it is allowable to use other schemas that extend the hyper schema's meta- schema. Optional parameters: pretty The value of the pretty parameter MAY be true or false to indicate if additional whitespace has been included to make the JSON representation easier to read. - +
This registry is maintained by IANA per RFC 4287 and this specification adds @@ -1032,7 +1032,7 @@ Content-Type: application/json; profile=/schema-for-this-data
- + @@ -1080,7 +1080,7 @@ Content-Type: application/json; profile=/schema-for-this-data Added "$ref" and "$schema" attributes. - + Replaced "maxDecimal" attribute with "divisibleBy" attribute. @@ -1090,13 +1090,13 @@ Content-Type: application/json; profile=/schema-for-this-data Added "targetSchema" attribute to link description object. - + Fixed category and updates from template. - + Initial draft. @@ -1105,7 +1105,7 @@ Content-Type: application/json; profile=/schema-for-this-data - +
diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-04.xml b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-04.xml index f9c1ea5a0c00a2..22fb3290df1472 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-04.xml +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/draft-zyp-json-schema-04.xml @@ -23,7 +23,7 @@ A JSON Media Type for Describing the Structure and Meaning of JSON Documents - + SitePen (USA)
@@ -36,7 +36,7 @@ kris@sitepen.com
- +
@@ -47,7 +47,7 @@ gary.court@gmail.com
- + Internet Engineering Task Force JSON @@ -57,48 +57,48 @@ Notation Hyper Schema Hypermedia - + - JSON (JavaScript Object Notation) Schema defines the media type "application/schema+json", - a JSON based format for defining the structure of JSON data. JSON Schema provides a contract for what JSON - data is required for a given application and how to interact with it. JSON - Schema is intended to define validation, documentation, hyperlink - navigation, and interaction control of JSON data. + JSON (JavaScript Object Notation) Schema defines the media type "application/schema+json", + a JSON based format for defining the structure of JSON data. JSON Schema provides a contract for what JSON + data is required for a given application and how to interact with it. JSON + Schema is intended to define validation, documentation, hyperlink + navigation, and interaction control of JSON data.
- +
- JSON (JavaScript Object Notation) Schema is a JSON media type for defining - the structure of JSON data. JSON Schema provides a contract for what JSON - data is required for a given application and how to interact with it. JSON - Schema is intended to define validation, documentation, hyperlink - navigation, and interaction control of JSON data. + JSON (JavaScript Object Notation) Schema is a JSON media type for defining + the structure of JSON data. JSON Schema provides a contract for what JSON + data is required for a given application and how to interact with it. JSON + Schema is intended to define validation, documentation, hyperlink + navigation, and interaction control of JSON data.
- +
- - - The key words "MUST", "MUST NOT", "REQUIRED", "SHALL", "SHALL NOT", "SHOULD", + + The key words "MUST", "MUST NOT", "REQUIRED", "SHALL", "SHALL NOT", "SHOULD", "SHOULD NOT", "RECOMMENDED", "MAY", and "OPTIONAL" in this document are to be interpreted as described in RFC 2119. - + - The terms "JSON", "JSON text", "JSON value", "member", "element", "object", - "array", "number", "string", "boolean", "true", "false", and "null" in this + The terms "JSON", "JSON text", "JSON value", "member", "element", "object", + "array", "number", "string", "boolean", "true", "false", and "null" in this document are to be interpreted as defined in RFC 4627. - + This specification also uses the following defined terms: - + A JSON Schema object. Equivalent to "JSON value" as defined in RFC 4627. @@ -108,35 +108,35 @@
- +
- JSON Schema defines the media type "application/schema+json" for - describing the structure of JSON text. JSON Schemas are also written in JSON and includes facilities + JSON Schema defines the media type "application/schema+json" for + describing the structure of JSON text. JSON Schemas are also written in JSON and includes facilities for describing the structure of JSON in terms of allowable values, descriptions, and interpreting relations with other resources. - This document is organized into several separate definitions. The first - definition is the core schema specification. This definition is primary + This document is organized into several separate definitions. The first + definition is the core schema specification. This definition is primary concerned with describing a JSON structure and specifying valid elements in the structure. The second definition is the Hyper Schema specification which is intended to define elements in a structure that can be interpreted as hyperlinks. - Hyper Schema builds on JSON Schema to describe the hyperlink structure of + Hyper Schema builds on JSON Schema to describe the hyperlink structure of JSON values. This allows user agents to be able to successfully navigate documents containing JSON based on their schemas. - Cumulatively JSON Schema acts as meta-JSON that can be used to define the + Cumulatively JSON Schema acts as meta-JSON that can be used to define the required type and constraints on JSON values, as well as define the meaning of the JSON values for the purpose of describing a resource and determining - hyperlinks within the representation. + hyperlinks within the representation.
An example JSON Schema that describes products might look like: - - This schema defines the properties of the instance, + This schema defines the properties of the instance, the required properties (id, name, and price), as well as an optional property (tags). This also defines the link relations of the instance.
- +
The JSON Schema media type does not attempt to dictate the structure of JSON @@ -195,7 +195,7 @@ This specification is protocol agnostic. The underlying protocol (such as HTTP) should sufficiently define the semantics of the client-server interface, the retrieval of resource - representations linked to by JSON representations, and modification of + representations linked to by JSON representations, and modification of those resources. The goal of this format is to sufficiently describe JSON structures such that one can utilize existing information available in existing JSON @@ -204,35 +204,35 @@
- +
JSON values are correlated to their schema by the "describedby" relation, where the schema is the target of the relation. JSON values MUST be of the "application/json" media type or - any other subtype. Consequently, dictating how a JSON value should + any other subtype. Consequently, dictating how a JSON value should specify the relation to the schema is beyond the normative scope of this document since this document specifically defines the JSON Schema media type, and no other. It is RECOMMNENDED that JSON values specify their schema so that user agents can interpret the instance and retain the self-descriptive characteristics. This avoides the need for out-of-band information about instance data. Two approaches are recommended for declaring the - relation to the schema that describes the meaning of a JSON instance's (or collection + relation to the schema that describes the meaning of a JSON instance's (or collection of instances) structure. A MIME type parameter named "profile" or a relation of "describedby" (which could be specified by a Link header) may be used: - +
-
- + or if the content is being transferred by a protocol (such as HTTP) that provides headers, a Link header can be used: - +
; rel="describedby" ]]>
- - Instances MAY specify multiple schemas, to indicate all the schemas that - are applicable to the data, and the data SHOULD be valid by all the schemas. - The instance data MAY have multiple schemas - that it is described by (the instance data SHOULD be valid for those schemas). - Or if the document is a collection of instances, the collection MAY contain - instances from different schemas. The mechanism for referencing a schema is - determined by the media type of the instance (if it provides a method for + + Instances MAY specify multiple schemas, to indicate all the schemas that + are applicable to the data, and the data SHOULD be valid by all the schemas. + The instance data MAY have multiple schemas + that it is described by (the instance data SHOULD be valid for those schemas). + Or if the document is a collection of instances, the collection MAY contain + instances from different schemas. The mechanism for referencing a schema is + determined by the media type of the instance (if it provides a method for referencing schemas).
- +
- JSON Schemas can themselves be described using JSON Schemas. + JSON Schemas can themselves be described using JSON Schemas. A self-describing JSON Schema for the core JSON Schema can - be found at http://json-schema.org/schema for the latest version or - http://json-schema.org/draft-04/schema for the draft-04 version. The hyper schema - self-description can be found at http://json-schema.org/hyper-schema + be found at http://json-schema.org/schema for the latest version or + http://json-schema.org/draft-04/schema for the draft-04 version. The hyper schema + self-description can be found at http://json-schema.org/hyper-schema or http://json-schema.org/draft-04/hyper-schema. All schemas used within a protocol with a media type specified SHOULD include a MIME parameter that refers to the self-descriptive hyper schema or another schema that extends this hyper schema: - +
- @@ -273,15 +273,15 @@ Content-Type: application/json;
- +
- A JSON Schema is a JSON object that defines various attributes + A JSON Schema is a JSON object that defines various attributes (including usage and valid values) of a JSON value. JSON Schema has recursive capabilities; there are a number of elements in the structure that allow for nested JSON Schemas. - +
An example JSON Schema could look like: @@ -305,17 +305,17 @@ Content-Type: application/json; ]]>
- + A JSON Schema object MAY have any of the following optional properties: - + - +
- This attribute defines what the primitive type or the schema of the instance MUST be in order to validate. + This attribute defines what the primitive type or the schema of the instance MUST be in order to validate. This attribute can take one of two forms: @@ -332,16 +332,16 @@ Content-Type: application/json; Instance MAY be of any type, including null. - + An array of one or more simple or schema types. - The instance value is valid if it is of the same type as one of the simple types, or valid by one of the schemas, in the array. + The instance value is valid if it is of the same type as one of the simple types, or valid by one of the schemas, in the array. - - If this attribute is not specified, then all value types are accepted. + + If this attribute is not specified, then all value types are accepted. - +
For example, a schema that defines if an instance can be a string or a number would be: @@ -352,37 +352,37 @@ Content-Type: application/json; ]]>
- +
This attribute is an object with properties that specify the schemas for the properties of the instance object. - In this attribute's object, each property value MUST be a schema. + In this attribute's object, each property value MUST be a schema. When the instance value is an object, the value of the instance's properties MUST be valid according to the schemas with the same property names specified in this attribute. Objects are unordered, so therefore the order of the instance properties or attribute properties MUST NOT determine validation success.
- +
- This attribute is an object that defines the schema for a set of property names of an object instance. - The name of each property of this attribute's object is a regular expression pattern in the ECMA 262/Perl 5 format, while the value is a schema. + This attribute is an object that defines the schema for a set of property names of an object instance. + The name of each property of this attribute's object is a regular expression pattern in the ECMA 262/Perl 5 format, while the value is a schema. If the pattern matches the name of a property on the instance object, the value of the instance's property MUST be valid against the pattern name's schema value.
- +
- This attribute specifies how any instance property that is not explicitly defined by either the "properties" or "patternProperties" attributes (hereafter referred to as "additional properties") is handled. If specified, the value MUST be a schema or a boolean. + This attribute specifies how any instance property that is not explicitly defined by either the "properties" or "patternProperties" attributes (hereafter referred to as "additional properties") is handled. If specified, the value MUST be a schema or a boolean. If a schema is provided, then all additional properties MUST be valid according to the schema. If false is provided, then no additional properties are allowed. The default value is an empty schema, which allows any value for additional properties.
- +
This attribute provides the allowed items in an array instance. If specified, this attribute MUST be a schema or an array of schemas. When this attribute value is a schema and the instance value is an array, then all the items in the array MUST be valid according to the schema. When this attribute value is an array of schemas and the instance value is an array, each position in the instance array MUST be valid according to the schema in the corresponding position for this array. This called tuple typing. When tuple typing is used, additional items are allowed, disallowed, or constrained by the "additionalItems" attribute the same way as "additionalProperties" for objects is.
- +
This attribute specifies how any item in the array instance that is not explicitly defined by "items" (hereafter referred to as "additional items") is handled. If specified, the value MUST be a schema or a boolean. If a schema is provided: @@ -395,16 +395,16 @@ Content-Type: application/json; If false is provided, then any additional items in the array are not allowed. The default value is an empty schema, which allows any value for additional items.
- +
This attribute is an array of strings that defines all the property names that must exist on the object instance.
- +
This attribute is an object that specifies the requirements of a property on an object instance. If an object instance has a property with the same name as a property in this attribute's object, then the instance must be valid against the attribute's property value (hereafter referred to as the "dependency value"). The dependency value can take one of two forms: - + If the dependency value is a string, then the instance object MUST have a property with the same name as the dependency value. @@ -416,44 +416,44 @@ Content-Type: application/json;
- +
This attribute defines the minimum value of the instance property when the type of the instance value is a number.
- +
This attribute defines the maximum value of the instance property when the type of the instance value is a number.
- +
This attribute indicates if the value of the instance (if the instance is a number) can not equal the number defined by the "minimum" attribute. This is false by default, meaning the instance value can be greater then or equal to the minimum value.
- +
This attribute indicates if the value of the instance (if the instance is a number) can not equal the number defined by the "maximum" attribute. This is false by default, meaning the instance value can be less then or equal to the maximum value.
- +
This attribute defines the minimum number of values in an array when the array is the instance value.
- +
This attribute defines the maximum number of values in an array when the array is the instance value.
- +
This attribute defines the minimum number of properties required on an object instance.
- +
This attribute defines the maximum number of properties the object instance can have.
- +
This attribute indicates that all items in an array instance MUST be unique (contains no two identical values). Two instance are consider equal if they are both of the same type and: - + are null; or are booleans/numbers/strings and have the same value; or @@ -462,43 +462,43 @@ Content-Type: application/json;
- +
When the instance value is a string, this provides a regular expression that a string instance MUST match in order to be valid. Regular expressions SHOULD follow the regular expression specification from ECMA 262/Perl 5
- +
When the instance value is a string, this defines the minimum length of the string.
- +
When the instance value is a string, this defines the maximum length of the string.
- +
This provides an enumeration of all possible values that are valid for the instance property. This MUST be an array, and each item in the array represents a possible value for the instance value. If this attribute is defined, the instance value MUST be one of the values in the array in order for the schema to be valid. Comparison of enum values uses the same algorithm as defined in "uniqueItems".
- +
This attribute defines the default value of the instance when the instance is undefined.
- +
This attribute is a string that provides a short description of the instance property.
- +
This attribute is a string that provides a full description of the of purpose the instance property.
- +
This attribute defines what value the number instance must be divisible by with no remainder (the result of the division must be an integer.) The value of this attribute SHOULD NOT be 0.
- +
This attribute takes the same values as the "type" attribute, however if the instance matches the type or if this value is an array and the instance matches any type or schema in the array, then this instance is not valid.
- +
The value of this property MUST be another schema which will provide a base schema which the current schema will inherit from. The inheritance rules are such that any instance that is valid according to the current schema MUST be valid according to the referenced schema. This MAY also be an array, in which case, the instance MUST be valid for all the schemas in the array. A schema that extends another schema MAY define additional attributes, constrain existing attributes, or add other constraints. @@ -506,7 +506,7 @@ Content-Type: application/json; instance against all constraints in the extending schema as well as the extended schema(s). More optimized implementations that merge schemas are possible, but are not required. Some examples of using "extends": - +
- +
- +
This attribute defines the current URI of this schema (this attribute is @@ -553,28 +553,28 @@ Content-Type: application/json; is also used to construct relative references such as for $ref.
- +
- This attribute defines a URI of a schema that contains the full representation of this schema. - When a validator encounters this attribute, it SHOULD replace the current schema with the schema referenced by the value's URI (if known and available) and re-validate the instance. + This attribute defines a URI of a schema that contains the full representation of this schema. + When a validator encounters this attribute, it SHOULD replace the current schema with the schema referenced by the value's URI (if known and available) and re-validate the instance. This URI MAY be relative or absolute, and relative URIs SHOULD be resolved against the URI of the current schema.
- +
- This attribute defines a URI of a JSON Schema that is the schema of the current schema. + This attribute defines a URI of a JSON Schema that is the schema of the current schema. When this attribute is defined, a validator SHOULD use the schema referenced by the value's URI (if known and available) when resolving Hyper Schemalinks. - + - A validator MAY use this attribute's value to determine which version of JSON Schema the current schema is written in, and provide the appropriate validation features and behavior. + A validator MAY use this attribute's value to determine which version of JSON Schema the current schema is written in, and provide the appropriate validation features and behavior. Therefore, it is RECOMMENDED that all schema authors include this attribute in their schemas to prevent conflicts with future JSON Schema specification changes.
- +
The following attributes are specified in addition to those @@ -586,30 +586,30 @@ Content-Type: application/json; essentially describes plain JSON (no constraints on the structures). Addition of attributes provides additive information for user agents. - +
- The value of the links property MUST be an array, where each item + The value of the links property MUST be an array, where each item in the array is a link description object which describes the link relations of the instances. - + - +
- A link description object is used to describe link relations. In - the context of a schema, it defines the link relations of the + A link description object is used to describe link relations. In + the context of a schema, it defines the link relations of the instances of the schema, and can be parameterized by the instance - values. The link description format can be used without JSON Schema, + values. The link description format can be used without JSON Schema, and use of this format can be declared by referencing the normative link description - schema as the the schema for the data structure that uses the - links. The URI of the normative link description schema is: + schema as the the schema for the data structure that uses the + links. The URI of the normative link description schema is: http://json-schema.org/links (latest version) or http://json-schema.org/draft-04/links (draft-04 version). - +
The value of the "href" link description property @@ -617,19 +617,19 @@ Content-Type: application/json; of the instance property SHOULD be resolved as a URI-Reference per RFC 3986 and MAY be a relative URI. The base URI to be used for relative resolution SHOULD be the URI used to retrieve the instance object (not the schema) - when used within a schema. Also, when links are used within a schema, the URI - SHOULD be parametrized by the property values of the instance + when used within a schema. Also, when links are used within a schema, the URI + SHOULD be parametrized by the property values of the instance object, if property values exist for the corresponding variables in the template (otherwise they MAY be provided from alternate sources, like user input). - + Instance property values SHOULD be substituted into the URIs where matching braces ('{', '}') are found surrounding zero or more characters, creating an expanded URI. Instance property value substitutions are resolved by using the text between the braces to denote the property name - from the instance to get the value to substitute. - + from the instance to get the value to substitute. +
For example, if an href value is defined: @@ -639,7 +639,7 @@ http://somesite.com/{id} Then it would be resolved by replace the value of the "id" property value from the instance object.
- +
If the value of the "id" property was "45", the expanded URI would be: @@ -648,23 +648,23 @@ http://somesite.com/45 ]]>
- - If matching braces are found with the string "@" (no quotes) between the braces, then the + + If matching braces are found with the string "@" (no quotes) between the braces, then the actual instance value SHOULD be used to replace the braces, rather than a property value. - This should only be used in situations where the instance is a scalar (string, + This should only be used in situations where the instance is a scalar (string, boolean, or number), and not for objects or arrays.
- +
- The value of the "rel" property indicates the name of the + The value of the "rel" property indicates the name of the relation to the target resource. The relation to the target SHOULD be interpreted as specifically from the instance object that the schema (or sub-schema) applies to, not just the top level resource that contains the object within its hierarchy. If a resource JSON representation contains a sub object with a property interpreted as a link, that sub-object holds the relation with the target. A relation to target from the top level resource MUST be indicated with the schema describing the top level JSON representation. - + Relationship definitions SHOULD NOT be media type dependent, and users are encouraged to utilize existing accepted relation definitions, including those in existing relation registries (see RFC 4287). However, we define these relations here for clarity of normative interpretation within the context of JSON hyper schema defined relations: - + If the relation value is "self", when this property is encountered in @@ -672,15 +672,15 @@ http://somesite.com/45 treated as a full representation of the target resource identified by the specified URI. - + This indicates that the target of the link is the full representation for the instance object. The object that contains this link possibly may not be the full representation. - + This indicates the target of the link is the schema for the instance object. This MAY be used to specifically denote the schemas of objects within a JSON object hierarchy, facilitating polymorphic type data structures. - + This relation indicates that the target of the link SHOULD be treated as the root or the body of the representation for the @@ -690,7 +690,7 @@ http://somesite.com/45 - + The following relations are applicable for schemas (the schema as the "from" resource in the relation): @@ -699,7 +699,7 @@ http://somesite.com/45 This indicates a target to use for creating new instances of a schema. This link definition SHOULD be a submission link with a non-safe method (like POST). - +
For example, if a schema is defined: @@ -720,7 +720,7 @@ http://somesite.com/45 ]]>
- +
And if a collection of instance resource's JSON representation was retrieved: @@ -744,41 +744,41 @@ GET /Resource/ The "children" collection would be located at "/Resource/?upId=thing".
- +
This property value is a string that defines the templating language used in the "href" attribute. If no templating language is defined, then the default Link Description Object templating langauge is used.
- +
This property value is a schema that defines the expected structure of the JSON representation of the target of the link.
- +
- The following properties also apply to link definition objects, and - provide functionality analogous to HTML forms, in providing a + The following properties also apply to link definition objects, and + provide functionality analogous to HTML forms, in providing a means for submitting extra (often user supplied) information to send to a server. - +
- This attribute defines which method can be used to access the target resource. - In an HTTP environment, this would be "GET" or "POST" (other HTTP methods - such as "PUT" and "DELETE" have semantics that are clearly implied by - accessed resources, and do not need to be defined here). + This attribute defines which method can be used to access the target resource. + In an HTTP environment, this would be "GET" or "POST" (other HTTP methods + such as "PUT" and "DELETE" have semantics that are clearly implied by + accessed resources, and do not need to be defined here). This defaults to "GET".
- +
If present, this property indicates a query media type format that the server - supports for querying or posting to the collection of instances at the target - resource. The query can be + supports for querying or posting to the collection of instances at the target + resource. The query can be suffixed to the target URI to query the collection with property-based constraints on the resources that SHOULD be returned from the server or used to post data to the resource (depending on the method). - +
For example, with the following schema: @@ -799,7 +799,7 @@ GET /Resource/ This indicates that the client can query the server for instances that have a specific name.
- +
For example: @@ -809,23 +809,23 @@ GET /Resource/
- If no enctype or method is specified, only the single URI specified by - the href property is defined. If the method is POST, "application/json" is + If no enctype or method is specified, only the single URI specified by + the href property is defined. If the method is POST, "application/json" is the default media type.
- +
This attribute contains a schema which defines the acceptable structure of the submitted - request (for a GET request, this schema would define the properties for the query string + request (for a GET request, this schema would define the properties for the query string and for a POST request, this would define the body).
- +
This property indicates the fragment resolution protocol to use for @@ -835,62 +835,62 @@ GET /Resource/ protocol is "json-pointer", which is defined below. Other fragment resolution protocols MAY be used, but are not defined in this document. - + The fragment identifier is based on RFC 3986, Sec 5, and defines the mechanism for resolving references to entities within a document. - +
The "json-pointer" fragment resolution protocol uses a JSON Pointer to resolve fragment identifiers in URIs within instance representations.
- + - +
This attribute indicates that the instance value SHOULD NOT be changed. Attempts by a user agent to modify the value of this property are expected to be rejected by a server.
- +
If the instance property value is a string, this attribute defines that the string SHOULD be interpreted as binary data and decoded using the encoding named by this schema property. RFC 2045, Sec 6.1 lists the possible values for this property.
- +
- This attribute is a URI that defines what the instance's URI MUST start with in order to validate. - The value of the "pathStart" attribute MUST be resolved as per RFC 3986, Sec 5, + This attribute is a URI that defines what the instance's URI MUST start with in order to validate. + The value of the "pathStart" attribute MUST be resolved as per RFC 3986, Sec 5, and is relative to the instance's URI. - + - When multiple schemas have been referenced for an instance, the user agent - can determine if this schema is applicable for a particular instance by + When multiple schemas have been referenced for an instance, the user agent + can determine if this schema is applicable for a particular instance by determining if the URI of the instance begins with the the value of the "pathStart" - attribute. If the URI of the instance does not start with this URI, - or if another schema specifies a starting URI that is longer and also matches the - instance, this schema SHOULD NOT be applied to the instance. Any schema - that does not have a pathStart attribute SHOULD be considered applicable + attribute. If the URI of the instance does not start with this URI, + or if another schema specifies a starting URI that is longer and also matches the + instance, this schema SHOULD NOT be applied to the instance. Any schema + that does not have a pathStart attribute SHOULD be considered applicable to all the instances for which it is referenced.
- +
This attribute defines the media type of the instance representations that this schema is defining.
- +
- This specification is a sub-type of the JSON format, and - consequently the security considerations are generally the same as RFC 4627. + This specification is a sub-type of the JSON format, and + consequently the security considerations are generally the same as RFC 4627. However, an additional issue is that when link relation of "self" - is used to denote a full representation of an object, the user agent + is used to denote a full representation of an object, the user agent SHOULD NOT consider the representation to be the authoritative representation of the resource denoted by the target URI if the target URI is not - equivalent to or a sub-path of the the URI used to request the resource + equivalent to or a sub-path of the the URI used to request the resource representation which contains the target URI with the "self" link. - +
For example, if a hyper schema was defined: @@ -904,7 +904,7 @@ GET /Resource/ ]]>
- +
And a resource was requested from somesite.com: @@ -941,22 +941,22 @@ Content-Type: application/json; profile=/schema-for-this-data
- +
The proposed MIME media type for JSON Schema is "application/schema+json". Type name: application Subtype name: schema+json Required parameters: profile - The value of the profile parameter SHOULD be a URI (relative or absolute) that - refers to the schema used to define the structure of this structure (the + The value of the profile parameter SHOULD be a URI (relative or absolute) that + refers to the schema used to define the structure of this structure (the meta-schema). Normally the value would be http://json-schema.org/draft-04/hyper-schema, but it is allowable to use other schemas that extend the hyper schema's meta- schema. Optional parameters: pretty The value of the pretty parameter MAY be true or false to indicate if additional whitespace has been included to make the JSON representation easier to read. - +
This registry is maintained by IANA per RFC 4287 and this specification adds @@ -968,7 +968,7 @@ Content-Type: application/json; profile=/schema-for-this-data
- + @@ -1019,7 +1019,7 @@ Content-Type: application/json; profile=/schema-for-this-data Improved wording of many sections.
- + Added example and verbiage to "extends" attribute. @@ -1043,7 +1043,7 @@ Content-Type: application/json; profile=/schema-for-this-data Added "$ref" and "$schema" attributes. - + Replaced "maxDecimal" attribute with "divisibleBy" attribute. @@ -1053,13 +1053,13 @@ Content-Type: application/json; profile=/schema-for-this-data Added "targetSchema" attribute to link description object. - + Fixed category and updates from template. - + Initial draft. diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/links.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/links.js index 5b1bbbfdd61c8d..2ef3f9fb7d0afe 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/links.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/links.js @@ -1,21 +1,35 @@ -/** +/** * JSON Schema link handler * Copyright (c) 2007 Kris Zyp SitePen (www.sitepen.com) * Licensed under the MIT (MIT-LICENSE.txt) license. */ -({define:typeof define!="undefined"?define:function(deps, factory){module.exports = factory();}}). -define([], function(){ +(function (root, factory) { + if (typeof define === 'function' && define.amd) { + // AMD. Register as an anonymous module. + define([], function () { + return factory(); + }); + } else if (typeof module === 'object' && module.exports) { + // Node. Does not work with strict CommonJS, but + // only CommonJS-like environments that support module.exports, + // like Node. + module.exports = factory(); + } else { + // Browser globals + root.jsonSchemaLinks = factory(); + } +}(this, function () {// setup primitive classes to be JSON Schema types var exports = {}; exports.cacheLinks = true; exports.getLink = function(relation, instance, schema){ // gets the URI of the link for the given relation based on the instance and schema // for example: // getLink( - // "brother", - // {"brother_id":33}, + // "brother", + // {"brother_id":33}, // {links:[{rel:"brother", href:"Brother/{brother_id}"}]}) -> // "Brother/33" - var links = schema.__linkTemplates; + var links = schema.__linkTemplates; if(!links){ links = {}; var schemaLinks = schema.links; @@ -49,4 +63,4 @@ exports.substitute = function(linkTemplate, instance){ }); }; return exports; -}); \ No newline at end of file +})); \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/validate.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/validate.js index 97cbbf6fa34603..4b6108800aafb5 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/validate.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/lib/validate.js @@ -13,10 +13,23 @@ empty list will be returned. A validation error will have two properties: "property" which indicates which property had the error "message" which indicates what the error was */ -({define:typeof define!="undefined"?define:function(deps, factory){module.exports = factory();}}). -define([], function(){ -var exports = validate; -// setup primitive classes to be JSON Schema types +(function (root, factory) { + if (typeof define === 'function' && define.amd) { + // AMD. Register as an anonymous module. + define([], function () { + return factory(); + }); + } else if (typeof module === 'object' && module.exports) { + // Node. Does not work with strict CommonJS, but + // only CommonJS-like environments that support module.exports, + // like Node. + module.exports = factory(); + } else { + // Browser globals + root.jsonSchema = factory(); + } +}(this, function () {// setup primitive classes to be JSON Schema types +var exports = validate exports.Integer = {type:"integer"}; var primitiveConstructors = { String: String, @@ -194,8 +207,8 @@ var validate = exports._validate = function(/*Any*/instance,/*Object*/schema,/*O if(typeof instance != 'object' || instance instanceof Array){ errors.push({property:path,message:"an object is required"}); } - - for(var i in objTypeDef){ + + for(var i in objTypeDef){ if(objTypeDef.hasOwnProperty(i)){ var value = instance[i]; // skip _not_ specified properties @@ -257,4 +270,4 @@ exports.mustBeValid = function(result){ } return exports; -}); +})); diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/package.json index b77d8b34664b20..f2de2d65f7ae1e 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/package.json +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/node_modules/json-schema/package.json @@ -2,44 +2,48 @@ "_args": [ [ { - "raw": "json-schema@0.2.2", + "raw": "json-schema@0.2.3", "scope": null, "escapedName": "json-schema", "name": "json-schema", - "rawSpec": "0.2.2", - "spec": "0.2.2", + "rawSpec": "0.2.3", + "spec": "0.2.3", "type": "version" }, "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim" ] ], - "_from": "json-schema@0.2.2", - "_id": "json-schema@0.2.2", + "_from": "json-schema@0.2.3", + "_id": "json-schema@0.2.3", "_inCache": true, - "_installable": true, "_location": "/request/http-signature/jsprim/json-schema", + "_nodeVersion": "6.1.0", + "_npmOperationalInternal": { + "host": "packages-12-west.internal.npmjs.com", + "tmp": "tmp/json-schema-0.2.3.tgz_1473699189380_0.7420965158380568" + }, "_npmUser": { "name": "kriszyp", "email": "kriszyp@gmail.com" }, - "_npmVersion": "1.1.59", + "_npmVersion": "3.8.9", "_phantomChildren": {}, "_requested": { - "raw": "json-schema@0.2.2", + "raw": "json-schema@0.2.3", "scope": null, "escapedName": "json-schema", "name": "json-schema", - "rawSpec": "0.2.2", - "spec": "0.2.2", + "rawSpec": "0.2.3", + "spec": "0.2.3", "type": "version" }, "_requiredBy": [ "/request/http-signature/jsprim" ], - "_resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.2.tgz", - "_shasum": "50354f19f603917c695f70b85afa77c3b0f23506", + "_resolved": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.3.tgz", + "_shasum": "b480c892e59a2f05954ce727bd3f2a4e882f9e13", "_shrinkwrap": null, - "_spec": "json-schema@0.2.2", + "_spec": "json-schema@0.2.3", "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim", "author": { "name": "Kris Zyp" @@ -56,9 +60,10 @@ "lib": "./lib" }, "dist": { - "shasum": "50354f19f603917c695f70b85afa77c3b0f23506", - "tarball": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.2.tgz" + "shasum": "b480c892e59a2f05954ce727bd3f2a4e882f9e13", + "tarball": "https://registry.npmjs.org/json-schema/-/json-schema-0.2.3.tgz" }, + "gitHead": "07ae2c618b5f581dbc108e065f4f95dcf0a1d85f", "homepage": "https://github.com/kriszyp/json-schema#readme", "keywords": [ "json", @@ -83,7 +88,7 @@ ], "name": "json-schema", "optionalDependencies": {}, - "readme": "JSON Schema is a repository for the JSON Schema specification, reference schemas and a CommonJS implementation of JSON Schema (not the only JavaScript implementation of JSON Schema, JSV is another excellent JavaScript validator).\r\n\r\nCode is licensed under the AFL or BSD license as part of the Persevere \r\nproject which is administered under the Dojo foundation,\r\nand all contributions require a Dojo CLA.", + "readme": "ERROR: No README data found!", "repository": { "type": "git", "url": "git+ssh://git@github.com/kriszyp/json-schema.git" @@ -91,5 +96,5 @@ "scripts": { "test": "echo TESTS DISABLED vows --spec test/*.js" }, - "version": "0.2.2" + "version": "0.2.3" } diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/package.json index e7c32411843366..974d4af4236c75 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/package.json +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/jsprim/package.json @@ -14,20 +14,19 @@ ] ], "_from": "jsprim@>=1.2.2 <2.0.0", - "_id": "jsprim@1.3.0", + "_id": "jsprim@1.3.1", "_inCache": true, - "_installable": true, "_location": "/request/http-signature/jsprim", "_nodeVersion": "0.12.7", "_npmOperationalInternal": { - "host": "packages-12-west.internal.npmjs.com", - "tmp": "tmp/jsprim-1.3.0.tgz_1466708163640_0.5282344303559512" + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/jsprim-1.3.1.tgz_1473725209917_0.5387293708045036" }, "_npmUser": { "name": "dap", "email": "dap@cs.brown.edu" }, - "_npmVersion": "2.11.3", + "_npmVersion": "2.15.9", "_phantomChildren": {}, "_requested": { "raw": "jsprim@^1.2.2", @@ -41,8 +40,8 @@ "_requiredBy": [ "/request/http-signature" ], - "_resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.3.0.tgz", - "_shasum": "ce2e1bef835204b4f3099928c602f8b6ae615650", + "_resolved": "https://registry.npmjs.org/jsprim/-/jsprim-1.3.1.tgz", + "_shasum": "2a7256f70412a29ee3670aaca625994c4dcff252", "_shrinkwrap": null, "_spec": "jsprim@^1.2.2", "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature", @@ -51,20 +50,20 @@ }, "dependencies": { "extsprintf": "1.0.2", - "json-schema": "0.2.2", + "json-schema": "0.2.3", "verror": "1.3.6" }, "description": "utilities for primitive JavaScript types", "devDependencies": {}, "directories": {}, "dist": { - "shasum": "ce2e1bef835204b4f3099928c602f8b6ae615650", - "tarball": "https://registry.npmjs.org/jsprim/-/jsprim-1.3.0.tgz" + "shasum": "2a7256f70412a29ee3670aaca625994c4dcff252", + "tarball": "https://registry.npmjs.org/jsprim/-/jsprim-1.3.1.tgz" }, "engines": [ "node >=0.6.0" ], - "gitHead": "694edcb22e2291c21f6c2a23907bf02e1edbfdf4", + "gitHead": "825aba45c6cff4340c18cdae363ccb5bdf840bd7", "homepage": "https://github.com/davepacheco/node-jsprim#readme", "license": "MIT", "main": "./lib/jsprim.js", @@ -82,5 +81,5 @@ "url": "git://github.com/davepacheco/node-jsprim.git" }, "scripts": {}, - "version": "1.3.0" + "version": "1.3.1" } diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/bin/sshpk-conv b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/bin/sshpk-conv index a1205a45d5431f..444045a5e8a8a0 100755 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/bin/sshpk-conv +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/bin/sshpk-conv @@ -149,6 +149,12 @@ if (require.main === module) { } catch (e) { if (e.name === 'KeyEncryptedError') { getPassword(function (err, pw) { + if (err) { + console.log('sshpk-conv: ' + + err.name + ': ' + + err.message); + process.exit(1); + } parseOpts.passphrase = pw; processKey(); }); diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/pem.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/pem.js index 5318b35165336d..c254e4e804c6f6 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/pem.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/pem.js @@ -107,9 +107,9 @@ function read(buf, options, forceType) { /* The new OpenSSH internal format abuses PEM headers */ if (alg && alg.toLowerCase() === 'openssh') - return (sshpriv.readSSHPrivate(type, buf)); + return (sshpriv.readSSHPrivate(type, buf, options)); if (alg && alg.toLowerCase() === 'ssh2') - return (rfc4253.readType(type, buf)); + return (rfc4253.readType(type, buf, options)); var der = new asn1.BerReader(buf); der.originalInput = input; diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/ssh-private.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/ssh-private.js index bfbdab527f9b82..2fcf71990c4725 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/ssh-private.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/formats/ssh-private.js @@ -17,6 +17,9 @@ var PrivateKey = require('../private-key'); var pem = require('./pem'); var rfc4253 = require('./rfc4253'); var SSHBuffer = require('../ssh-buffer'); +var errors = require('../errors'); + +var bcrypt; function read(buf, options) { return (pem.read(buf, options)); @@ -24,7 +27,7 @@ function read(buf, options) { var MAGIC = 'openssh-key-v1'; -function readSSHPrivate(type, buf) { +function readSSHPrivate(type, buf, options) { buf = new SSHBuffer({buffer: buf}); var magic = buf.readCString(); @@ -32,16 +35,7 @@ function readSSHPrivate(type, buf) { var cipher = buf.readString(); var kdf = buf.readString(); - - /* We only support unencrypted keys. */ - if (cipher !== 'none' || kdf !== 'none') { - throw (new Error('OpenSSH-format key is encrypted ' + - '(password-protected). Please use the SSH agent ' + - 'or decrypt the key.')); - } - - /* Skip over kdfoptions. */ - buf.readString(); + var kdfOpts = buf.readBuffer(); var nkeys = buf.readInt(); if (nkeys !== 1) { @@ -59,11 +53,74 @@ function readSSHPrivate(type, buf) { var privKeyBlob = buf.readBuffer(); assert.ok(buf.atEnd(), 'excess bytes left after key'); + var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); + switch (kdf) { + case 'none': + if (cipher !== 'none') { + throw (new Error('OpenSSH-format key uses KDF "none" ' + + 'but specifies a cipher other than "none"')); + } + break; + case 'bcrypt': + var salt = kdfOptsBuf.readBuffer(); + var rounds = kdfOptsBuf.readInt(); + var cinf = utils.opensshCipherInfo(cipher); + if (bcrypt === undefined) { + bcrypt = require('bcrypt-pbkdf'); + } + + if (typeof (options.passphrase) === 'string') { + options.passphrase = new Buffer(options.passphrase, + 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'OpenSSH')); + } + + var pass = new Uint8Array(options.passphrase); + var salti = new Uint8Array(salt); + /* Use the pbkdf to derive both the key and the IV. */ + var out = new Uint8Array(cinf.keySize + cinf.blockSize); + var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, + out, out.length, rounds); + if (res !== 0) { + throw (new Error('bcrypt_pbkdf function returned ' + + 'failure, parameters invalid')); + } + out = new Buffer(out); + var ckey = out.slice(0, cinf.keySize); + var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); + var cipherStream = crypto.createDecipheriv(cinf.opensslName, + ckey, iv); + cipherStream.setAutoPadding(false); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + if (e.toString().indexOf('bad decrypt') !== -1) { + throw (new Error('Incorrect passphrase ' + + 'supplied, could not decrypt key')); + } + throw (e); + }); + cipherStream.write(privKeyBlob); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + privKeyBlob = Buffer.concat(chunks); + break; + default: + throw (new Error( + 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); + } + buf = new SSHBuffer({buffer: privKeyBlob}); var checkInt1 = buf.readInt(); var checkInt2 = buf.readInt(); - assert.strictEqual(checkInt1, checkInt2, 'checkints do not match'); + if (checkInt1 !== checkInt2) { + throw (new Error('Incorrect passphrase supplied, could not ' + + 'decrypt key')); + } var ret = {}; var key = rfc4253.readInternal(ret, 'private', buf.remainder()); @@ -83,6 +140,26 @@ function write(key, options) { else pubKey = key; + var cipher = 'none'; + var kdf = 'none'; + var kdfopts = new Buffer(0); + var cinf = { blockSize: 8 }; + var passphrase; + if (options !== undefined) { + passphrase = options.passphrase; + if (typeof (passphrase) === 'string') + passphrase = new Buffer(passphrase, 'utf-8'); + if (passphrase !== undefined) { + assert.buffer(passphrase, 'options.passphrase'); + assert.optionalString(options.cipher, 'options.cipher'); + cipher = options.cipher; + if (cipher === undefined) + cipher = 'aes128-ctr'; + cinf = utils.opensshCipherInfo(cipher); + kdf = 'bcrypt'; + } + } + var privBuf; if (PrivateKey.isPrivateKey(key)) { privBuf = new SSHBuffer({}); @@ -93,22 +170,68 @@ function write(key, options) { privBuf.writeString(key.comment || ''); var n = 1; - while (privBuf._offset % 8 !== 0) + while (privBuf._offset % cinf.blockSize !== 0) privBuf.writeChar(n++); + privBuf = privBuf.toBuffer(); + } + + switch (kdf) { + case 'none': + break; + case 'bcrypt': + var salt = crypto.randomBytes(16); + var rounds = 16; + var kdfssh = new SSHBuffer({}); + kdfssh.writeBuffer(salt); + kdfssh.writeInt(rounds); + kdfopts = kdfssh.toBuffer(); + + if (bcrypt === undefined) { + bcrypt = require('bcrypt-pbkdf'); + } + var pass = new Uint8Array(passphrase); + var salti = new Uint8Array(salt); + /* Use the pbkdf to derive both the key and the IV. */ + var out = new Uint8Array(cinf.keySize + cinf.blockSize); + var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, + out, out.length, rounds); + if (res !== 0) { + throw (new Error('bcrypt_pbkdf function returned ' + + 'failure, parameters invalid')); + } + out = new Buffer(out); + var ckey = out.slice(0, cinf.keySize); + var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); + + var cipherStream = crypto.createCipheriv(cinf.opensslName, + ckey, iv); + cipherStream.setAutoPadding(false); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + throw (e); + }); + cipherStream.write(privBuf); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + privBuf = Buffer.concat(chunks); + break; + default: + throw (new Error('Unsupported kdf ' + kdf)); } var buf = new SSHBuffer({}); buf.writeCString(MAGIC); - buf.writeString('none'); /* cipher */ - buf.writeString('none'); /* kdf */ - buf.writeBuffer(new Buffer(0)); /* kdfoptions */ + buf.writeString(cipher); /* cipher */ + buf.writeString(kdf); /* kdf */ + buf.writeBuffer(kdfopts); /* kdfoptions */ buf.writeInt(1); /* nkeys */ buf.writeBuffer(pubKey.toBuffer('rfc4253')); if (privBuf) - buf.writeBuffer(privBuf.toBuffer()); + buf.writeBuffer(privBuf); buf = buf.toBuffer(); diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/utils.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/utils.js index d57245cc16b41d..466634c00ecbd7 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/utils.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/lib/utils.js @@ -9,7 +9,8 @@ module.exports = { countZeros: countZeros, assertCompatible: assertCompatible, isCompatible: isCompatible, - opensslKeyDeriv: opensslKeyDeriv + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo }; var assert = require('assert-plus'); @@ -244,3 +245,44 @@ function addRSAMissing(key) { key.parts.push(key.part.dmodq); } } + +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/README.md b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/README.md new file mode 100644 index 00000000000000..12018090bb18f4 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/README.md @@ -0,0 +1,39 @@ +Port of the OpenBSD `bcrypt_pbkdf` function to pure Javascript. `npm`-ified +version of [Devi Mandiri's port] +(https://github.com/devi/tmp/blob/master/js/bcrypt_pbkdf.js), +with some minor performance improvements. The code is copied verbatim (and +un-styled) from Devi's work. + +This product includes software developed by Niels Provos. + +## API + +### `bcrypt_pbkdf.pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds)` + +Derive a cryptographic key of arbitrary length from a given password and salt, +using the OpenBSD `bcrypt_pbkdf` function. This is a combination of Blowfish and +SHA-512. + +See [this article](http://www.tedunangst.com/flak/post/bcrypt-pbkdf) for +further information. + +Parameters: + + * `pass`, a Uint8Array of length `passlen` + * `passlen`, an integer Number + * `salt`, a Uint8Array of length `saltlen` + * `saltlen`, an integer Number + * `key`, a Uint8Array of length `keylen`, will be filled with output + * `keylen`, an integer Number + * `rounds`, an integer Number, number of rounds of the PBKDF to run + +### `bcrypt_pbkdf.hash(sha2pass, sha2salt, out)` + +Calculate a Blowfish hash, given SHA2-512 output of a password and salt. Used as +part of the inner round function in the PBKDF. + +Parameters: + + * `sha2pass`, a Uint8Array of length 64 + * `sha2salt`, a Uint8Array of length 64 + * `out`, a Uint8Array of length 32, will be filled with output diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/index.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/index.js new file mode 100644 index 00000000000000..ea29aa967cbc8e --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/index.js @@ -0,0 +1,559 @@ +'use strict'; + +var crypto_hash_sha512 = require('tweetnacl').lowlevel.crypto_hash; + +/* + * This file is a 1:1 port from the OpenBSD blowfish.c and bcrypt_pbkdf.c. As a + * result, it retains the original copyright and license. The two files are + * under slightly different (but compatible) licenses, and are here combined in + * one file. + * + * Credit for the actual porting work goes to: + * Devi Mandiri + */ + +/* + * The Blowfish portions are under the following license: + * + * Blowfish block cipher for OpenBSD + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Implementation advice by David Mazieres . + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. All advertising materials mentioning features or use of this software + * must display the following acknowledgement: + * This product includes software developed by Niels Provos. + * 4. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * The bcrypt_pbkdf portions are under the following license: + * + * Copyright (c) 2013 Ted Unangst + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +/* + * Performance improvements (Javascript-specific): + * + * Copyright 2016, Joyent Inc + * Author: Alex Wilson + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +// Ported from OpenBSD bcrypt_pbkdf.c v1.9 + +var BLF_J = 0; + +var Blowfish = function() { + this.S = [ + new Uint32Array([ + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, + 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, + 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, + 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, + 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, + 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, + 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, + 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, + 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, + 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, + 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, + 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, + 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, + 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, + 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, + 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, + 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, + 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, + 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, + 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, + 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, + 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, + 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, + 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, + 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, + 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, + 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, + 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, + 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, + 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, + 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, + 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, + 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, + 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, + 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, + 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, + 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, + 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, + 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, + 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, + 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, + 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, + 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]), + new Uint32Array([ + 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, + 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, + 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, + 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, + 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, + 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, + 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, + 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, + 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, + 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, + 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, + 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, + 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, + 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, + 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, + 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, + 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, + 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, + 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, + 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, + 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, + 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, + 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, + 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, + 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, + 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, + 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, + 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, + 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, + 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, + 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, + 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, + 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, + 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, + 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, + 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, + 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, + 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, + 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, + 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, + 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, + 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, + 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]), + new Uint32Array([ + 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, + 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, + 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, + 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, + 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, + 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, + 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, + 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, + 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, + 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, + 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, + 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, + 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, + 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, + 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, + 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, + 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, + 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, + 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, + 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, + 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, + 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, + 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, + 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, + 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, + 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, + 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, + 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, + 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, + 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, + 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, + 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, + 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, + 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, + 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, + 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, + 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, + 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, + 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, + 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, + 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, + 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, + 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]), + new Uint32Array([ + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, + 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, + 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, + 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, + 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, + 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, + 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, + 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, + 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, + 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, + 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, + 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, + 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, + 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, + 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, + 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, + 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, + 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, + 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, + 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, + 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, + 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, + 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, + 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, + 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, + 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, + 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, + 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, + 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, + 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, + 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, + 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, + 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, + 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, + 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, + 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, + 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, + 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, + 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, + 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, + 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, + 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, + 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6]) + ]; + this.P = new Uint32Array([ + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, + 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, + 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, + 0x9216d5d9, 0x8979fb1b]); +}; + +function F(S, x8, i) { + return (((S[0][x8[i+3]] + + S[1][x8[i+2]]) ^ + S[2][x8[i+1]]) + + S[3][x8[i]]); +}; + +Blowfish.prototype.encipher = function(x, x8) { + if (x8 === undefined) { + x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + } + x[0] ^= this.P[0]; + for (var i = 1; i < 16; i += 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i+1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[17]; + x[1] = t; +}; + +Blowfish.prototype.decipher = function(x) { + var x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + x[0] ^= this.P[17]; + for (var i = 16; i > 0; i -= 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i-1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[0]; + x[1] = t; +}; + +function stream2word(data, databytes){ + var i, temp = 0; + for (i = 0; i < 4; i++, BLF_J++) { + if (BLF_J >= databytes) BLF_J = 0; + temp = (temp << 8) | data[BLF_J]; + } + return temp; +}; + +Blowfish.prototype.expand0state = function(key, keybytes) { + var d = new Uint32Array(2), i, k; + var d8 = new Uint8Array(d.buffer); + + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } + BLF_J = 0; + + for (i = 0; i < 18; i += 2) { + this.encipher(d, d8); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + this.encipher(d, d8); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } +}; + +Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) { + var d = new Uint32Array(2), i, k; + + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } + + for (i = 0, BLF_J = 0; i < 18; i += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } + BLF_J = 0; +}; + +Blowfish.prototype.enc = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.encipher(data.subarray(i*2)); + } +}; + +Blowfish.prototype.dec = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.decipher(data.subarray(i*2)); + } +}; + +var BCRYPT_BLOCKS = 8, + BCRYPT_HASHSIZE = 32; + +function bcrypt_hash(sha2pass, sha2salt, out) { + var state = new Blowfish(), + cdata = new Uint32Array(BCRYPT_BLOCKS), i, + ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105, + 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109, + 105,116,101]); //"OxychromaticBlowfishSwatDynamite" + + state.expandstate(sha2salt, 64, sha2pass, 64); + for (i = 0; i < 64; i++) { + state.expand0state(sha2salt, 64); + state.expand0state(sha2pass, 64); + } + + for (i = 0; i < BCRYPT_BLOCKS; i++) + cdata[i] = stream2word(ciphertext, ciphertext.byteLength); + for (i = 0; i < 64; i++) + state.enc(cdata, cdata.byteLength / 8); + + for (i = 0; i < BCRYPT_BLOCKS; i++) { + out[4*i+3] = cdata[i] >>> 24; + out[4*i+2] = cdata[i] >>> 16; + out[4*i+1] = cdata[i] >>> 8; + out[4*i+0] = cdata[i]; + } +}; + +function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) { + var sha2pass = new Uint8Array(64), + sha2salt = new Uint8Array(64), + out = new Uint8Array(BCRYPT_HASHSIZE), + tmpout = new Uint8Array(BCRYPT_HASHSIZE), + countsalt = new Uint8Array(saltlen+4), + i, j, amt, stride, dest, count, + origkeylen = keylen; + + if (rounds < 1) + return -1; + if (passlen === 0 || saltlen === 0 || keylen === 0 || + keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20)) + return -1; + + stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength); + amt = Math.floor((keylen + stride - 1) / stride); + + for (i = 0; i < saltlen; i++) + countsalt[i] = salt[i]; + + crypto_hash_sha512(sha2pass, pass, passlen); + + for (count = 1; keylen > 0; count++) { + countsalt[saltlen+0] = count >>> 24; + countsalt[saltlen+1] = count >>> 16; + countsalt[saltlen+2] = count >>> 8; + countsalt[saltlen+3] = count; + + crypto_hash_sha512(sha2salt, countsalt, saltlen + 4); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (i = out.byteLength; i--;) + out[i] = tmpout[i]; + + for (i = 1; i < rounds; i++) { + crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (j = 0; j < out.byteLength; j++) + out[j] ^= tmpout[j]; + } + + amt = Math.min(amt, keylen); + for (i = 0; i < amt; i++) { + dest = i * stride + (count - 1); + if (dest >= origkeylen) + break; + key[dest] = out[i]; + } + keylen -= i; + } + + return 0; +}; + +module.exports = { + BLOCKS: BCRYPT_BLOCKS, + HASHSIZE: BCRYPT_HASHSIZE, + hash: bcrypt_hash, + pbkdf: bcrypt_pbkdf +}; diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/package.json new file mode 100644 index 00000000000000..fc8efaac7c49c3 --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/bcrypt-pbkdf/package.json @@ -0,0 +1,72 @@ +{ + "_args": [ + [ + { + "raw": "bcrypt-pbkdf@^1.0.0", + "scope": null, + "escapedName": "bcrypt-pbkdf", + "name": "bcrypt-pbkdf", + "rawSpec": "^1.0.0", + "spec": ">=1.0.0 <2.0.0", + "type": "range" + }, + "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk" + ] + ], + "_from": "bcrypt-pbkdf@>=1.0.0 <2.0.0", + "_id": "bcrypt-pbkdf@1.0.0", + "_inCache": true, + "_location": "/request/http-signature/sshpk/bcrypt-pbkdf", + "_nodeVersion": "0.12.15", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/bcrypt-pbkdf-1.0.0.tgz_1471381825814_0.06877309852279723" + }, + "_npmUser": { + "name": "arekinath", + "email": "alex@cooperi.net" + }, + "_npmVersion": "3.10.3", + "_phantomChildren": {}, + "_requested": { + "raw": "bcrypt-pbkdf@^1.0.0", + "scope": null, + "escapedName": "bcrypt-pbkdf", + "name": "bcrypt-pbkdf", + "rawSpec": "^1.0.0", + "spec": ">=1.0.0 <2.0.0", + "type": "range" + }, + "_requiredBy": [ + "/request/http-signature/sshpk" + ], + "_resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.0.tgz", + "_shasum": "3ca76b85241c7170bf7d9703e7b9aa74630040d4", + "_shrinkwrap": null, + "_spec": "bcrypt-pbkdf@^1.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk", + "dependencies": { + "tweetnacl": "^0.14.3" + }, + "description": "Port of the OpenBSD bcrypt_pbkdf function to pure JS", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "3ca76b85241c7170bf7d9703e7b9aa74630040d4", + "tarball": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.0.tgz" + }, + "gitHead": "e88be37d3cd25395b4aa496ac468b33671368be6", + "license": "BSD-4-Clause", + "main": "index.js", + "maintainers": [ + { + "name": "arekinath", + "email": "alex@cooperi.net" + } + ], + "name": "bcrypt-pbkdf", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "scripts": {}, + "version": "1.0.0" +} diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/CHANGELOG.md b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/CHANGELOG.md index 77c69bd5ee45be..9debcb42f2e992 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/CHANGELOG.md +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/CHANGELOG.md @@ -2,6 +2,59 @@ TweetNaCl.js Changelog ====================== +v0.14.1 +------- + +No code changes, just tweaked packaging and added COPYING.txt. + + +v0.14.0 +------- + +* **Breaking change!** All functions from `nacl.util` have been removed. These + functions are no longer available: + + nacl.util.decodeUTF8 + nacl.util.encodeUTF8 + nacl.util.decodeBase64 + nacl.util.encodeBase64 + + If want to continue using them, you can include + package: + + + + + or + + var nacl = require('tweetnacl'); + nacl.util = require('tweetnacl-util'); + + However it is recommended to use better packages that have wider + compatibility and better performance. Functions from `nacl.util` were never + intended to be robust solution for string conversion and were included for + convenience: cryptography library is not the right place for them. + + Currently calling these functions will throw error pointing to + `tweetnacl-util-js` (in the next version this error message will be removed). + +* Improved detection of available random number generators, making it possible + to use `nacl.randomBytes` and related functions in Web Workers without + changes. + +* Changes to testing (see README). + + +v0.13.3 +------- + +No code changes. + +* Reverted license field in package.json to "Public domain". + +* Fixed typo in README. + + v0.13.2 ------- diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/COPYING.txt b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/COPYING.txt new file mode 100644 index 00000000000000..c2bd1e5b7e81ab --- /dev/null +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/COPYING.txt @@ -0,0 +1,9 @@ +Public Domain + +The person who associated a work with this deed has dedicated the work to the +public domain by waiving all of his or her rights to the work worldwide under +copyright law, including all related and neighboring rights, to the extent +allowed by law. + +You can copy, modify, distribute and perform the work, even for commercial +purposes, all without asking permission. diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/README.md b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/README.md index 11bd3472c258d1..c80bbed8d8da15 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/README.md +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/README.md @@ -7,7 +7,7 @@ to JavaScript for modern browsers and Node.js. Public domain. [![Build Status](https://travis-ci.org/dchest/tweetnacl-js.svg?branch=master) ](https://travis-ci.org/dchest/tweetnacl-js) -[Demo](https://dchest.github.io/tweetnacl-js/) +Demo: **:warning: Beta version. The library is stable and API is frozen, however it has not been independently reviewed. If you can help reviewing it, please @@ -26,8 +26,6 @@ Documentation * [Hashing](#hashing) * [Random bytes generation](#random-bytes-generation) * [Constant-time comparison](#constant-time-comparison) - * [Utilities](#utilities) -* [Examples](#examples) * [System requirements](#system-requirements) * [Development and testing](#development-and-testing) * [Contributors](#contributors) @@ -67,10 +65,20 @@ or [download source code](https://github.com/dchest/tweetnacl-js/releases). Usage ------- +----- All API functions accept and return bytes as `Uint8Array`s. If you need to -encode or decode strings, use functions from `nacl.util` namespace. +encode or decode strings, use functions from + or one of the more robust codec +packages. + +In Node.js v4 and later `Buffer` objects are backed by `Uint8Array`s, so you +can freely pass them to TweetNaCl.js functions as arguments. The returned +objects are still `Uint8Array`s, so if you need `Buffer`s, you'll have to +convert them manually; make sure to convert using copying: `new Buffer(array)`, +instead of sharing: `new Buffer(array.buffer)`, because some functions return +subarrays of their buffers. + ### Public-key authenticated encryption (box) @@ -287,12 +295,6 @@ depending on the platform it runs on: * `window.msCrypto.getRandomValues` (Internet Explorer 11) * `crypto.randomBytes` (Node.js) -Note that browsers are required to throw `QuotaExceededError` exception if -requested `length` is more than 65536, so do not ask for more than 65536 bytes -in *one call* (multiple calls to get as many bytes as you like are okay: -browsers can generate infinite amount of random bytes without any bad -consequences). - If the platform doesn't provide a suitable PRNG, the following functions, which require random numbers, will throw exception: @@ -326,30 +328,6 @@ Returns `false` if either of the arguments has zero length, or arguments have different lengths, or their contents differ. -### Utilities - -Encoding/decoding functions are provided for convenience. They are correct, -however their performance and wide compatibility with uncommon runtimes is not -something that is considered important compared to the simplicity and size of -implementation. You can use third-party libraries if you need to. - -#### nacl.util.decodeUTF8(string) - -Decodes string and returns `Uint8Array` of bytes. - -#### nacl.util.encodeUTF8(array) - -Encodes `Uint8Array` or `Array` of bytes into string. - -#### nacl.util.decodeBase64(string) - -Decodes Base-64 encoded string and returns `Uint8Array` of bytes. - -#### nacl.util.encodeBase64(array) - -Encodes `Uint8Array` or `Array` of bytes into string using Base-64 encoding. - - System requirements ------------------- @@ -364,7 +342,7 @@ of: Other systems: -* Node.js (we test on 0.10 and later) +* Node.js Development and testing @@ -385,32 +363,36 @@ Tests use minified version, so make sure to rebuild it every time you change To run tests in Node.js: - $ npm test + $ npm run test-node By default all tests described here work on `nacl.min.js`. To test other versions, set environment variable `NACL_SRC` to the file name you want to test. For example, the following command will test fast minified version: - $ NACL_SRC=nacl-fast.min.js npm test + $ NACL_SRC=nacl-fast.min.js npm run test-node To run full suite of tests in Node.js, including comparing outputs of JavaScript port to outputs of the original C version: - $ npm run testall + $ npm run test-node-all To prepare tests for browsers: - $ npm run browser + $ npm run build-test-browser and then open `test/browser/test.html` (or `test/browser/test-fast.html`) to run them. -To run headless browser tests with `testling`: +To run headless browser tests with `tape-run` (powered by Electron): - $ npm run testling + $ npm run test-browser (If you get `Error: spawn ENOENT`, install *xvfb*: `sudo apt-get install xvfb`.) +To run tests in both Node and Electron: + + $ npm test + ### Benchmarking To run benchmarks in Node.js: diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.js index 6c4995848cc42c..5e4562fe89a1ab 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.js @@ -745,7 +745,7 @@ poly1305.prototype.finish = function(mac, macpos) { } g[9] -= (1 << 13); - mask = (g[9] >>> ((2 * 8) - 1)) - 1; + mask = (c ^ 1) - 1; for (i = 0; i < 10; i++) g[i] &= mask; mask = ~mask; for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; @@ -2157,39 +2157,13 @@ function cleanup(arr) { for (var i = 0; i < arr.length; i++) arr[i] = 0; } -nacl.util = {}; - -nacl.util.decodeUTF8 = function(s) { - var i, d = unescape(encodeURIComponent(s)), b = new Uint8Array(d.length); - for (i = 0; i < d.length; i++) b[i] = d.charCodeAt(i); - return b; -}; - -nacl.util.encodeUTF8 = function(arr) { - var i, s = []; - for (i = 0; i < arr.length; i++) s.push(String.fromCharCode(arr[i])); - return decodeURIComponent(escape(s.join(''))); -}; - -nacl.util.encodeBase64 = function(arr) { - if (typeof btoa === 'undefined') { - return (new Buffer(arr)).toString('base64'); - } else { - var i, s = [], len = arr.length; - for (i = 0; i < len; i++) s.push(String.fromCharCode(arr[i])); - return btoa(s.join('')); - } -}; - -nacl.util.decodeBase64 = function(s) { - if (typeof atob === 'undefined') { - return new Uint8Array(Array.prototype.slice.call(new Buffer(s, 'base64'), 0)); - } else { - var i, d = atob(s), b = new Uint8Array(d.length); - for (i = 0; i < d.length; i++) b[i] = d.charCodeAt(i); - return b; - } -}; +// TODO: Completely remove this in v0.15. +if (!nacl.util) { + nacl.util = {}; + nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { + throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); + }; +} nacl.randomBytes = function(n) { var b = new Uint8Array(n); @@ -2386,26 +2360,22 @@ nacl.setPRNG = function(fn) { (function() { // Initialize PRNG if environment provides CSPRNG. // If not, methods calling randombytes will throw. - var crypto; - if (typeof window !== 'undefined') { - // Browser. - if (window.crypto && window.crypto.getRandomValues) { - crypto = window.crypto; // Standard - } else if (window.msCrypto && window.msCrypto.getRandomValues) { - crypto = window.msCrypto; // Internet Explorer 11+ - } - if (crypto) { - nacl.setPRNG(function(x, n) { - var i, v = new Uint8Array(n); - crypto.getRandomValues(v); - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } + var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; + if (crypto && crypto.getRandomValues) { + // Browsers. + var QUOTA = 65536; + nacl.setPRNG(function(x, n) { + var i, v = new Uint8Array(n); + for (i = 0; i < n; i += QUOTA) { + crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); + } + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); } else if (typeof require !== 'undefined') { // Node.js. crypto = require('crypto'); - if (crypto) { + if (crypto && crypto.randomBytes) { nacl.setPRNG(function(x, n) { var i, v = crypto.randomBytes(n); for (i = 0; i < n; i++) x[i] = v[i]; @@ -2415,4 +2385,4 @@ nacl.setPRNG = function(fn) { } })(); -})(typeof module !== 'undefined' && module.exports ? module.exports : (window.nacl = window.nacl || {})); +})(typeof module !== 'undefined' && module.exports ? module.exports : (self.nacl = self.nacl || {})); diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.min.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.min.js index 7072c2af4435bd..624fbbe91e71fc 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.min.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl-fast.min.js @@ -1,2 +1,2 @@ -!function(r){"use strict";function t(r,t,n,e){r[t]=n>>24&255,r[t+1]=n>>16&255,r[t+2]=n>>8&255,r[t+3]=255&n,r[t+4]=e>>24&255,r[t+5]=e>>16&255,r[t+6]=e>>8&255,r[t+7]=255&e}function n(r,t,n,e,o){var i,h=0;for(i=0;o>i;i++)h|=r[t+i]^n[e+i];return(1&h-1>>>8)-1}function e(r,t,e,o){return n(r,t,e,o,16)}function o(r,t,e,o){return n(r,t,e,o,32)}function i(r,t,n,e){for(var o,i=255&e[0]|(255&e[1])<<8|(255&e[2])<<16|(255&e[3])<<24,h=255&n[0]|(255&n[1])<<8|(255&n[2])<<16|(255&n[3])<<24,a=255&n[4]|(255&n[5])<<8|(255&n[6])<<16|(255&n[7])<<24,f=255&n[8]|(255&n[9])<<8|(255&n[10])<<16|(255&n[11])<<24,s=255&n[12]|(255&n[13])<<8|(255&n[14])<<16|(255&n[15])<<24,u=255&e[4]|(255&e[5])<<8|(255&e[6])<<16|(255&e[7])<<24,c=255&t[0]|(255&t[1])<<8|(255&t[2])<<16|(255&t[3])<<24,y=255&t[4]|(255&t[5])<<8|(255&t[6])<<16|(255&t[7])<<24,l=255&t[8]|(255&t[9])<<8|(255&t[10])<<16|(255&t[11])<<24,w=255&t[12]|(255&t[13])<<8|(255&t[14])<<16|(255&t[15])<<24,p=255&e[8]|(255&e[9])<<8|(255&e[10])<<16|(255&e[11])<<24,g=255&n[16]|(255&n[17])<<8|(255&n[18])<<16|(255&n[19])<<24,v=255&n[20]|(255&n[21])<<8|(255&n[22])<<16|(255&n[23])<<24,b=255&n[24]|(255&n[25])<<8|(255&n[26])<<16|(255&n[27])<<24,d=255&n[28]|(255&n[29])<<8|(255&n[30])<<16|(255&n[31])<<24,A=255&e[12]|(255&e[13])<<8|(255&e[14])<<16|(255&e[15])<<24,_=i,U=h,E=a,x=f,M=s,m=u,B=c,S=y,K=l,T=w,Y=p,k=g,L=v,C=b,R=d,z=A,P=0;20>P;P+=2)o=_+L|0,M^=o<<7|o>>>25,o=M+_|0,K^=o<<9|o>>>23,o=K+M|0,L^=o<<13|o>>>19,o=L+K|0,_^=o<<18|o>>>14,o=m+U|0,T^=o<<7|o>>>25,o=T+m|0,C^=o<<9|o>>>23,o=C+T|0,U^=o<<13|o>>>19,o=U+C|0,m^=o<<18|o>>>14,o=Y+B|0,R^=o<<7|o>>>25,o=R+Y|0,E^=o<<9|o>>>23,o=E+R|0,B^=o<<13|o>>>19,o=B+E|0,Y^=o<<18|o>>>14,o=z+k|0,x^=o<<7|o>>>25,o=x+z|0,S^=o<<9|o>>>23,o=S+x|0,k^=o<<13|o>>>19,o=k+S|0,z^=o<<18|o>>>14,o=_+x|0,U^=o<<7|o>>>25,o=U+_|0,E^=o<<9|o>>>23,o=E+U|0,x^=o<<13|o>>>19,o=x+E|0,_^=o<<18|o>>>14,o=m+M|0,B^=o<<7|o>>>25,o=B+m|0,S^=o<<9|o>>>23,o=S+B|0,M^=o<<13|o>>>19,o=M+S|0,m^=o<<18|o>>>14,o=Y+T|0,k^=o<<7|o>>>25,o=k+Y|0,K^=o<<9|o>>>23,o=K+k|0,T^=o<<13|o>>>19,o=T+K|0,Y^=o<<18|o>>>14,o=z+R|0,L^=o<<7|o>>>25,o=L+z|0,C^=o<<9|o>>>23,o=C+L|0,R^=o<<13|o>>>19,o=R+C|0,z^=o<<18|o>>>14;_=_+i|0,U=U+h|0,E=E+a|0,x=x+f|0,M=M+s|0,m=m+u|0,B=B+c|0,S=S+y|0,K=K+l|0,T=T+w|0,Y=Y+p|0,k=k+g|0,L=L+v|0,C=C+b|0,R=R+d|0,z=z+A|0,r[0]=_>>>0&255,r[1]=_>>>8&255,r[2]=_>>>16&255,r[3]=_>>>24&255,r[4]=U>>>0&255,r[5]=U>>>8&255,r[6]=U>>>16&255,r[7]=U>>>24&255,r[8]=E>>>0&255,r[9]=E>>>8&255,r[10]=E>>>16&255,r[11]=E>>>24&255,r[12]=x>>>0&255,r[13]=x>>>8&255,r[14]=x>>>16&255,r[15]=x>>>24&255,r[16]=M>>>0&255,r[17]=M>>>8&255,r[18]=M>>>16&255,r[19]=M>>>24&255,r[20]=m>>>0&255,r[21]=m>>>8&255,r[22]=m>>>16&255,r[23]=m>>>24&255,r[24]=B>>>0&255,r[25]=B>>>8&255,r[26]=B>>>16&255,r[27]=B>>>24&255,r[28]=S>>>0&255,r[29]=S>>>8&255,r[30]=S>>>16&255,r[31]=S>>>24&255,r[32]=K>>>0&255,r[33]=K>>>8&255,r[34]=K>>>16&255,r[35]=K>>>24&255,r[36]=T>>>0&255,r[37]=T>>>8&255,r[38]=T>>>16&255,r[39]=T>>>24&255,r[40]=Y>>>0&255,r[41]=Y>>>8&255,r[42]=Y>>>16&255,r[43]=Y>>>24&255,r[44]=k>>>0&255,r[45]=k>>>8&255,r[46]=k>>>16&255,r[47]=k>>>24&255,r[48]=L>>>0&255,r[49]=L>>>8&255,r[50]=L>>>16&255,r[51]=L>>>24&255,r[52]=C>>>0&255,r[53]=C>>>8&255,r[54]=C>>>16&255,r[55]=C>>>24&255,r[56]=R>>>0&255,r[57]=R>>>8&255,r[58]=R>>>16&255,r[59]=R>>>24&255,r[60]=z>>>0&255,r[61]=z>>>8&255,r[62]=z>>>16&255,r[63]=z>>>24&255}function h(r,t,n,e){for(var o,i=255&e[0]|(255&e[1])<<8|(255&e[2])<<16|(255&e[3])<<24,h=255&n[0]|(255&n[1])<<8|(255&n[2])<<16|(255&n[3])<<24,a=255&n[4]|(255&n[5])<<8|(255&n[6])<<16|(255&n[7])<<24,f=255&n[8]|(255&n[9])<<8|(255&n[10])<<16|(255&n[11])<<24,s=255&n[12]|(255&n[13])<<8|(255&n[14])<<16|(255&n[15])<<24,u=255&e[4]|(255&e[5])<<8|(255&e[6])<<16|(255&e[7])<<24,c=255&t[0]|(255&t[1])<<8|(255&t[2])<<16|(255&t[3])<<24,y=255&t[4]|(255&t[5])<<8|(255&t[6])<<16|(255&t[7])<<24,l=255&t[8]|(255&t[9])<<8|(255&t[10])<<16|(255&t[11])<<24,w=255&t[12]|(255&t[13])<<8|(255&t[14])<<16|(255&t[15])<<24,p=255&e[8]|(255&e[9])<<8|(255&e[10])<<16|(255&e[11])<<24,g=255&n[16]|(255&n[17])<<8|(255&n[18])<<16|(255&n[19])<<24,v=255&n[20]|(255&n[21])<<8|(255&n[22])<<16|(255&n[23])<<24,b=255&n[24]|(255&n[25])<<8|(255&n[26])<<16|(255&n[27])<<24,d=255&n[28]|(255&n[29])<<8|(255&n[30])<<16|(255&n[31])<<24,A=255&e[12]|(255&e[13])<<8|(255&e[14])<<16|(255&e[15])<<24,_=i,U=h,E=a,x=f,M=s,m=u,B=c,S=y,K=l,T=w,Y=p,k=g,L=v,C=b,R=d,z=A,P=0;20>P;P+=2)o=_+L|0,M^=o<<7|o>>>25,o=M+_|0,K^=o<<9|o>>>23,o=K+M|0,L^=o<<13|o>>>19,o=L+K|0,_^=o<<18|o>>>14,o=m+U|0,T^=o<<7|o>>>25,o=T+m|0,C^=o<<9|o>>>23,o=C+T|0,U^=o<<13|o>>>19,o=U+C|0,m^=o<<18|o>>>14,o=Y+B|0,R^=o<<7|o>>>25,o=R+Y|0,E^=o<<9|o>>>23,o=E+R|0,B^=o<<13|o>>>19,o=B+E|0,Y^=o<<18|o>>>14,o=z+k|0,x^=o<<7|o>>>25,o=x+z|0,S^=o<<9|o>>>23,o=S+x|0,k^=o<<13|o>>>19,o=k+S|0,z^=o<<18|o>>>14,o=_+x|0,U^=o<<7|o>>>25,o=U+_|0,E^=o<<9|o>>>23,o=E+U|0,x^=o<<13|o>>>19,o=x+E|0,_^=o<<18|o>>>14,o=m+M|0,B^=o<<7|o>>>25,o=B+m|0,S^=o<<9|o>>>23,o=S+B|0,M^=o<<13|o>>>19,o=M+S|0,m^=o<<18|o>>>14,o=Y+T|0,k^=o<<7|o>>>25,o=k+Y|0,K^=o<<9|o>>>23,o=K+k|0,T^=o<<13|o>>>19,o=T+K|0,Y^=o<<18|o>>>14,o=z+R|0,L^=o<<7|o>>>25,o=L+z|0,C^=o<<9|o>>>23,o=C+L|0,R^=o<<13|o>>>19,o=R+C|0,z^=o<<18|o>>>14;r[0]=_>>>0&255,r[1]=_>>>8&255,r[2]=_>>>16&255,r[3]=_>>>24&255,r[4]=m>>>0&255,r[5]=m>>>8&255,r[6]=m>>>16&255,r[7]=m>>>24&255,r[8]=Y>>>0&255,r[9]=Y>>>8&255,r[10]=Y>>>16&255,r[11]=Y>>>24&255,r[12]=z>>>0&255,r[13]=z>>>8&255,r[14]=z>>>16&255,r[15]=z>>>24&255,r[16]=B>>>0&255,r[17]=B>>>8&255,r[18]=B>>>16&255,r[19]=B>>>24&255,r[20]=S>>>0&255,r[21]=S>>>8&255,r[22]=S>>>16&255,r[23]=S>>>24&255,r[24]=K>>>0&255,r[25]=K>>>8&255,r[26]=K>>>16&255,r[27]=K>>>24&255,r[28]=T>>>0&255,r[29]=T>>>8&255,r[30]=T>>>16&255,r[31]=T>>>24&255}function a(r,t,n,e){i(r,t,n,e)}function f(r,t,n,e){h(r,t,n,e)}function s(r,t,n,e,o,i,h){var f,s,u=new Uint8Array(16),c=new Uint8Array(64);for(s=0;16>s;s++)u[s]=0;for(s=0;8>s;s++)u[s]=i[s];for(;o>=64;){for(a(c,u,h,cr),s=0;64>s;s++)r[t+s]=n[e+s]^c[s];for(f=1,s=8;16>s;s++)f=f+(255&u[s])|0,u[s]=255&f,f>>>=8;o-=64,t+=64,e+=64}if(o>0)for(a(c,u,h,cr),s=0;o>s;s++)r[t+s]=n[e+s]^c[s];return 0}function u(r,t,n,e,o){var i,h,f=new Uint8Array(16),s=new Uint8Array(64);for(h=0;16>h;h++)f[h]=0;for(h=0;8>h;h++)f[h]=e[h];for(;n>=64;){for(a(s,f,o,cr),h=0;64>h;h++)r[t+h]=s[h];for(i=1,h=8;16>h;h++)i=i+(255&f[h])|0,f[h]=255&i,i>>>=8;n-=64,t+=64}if(n>0)for(a(s,f,o,cr),h=0;n>h;h++)r[t+h]=s[h];return 0}function c(r,t,n,e,o){var i=new Uint8Array(32);f(i,e,o,cr);for(var h=new Uint8Array(8),a=0;8>a;a++)h[a]=e[a+16];return u(r,t,n,h,i)}function y(r,t,n,e,o,i,h){var a=new Uint8Array(32);f(a,i,h,cr);for(var u=new Uint8Array(8),c=0;8>c;c++)u[c]=i[c+16];return s(r,t,n,e,o,u,a)}function l(r,t,n,e,o,i){var h=new yr(i);return h.update(n,e,o),h.finish(r,t),0}function w(r,t,n,o,i,h){var a=new Uint8Array(16);return l(a,0,n,o,i,h),e(r,t,a,0)}function p(r,t,n,e,o){var i;if(32>n)return-1;for(y(r,0,t,0,n,e,o),l(r,16,r,32,n-32,r),i=0;16>i;i++)r[i]=0;return 0}function g(r,t,n,e,o){var i,h=new Uint8Array(32);if(32>n)return-1;if(c(h,0,32,e,o),0!==w(t,16,t,32,n-32,h))return-1;for(y(r,0,t,0,n,e,o),i=0;32>i;i++)r[i]=0;return 0}function v(r,t){var n;for(n=0;16>n;n++)r[n]=0|t[n]}function b(r){var t,n,e=1;for(t=0;16>t;t++)n=r[t]+e+65535,e=Math.floor(n/65536),r[t]=n-65536*e;r[0]+=e-1+37*(e-1)}function d(r,t,n){for(var e,o=~(n-1),i=0;16>i;i++)e=o&(r[i]^t[i]),r[i]^=e,t[i]^=e}function A(r,t){var n,e,o,i=$(),h=$();for(n=0;16>n;n++)h[n]=t[n];for(b(h),b(h),b(h),e=0;2>e;e++){for(i[0]=h[0]-65517,n=1;15>n;n++)i[n]=h[n]-65535-(i[n-1]>>16&1),i[n-1]&=65535;i[15]=h[15]-32767-(i[14]>>16&1),o=i[15]>>16&1,i[14]&=65535,d(h,i,1-o)}for(n=0;16>n;n++)r[2*n]=255&h[n],r[2*n+1]=h[n]>>8}function _(r,t){var n=new Uint8Array(32),e=new Uint8Array(32);return A(n,r),A(e,t),o(n,0,e,0)}function U(r){var t=new Uint8Array(32);return A(t,r),1&t[0]}function E(r,t){var n;for(n=0;16>n;n++)r[n]=t[2*n]+(t[2*n+1]<<8);r[15]&=32767}function x(r,t,n){for(var e=0;16>e;e++)r[e]=t[e]+n[e]}function M(r,t,n){for(var e=0;16>e;e++)r[e]=t[e]-n[e]}function m(r,t,n){var e,o,i=0,h=0,a=0,f=0,s=0,u=0,c=0,y=0,l=0,w=0,p=0,g=0,v=0,b=0,d=0,A=0,_=0,U=0,E=0,x=0,M=0,m=0,B=0,S=0,K=0,T=0,Y=0,k=0,L=0,C=0,R=0,z=n[0],P=n[1],O=n[2],N=n[3],F=n[4],I=n[5],j=n[6],G=n[7],Z=n[8],V=n[9],q=n[10],X=n[11],D=n[12],H=n[13],J=n[14],Q=n[15];e=t[0],i+=e*z,h+=e*P,a+=e*O,f+=e*N,s+=e*F,u+=e*I,c+=e*j,y+=e*G,l+=e*Z,w+=e*V,p+=e*q,g+=e*X,v+=e*D,b+=e*H,d+=e*J,A+=e*Q,e=t[1],h+=e*z,a+=e*P,f+=e*O,s+=e*N,u+=e*F,c+=e*I,y+=e*j,l+=e*G,w+=e*Z,p+=e*V,g+=e*q,v+=e*X,b+=e*D,d+=e*H,A+=e*J,_+=e*Q,e=t[2],a+=e*z,f+=e*P,s+=e*O,u+=e*N,c+=e*F,y+=e*I,l+=e*j,w+=e*G,p+=e*Z,g+=e*V,v+=e*q,b+=e*X,d+=e*D,A+=e*H,_+=e*J,U+=e*Q,e=t[3],f+=e*z,s+=e*P,u+=e*O,c+=e*N,y+=e*F,l+=e*I,w+=e*j,p+=e*G,g+=e*Z,v+=e*V,b+=e*q,d+=e*X,A+=e*D,_+=e*H,U+=e*J,E+=e*Q,e=t[4],s+=e*z,u+=e*P,c+=e*O,y+=e*N,l+=e*F,w+=e*I,p+=e*j,g+=e*G,v+=e*Z,b+=e*V,d+=e*q,A+=e*X,_+=e*D,U+=e*H,E+=e*J,x+=e*Q,e=t[5],u+=e*z,c+=e*P,y+=e*O,l+=e*N,w+=e*F,p+=e*I,g+=e*j,v+=e*G,b+=e*Z,d+=e*V,A+=e*q,_+=e*X,U+=e*D,E+=e*H,x+=e*J,M+=e*Q,e=t[6],c+=e*z,y+=e*P,l+=e*O,w+=e*N,p+=e*F,g+=e*I,v+=e*j,b+=e*G,d+=e*Z,A+=e*V,_+=e*q,U+=e*X,E+=e*D,x+=e*H,M+=e*J,m+=e*Q,e=t[7],y+=e*z,l+=e*P,w+=e*O,p+=e*N,g+=e*F,v+=e*I,b+=e*j,d+=e*G,A+=e*Z,_+=e*V,U+=e*q,E+=e*X,x+=e*D,M+=e*H,m+=e*J,B+=e*Q,e=t[8],l+=e*z,w+=e*P,p+=e*O,g+=e*N,v+=e*F,b+=e*I,d+=e*j,A+=e*G,_+=e*Z,U+=e*V,E+=e*q,x+=e*X,M+=e*D,m+=e*H,B+=e*J,S+=e*Q,e=t[9],w+=e*z,p+=e*P,g+=e*O,v+=e*N,b+=e*F,d+=e*I,A+=e*j,_+=e*G,U+=e*Z,E+=e*V,x+=e*q,M+=e*X,m+=e*D,B+=e*H,S+=e*J,K+=e*Q,e=t[10],p+=e*z,g+=e*P,v+=e*O,b+=e*N,d+=e*F,A+=e*I,_+=e*j,U+=e*G,E+=e*Z,x+=e*V,M+=e*q,m+=e*X,B+=e*D,S+=e*H,K+=e*J,T+=e*Q,e=t[11],g+=e*z,v+=e*P,b+=e*O,d+=e*N,A+=e*F,_+=e*I,U+=e*j,E+=e*G,x+=e*Z,M+=e*V,m+=e*q,B+=e*X,S+=e*D,K+=e*H,T+=e*J,Y+=e*Q,e=t[12],v+=e*z,b+=e*P,d+=e*O,A+=e*N,_+=e*F,U+=e*I,E+=e*j,x+=e*G,M+=e*Z,m+=e*V,B+=e*q,S+=e*X,K+=e*D,T+=e*H,Y+=e*J,k+=e*Q,e=t[13],b+=e*z,d+=e*P,A+=e*O,_+=e*N,U+=e*F,E+=e*I,x+=e*j,M+=e*G,m+=e*Z,B+=e*V,S+=e*q,K+=e*X,T+=e*D,Y+=e*H,k+=e*J,L+=e*Q,e=t[14],d+=e*z,A+=e*P,_+=e*O,U+=e*N,E+=e*F,x+=e*I,M+=e*j,m+=e*G,B+=e*Z,S+=e*V,K+=e*q,T+=e*X,Y+=e*D,k+=e*H,L+=e*J,C+=e*Q,e=t[15],A+=e*z,_+=e*P,U+=e*O,E+=e*N,x+=e*F,M+=e*I,m+=e*j,B+=e*G,S+=e*Z,K+=e*V,T+=e*q,Y+=e*X,k+=e*D,L+=e*H,C+=e*J,R+=e*Q,i+=38*_,h+=38*U,a+=38*E,f+=38*x,s+=38*M,u+=38*m,c+=38*B,y+=38*S,l+=38*K,w+=38*T,p+=38*Y,g+=38*k,v+=38*L,b+=38*C,d+=38*R,o=1,e=i+o+65535,o=Math.floor(e/65536),i=e-65536*o,e=h+o+65535,o=Math.floor(e/65536),h=e-65536*o,e=a+o+65535,o=Math.floor(e/65536),a=e-65536*o,e=f+o+65535,o=Math.floor(e/65536),f=e-65536*o,e=s+o+65535,o=Math.floor(e/65536),s=e-65536*o,e=u+o+65535,o=Math.floor(e/65536),u=e-65536*o,e=c+o+65535,o=Math.floor(e/65536),c=e-65536*o,e=y+o+65535,o=Math.floor(e/65536),y=e-65536*o,e=l+o+65535,o=Math.floor(e/65536),l=e-65536*o,e=w+o+65535,o=Math.floor(e/65536),w=e-65536*o,e=p+o+65535,o=Math.floor(e/65536),p=e-65536*o,e=g+o+65535,o=Math.floor(e/65536),g=e-65536*o,e=v+o+65535,o=Math.floor(e/65536),v=e-65536*o,e=b+o+65535,o=Math.floor(e/65536),b=e-65536*o,e=d+o+65535,o=Math.floor(e/65536),d=e-65536*o,e=A+o+65535,o=Math.floor(e/65536),A=e-65536*o,i+=o-1+37*(o-1),o=1,e=i+o+65535,o=Math.floor(e/65536),i=e-65536*o,e=h+o+65535,o=Math.floor(e/65536),h=e-65536*o,e=a+o+65535,o=Math.floor(e/65536),a=e-65536*o,e=f+o+65535,o=Math.floor(e/65536),f=e-65536*o,e=s+o+65535,o=Math.floor(e/65536),s=e-65536*o,e=u+o+65535,o=Math.floor(e/65536),u=e-65536*o,e=c+o+65535,o=Math.floor(e/65536),c=e-65536*o,e=y+o+65535,o=Math.floor(e/65536),y=e-65536*o,e=l+o+65535,o=Math.floor(e/65536),l=e-65536*o,e=w+o+65535,o=Math.floor(e/65536),w=e-65536*o,e=p+o+65535,o=Math.floor(e/65536),p=e-65536*o,e=g+o+65535,o=Math.floor(e/65536),g=e-65536*o,e=v+o+65535,o=Math.floor(e/65536),v=e-65536*o,e=b+o+65535,o=Math.floor(e/65536),b=e-65536*o,e=d+o+65535,o=Math.floor(e/65536),d=e-65536*o,e=A+o+65535,o=Math.floor(e/65536),A=e-65536*o,i+=o-1+37*(o-1),r[0]=i,r[1]=h,r[2]=a,r[3]=f,r[4]=s,r[5]=u,r[6]=c,r[7]=y,r[8]=l,r[9]=w,r[10]=p,r[11]=g,r[12]=v,r[13]=b,r[14]=d,r[15]=A}function B(r,t){m(r,t,t)}function S(r,t){var n,e=$();for(n=0;16>n;n++)e[n]=t[n];for(n=253;n>=0;n--)B(e,e),2!==n&&4!==n&&m(e,e,t);for(n=0;16>n;n++)r[n]=e[n]}function K(r,t){var n,e=$();for(n=0;16>n;n++)e[n]=t[n];for(n=250;n>=0;n--)B(e,e),1!==n&&m(e,e,t);for(n=0;16>n;n++)r[n]=e[n]}function T(r,t,n){var e,o,i=new Uint8Array(32),h=new Float64Array(80),a=$(),f=$(),s=$(),u=$(),c=$(),y=$();for(o=0;31>o;o++)i[o]=t[o];for(i[31]=127&t[31]|64,i[0]&=248,E(h,n),o=0;16>o;o++)f[o]=h[o],u[o]=a[o]=s[o]=0;for(a[0]=u[0]=1,o=254;o>=0;--o)e=i[o>>>3]>>>(7&o)&1,d(a,f,e),d(s,u,e),x(c,a,s),M(a,a,s),x(s,f,u),M(f,f,u),B(u,c),B(y,a),m(a,s,a),m(s,f,c),x(c,a,s),M(a,a,s),B(f,a),M(s,u,y),m(a,s,ir),x(a,a,u),m(s,s,a),m(a,u,y),m(u,f,h),B(f,c),d(a,f,e),d(s,u,e);for(o=0;16>o;o++)h[o+16]=a[o],h[o+32]=s[o],h[o+48]=f[o],h[o+64]=u[o];var l=h.subarray(32),w=h.subarray(16);return S(l,l),m(w,w,l),A(r,w),0}function Y(r,t){return T(r,t,nr)}function k(r,t){return rr(t,32),Y(r,t)}function L(r,t,n){var e=new Uint8Array(32);return T(e,n,t),f(r,tr,e,cr)}function C(r,t,n,e,o,i){var h=new Uint8Array(32);return L(h,o,i),lr(r,t,n,e,h)}function R(r,t,n,e,o,i){var h=new Uint8Array(32);return L(h,o,i),wr(r,t,n,e,h)}function z(r,t,n,e){for(var o,i,h,a,f,s,u,c,y,l,w,p,g,v,b,d,A,_,U,E,x,M,m,B,S,K,T=new Int32Array(16),Y=new Int32Array(16),k=r[0],L=r[1],C=r[2],R=r[3],z=r[4],P=r[5],O=r[6],N=r[7],F=t[0],I=t[1],j=t[2],G=t[3],Z=t[4],V=t[5],q=t[6],X=t[7],D=0;e>=128;){for(U=0;16>U;U++)E=8*U+D,T[U]=n[E+0]<<24|n[E+1]<<16|n[E+2]<<8|n[E+3],Y[U]=n[E+4]<<24|n[E+5]<<16|n[E+6]<<8|n[E+7];for(U=0;80>U;U++)if(o=k,i=L,h=C,a=R,f=z,s=P,u=O,c=N,y=F,l=I,w=j,p=G,g=Z,v=V,b=q,d=X,x=N,M=X,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=(z>>>14|Z<<18)^(z>>>18|Z<<14)^(Z>>>9|z<<23),M=(Z>>>14|z<<18)^(Z>>>18|z<<14)^(z>>>9|Z<<23),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=z&P^~z&O,M=Z&V^~Z&q,m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=pr[2*U],M=pr[2*U+1],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=T[U%16],M=Y[U%16],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,A=65535&S|K<<16,_=65535&m|B<<16,x=A,M=_,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=(k>>>28|F<<4)^(F>>>2|k<<30)^(F>>>7|k<<25),M=(F>>>28|k<<4)^(k>>>2|F<<30)^(k>>>7|F<<25),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=k&L^k&C^L&C,M=F&I^F&j^I&j,m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,c=65535&S|K<<16,d=65535&m|B<<16,x=a,M=p,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=A,M=_,m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,a=65535&S|K<<16,p=65535&m|B<<16,L=o,C=i,R=h,z=a,P=f,O=s,N=u,k=c,I=y,j=l,G=w,Z=p,V=g,q=v,X=b,F=d,U%16===15)for(E=0;16>E;E++)x=T[E],M=Y[E],m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=T[(E+9)%16],M=Y[(E+9)%16],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,A=T[(E+1)%16],_=Y[(E+1)%16],x=(A>>>1|_<<31)^(A>>>8|_<<24)^A>>>7,M=(_>>>1|A<<31)^(_>>>8|A<<24)^(_>>>7|A<<25),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,A=T[(E+14)%16],_=Y[(E+14)%16],x=(A>>>19|_<<13)^(_>>>29|A<<3)^A>>>6,M=(_>>>19|A<<13)^(A>>>29|_<<3)^(_>>>6|A<<26),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,T[E]=65535&S|K<<16,Y[E]=65535&m|B<<16;x=k,M=F,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[0],M=t[0],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[0]=k=65535&S|K<<16,t[0]=F=65535&m|B<<16,x=L,M=I,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[1],M=t[1],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[1]=L=65535&S|K<<16,t[1]=I=65535&m|B<<16,x=C,M=j,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[2],M=t[2],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[2]=C=65535&S|K<<16,t[2]=j=65535&m|B<<16,x=R,M=G,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[3],M=t[3],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[3]=R=65535&S|K<<16,t[3]=G=65535&m|B<<16,x=z,M=Z,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[4],M=t[4],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[4]=z=65535&S|K<<16,t[4]=Z=65535&m|B<<16,x=P,M=V,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[5],M=t[5],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[5]=P=65535&S|K<<16,t[5]=V=65535&m|B<<16,x=O,M=q,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[6],M=t[6],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[6]=O=65535&S|K<<16,t[6]=q=65535&m|B<<16,x=N,M=X,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[7],M=t[7],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[7]=N=65535&S|K<<16,t[7]=X=65535&m|B<<16,D+=128,e-=128}return e}function P(r,n,e){var o,i=new Int32Array(8),h=new Int32Array(8),a=new Uint8Array(256),f=e;for(i[0]=1779033703,i[1]=3144134277,i[2]=1013904242,i[3]=2773480762,i[4]=1359893119,i[5]=2600822924,i[6]=528734635,i[7]=1541459225,h[0]=4089235720,h[1]=2227873595,h[2]=4271175723,h[3]=1595750129,h[4]=2917565137,h[5]=725511199,h[6]=4215389547,h[7]=327033209,z(i,h,n,e),e%=128,o=0;e>o;o++)a[o]=n[f-e+o];for(a[e]=128,e=256-128*(112>e?1:0),a[e-9]=0,t(a,e-8,f/536870912|0,f<<3),z(i,h,a,e),o=0;8>o;o++)t(r,8*o,i[o],h[o]);return 0}function O(r,t){var n=$(),e=$(),o=$(),i=$(),h=$(),a=$(),f=$(),s=$(),u=$();M(n,r[1],r[0]),M(u,t[1],t[0]),m(n,n,u),x(e,r[0],r[1]),x(u,t[0],t[1]),m(e,e,u),m(o,r[3],t[3]),m(o,o,ar),m(i,r[2],t[2]),x(i,i,i),M(h,e,n),M(a,i,o),x(f,i,o),x(s,e,n),m(r[0],h,a),m(r[1],s,f),m(r[2],f,a),m(r[3],h,s)}function N(r,t,n){var e;for(e=0;4>e;e++)d(r[e],t[e],n)}function F(r,t){var n=$(),e=$(),o=$();S(o,t[2]),m(n,t[0],o),m(e,t[1],o),A(r,e),r[31]^=U(n)<<7}function I(r,t,n){var e,o;for(v(r[0],er),v(r[1],or),v(r[2],or),v(r[3],er),o=255;o>=0;--o)e=n[o/8|0]>>(7&o)&1,N(r,t,e),O(t,r),O(r,r),N(r,t,e)}function j(r,t){var n=[$(),$(),$(),$()];v(n[0],fr),v(n[1],sr),v(n[2],or),m(n[3],fr,sr),I(r,n,t)}function G(r,t,n){var e,o=new Uint8Array(64),i=[$(),$(),$(),$()];for(n||rr(t,32),P(o,t,32),o[0]&=248,o[31]&=127,o[31]|=64,j(i,o),F(r,i),e=0;32>e;e++)t[e+32]=r[e];return 0}function Z(r,t){var n,e,o,i;for(e=63;e>=32;--e){for(n=0,o=e-32,i=e-12;i>o;++o)t[o]+=n-16*t[e]*gr[o-(e-32)],n=t[o]+128>>8,t[o]-=256*n;t[o]+=n,t[e]=0}for(n=0,o=0;32>o;o++)t[o]+=n-(t[31]>>4)*gr[o],n=t[o]>>8,t[o]&=255;for(o=0;32>o;o++)t[o]-=n*gr[o];for(e=0;32>e;e++)t[e+1]+=t[e]>>8,r[e]=255&t[e]}function V(r){var t,n=new Float64Array(64);for(t=0;64>t;t++)n[t]=r[t];for(t=0;64>t;t++)r[t]=0;Z(r,n)}function q(r,t,n,e){var o,i,h=new Uint8Array(64),a=new Uint8Array(64),f=new Uint8Array(64),s=new Float64Array(64),u=[$(),$(),$(),$()];P(h,e,32),h[0]&=248,h[31]&=127,h[31]|=64;var c=n+64;for(o=0;n>o;o++)r[64+o]=t[o];for(o=0;32>o;o++)r[32+o]=h[32+o];for(P(f,r.subarray(32),n+32),V(f),j(u,f),F(r,u),o=32;64>o;o++)r[o]=e[o];for(P(a,r,n+64),V(a),o=0;64>o;o++)s[o]=0;for(o=0;32>o;o++)s[o]=f[o];for(o=0;32>o;o++)for(i=0;32>i;i++)s[o+i]+=a[o]*h[i];return Z(r.subarray(32),s),c}function X(r,t){var n=$(),e=$(),o=$(),i=$(),h=$(),a=$(),f=$();return v(r[2],or),E(r[1],t),B(o,r[1]),m(i,o,hr),M(o,o,r[2]),x(i,r[2],i),B(h,i),B(a,h),m(f,a,h),m(n,f,o),m(n,n,i),K(n,n),m(n,n,o),m(n,n,i),m(n,n,i),m(r[0],n,i),B(e,r[0]),m(e,e,i),_(e,o)&&m(r[0],r[0],ur),B(e,r[0]),m(e,e,i),_(e,o)?-1:(U(r[0])===t[31]>>7&&M(r[0],er,r[0]),m(r[3],r[0],r[1]),0)}function D(r,t,n,e){var i,h,a=new Uint8Array(32),f=new Uint8Array(64),s=[$(),$(),$(),$()],u=[$(),$(),$(),$()];if(h=-1,64>n)return-1;if(X(u,e))return-1;for(i=0;n>i;i++)r[i]=t[i];for(i=0;32>i;i++)r[i+32]=e[i];if(P(f,r,n),V(f),I(s,u,f),j(u,t.subarray(32)),O(s,u),F(a,s),n-=64,o(t,0,a,0)){for(i=0;n>i;i++)r[i]=0;return-1}for(i=0;n>i;i++)r[i]=t[i+64];return h=n}function H(r,t){if(r.length!==vr)throw new Error("bad key size");if(t.length!==br)throw new Error("bad nonce size")}function J(r,t){if(r.length!==Er)throw new Error("bad public key size");if(t.length!==xr)throw new Error("bad secret key size")}function Q(){var r,t;for(t=0;t>>13|n<<3),e=255&r[4]|(255&r[5])<<8,this.r[2]=7939&(n>>>10|e<<6),o=255&r[6]|(255&r[7])<<8,this.r[3]=8191&(e>>>7|o<<9),i=255&r[8]|(255&r[9])<<8,this.r[4]=255&(o>>>4|i<<12),this.r[5]=i>>>1&8190,h=255&r[10]|(255&r[11])<<8,this.r[6]=8191&(i>>>14|h<<2),a=255&r[12]|(255&r[13])<<8,this.r[7]=8065&(h>>>11|a<<5),f=255&r[14]|(255&r[15])<<8,this.r[8]=8191&(a>>>8|f<<8),this.r[9]=f>>>5&127,this.pad[0]=255&r[16]|(255&r[17])<<8,this.pad[1]=255&r[18]|(255&r[19])<<8,this.pad[2]=255&r[20]|(255&r[21])<<8,this.pad[3]=255&r[22]|(255&r[23])<<8,this.pad[4]=255&r[24]|(255&r[25])<<8,this.pad[5]=255&r[26]|(255&r[27])<<8,this.pad[6]=255&r[28]|(255&r[29])<<8,this.pad[7]=255&r[30]|(255&r[31])<<8};yr.prototype.blocks=function(r,t,n){for(var e,o,i,h,a,f,s,u,c,y,l,w,p,g,v,b,d,A,_,U=this.fin?0:2048,E=this.h[0],x=this.h[1],M=this.h[2],m=this.h[3],B=this.h[4],S=this.h[5],K=this.h[6],T=this.h[7],Y=this.h[8],k=this.h[9],L=this.r[0],C=this.r[1],R=this.r[2],z=this.r[3],P=this.r[4],O=this.r[5],N=this.r[6],F=this.r[7],I=this.r[8],j=this.r[9];n>=16;)e=255&r[t+0]|(255&r[t+1])<<8,E+=8191&e,o=255&r[t+2]|(255&r[t+3])<<8,x+=8191&(e>>>13|o<<3),i=255&r[t+4]|(255&r[t+5])<<8,M+=8191&(o>>>10|i<<6),h=255&r[t+6]|(255&r[t+7])<<8,m+=8191&(i>>>7|h<<9),a=255&r[t+8]|(255&r[t+9])<<8,B+=8191&(h>>>4|a<<12),S+=a>>>1&8191,f=255&r[t+10]|(255&r[t+11])<<8,K+=8191&(a>>>14|f<<2),s=255&r[t+12]|(255&r[t+13])<<8,T+=8191&(f>>>11|s<<5),u=255&r[t+14]|(255&r[t+15])<<8,Y+=8191&(s>>>8|u<<8),k+=u>>>5|U,c=0,y=c,y+=E*L,y+=5*x*j,y+=5*M*I,y+=5*m*F,y+=5*B*N,c=y>>>13,y&=8191,y+=5*S*O,y+=5*K*P,y+=5*T*z,y+=5*Y*R,y+=5*k*C,c+=y>>>13,y&=8191,l=c,l+=E*C,l+=x*L,l+=5*M*j,l+=5*m*I,l+=5*B*F,c=l>>>13,l&=8191,l+=5*S*N,l+=5*K*O,l+=5*T*P,l+=5*Y*z,l+=5*k*R,c+=l>>>13,l&=8191,w=c,w+=E*R,w+=x*C,w+=M*L,w+=5*m*j,w+=5*B*I,c=w>>>13,w&=8191,w+=5*S*F,w+=5*K*N,w+=5*T*O,w+=5*Y*P,w+=5*k*z,c+=w>>>13,w&=8191,p=c,p+=E*z,p+=x*R,p+=M*C,p+=m*L,p+=5*B*j,c=p>>>13,p&=8191,p+=5*S*I,p+=5*K*F,p+=5*T*N,p+=5*Y*O,p+=5*k*P,c+=p>>>13,p&=8191,g=c,g+=E*P,g+=x*z,g+=M*R,g+=m*C,g+=B*L,c=g>>>13,g&=8191,g+=5*S*j,g+=5*K*I,g+=5*T*F,g+=5*Y*N,g+=5*k*O,c+=g>>>13,g&=8191,v=c,v+=E*O,v+=x*P,v+=M*z,v+=m*R,v+=B*C,c=v>>>13,v&=8191,v+=S*L,v+=5*K*j,v+=5*T*I,v+=5*Y*F,v+=5*k*N,c+=v>>>13,v&=8191,b=c,b+=E*N,b+=x*O,b+=M*P,b+=m*z,b+=B*R,c=b>>>13,b&=8191,b+=S*C,b+=K*L,b+=5*T*j,b+=5*Y*I,b+=5*k*F,c+=b>>>13,b&=8191,d=c,d+=E*F,d+=x*N,d+=M*O,d+=m*P,d+=B*z,c=d>>>13,d&=8191,d+=S*R,d+=K*C,d+=T*L,d+=5*Y*j,d+=5*k*I,c+=d>>>13,d&=8191,A=c,A+=E*I,A+=x*F,A+=M*N,A+=m*O,A+=B*P,c=A>>>13,A&=8191,A+=S*z,A+=K*R,A+=T*C,A+=Y*L,A+=5*k*j,c+=A>>>13,A&=8191,_=c,_+=E*j,_+=x*I,_+=M*F,_+=m*N,_+=B*O,c=_>>>13,_&=8191,_+=S*P,_+=K*z,_+=T*R,_+=Y*C,_+=k*L,c+=_>>>13,_&=8191,c=(c<<2)+c|0,c=c+y|0,y=8191&c,c>>>=13,l+=c,E=y,x=l,M=w,m=p,B=g,S=v,K=b,T=d,Y=A,k=_,t+=16,n-=16;this.h[0]=E,this.h[1]=x,this.h[2]=M,this.h[3]=m,this.h[4]=B,this.h[5]=S,this.h[6]=K,this.h[7]=T,this.h[8]=Y,this.h[9]=k},yr.prototype.finish=function(r,t){var n,e,o,i,h=new Uint16Array(10);if(this.leftover){for(i=this.leftover,this.buffer[i++]=1;16>i;i++)this.buffer[i]=0;this.fin=1,this.blocks(this.buffer,0,16)}for(n=this.h[1]>>>13,this.h[1]&=8191,i=2;10>i;i++)this.h[i]+=n,n=this.h[i]>>>13,this.h[i]&=8191;for(this.h[0]+=5*n,n=this.h[0]>>>13,this.h[0]&=8191,this.h[1]+=n,n=this.h[1]>>>13,this.h[1]&=8191,this.h[2]+=n,h[0]=this.h[0]+5,n=h[0]>>>13,h[0]&=8191,i=1;10>i;i++)h[i]=this.h[i]+n,n=h[i]>>>13,h[i]&=8191;for(h[9]-=8192,e=(h[9]>>>15)-1,i=0;10>i;i++)h[i]&=e;for(e=~e,i=0;10>i;i++)this.h[i]=this.h[i]&e|h[i];for(this.h[0]=65535&(this.h[0]|this.h[1]<<13),this.h[1]=65535&(this.h[1]>>>3|this.h[2]<<10),this.h[2]=65535&(this.h[2]>>>6|this.h[3]<<7),this.h[3]=65535&(this.h[3]>>>9|this.h[4]<<4),this.h[4]=65535&(this.h[4]>>>12|this.h[5]<<1|this.h[6]<<14),this.h[5]=65535&(this.h[6]>>>2|this.h[7]<<11),this.h[6]=65535&(this.h[7]>>>5|this.h[8]<<8),this.h[7]=65535&(this.h[8]>>>8|this.h[9]<<5),o=this.h[0]+this.pad[0],this.h[0]=65535&o,i=1;8>i;i++)o=(this.h[i]+this.pad[i]|0)+(o>>>16)|0,this.h[i]=65535&o;r[t+0]=this.h[0]>>>0&255,r[t+1]=this.h[0]>>>8&255,r[t+2]=this.h[1]>>>0&255,r[t+3]=this.h[1]>>>8&255,r[t+4]=this.h[2]>>>0&255,r[t+5]=this.h[2]>>>8&255,r[t+6]=this.h[3]>>>0&255,r[t+7]=this.h[3]>>>8&255,r[t+8]=this.h[4]>>>0&255,r[t+9]=this.h[4]>>>8&255,r[t+10]=this.h[5]>>>0&255,r[t+11]=this.h[5]>>>8&255,r[t+12]=this.h[6]>>>0&255,r[t+13]=this.h[6]>>>8&255,r[t+14]=this.h[7]>>>0&255,r[t+15]=this.h[7]>>>8&255},yr.prototype.update=function(r,t,n){var e,o;if(this.leftover){for(o=16-this.leftover,o>n&&(o=n),e=0;o>e;e++)this.buffer[this.leftover+e]=r[t+e];if(n-=o,t+=o,this.leftover+=o,this.leftover<16)return;this.blocks(this.buffer,0,16),this.leftover=0}if(n>=16&&(o=n-n%16,this.blocks(r,t,o),t+=o,n-=o),n){for(e=0;n>e;e++)this.buffer[this.leftover+e]=r[t+e];this.leftover+=n}};var lr=p,wr=g,pr=[1116352408,3609767458,1899447441,602891725,3049323471,3964484399,3921009573,2173295548,961987163,4081628472,1508970993,3053834265,2453635748,2937671579,2870763221,3664609560,3624381080,2734883394,310598401,1164996542,607225278,1323610764,1426881987,3590304994,1925078388,4068182383,2162078206,991336113,2614888103,633803317,3248222580,3479774868,3835390401,2666613458,4022224774,944711139,264347078,2341262773,604807628,2007800933,770255983,1495990901,1249150122,1856431235,1555081692,3175218132,1996064986,2198950837,2554220882,3999719339,2821834349,766784016,2952996808,2566594879,3210313671,3203337956,3336571891,1034457026,3584528711,2466948901,113926993,3758326383,338241895,168717936,666307205,1188179964,773529912,1546045734,1294757372,1522805485,1396182291,2643833823,1695183700,2343527390,1986661051,1014477480,2177026350,1206759142,2456956037,344077627,2730485921,1290863460,2820302411,3158454273,3259730800,3505952657,3345764771,106217008,3516065817,3606008344,3600352804,1432725776,4094571909,1467031594,275423344,851169720,430227734,3100823752,506948616,1363258195,659060556,3750685593,883997877,3785050280,958139571,3318307427,1322822218,3812723403,1537002063,2003034995,1747873779,3602036899,1955562222,1575990012,2024104815,1125592928,2227730452,2716904306,2361852424,442776044,2428436474,593698344,2756734187,3733110249,3204031479,2999351573,3329325298,3815920427,3391569614,3928383900,3515267271,566280711,3940187606,3454069534,4118630271,4000239992,116418474,1914138554,174292421,2731055270,289380356,3203993006,460393269,320620315,685471733,587496836,852142971,1086792851,1017036298,365543100,1126000580,2618297676,1288033470,3409855158,1501505948,4234509866,1607167915,987167468,1816402316,1246189591],gr=new Float64Array([237,211,245,92,26,99,18,88,214,156,247,162,222,249,222,20,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16]),vr=32,br=24,dr=32,Ar=16,_r=32,Ur=32,Er=32,xr=32,Mr=32,mr=br,Br=dr,Sr=Ar,Kr=64,Tr=32,Yr=64,kr=32,Lr=64;r.lowlevel={crypto_core_hsalsa20:f,crypto_stream_xor:y,crypto_stream:c,crypto_stream_salsa20_xor:s,crypto_stream_salsa20:u,crypto_onetimeauth:l,crypto_onetimeauth_verify:w,crypto_verify_16:e,crypto_verify_32:o,crypto_secretbox:p,crypto_secretbox_open:g,crypto_scalarmult:T,crypto_scalarmult_base:Y,crypto_box_beforenm:L,crypto_box_afternm:lr,crypto_box:C,crypto_box_open:R,crypto_box_keypair:k,crypto_hash:P,crypto_sign:q,crypto_sign_keypair:G,crypto_sign_open:D,crypto_secretbox_KEYBYTES:vr,crypto_secretbox_NONCEBYTES:br,crypto_secretbox_ZEROBYTES:dr,crypto_secretbox_BOXZEROBYTES:Ar,crypto_scalarmult_BYTES:_r,crypto_scalarmult_SCALARBYTES:Ur,crypto_box_PUBLICKEYBYTES:Er,crypto_box_SECRETKEYBYTES:xr,crypto_box_BEFORENMBYTES:Mr,crypto_box_NONCEBYTES:mr,crypto_box_ZEROBYTES:Br,crypto_box_BOXZEROBYTES:Sr,crypto_sign_BYTES:Kr,crypto_sign_PUBLICKEYBYTES:Tr,crypto_sign_SECRETKEYBYTES:Yr,crypto_sign_SEEDBYTES:kr,crypto_hash_BYTES:Lr},r.util={},r.util.decodeUTF8=function(r){var t,n=unescape(encodeURIComponent(r)),e=new Uint8Array(n.length);for(t=0;tt;t++)n.push(String.fromCharCode(r[t]));return btoa(n.join(""))},r.util.decodeBase64=function(r){if("undefined"==typeof atob)return new Uint8Array(Array.prototype.slice.call(new Buffer(r,"base64"),0));var t,n=atob(r),e=new Uint8Array(n.length);for(t=0;te)return null;for(var o=new Uint8Array(e),i=0;ie;e++)o[e]=t[e];for(e=0;e=0},r.sign.keyPair=function(){var r=new Uint8Array(Tr),t=new Uint8Array(Yr);return G(r,t),{publicKey:r,secretKey:t}},r.sign.keyPair.fromSecretKey=function(r){if(Q(r),r.length!==Yr)throw new Error("bad secret key size");for(var t=new Uint8Array(Tr),n=0;ne;e++)n[e]=r[e];return G(t,n,!0),{publicKey:t,secretKey:n}},r.sign.publicKeyLength=Tr,r.sign.secretKeyLength=Yr,r.sign.seedLength=kr,r.sign.signatureLength=Kr,r.hash=function(r){Q(r);var t=new Uint8Array(Lr);return P(t,r,r.length),t},r.hash.hashLength=Lr,r.verify=function(r,t){return Q(r,t),0===r.length||0===t.length?!1:r.length!==t.length?!1:0===n(r,0,t,0,r.length)?!0:!1},r.setPRNG=function(r){rr=r},function(){var t;"undefined"!=typeof window?(window.crypto&&window.crypto.getRandomValues?t=window.crypto:window.msCrypto&&window.msCrypto.getRandomValues&&(t=window.msCrypto),t&&r.setPRNG(function(r,n){var e,o=new Uint8Array(n);for(t.getRandomValues(o),e=0;n>e;e++)r[e]=o[e];W(o)})):"undefined"!=typeof require&&(t=require("crypto"),t&&r.setPRNG(function(r,n){var e,o=t.randomBytes(n);for(e=0;n>e;e++)r[e]=o[e];W(o)}))}()}("undefined"!=typeof module&&module.exports?module.exports:window.nacl=window.nacl||{}); \ No newline at end of file +!function(r){"use strict";function t(r,t,n,e){r[t]=n>>24&255,r[t+1]=n>>16&255,r[t+2]=n>>8&255,r[t+3]=255&n,r[t+4]=e>>24&255,r[t+5]=e>>16&255,r[t+6]=e>>8&255,r[t+7]=255&e}function n(r,t,n,e,o){var i,h=0;for(i=0;o>i;i++)h|=r[t+i]^n[e+i];return(1&h-1>>>8)-1}function e(r,t,e,o){return n(r,t,e,o,16)}function o(r,t,e,o){return n(r,t,e,o,32)}function i(r,t,n,e){for(var o,i=255&e[0]|(255&e[1])<<8|(255&e[2])<<16|(255&e[3])<<24,h=255&n[0]|(255&n[1])<<8|(255&n[2])<<16|(255&n[3])<<24,a=255&n[4]|(255&n[5])<<8|(255&n[6])<<16|(255&n[7])<<24,f=255&n[8]|(255&n[9])<<8|(255&n[10])<<16|(255&n[11])<<24,s=255&n[12]|(255&n[13])<<8|(255&n[14])<<16|(255&n[15])<<24,u=255&e[4]|(255&e[5])<<8|(255&e[6])<<16|(255&e[7])<<24,c=255&t[0]|(255&t[1])<<8|(255&t[2])<<16|(255&t[3])<<24,y=255&t[4]|(255&t[5])<<8|(255&t[6])<<16|(255&t[7])<<24,l=255&t[8]|(255&t[9])<<8|(255&t[10])<<16|(255&t[11])<<24,w=255&t[12]|(255&t[13])<<8|(255&t[14])<<16|(255&t[15])<<24,p=255&e[8]|(255&e[9])<<8|(255&e[10])<<16|(255&e[11])<<24,v=255&n[16]|(255&n[17])<<8|(255&n[18])<<16|(255&n[19])<<24,b=255&n[20]|(255&n[21])<<8|(255&n[22])<<16|(255&n[23])<<24,g=255&n[24]|(255&n[25])<<8|(255&n[26])<<16|(255&n[27])<<24,_=255&n[28]|(255&n[29])<<8|(255&n[30])<<16|(255&n[31])<<24,A=255&e[12]|(255&e[13])<<8|(255&e[14])<<16|(255&e[15])<<24,d=i,U=h,E=a,x=f,M=s,m=u,B=c,S=y,K=l,T=w,Y=p,k=v,L=b,z=g,R=_,P=A,O=0;20>O;O+=2)o=d+L|0,M^=o<<7|o>>>25,o=M+d|0,K^=o<<9|o>>>23,o=K+M|0,L^=o<<13|o>>>19,o=L+K|0,d^=o<<18|o>>>14,o=m+U|0,T^=o<<7|o>>>25,o=T+m|0,z^=o<<9|o>>>23,o=z+T|0,U^=o<<13|o>>>19,o=U+z|0,m^=o<<18|o>>>14,o=Y+B|0,R^=o<<7|o>>>25,o=R+Y|0,E^=o<<9|o>>>23,o=E+R|0,B^=o<<13|o>>>19,o=B+E|0,Y^=o<<18|o>>>14,o=P+k|0,x^=o<<7|o>>>25,o=x+P|0,S^=o<<9|o>>>23,o=S+x|0,k^=o<<13|o>>>19,o=k+S|0,P^=o<<18|o>>>14,o=d+x|0,U^=o<<7|o>>>25,o=U+d|0,E^=o<<9|o>>>23,o=E+U|0,x^=o<<13|o>>>19,o=x+E|0,d^=o<<18|o>>>14,o=m+M|0,B^=o<<7|o>>>25,o=B+m|0,S^=o<<9|o>>>23,o=S+B|0,M^=o<<13|o>>>19,o=M+S|0,m^=o<<18|o>>>14,o=Y+T|0,k^=o<<7|o>>>25,o=k+Y|0,K^=o<<9|o>>>23,o=K+k|0,T^=o<<13|o>>>19,o=T+K|0,Y^=o<<18|o>>>14,o=P+R|0,L^=o<<7|o>>>25,o=L+P|0,z^=o<<9|o>>>23,o=z+L|0,R^=o<<13|o>>>19,o=R+z|0,P^=o<<18|o>>>14;d=d+i|0,U=U+h|0,E=E+a|0,x=x+f|0,M=M+s|0,m=m+u|0,B=B+c|0,S=S+y|0,K=K+l|0,T=T+w|0,Y=Y+p|0,k=k+v|0,L=L+b|0,z=z+g|0,R=R+_|0,P=P+A|0,r[0]=d>>>0&255,r[1]=d>>>8&255,r[2]=d>>>16&255,r[3]=d>>>24&255,r[4]=U>>>0&255,r[5]=U>>>8&255,r[6]=U>>>16&255,r[7]=U>>>24&255,r[8]=E>>>0&255,r[9]=E>>>8&255,r[10]=E>>>16&255,r[11]=E>>>24&255,r[12]=x>>>0&255,r[13]=x>>>8&255,r[14]=x>>>16&255,r[15]=x>>>24&255,r[16]=M>>>0&255,r[17]=M>>>8&255,r[18]=M>>>16&255,r[19]=M>>>24&255,r[20]=m>>>0&255,r[21]=m>>>8&255,r[22]=m>>>16&255,r[23]=m>>>24&255,r[24]=B>>>0&255,r[25]=B>>>8&255,r[26]=B>>>16&255,r[27]=B>>>24&255,r[28]=S>>>0&255,r[29]=S>>>8&255,r[30]=S>>>16&255,r[31]=S>>>24&255,r[32]=K>>>0&255,r[33]=K>>>8&255,r[34]=K>>>16&255,r[35]=K>>>24&255,r[36]=T>>>0&255,r[37]=T>>>8&255,r[38]=T>>>16&255,r[39]=T>>>24&255,r[40]=Y>>>0&255,r[41]=Y>>>8&255,r[42]=Y>>>16&255,r[43]=Y>>>24&255,r[44]=k>>>0&255,r[45]=k>>>8&255,r[46]=k>>>16&255,r[47]=k>>>24&255,r[48]=L>>>0&255,r[49]=L>>>8&255,r[50]=L>>>16&255,r[51]=L>>>24&255,r[52]=z>>>0&255,r[53]=z>>>8&255,r[54]=z>>>16&255,r[55]=z>>>24&255,r[56]=R>>>0&255,r[57]=R>>>8&255,r[58]=R>>>16&255,r[59]=R>>>24&255,r[60]=P>>>0&255,r[61]=P>>>8&255,r[62]=P>>>16&255,r[63]=P>>>24&255}function h(r,t,n,e){for(var o,i=255&e[0]|(255&e[1])<<8|(255&e[2])<<16|(255&e[3])<<24,h=255&n[0]|(255&n[1])<<8|(255&n[2])<<16|(255&n[3])<<24,a=255&n[4]|(255&n[5])<<8|(255&n[6])<<16|(255&n[7])<<24,f=255&n[8]|(255&n[9])<<8|(255&n[10])<<16|(255&n[11])<<24,s=255&n[12]|(255&n[13])<<8|(255&n[14])<<16|(255&n[15])<<24,u=255&e[4]|(255&e[5])<<8|(255&e[6])<<16|(255&e[7])<<24,c=255&t[0]|(255&t[1])<<8|(255&t[2])<<16|(255&t[3])<<24,y=255&t[4]|(255&t[5])<<8|(255&t[6])<<16|(255&t[7])<<24,l=255&t[8]|(255&t[9])<<8|(255&t[10])<<16|(255&t[11])<<24,w=255&t[12]|(255&t[13])<<8|(255&t[14])<<16|(255&t[15])<<24,p=255&e[8]|(255&e[9])<<8|(255&e[10])<<16|(255&e[11])<<24,v=255&n[16]|(255&n[17])<<8|(255&n[18])<<16|(255&n[19])<<24,b=255&n[20]|(255&n[21])<<8|(255&n[22])<<16|(255&n[23])<<24,g=255&n[24]|(255&n[25])<<8|(255&n[26])<<16|(255&n[27])<<24,_=255&n[28]|(255&n[29])<<8|(255&n[30])<<16|(255&n[31])<<24,A=255&e[12]|(255&e[13])<<8|(255&e[14])<<16|(255&e[15])<<24,d=i,U=h,E=a,x=f,M=s,m=u,B=c,S=y,K=l,T=w,Y=p,k=v,L=b,z=g,R=_,P=A,O=0;20>O;O+=2)o=d+L|0,M^=o<<7|o>>>25,o=M+d|0,K^=o<<9|o>>>23,o=K+M|0,L^=o<<13|o>>>19,o=L+K|0,d^=o<<18|o>>>14,o=m+U|0,T^=o<<7|o>>>25,o=T+m|0,z^=o<<9|o>>>23,o=z+T|0,U^=o<<13|o>>>19,o=U+z|0,m^=o<<18|o>>>14,o=Y+B|0,R^=o<<7|o>>>25,o=R+Y|0,E^=o<<9|o>>>23,o=E+R|0,B^=o<<13|o>>>19,o=B+E|0,Y^=o<<18|o>>>14,o=P+k|0,x^=o<<7|o>>>25,o=x+P|0,S^=o<<9|o>>>23,o=S+x|0,k^=o<<13|o>>>19,o=k+S|0,P^=o<<18|o>>>14,o=d+x|0,U^=o<<7|o>>>25,o=U+d|0,E^=o<<9|o>>>23,o=E+U|0,x^=o<<13|o>>>19,o=x+E|0,d^=o<<18|o>>>14,o=m+M|0,B^=o<<7|o>>>25,o=B+m|0,S^=o<<9|o>>>23,o=S+B|0,M^=o<<13|o>>>19,o=M+S|0,m^=o<<18|o>>>14,o=Y+T|0,k^=o<<7|o>>>25,o=k+Y|0,K^=o<<9|o>>>23,o=K+k|0,T^=o<<13|o>>>19,o=T+K|0,Y^=o<<18|o>>>14,o=P+R|0,L^=o<<7|o>>>25,o=L+P|0,z^=o<<9|o>>>23,o=z+L|0,R^=o<<13|o>>>19,o=R+z|0,P^=o<<18|o>>>14;r[0]=d>>>0&255,r[1]=d>>>8&255,r[2]=d>>>16&255,r[3]=d>>>24&255,r[4]=m>>>0&255,r[5]=m>>>8&255,r[6]=m>>>16&255,r[7]=m>>>24&255,r[8]=Y>>>0&255,r[9]=Y>>>8&255,r[10]=Y>>>16&255,r[11]=Y>>>24&255,r[12]=P>>>0&255,r[13]=P>>>8&255,r[14]=P>>>16&255,r[15]=P>>>24&255,r[16]=B>>>0&255,r[17]=B>>>8&255,r[18]=B>>>16&255,r[19]=B>>>24&255,r[20]=S>>>0&255,r[21]=S>>>8&255,r[22]=S>>>16&255,r[23]=S>>>24&255,r[24]=K>>>0&255,r[25]=K>>>8&255,r[26]=K>>>16&255,r[27]=K>>>24&255,r[28]=T>>>0&255,r[29]=T>>>8&255,r[30]=T>>>16&255,r[31]=T>>>24&255}function a(r,t,n,e){i(r,t,n,e)}function f(r,t,n,e){h(r,t,n,e)}function s(r,t,n,e,o,i,h){var f,s,u=new Uint8Array(16),c=new Uint8Array(64);for(s=0;16>s;s++)u[s]=0;for(s=0;8>s;s++)u[s]=i[s];for(;o>=64;){for(a(c,u,h,cr),s=0;64>s;s++)r[t+s]=n[e+s]^c[s];for(f=1,s=8;16>s;s++)f=f+(255&u[s])|0,u[s]=255&f,f>>>=8;o-=64,t+=64,e+=64}if(o>0)for(a(c,u,h,cr),s=0;o>s;s++)r[t+s]=n[e+s]^c[s];return 0}function u(r,t,n,e,o){var i,h,f=new Uint8Array(16),s=new Uint8Array(64);for(h=0;16>h;h++)f[h]=0;for(h=0;8>h;h++)f[h]=e[h];for(;n>=64;){for(a(s,f,o,cr),h=0;64>h;h++)r[t+h]=s[h];for(i=1,h=8;16>h;h++)i=i+(255&f[h])|0,f[h]=255&i,i>>>=8;n-=64,t+=64}if(n>0)for(a(s,f,o,cr),h=0;n>h;h++)r[t+h]=s[h];return 0}function c(r,t,n,e,o){var i=new Uint8Array(32);f(i,e,o,cr);for(var h=new Uint8Array(8),a=0;8>a;a++)h[a]=e[a+16];return u(r,t,n,h,i)}function y(r,t,n,e,o,i,h){var a=new Uint8Array(32);f(a,i,h,cr);for(var u=new Uint8Array(8),c=0;8>c;c++)u[c]=i[c+16];return s(r,t,n,e,o,u,a)}function l(r,t,n,e,o,i){var h=new yr(i);return h.update(n,e,o),h.finish(r,t),0}function w(r,t,n,o,i,h){var a=new Uint8Array(16);return l(a,0,n,o,i,h),e(r,t,a,0)}function p(r,t,n,e,o){var i;if(32>n)return-1;for(y(r,0,t,0,n,e,o),l(r,16,r,32,n-32,r),i=0;16>i;i++)r[i]=0;return 0}function v(r,t,n,e,o){var i,h=new Uint8Array(32);if(32>n)return-1;if(c(h,0,32,e,o),0!==w(t,16,t,32,n-32,h))return-1;for(y(r,0,t,0,n,e,o),i=0;32>i;i++)r[i]=0;return 0}function b(r,t){var n;for(n=0;16>n;n++)r[n]=0|t[n]}function g(r){var t,n,e=1;for(t=0;16>t;t++)n=r[t]+e+65535,e=Math.floor(n/65536),r[t]=n-65536*e;r[0]+=e-1+37*(e-1)}function _(r,t,n){for(var e,o=~(n-1),i=0;16>i;i++)e=o&(r[i]^t[i]),r[i]^=e,t[i]^=e}function A(r,t){var n,e,o,i=$(),h=$();for(n=0;16>n;n++)h[n]=t[n];for(g(h),g(h),g(h),e=0;2>e;e++){for(i[0]=h[0]-65517,n=1;15>n;n++)i[n]=h[n]-65535-(i[n-1]>>16&1),i[n-1]&=65535;i[15]=h[15]-32767-(i[14]>>16&1),o=i[15]>>16&1,i[14]&=65535,_(h,i,1-o)}for(n=0;16>n;n++)r[2*n]=255&h[n],r[2*n+1]=h[n]>>8}function d(r,t){var n=new Uint8Array(32),e=new Uint8Array(32);return A(n,r),A(e,t),o(n,0,e,0)}function U(r){var t=new Uint8Array(32);return A(t,r),1&t[0]}function E(r,t){var n;for(n=0;16>n;n++)r[n]=t[2*n]+(t[2*n+1]<<8);r[15]&=32767}function x(r,t,n){for(var e=0;16>e;e++)r[e]=t[e]+n[e]}function M(r,t,n){for(var e=0;16>e;e++)r[e]=t[e]-n[e]}function m(r,t,n){var e,o,i=0,h=0,a=0,f=0,s=0,u=0,c=0,y=0,l=0,w=0,p=0,v=0,b=0,g=0,_=0,A=0,d=0,U=0,E=0,x=0,M=0,m=0,B=0,S=0,K=0,T=0,Y=0,k=0,L=0,z=0,R=0,P=n[0],O=n[1],N=n[2],C=n[3],F=n[4],I=n[5],G=n[6],Z=n[7],j=n[8],q=n[9],V=n[10],X=n[11],D=n[12],H=n[13],J=n[14],Q=n[15];e=t[0],i+=e*P,h+=e*O,a+=e*N,f+=e*C,s+=e*F,u+=e*I,c+=e*G,y+=e*Z,l+=e*j,w+=e*q,p+=e*V,v+=e*X,b+=e*D,g+=e*H,_+=e*J,A+=e*Q,e=t[1],h+=e*P,a+=e*O,f+=e*N,s+=e*C,u+=e*F,c+=e*I,y+=e*G,l+=e*Z,w+=e*j,p+=e*q,v+=e*V,b+=e*X,g+=e*D,_+=e*H,A+=e*J,d+=e*Q,e=t[2],a+=e*P,f+=e*O,s+=e*N,u+=e*C,c+=e*F,y+=e*I,l+=e*G,w+=e*Z,p+=e*j,v+=e*q,b+=e*V,g+=e*X,_+=e*D,A+=e*H,d+=e*J,U+=e*Q,e=t[3],f+=e*P,s+=e*O,u+=e*N,c+=e*C,y+=e*F,l+=e*I,w+=e*G,p+=e*Z,v+=e*j,b+=e*q,g+=e*V,_+=e*X,A+=e*D,d+=e*H,U+=e*J,E+=e*Q,e=t[4],s+=e*P,u+=e*O,c+=e*N,y+=e*C,l+=e*F,w+=e*I,p+=e*G,v+=e*Z,b+=e*j,g+=e*q,_+=e*V,A+=e*X,d+=e*D,U+=e*H,E+=e*J,x+=e*Q,e=t[5],u+=e*P,c+=e*O,y+=e*N,l+=e*C,w+=e*F,p+=e*I,v+=e*G,b+=e*Z,g+=e*j,_+=e*q,A+=e*V,d+=e*X,U+=e*D,E+=e*H,x+=e*J,M+=e*Q,e=t[6],c+=e*P,y+=e*O,l+=e*N,w+=e*C,p+=e*F,v+=e*I,b+=e*G,g+=e*Z,_+=e*j,A+=e*q,d+=e*V,U+=e*X,E+=e*D,x+=e*H,M+=e*J,m+=e*Q,e=t[7],y+=e*P,l+=e*O,w+=e*N,p+=e*C,v+=e*F,b+=e*I,g+=e*G,_+=e*Z,A+=e*j,d+=e*q,U+=e*V,E+=e*X,x+=e*D,M+=e*H,m+=e*J,B+=e*Q,e=t[8],l+=e*P,w+=e*O,p+=e*N,v+=e*C,b+=e*F,g+=e*I,_+=e*G,A+=e*Z,d+=e*j,U+=e*q,E+=e*V,x+=e*X,M+=e*D,m+=e*H,B+=e*J,S+=e*Q,e=t[9],w+=e*P,p+=e*O,v+=e*N,b+=e*C,g+=e*F,_+=e*I,A+=e*G,d+=e*Z,U+=e*j,E+=e*q,x+=e*V,M+=e*X,m+=e*D,B+=e*H,S+=e*J,K+=e*Q,e=t[10],p+=e*P,v+=e*O,b+=e*N,g+=e*C,_+=e*F,A+=e*I,d+=e*G,U+=e*Z,E+=e*j,x+=e*q,M+=e*V,m+=e*X,B+=e*D,S+=e*H,K+=e*J,T+=e*Q,e=t[11],v+=e*P,b+=e*O,g+=e*N,_+=e*C,A+=e*F,d+=e*I,U+=e*G,E+=e*Z,x+=e*j,M+=e*q,m+=e*V,B+=e*X,S+=e*D,K+=e*H,T+=e*J,Y+=e*Q,e=t[12],b+=e*P,g+=e*O,_+=e*N,A+=e*C,d+=e*F,U+=e*I,E+=e*G,x+=e*Z,M+=e*j,m+=e*q,B+=e*V,S+=e*X,K+=e*D,T+=e*H,Y+=e*J,k+=e*Q,e=t[13],g+=e*P,_+=e*O,A+=e*N,d+=e*C,U+=e*F,E+=e*I,x+=e*G,M+=e*Z,m+=e*j,B+=e*q,S+=e*V,K+=e*X,T+=e*D,Y+=e*H,k+=e*J,L+=e*Q,e=t[14],_+=e*P,A+=e*O,d+=e*N,U+=e*C,E+=e*F,x+=e*I,M+=e*G,m+=e*Z,B+=e*j,S+=e*q,K+=e*V,T+=e*X,Y+=e*D,k+=e*H,L+=e*J,z+=e*Q,e=t[15],A+=e*P,d+=e*O,U+=e*N,E+=e*C,x+=e*F,M+=e*I,m+=e*G,B+=e*Z,S+=e*j,K+=e*q,T+=e*V,Y+=e*X,k+=e*D,L+=e*H,z+=e*J,R+=e*Q,i+=38*d,h+=38*U,a+=38*E,f+=38*x,s+=38*M,u+=38*m,c+=38*B,y+=38*S,l+=38*K,w+=38*T,p+=38*Y,v+=38*k,b+=38*L,g+=38*z,_+=38*R,o=1,e=i+o+65535,o=Math.floor(e/65536),i=e-65536*o,e=h+o+65535,o=Math.floor(e/65536),h=e-65536*o,e=a+o+65535,o=Math.floor(e/65536),a=e-65536*o,e=f+o+65535,o=Math.floor(e/65536),f=e-65536*o,e=s+o+65535,o=Math.floor(e/65536),s=e-65536*o,e=u+o+65535,o=Math.floor(e/65536),u=e-65536*o,e=c+o+65535,o=Math.floor(e/65536),c=e-65536*o,e=y+o+65535,o=Math.floor(e/65536),y=e-65536*o,e=l+o+65535,o=Math.floor(e/65536),l=e-65536*o,e=w+o+65535,o=Math.floor(e/65536),w=e-65536*o,e=p+o+65535,o=Math.floor(e/65536),p=e-65536*o,e=v+o+65535,o=Math.floor(e/65536),v=e-65536*o,e=b+o+65535,o=Math.floor(e/65536),b=e-65536*o,e=g+o+65535,o=Math.floor(e/65536),g=e-65536*o,e=_+o+65535,o=Math.floor(e/65536),_=e-65536*o,e=A+o+65535,o=Math.floor(e/65536),A=e-65536*o,i+=o-1+37*(o-1),o=1,e=i+o+65535,o=Math.floor(e/65536),i=e-65536*o,e=h+o+65535,o=Math.floor(e/65536),h=e-65536*o,e=a+o+65535,o=Math.floor(e/65536),a=e-65536*o,e=f+o+65535,o=Math.floor(e/65536),f=e-65536*o,e=s+o+65535,o=Math.floor(e/65536),s=e-65536*o,e=u+o+65535,o=Math.floor(e/65536),u=e-65536*o,e=c+o+65535,o=Math.floor(e/65536),c=e-65536*o,e=y+o+65535,o=Math.floor(e/65536),y=e-65536*o,e=l+o+65535,o=Math.floor(e/65536),l=e-65536*o,e=w+o+65535,o=Math.floor(e/65536),w=e-65536*o,e=p+o+65535,o=Math.floor(e/65536),p=e-65536*o,e=v+o+65535,o=Math.floor(e/65536),v=e-65536*o,e=b+o+65535,o=Math.floor(e/65536),b=e-65536*o,e=g+o+65535,o=Math.floor(e/65536),g=e-65536*o,e=_+o+65535,o=Math.floor(e/65536),_=e-65536*o,e=A+o+65535,o=Math.floor(e/65536),A=e-65536*o,i+=o-1+37*(o-1),r[0]=i,r[1]=h,r[2]=a,r[3]=f,r[4]=s,r[5]=u,r[6]=c,r[7]=y,r[8]=l,r[9]=w,r[10]=p,r[11]=v,r[12]=b,r[13]=g,r[14]=_,r[15]=A}function B(r,t){m(r,t,t)}function S(r,t){var n,e=$();for(n=0;16>n;n++)e[n]=t[n];for(n=253;n>=0;n--)B(e,e),2!==n&&4!==n&&m(e,e,t);for(n=0;16>n;n++)r[n]=e[n]}function K(r,t){var n,e=$();for(n=0;16>n;n++)e[n]=t[n];for(n=250;n>=0;n--)B(e,e),1!==n&&m(e,e,t);for(n=0;16>n;n++)r[n]=e[n]}function T(r,t,n){var e,o,i=new Uint8Array(32),h=new Float64Array(80),a=$(),f=$(),s=$(),u=$(),c=$(),y=$();for(o=0;31>o;o++)i[o]=t[o];for(i[31]=127&t[31]|64,i[0]&=248,E(h,n),o=0;16>o;o++)f[o]=h[o],u[o]=a[o]=s[o]=0;for(a[0]=u[0]=1,o=254;o>=0;--o)e=i[o>>>3]>>>(7&o)&1,_(a,f,e),_(s,u,e),x(c,a,s),M(a,a,s),x(s,f,u),M(f,f,u),B(u,c),B(y,a),m(a,s,a),m(s,f,c),x(c,a,s),M(a,a,s),B(f,a),M(s,u,y),m(a,s,ir),x(a,a,u),m(s,s,a),m(a,u,y),m(u,f,h),B(f,c),_(a,f,e),_(s,u,e);for(o=0;16>o;o++)h[o+16]=a[o],h[o+32]=s[o],h[o+48]=f[o],h[o+64]=u[o];var l=h.subarray(32),w=h.subarray(16);return S(l,l),m(w,w,l),A(r,w),0}function Y(r,t){return T(r,t,nr)}function k(r,t){return rr(t,32),Y(r,t)}function L(r,t,n){var e=new Uint8Array(32);return T(e,n,t),f(r,tr,e,cr)}function z(r,t,n,e,o,i){var h=new Uint8Array(32);return L(h,o,i),lr(r,t,n,e,h)}function R(r,t,n,e,o,i){var h=new Uint8Array(32);return L(h,o,i),wr(r,t,n,e,h)}function P(r,t,n,e){for(var o,i,h,a,f,s,u,c,y,l,w,p,v,b,g,_,A,d,U,E,x,M,m,B,S,K,T=new Int32Array(16),Y=new Int32Array(16),k=r[0],L=r[1],z=r[2],R=r[3],P=r[4],O=r[5],N=r[6],C=r[7],F=t[0],I=t[1],G=t[2],Z=t[3],j=t[4],q=t[5],V=t[6],X=t[7],D=0;e>=128;){for(U=0;16>U;U++)E=8*U+D,T[U]=n[E+0]<<24|n[E+1]<<16|n[E+2]<<8|n[E+3],Y[U]=n[E+4]<<24|n[E+5]<<16|n[E+6]<<8|n[E+7];for(U=0;80>U;U++)if(o=k,i=L,h=z,a=R,f=P,s=O,u=N,c=C,y=F,l=I,w=G,p=Z,v=j,b=q,g=V,_=X,x=C,M=X,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=(P>>>14|j<<18)^(P>>>18|j<<14)^(j>>>9|P<<23),M=(j>>>14|P<<18)^(j>>>18|P<<14)^(P>>>9|j<<23),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=P&O^~P&N,M=j&q^~j&V,m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=pr[2*U],M=pr[2*U+1],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=T[U%16],M=Y[U%16],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,A=65535&S|K<<16,d=65535&m|B<<16,x=A,M=d,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=(k>>>28|F<<4)^(F>>>2|k<<30)^(F>>>7|k<<25),M=(F>>>28|k<<4)^(k>>>2|F<<30)^(k>>>7|F<<25),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,x=k&L^k&z^L&z,M=F&I^F&G^I&G,m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,c=65535&S|K<<16,_=65535&m|B<<16,x=a,M=p,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=A,M=d,m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,a=65535&S|K<<16,p=65535&m|B<<16,L=o,z=i,R=h,P=a,O=f,N=s,C=u,k=c,I=y,G=l,Z=w,j=p,q=v,V=b,X=g,F=_,U%16===15)for(E=0;16>E;E++)x=T[E],M=Y[E],m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=T[(E+9)%16],M=Y[(E+9)%16],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,A=T[(E+1)%16],d=Y[(E+1)%16],x=(A>>>1|d<<31)^(A>>>8|d<<24)^A>>>7,M=(d>>>1|A<<31)^(d>>>8|A<<24)^(d>>>7|A<<25),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,A=T[(E+14)%16],d=Y[(E+14)%16],x=(A>>>19|d<<13)^(d>>>29|A<<3)^A>>>6,M=(d>>>19|A<<13)^(A>>>29|d<<3)^(d>>>6|A<<26),m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,T[E]=65535&S|K<<16,Y[E]=65535&m|B<<16;x=k,M=F,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[0],M=t[0],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[0]=k=65535&S|K<<16,t[0]=F=65535&m|B<<16,x=L,M=I,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[1],M=t[1],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[1]=L=65535&S|K<<16,t[1]=I=65535&m|B<<16,x=z,M=G,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[2],M=t[2],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[2]=z=65535&S|K<<16,t[2]=G=65535&m|B<<16,x=R,M=Z,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[3],M=t[3],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[3]=R=65535&S|K<<16,t[3]=Z=65535&m|B<<16,x=P,M=j,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[4],M=t[4],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[4]=P=65535&S|K<<16,t[4]=j=65535&m|B<<16,x=O,M=q,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[5],M=t[5],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[5]=O=65535&S|K<<16,t[5]=q=65535&m|B<<16,x=N,M=V,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[6],M=t[6],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[6]=N=65535&S|K<<16,t[6]=V=65535&m|B<<16,x=C,M=X,m=65535&M,B=M>>>16,S=65535&x,K=x>>>16,x=r[7],M=t[7],m+=65535&M,B+=M>>>16,S+=65535&x,K+=x>>>16,B+=m>>>16,S+=B>>>16,K+=S>>>16,r[7]=C=65535&S|K<<16,t[7]=X=65535&m|B<<16,D+=128,e-=128}return e}function O(r,n,e){var o,i=new Int32Array(8),h=new Int32Array(8),a=new Uint8Array(256),f=e;for(i[0]=1779033703,i[1]=3144134277,i[2]=1013904242,i[3]=2773480762,i[4]=1359893119,i[5]=2600822924,i[6]=528734635,i[7]=1541459225,h[0]=4089235720,h[1]=2227873595,h[2]=4271175723,h[3]=1595750129,h[4]=2917565137,h[5]=725511199,h[6]=4215389547,h[7]=327033209,P(i,h,n,e),e%=128,o=0;e>o;o++)a[o]=n[f-e+o];for(a[e]=128,e=256-128*(112>e?1:0),a[e-9]=0,t(a,e-8,f/536870912|0,f<<3),P(i,h,a,e),o=0;8>o;o++)t(r,8*o,i[o],h[o]);return 0}function N(r,t){var n=$(),e=$(),o=$(),i=$(),h=$(),a=$(),f=$(),s=$(),u=$();M(n,r[1],r[0]),M(u,t[1],t[0]),m(n,n,u),x(e,r[0],r[1]),x(u,t[0],t[1]),m(e,e,u),m(o,r[3],t[3]),m(o,o,ar),m(i,r[2],t[2]),x(i,i,i),M(h,e,n),M(a,i,o),x(f,i,o),x(s,e,n),m(r[0],h,a),m(r[1],s,f),m(r[2],f,a),m(r[3],h,s)}function C(r,t,n){var e;for(e=0;4>e;e++)_(r[e],t[e],n)}function F(r,t){var n=$(),e=$(),o=$();S(o,t[2]),m(n,t[0],o),m(e,t[1],o),A(r,e),r[31]^=U(n)<<7}function I(r,t,n){var e,o;for(b(r[0],er),b(r[1],or),b(r[2],or),b(r[3],er),o=255;o>=0;--o)e=n[o/8|0]>>(7&o)&1,C(r,t,e),N(t,r),N(r,r),C(r,t,e)}function G(r,t){var n=[$(),$(),$(),$()];b(n[0],fr),b(n[1],sr),b(n[2],or),m(n[3],fr,sr),I(r,n,t)}function Z(r,t,n){var e,o=new Uint8Array(64),i=[$(),$(),$(),$()];for(n||rr(t,32),O(o,t,32),o[0]&=248,o[31]&=127,o[31]|=64,G(i,o),F(r,i),e=0;32>e;e++)t[e+32]=r[e];return 0}function j(r,t){var n,e,o,i;for(e=63;e>=32;--e){for(n=0,o=e-32,i=e-12;i>o;++o)t[o]+=n-16*t[e]*vr[o-(e-32)],n=t[o]+128>>8,t[o]-=256*n;t[o]+=n,t[e]=0}for(n=0,o=0;32>o;o++)t[o]+=n-(t[31]>>4)*vr[o],n=t[o]>>8,t[o]&=255;for(o=0;32>o;o++)t[o]-=n*vr[o];for(e=0;32>e;e++)t[e+1]+=t[e]>>8,r[e]=255&t[e]}function q(r){var t,n=new Float64Array(64);for(t=0;64>t;t++)n[t]=r[t];for(t=0;64>t;t++)r[t]=0;j(r,n)}function V(r,t,n,e){var o,i,h=new Uint8Array(64),a=new Uint8Array(64),f=new Uint8Array(64),s=new Float64Array(64),u=[$(),$(),$(),$()];O(h,e,32),h[0]&=248,h[31]&=127,h[31]|=64;var c=n+64;for(o=0;n>o;o++)r[64+o]=t[o];for(o=0;32>o;o++)r[32+o]=h[32+o];for(O(f,r.subarray(32),n+32),q(f),G(u,f),F(r,u),o=32;64>o;o++)r[o]=e[o];for(O(a,r,n+64),q(a),o=0;64>o;o++)s[o]=0;for(o=0;32>o;o++)s[o]=f[o];for(o=0;32>o;o++)for(i=0;32>i;i++)s[o+i]+=a[o]*h[i];return j(r.subarray(32),s),c}function X(r,t){var n=$(),e=$(),o=$(),i=$(),h=$(),a=$(),f=$();return b(r[2],or),E(r[1],t),B(o,r[1]),m(i,o,hr),M(o,o,r[2]),x(i,r[2],i),B(h,i),B(a,h),m(f,a,h),m(n,f,o),m(n,n,i),K(n,n),m(n,n,o),m(n,n,i),m(n,n,i),m(r[0],n,i),B(e,r[0]),m(e,e,i),d(e,o)&&m(r[0],r[0],ur),B(e,r[0]),m(e,e,i),d(e,o)?-1:(U(r[0])===t[31]>>7&&M(r[0],er,r[0]),m(r[3],r[0],r[1]),0)}function D(r,t,n,e){var i,h,a=new Uint8Array(32),f=new Uint8Array(64),s=[$(),$(),$(),$()],u=[$(),$(),$(),$()];if(h=-1,64>n)return-1;if(X(u,e))return-1;for(i=0;n>i;i++)r[i]=t[i];for(i=0;32>i;i++)r[i+32]=e[i];if(O(f,r,n),q(f),I(s,u,f),G(u,t.subarray(32)),N(s,u),F(a,s),n-=64,o(t,0,a,0)){for(i=0;n>i;i++)r[i]=0;return-1}for(i=0;n>i;i++)r[i]=t[i+64];return h=n}function H(r,t){if(r.length!==br)throw new Error("bad key size");if(t.length!==gr)throw new Error("bad nonce size")}function J(r,t){if(r.length!==Er)throw new Error("bad public key size");if(t.length!==xr)throw new Error("bad secret key size")}function Q(){var r,t;for(t=0;t>>13|n<<3),e=255&r[4]|(255&r[5])<<8,this.r[2]=7939&(n>>>10|e<<6),o=255&r[6]|(255&r[7])<<8,this.r[3]=8191&(e>>>7|o<<9),i=255&r[8]|(255&r[9])<<8,this.r[4]=255&(o>>>4|i<<12),this.r[5]=i>>>1&8190,h=255&r[10]|(255&r[11])<<8,this.r[6]=8191&(i>>>14|h<<2),a=255&r[12]|(255&r[13])<<8,this.r[7]=8065&(h>>>11|a<<5),f=255&r[14]|(255&r[15])<<8,this.r[8]=8191&(a>>>8|f<<8),this.r[9]=f>>>5&127,this.pad[0]=255&r[16]|(255&r[17])<<8,this.pad[1]=255&r[18]|(255&r[19])<<8,this.pad[2]=255&r[20]|(255&r[21])<<8,this.pad[3]=255&r[22]|(255&r[23])<<8,this.pad[4]=255&r[24]|(255&r[25])<<8,this.pad[5]=255&r[26]|(255&r[27])<<8,this.pad[6]=255&r[28]|(255&r[29])<<8,this.pad[7]=255&r[30]|(255&r[31])<<8};yr.prototype.blocks=function(r,t,n){for(var e,o,i,h,a,f,s,u,c,y,l,w,p,v,b,g,_,A,d,U=this.fin?0:2048,E=this.h[0],x=this.h[1],M=this.h[2],m=this.h[3],B=this.h[4],S=this.h[5],K=this.h[6],T=this.h[7],Y=this.h[8],k=this.h[9],L=this.r[0],z=this.r[1],R=this.r[2],P=this.r[3],O=this.r[4],N=this.r[5],C=this.r[6],F=this.r[7],I=this.r[8],G=this.r[9];n>=16;)e=255&r[t+0]|(255&r[t+1])<<8,E+=8191&e,o=255&r[t+2]|(255&r[t+3])<<8,x+=8191&(e>>>13|o<<3),i=255&r[t+4]|(255&r[t+5])<<8,M+=8191&(o>>>10|i<<6),h=255&r[t+6]|(255&r[t+7])<<8,m+=8191&(i>>>7|h<<9),a=255&r[t+8]|(255&r[t+9])<<8,B+=8191&(h>>>4|a<<12),S+=a>>>1&8191,f=255&r[t+10]|(255&r[t+11])<<8,K+=8191&(a>>>14|f<<2),s=255&r[t+12]|(255&r[t+13])<<8,T+=8191&(f>>>11|s<<5),u=255&r[t+14]|(255&r[t+15])<<8,Y+=8191&(s>>>8|u<<8),k+=u>>>5|U,c=0,y=c,y+=E*L,y+=x*(5*G),y+=M*(5*I),y+=m*(5*F),y+=B*(5*C),c=y>>>13,y&=8191,y+=S*(5*N),y+=K*(5*O),y+=T*(5*P),y+=Y*(5*R),y+=k*(5*z),c+=y>>>13,y&=8191,l=c,l+=E*z,l+=x*L,l+=M*(5*G),l+=m*(5*I),l+=B*(5*F),c=l>>>13,l&=8191,l+=S*(5*C),l+=K*(5*N),l+=T*(5*O),l+=Y*(5*P),l+=k*(5*R),c+=l>>>13,l&=8191,w=c,w+=E*R,w+=x*z,w+=M*L,w+=m*(5*G),w+=B*(5*I),c=w>>>13,w&=8191,w+=S*(5*F),w+=K*(5*C),w+=T*(5*N),w+=Y*(5*O),w+=k*(5*P),c+=w>>>13,w&=8191,p=c,p+=E*P,p+=x*R,p+=M*z,p+=m*L,p+=B*(5*G),c=p>>>13,p&=8191,p+=S*(5*I),p+=K*(5*F),p+=T*(5*C),p+=Y*(5*N),p+=k*(5*O),c+=p>>>13,p&=8191,v=c,v+=E*O,v+=x*P,v+=M*R,v+=m*z,v+=B*L,c=v>>>13,v&=8191,v+=S*(5*G),v+=K*(5*I),v+=T*(5*F),v+=Y*(5*C),v+=k*(5*N),c+=v>>>13,v&=8191,b=c,b+=E*N,b+=x*O,b+=M*P,b+=m*R,b+=B*z,c=b>>>13,b&=8191,b+=S*L,b+=K*(5*G),b+=T*(5*I),b+=Y*(5*F),b+=k*(5*C),c+=b>>>13,b&=8191,g=c,g+=E*C,g+=x*N,g+=M*O,g+=m*P,g+=B*R,c=g>>>13,g&=8191,g+=S*z,g+=K*L,g+=T*(5*G),g+=Y*(5*I),g+=k*(5*F),c+=g>>>13,g&=8191,_=c,_+=E*F,_+=x*C,_+=M*N,_+=m*O,_+=B*P,c=_>>>13,_&=8191,_+=S*R,_+=K*z,_+=T*L,_+=Y*(5*G),_+=k*(5*I),c+=_>>>13,_&=8191,A=c,A+=E*I,A+=x*F,A+=M*C,A+=m*N,A+=B*O,c=A>>>13,A&=8191,A+=S*P,A+=K*R,A+=T*z,A+=Y*L,A+=k*(5*G),c+=A>>>13,A&=8191,d=c,d+=E*G,d+=x*I,d+=M*F,d+=m*C,d+=B*N,c=d>>>13,d&=8191,d+=S*O,d+=K*P,d+=T*R,d+=Y*z,d+=k*L,c+=d>>>13,d&=8191,c=(c<<2)+c|0,c=c+y|0,y=8191&c,c>>>=13,l+=c,E=y,x=l,M=w,m=p,B=v,S=b,K=g,T=_,Y=A,k=d,t+=16,n-=16;this.h[0]=E,this.h[1]=x,this.h[2]=M,this.h[3]=m,this.h[4]=B,this.h[5]=S,this.h[6]=K,this.h[7]=T,this.h[8]=Y,this.h[9]=k},yr.prototype.finish=function(r,t){var n,e,o,i,h=new Uint16Array(10);if(this.leftover){for(i=this.leftover,this.buffer[i++]=1;16>i;i++)this.buffer[i]=0;this.fin=1,this.blocks(this.buffer,0,16)}for(n=this.h[1]>>>13,this.h[1]&=8191,i=2;10>i;i++)this.h[i]+=n,n=this.h[i]>>>13,this.h[i]&=8191;for(this.h[0]+=5*n,n=this.h[0]>>>13,this.h[0]&=8191,this.h[1]+=n,n=this.h[1]>>>13,this.h[1]&=8191,this.h[2]+=n,h[0]=this.h[0]+5,n=h[0]>>>13,h[0]&=8191,i=1;10>i;i++)h[i]=this.h[i]+n,n=h[i]>>>13,h[i]&=8191;for(h[9]-=8192,e=(1^n)-1,i=0;10>i;i++)h[i]&=e;for(e=~e,i=0;10>i;i++)this.h[i]=this.h[i]&e|h[i];for(this.h[0]=65535&(this.h[0]|this.h[1]<<13),this.h[1]=65535&(this.h[1]>>>3|this.h[2]<<10),this.h[2]=65535&(this.h[2]>>>6|this.h[3]<<7),this.h[3]=65535&(this.h[3]>>>9|this.h[4]<<4),this.h[4]=65535&(this.h[4]>>>12|this.h[5]<<1|this.h[6]<<14),this.h[5]=65535&(this.h[6]>>>2|this.h[7]<<11),this.h[6]=65535&(this.h[7]>>>5|this.h[8]<<8),this.h[7]=65535&(this.h[8]>>>8|this.h[9]<<5),o=this.h[0]+this.pad[0],this.h[0]=65535&o,i=1;8>i;i++)o=(this.h[i]+this.pad[i]|0)+(o>>>16)|0,this.h[i]=65535&o;r[t+0]=this.h[0]>>>0&255,r[t+1]=this.h[0]>>>8&255,r[t+2]=this.h[1]>>>0&255,r[t+3]=this.h[1]>>>8&255,r[t+4]=this.h[2]>>>0&255,r[t+5]=this.h[2]>>>8&255,r[t+6]=this.h[3]>>>0&255,r[t+7]=this.h[3]>>>8&255,r[t+8]=this.h[4]>>>0&255,r[t+9]=this.h[4]>>>8&255,r[t+10]=this.h[5]>>>0&255,r[t+11]=this.h[5]>>>8&255,r[t+12]=this.h[6]>>>0&255,r[t+13]=this.h[6]>>>8&255,r[t+14]=this.h[7]>>>0&255,r[t+15]=this.h[7]>>>8&255},yr.prototype.update=function(r,t,n){var e,o;if(this.leftover){for(o=16-this.leftover,o>n&&(o=n),e=0;o>e;e++)this.buffer[this.leftover+e]=r[t+e];if(n-=o,t+=o,this.leftover+=o,this.leftover<16)return;this.blocks(this.buffer,0,16),this.leftover=0}if(n>=16&&(o=n-n%16,this.blocks(r,t,o),t+=o,n-=o),n){for(e=0;n>e;e++)this.buffer[this.leftover+e]=r[t+e];this.leftover+=n}};var lr=p,wr=v,pr=[1116352408,3609767458,1899447441,602891725,3049323471,3964484399,3921009573,2173295548,961987163,4081628472,1508970993,3053834265,2453635748,2937671579,2870763221,3664609560,3624381080,2734883394,310598401,1164996542,607225278,1323610764,1426881987,3590304994,1925078388,4068182383,2162078206,991336113,2614888103,633803317,3248222580,3479774868,3835390401,2666613458,4022224774,944711139,264347078,2341262773,604807628,2007800933,770255983,1495990901,1249150122,1856431235,1555081692,3175218132,1996064986,2198950837,2554220882,3999719339,2821834349,766784016,2952996808,2566594879,3210313671,3203337956,3336571891,1034457026,3584528711,2466948901,113926993,3758326383,338241895,168717936,666307205,1188179964,773529912,1546045734,1294757372,1522805485,1396182291,2643833823,1695183700,2343527390,1986661051,1014477480,2177026350,1206759142,2456956037,344077627,2730485921,1290863460,2820302411,3158454273,3259730800,3505952657,3345764771,106217008,3516065817,3606008344,3600352804,1432725776,4094571909,1467031594,275423344,851169720,430227734,3100823752,506948616,1363258195,659060556,3750685593,883997877,3785050280,958139571,3318307427,1322822218,3812723403,1537002063,2003034995,1747873779,3602036899,1955562222,1575990012,2024104815,1125592928,2227730452,2716904306,2361852424,442776044,2428436474,593698344,2756734187,3733110249,3204031479,2999351573,3329325298,3815920427,3391569614,3928383900,3515267271,566280711,3940187606,3454069534,4118630271,4000239992,116418474,1914138554,174292421,2731055270,289380356,3203993006,460393269,320620315,685471733,587496836,852142971,1086792851,1017036298,365543100,1126000580,2618297676,1288033470,3409855158,1501505948,4234509866,1607167915,987167468,1816402316,1246189591],vr=new Float64Array([237,211,245,92,26,99,18,88,214,156,247,162,222,249,222,20,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16]),br=32,gr=24,_r=32,Ar=16,dr=32,Ur=32,Er=32,xr=32,Mr=32,mr=gr,Br=_r,Sr=Ar,Kr=64,Tr=32,Yr=64,kr=32,Lr=64;r.lowlevel={crypto_core_hsalsa20:f,crypto_stream_xor:y,crypto_stream:c,crypto_stream_salsa20_xor:s,crypto_stream_salsa20:u,crypto_onetimeauth:l,crypto_onetimeauth_verify:w,crypto_verify_16:e,crypto_verify_32:o,crypto_secretbox:p,crypto_secretbox_open:v,crypto_scalarmult:T,crypto_scalarmult_base:Y,crypto_box_beforenm:L,crypto_box_afternm:lr,crypto_box:z,crypto_box_open:R,crypto_box_keypair:k,crypto_hash:O,crypto_sign:V,crypto_sign_keypair:Z,crypto_sign_open:D,crypto_secretbox_KEYBYTES:br,crypto_secretbox_NONCEBYTES:gr,crypto_secretbox_ZEROBYTES:_r,crypto_secretbox_BOXZEROBYTES:Ar,crypto_scalarmult_BYTES:dr,crypto_scalarmult_SCALARBYTES:Ur,crypto_box_PUBLICKEYBYTES:Er,crypto_box_SECRETKEYBYTES:xr,crypto_box_BEFORENMBYTES:Mr,crypto_box_NONCEBYTES:mr,crypto_box_ZEROBYTES:Br,crypto_box_BOXZEROBYTES:Sr,crypto_sign_BYTES:Kr,crypto_sign_PUBLICKEYBYTES:Tr,crypto_sign_SECRETKEYBYTES:Yr,crypto_sign_SEEDBYTES:kr,crypto_hash_BYTES:Lr},r.util||(r.util={},r.util.decodeUTF8=r.util.encodeUTF8=r.util.encodeBase64=r.util.decodeBase64=function(){throw new Error("nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js")}),r.randomBytes=function(r){var t=new Uint8Array(r);return rr(t,r),t},r.secretbox=function(r,t,n){Q(r,t,n),H(n,t);for(var e=new Uint8Array(_r+r.length),o=new Uint8Array(e.length),i=0;ie)return null;for(var o=new Uint8Array(e),i=0;ie;e++)o[e]=t[e];for(e=0;e=0},r.sign.keyPair=function(){var r=new Uint8Array(Tr),t=new Uint8Array(Yr);return Z(r,t),{publicKey:r,secretKey:t}},r.sign.keyPair.fromSecretKey=function(r){if(Q(r),r.length!==Yr)throw new Error("bad secret key size");for(var t=new Uint8Array(Tr),n=0;ne;e++)n[e]=r[e];return Z(t,n,!0),{publicKey:t,secretKey:n}},r.sign.publicKeyLength=Tr,r.sign.secretKeyLength=Yr,r.sign.seedLength=kr,r.sign.signatureLength=Kr,r.hash=function(r){Q(r);var t=new Uint8Array(Lr);return O(t,r,r.length),t},r.hash.hashLength=Lr,r.verify=function(r,t){return Q(r,t), +0===r.length||0===t.length?!1:r.length!==t.length?!1:0===n(r,0,t,0,r.length)?!0:!1},r.setPRNG=function(r){rr=r},function(){var t="undefined"!=typeof self?self.crypto||self.msCrypto:null;if(t&&t.getRandomValues){var n=65536;r.setPRNG(function(r,e){var o,i=new Uint8Array(e);for(o=0;e>o;o+=n)t.getRandomValues(i.subarray(o,o+Math.min(e-o,n)));for(o=0;e>o;o++)r[o]=i[o];W(i)})}else"undefined"!=typeof require&&(t=require("crypto"),t&&t.randomBytes&&r.setPRNG(function(r,n){var e,o=t.randomBytes(n);for(e=0;n>e;e++)r[e]=o[e];W(o)}))}()}("undefined"!=typeof module&&module.exports?module.exports:self.nacl=self.nacl||{}); \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.js index b8edbbee692cdf..f72dd78d12550f 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.js @@ -944,39 +944,13 @@ function cleanup(arr) { for (var i = 0; i < arr.length; i++) arr[i] = 0; } -nacl.util = {}; - -nacl.util.decodeUTF8 = function(s) { - var i, d = unescape(encodeURIComponent(s)), b = new Uint8Array(d.length); - for (i = 0; i < d.length; i++) b[i] = d.charCodeAt(i); - return b; -}; - -nacl.util.encodeUTF8 = function(arr) { - var i, s = []; - for (i = 0; i < arr.length; i++) s.push(String.fromCharCode(arr[i])); - return decodeURIComponent(escape(s.join(''))); -}; - -nacl.util.encodeBase64 = function(arr) { - if (typeof btoa === 'undefined') { - return (new Buffer(arr)).toString('base64'); - } else { - var i, s = [], len = arr.length; - for (i = 0; i < len; i++) s.push(String.fromCharCode(arr[i])); - return btoa(s.join('')); - } -}; - -nacl.util.decodeBase64 = function(s) { - if (typeof atob === 'undefined') { - return new Uint8Array(Array.prototype.slice.call(new Buffer(s, 'base64'), 0)); - } else { - var i, d = atob(s), b = new Uint8Array(d.length); - for (i = 0; i < d.length; i++) b[i] = d.charCodeAt(i); - return b; - } -}; +// TODO: Completely remove this in v0.15. +if (!nacl.util) { + nacl.util = {}; + nacl.util.decodeUTF8 = nacl.util.encodeUTF8 = nacl.util.encodeBase64 = nacl.util.decodeBase64 = function() { + throw new Error('nacl.util moved into separate package: https://github.com/dchest/tweetnacl-util-js'); + }; +} nacl.randomBytes = function(n) { var b = new Uint8Array(n); @@ -1173,26 +1147,22 @@ nacl.setPRNG = function(fn) { (function() { // Initialize PRNG if environment provides CSPRNG. // If not, methods calling randombytes will throw. - var crypto; - if (typeof window !== 'undefined') { - // Browser. - if (window.crypto && window.crypto.getRandomValues) { - crypto = window.crypto; // Standard - } else if (window.msCrypto && window.msCrypto.getRandomValues) { - crypto = window.msCrypto; // Internet Explorer 11+ - } - if (crypto) { - nacl.setPRNG(function(x, n) { - var i, v = new Uint8Array(n); - crypto.getRandomValues(v); - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } + var crypto = typeof self !== 'undefined' ? (self.crypto || self.msCrypto) : null; + if (crypto && crypto.getRandomValues) { + // Browsers. + var QUOTA = 65536; + nacl.setPRNG(function(x, n) { + var i, v = new Uint8Array(n); + for (i = 0; i < n; i += QUOTA) { + crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); + } + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); } else if (typeof require !== 'undefined') { // Node.js. crypto = require('crypto'); - if (crypto) { + if (crypto && crypto.randomBytes) { nacl.setPRNG(function(x, n) { var i, v = crypto.randomBytes(n); for (i = 0; i < n; i++) x[i] = v[i]; @@ -1202,4 +1172,4 @@ nacl.setPRNG = function(fn) { } })(); -})(typeof module !== 'undefined' && module.exports ? module.exports : (window.nacl = window.nacl || {})); +})(typeof module !== 'undefined' && module.exports ? module.exports : (self.nacl = self.nacl || {})); diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.min.js b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.min.js index 95d869502e4b0d..eed3854153ec05 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.min.js +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/nacl.min.js @@ -1 +1 @@ -!function(r){"use strict";function n(r,n){return r<>>32-n}function e(r,n){var e=255&r[n+3];return e=e<<8|255&r[n+2],e=e<<8|255&r[n+1],e<<8|255&r[n+0]}function t(r,n){var e=r[n]<<24|r[n+1]<<16|r[n+2]<<8|r[n+3],t=r[n+4]<<24|r[n+5]<<16|r[n+6]<<8|r[n+7];return new lr(e,t)}function o(r,n,e){var t;for(t=0;4>t;t++)r[n+t]=255&e,e>>>=8}function i(r,n,e){r[n]=e.hi>>24&255,r[n+1]=e.hi>>16&255,r[n+2]=e.hi>>8&255,r[n+3]=255&e.hi,r[n+4]=e.lo>>24&255,r[n+5]=e.lo>>16&255,r[n+6]=e.lo>>8&255,r[n+7]=255&e.lo}function a(r,n,e,t,o){var i,a=0;for(i=0;o>i;i++)a|=r[n+i]^e[t+i];return(1&a-1>>>8)-1}function f(r,n,e,t){return a(r,n,e,t,16)}function u(r,n,e,t){return a(r,n,e,t,32)}function c(r,t,i,a,f){var u,c,w,y=new Uint32Array(16),s=new Uint32Array(16),l=new Uint32Array(16),h=new Uint32Array(4);for(u=0;4>u;u++)s[5*u]=e(a,4*u),s[1+u]=e(i,4*u),s[6+u]=e(t,4*u),s[11+u]=e(i,16+4*u);for(u=0;16>u;u++)l[u]=s[u];for(u=0;20>u;u++){for(c=0;4>c;c++){for(w=0;4>w;w++)h[w]=s[(5*c+4*w)%16];for(h[1]^=n(h[0]+h[3]|0,7),h[2]^=n(h[1]+h[0]|0,9),h[3]^=n(h[2]+h[1]|0,13),h[0]^=n(h[3]+h[2]|0,18),w=0;4>w;w++)y[4*c+(c+w)%4]=h[w]}for(w=0;16>w;w++)s[w]=y[w]}if(f){for(u=0;16>u;u++)s[u]=s[u]+l[u]|0;for(u=0;4>u;u++)s[5*u]=s[5*u]-e(a,4*u)|0,s[6+u]=s[6+u]-e(t,4*u)|0;for(u=0;4>u;u++)o(r,4*u,s[5*u]),o(r,16+4*u,s[6+u])}else for(u=0;16>u;u++)o(r,4*u,s[u]+l[u]|0)}function w(r,n,e,t){return c(r,n,e,t,!1),0}function y(r,n,e,t){return c(r,n,e,t,!0),0}function s(r,n,e,t,o,i,a){var f,u,c=new Uint8Array(16),y=new Uint8Array(64);if(!o)return 0;for(u=0;16>u;u++)c[u]=0;for(u=0;8>u;u++)c[u]=i[u];for(;o>=64;){for(w(y,c,a,Br),u=0;64>u;u++)r[n+u]=(e?e[t+u]:0)^y[u];for(f=1,u=8;16>u;u++)f=f+(255&c[u])|0,c[u]=255&f,f>>>=8;o-=64,n+=64,e&&(t+=64)}if(o>0)for(w(y,c,a,Br),u=0;o>u;u++)r[n+u]=(e?e[t+u]:0)^y[u];return 0}function l(r,n,e,t,o){return s(r,n,null,0,e,t,o)}function h(r,n,e,t,o){var i=new Uint8Array(32);return y(i,t,o,Br),l(r,n,e,t.subarray(16),i)}function g(r,n,e,t,o,i,a){var f=new Uint8Array(32);return y(f,i,a,Br),s(r,n,e,t,o,i.subarray(16),f)}function p(r,n){var e,t=0;for(e=0;17>e;e++)t=t+(r[e]+n[e]|0)|0,r[e]=255&t,t>>>=8}function v(r,n,e,t,o,i){var a,f,u,c,w=new Uint32Array(17),y=new Uint32Array(17),s=new Uint32Array(17),l=new Uint32Array(17),h=new Uint32Array(17);for(u=0;17>u;u++)y[u]=s[u]=0;for(u=0;16>u;u++)y[u]=i[u];for(y[3]&=15,y[4]&=252,y[7]&=15,y[8]&=252,y[11]&=15,y[12]&=252,y[15]&=15;o>0;){for(u=0;17>u;u++)l[u]=0;for(u=0;16>u&&o>u;++u)l[u]=e[t+u];for(l[u]=1,t+=u,o-=u,p(s,l),f=0;17>f;f++)for(w[f]=0,u=0;17>u;u++)w[f]=w[f]+s[u]*(f>=u?y[f-u]:320*y[f+17-u]|0)|0|0;for(f=0;17>f;f++)s[f]=w[f];for(c=0,u=0;16>u;u++)c=c+s[u]|0,s[u]=255&c,c>>>=8;for(c=c+s[16]|0,s[16]=3&c,c=5*(c>>>2)|0,u=0;16>u;u++)c=c+s[u]|0,s[u]=255&c,c>>>=8;c=c+s[16]|0,s[16]=c}for(u=0;17>u;u++)h[u]=s[u];for(p(s,Sr),a=0|-(s[16]>>>7),u=0;17>u;u++)s[u]^=a&(h[u]^s[u]);for(u=0;16>u;u++)l[u]=i[u+16];for(l[16]=0,p(s,l),u=0;16>u;u++)r[n+u]=s[u];return 0}function b(r,n,e,t,o,i){var a=new Uint8Array(16);return v(a,0,e,t,o,i),f(r,n,a,0)}function A(r,n,e,t,o){var i;if(32>e)return-1;for(g(r,0,n,0,e,t,o),v(r,16,r,32,e-32,r),i=0;16>i;i++)r[i]=0;return 0}function U(r,n,e,t,o){var i,a=new Uint8Array(32);if(32>e)return-1;if(h(a,0,32,t,o),0!==b(n,16,n,32,e-32,a))return-1;for(g(r,0,n,0,e,t,o),i=0;32>i;i++)r[i]=0;return 0}function _(r,n){var e;for(e=0;16>e;e++)r[e]=0|n[e]}function d(r){var n,e;for(e=0;16>e;e++)r[e]+=65536,n=Math.floor(r[e]/65536),r[(e+1)*(15>e?1:0)]+=n-1+37*(n-1)*(15===e?1:0),r[e]-=65536*n}function E(r,n,e){for(var t,o=~(e-1),i=0;16>i;i++)t=o&(r[i]^n[i]),r[i]^=t,n[i]^=t}function x(r,n){var e,t,o,i=hr(),a=hr();for(e=0;16>e;e++)a[e]=n[e];for(d(a),d(a),d(a),t=0;2>t;t++){for(i[0]=a[0]-65517,e=1;15>e;e++)i[e]=a[e]-65535-(i[e-1]>>16&1),i[e-1]&=65535;i[15]=a[15]-32767-(i[14]>>16&1),o=i[15]>>16&1,i[14]&=65535,E(a,i,1-o)}for(e=0;16>e;e++)r[2*e]=255&a[e],r[2*e+1]=a[e]>>8}function m(r,n){var e=new Uint8Array(32),t=new Uint8Array(32);return x(e,r),x(t,n),u(e,0,t,0)}function B(r){var n=new Uint8Array(32);return x(n,r),1&n[0]}function S(r,n){var e;for(e=0;16>e;e++)r[e]=n[2*e]+(n[2*e+1]<<8);r[15]&=32767}function K(r,n,e){var t;for(t=0;16>t;t++)r[t]=n[t]+e[t]|0}function T(r,n,e){var t;for(t=0;16>t;t++)r[t]=n[t]-e[t]|0}function Y(r,n,e){var t,o,i=new Float64Array(31);for(t=0;31>t;t++)i[t]=0;for(t=0;16>t;t++)for(o=0;16>o;o++)i[t+o]+=n[t]*e[o];for(t=0;15>t;t++)i[t]+=38*i[t+16];for(t=0;16>t;t++)r[t]=i[t];d(r),d(r)}function L(r,n){Y(r,n,n)}function C(r,n){var e,t=hr();for(e=0;16>e;e++)t[e]=n[e];for(e=253;e>=0;e--)L(t,t),2!==e&&4!==e&&Y(t,t,n);for(e=0;16>e;e++)r[e]=t[e]}function R(r,n){var e,t=hr();for(e=0;16>e;e++)t[e]=n[e];for(e=250;e>=0;e--)L(t,t),1!==e&&Y(t,t,n);for(e=0;16>e;e++)r[e]=t[e]}function k(r,n,e){var t,o,i=new Uint8Array(32),a=new Float64Array(80),f=hr(),u=hr(),c=hr(),w=hr(),y=hr(),s=hr();for(o=0;31>o;o++)i[o]=n[o];for(i[31]=127&n[31]|64,i[0]&=248,S(a,e),o=0;16>o;o++)u[o]=a[o],w[o]=f[o]=c[o]=0;for(f[0]=w[0]=1,o=254;o>=0;--o)t=i[o>>>3]>>>(7&o)&1,E(f,u,t),E(c,w,t),K(y,f,c),T(f,f,c),K(c,u,w),T(u,u,w),L(w,y),L(s,f),Y(f,c,f),Y(c,u,y),K(y,f,c),T(f,f,c),L(u,f),T(c,w,s),Y(f,c,Ur),K(f,f,w),Y(c,c,f),Y(f,w,s),Y(w,u,a),L(u,y),E(f,u,t),E(c,w,t);for(o=0;16>o;o++)a[o+16]=f[o],a[o+32]=c[o],a[o+48]=u[o],a[o+64]=w[o];var l=a.subarray(32),h=a.subarray(16);return C(l,l),Y(h,h,l),x(r,h),0}function z(r,n){return k(r,n,vr)}function P(r,n){return gr(n,32),z(r,n)}function O(r,n,e){var t=new Uint8Array(32);return k(t,e,n),y(r,pr,t,Br)}function F(r,n,e,t,o,i){var a=new Uint8Array(32);return O(a,o,i),Kr(r,n,e,t,a)}function N(r,n,e,t,o,i){var a=new Uint8Array(32);return O(a,o,i),Tr(r,n,e,t,a)}function M(){var r,n,e,t=0,o=0,i=0,a=0,f=65535;for(e=0;e>>16,i+=n&f,a+=n>>>16;return o+=t>>>16,i+=o>>>16,a+=i>>>16,new lr(i&f|a<<16,t&f|o<<16)}function j(r,n){return new lr(r.hi>>>n,r.lo>>>n|r.hi<<32-n)}function G(){var r,n=0,e=0;for(r=0;rn?(e=r.hi>>>n|r.lo<>>n|r.hi<n&&(e=r.lo>>>n|r.hi<>>n|r.lo<a;a++)u[a]=w[a]=t(r,8*a);for(var s=0;e>=128;){for(a=0;16>a;a++)y[a]=t(n,8*a+s);for(a=0;80>a;a++){for(f=0;8>f;f++)c[f]=w[f];for(o=M(w[7],X(w[4]),Z(w[4],w[5],w[6]),Yr[a],y[a%16]),c[7]=M(o,q(w[0]),V(w[0],w[1],w[2])),c[3]=M(c[3],o),f=0;8>f;f++)w[(f+1)%8]=c[f];if(a%16===15)for(f=0;16>f;f++)y[f]=M(y[f],y[(f+9)%16],D(y[(f+1)%16]),H(y[(f+14)%16]))}for(a=0;8>a;a++)w[a]=M(w[a],u[a]),u[a]=w[a];s+=128,e-=128}for(a=0;8>a;a++)i(r,8*a,u[a]);return e}function Q(r,n,e){var t,o=new Uint8Array(64),a=new Uint8Array(256),f=e;for(t=0;64>t;t++)o[t]=Lr[t];for(J(o,n,e),e%=128,t=0;256>t;t++)a[t]=0;for(t=0;e>t;t++)a[t]=n[f-e+t];for(a[e]=128,e=256-128*(112>e?1:0),a[e-9]=0,i(a,e-8,new lr(f/536870912|0,f<<3)),J(o,a,e),t=0;64>t;t++)r[t]=o[t];return 0}function W(r,n){var e=hr(),t=hr(),o=hr(),i=hr(),a=hr(),f=hr(),u=hr(),c=hr(),w=hr();T(e,r[1],r[0]),T(w,n[1],n[0]),Y(e,e,w),K(t,r[0],r[1]),K(w,n[0],n[1]),Y(t,t,w),Y(o,r[3],n[3]),Y(o,o,dr),Y(i,r[2],n[2]),K(i,i,i),T(a,t,e),T(f,i,o),K(u,i,o),K(c,t,e),Y(r[0],a,f),Y(r[1],c,u),Y(r[2],u,f),Y(r[3],a,c)}function $(r,n,e){var t;for(t=0;4>t;t++)E(r[t],n[t],e)}function rr(r,n){var e=hr(),t=hr(),o=hr();C(o,n[2]),Y(e,n[0],o),Y(t,n[1],o),x(r,t),r[31]^=B(e)<<7}function nr(r,n,e){var t,o;for(_(r[0],br),_(r[1],Ar),_(r[2],Ar),_(r[3],br),o=255;o>=0;--o)t=e[o/8|0]>>(7&o)&1,$(r,n,t),W(n,r),W(r,r),$(r,n,t)}function er(r,n){var e=[hr(),hr(),hr(),hr()];_(e[0],Er),_(e[1],xr),_(e[2],Ar),Y(e[3],Er,xr),nr(r,e,n)}function tr(r,n,e){var t,o=new Uint8Array(64),i=[hr(),hr(),hr(),hr()];for(e||gr(n,32),Q(o,n,32),o[0]&=248,o[31]&=127,o[31]|=64,er(i,o),rr(r,i),t=0;32>t;t++)n[t+32]=r[t];return 0}function or(r,n){var e,t,o,i;for(t=63;t>=32;--t){for(e=0,o=t-32,i=t-12;i>o;++o)n[o]+=e-16*n[t]*Cr[o-(t-32)],e=n[o]+128>>8,n[o]-=256*e;n[o]+=e,n[t]=0}for(e=0,o=0;32>o;o++)n[o]+=e-(n[31]>>4)*Cr[o],e=n[o]>>8,n[o]&=255;for(o=0;32>o;o++)n[o]-=e*Cr[o];for(t=0;32>t;t++)n[t+1]+=n[t]>>8,r[t]=255&n[t]}function ir(r){var n,e=new Float64Array(64);for(n=0;64>n;n++)e[n]=r[n];for(n=0;64>n;n++)r[n]=0;or(r,e)}function ar(r,n,e,t){var o,i,a=new Uint8Array(64),f=new Uint8Array(64),u=new Uint8Array(64),c=new Float64Array(64),w=[hr(),hr(),hr(),hr()];Q(a,t,32),a[0]&=248,a[31]&=127,a[31]|=64;var y=e+64;for(o=0;e>o;o++)r[64+o]=n[o];for(o=0;32>o;o++)r[32+o]=a[32+o];for(Q(u,r.subarray(32),e+32),ir(u),er(w,u),rr(r,w),o=32;64>o;o++)r[o]=t[o];for(Q(f,r,e+64),ir(f),o=0;64>o;o++)c[o]=0;for(o=0;32>o;o++)c[o]=u[o];for(o=0;32>o;o++)for(i=0;32>i;i++)c[o+i]+=f[o]*a[i];return or(r.subarray(32),c),y}function fr(r,n){var e=hr(),t=hr(),o=hr(),i=hr(),a=hr(),f=hr(),u=hr();return _(r[2],Ar),S(r[1],n),L(o,r[1]),Y(i,o,_r),T(o,o,r[2]),K(i,r[2],i),L(a,i),L(f,a),Y(u,f,a),Y(e,u,o),Y(e,e,i),R(e,e),Y(e,e,o),Y(e,e,i),Y(e,e,i),Y(r[0],e,i),L(t,r[0]),Y(t,t,i),m(t,o)&&Y(r[0],r[0],mr),L(t,r[0]),Y(t,t,i),m(t,o)?-1:(B(r[0])===n[31]>>7&&T(r[0],br,r[0]),Y(r[3],r[0],r[1]),0)}function ur(r,n,e,t){var o,i,a=new Uint8Array(32),f=new Uint8Array(64),c=[hr(),hr(),hr(),hr()],w=[hr(),hr(),hr(),hr()];if(i=-1,64>e)return-1;if(fr(w,t))return-1;for(o=0;e>o;o++)r[o]=n[o];for(o=0;32>o;o++)r[o+32]=t[o];if(Q(f,r,e),ir(f),nr(c,w,f),er(w,n.subarray(32)),W(c,w),rr(a,c),e-=64,u(n,0,a,0)){for(o=0;e>o;o++)r[o]=0;return-1}for(o=0;e>o;o++)r[o]=n[o+64];return i=e}function cr(r,n){if(r.length!==Rr)throw new Error("bad key size");if(n.length!==kr)throw new Error("bad nonce size")}function wr(r,n){if(r.length!==Nr)throw new Error("bad public key size");if(n.length!==Mr)throw new Error("bad secret key size")}function yr(){var r,n;for(n=0;nn;n++)e.push(String.fromCharCode(r[n]));return btoa(e.join(""))},r.util.decodeBase64=function(r){if("undefined"==typeof atob)return new Uint8Array(Array.prototype.slice.call(new Buffer(r,"base64"),0));var n,e=atob(r),t=new Uint8Array(e.length);for(n=0;nt)return null;for(var o=new Uint8Array(t),i=0;it;t++)o[t]=n[t];for(t=0;t=0},r.sign.keyPair=function(){var r=new Uint8Array(qr),n=new Uint8Array(Xr);return tr(r,n),{publicKey:r,secretKey:n}},r.sign.keyPair.fromSecretKey=function(r){if(yr(r),r.length!==Xr)throw new Error("bad secret key size");for(var n=new Uint8Array(qr),e=0;et;t++)e[t]=r[t];return tr(n,e,!0),{publicKey:n,secretKey:e}},r.sign.publicKeyLength=qr,r.sign.secretKeyLength=Xr,r.sign.seedLength=Dr,r.sign.signatureLength=Vr,r.hash=function(r){yr(r);var n=new Uint8Array(Hr);return Q(n,r,r.length),n},r.hash.hashLength=Hr,r.verify=function(r,n){return yr(r,n),0===r.length||0===n.length?!1:r.length!==n.length?!1:0===a(r,0,n,0,r.length)?!0:!1},r.setPRNG=function(r){gr=r},function(){var n;"undefined"!=typeof window?(window.crypto&&window.crypto.getRandomValues?n=window.crypto:window.msCrypto&&window.msCrypto.getRandomValues&&(n=window.msCrypto),n&&r.setPRNG(function(r,e){var t,o=new Uint8Array(e);for(n.getRandomValues(o),t=0;e>t;t++)r[t]=o[t];sr(o)})):"undefined"!=typeof require&&(n=require("crypto"),n&&r.setPRNG(function(r,e){var t,o=n.randomBytes(e);for(t=0;e>t;t++)r[t]=o[t];sr(o)}))}()}("undefined"!=typeof module&&module.exports?module.exports:window.nacl=window.nacl||{}); \ No newline at end of file +!function(r){"use strict";function n(r,n){return r<>>32-n}function e(r,n){var e=255&r[n+3];return e=e<<8|255&r[n+2],e=e<<8|255&r[n+1],e<<8|255&r[n+0]}function t(r,n){var e=r[n]<<24|r[n+1]<<16|r[n+2]<<8|r[n+3],t=r[n+4]<<24|r[n+5]<<16|r[n+6]<<8|r[n+7];return new lr(e,t)}function o(r,n,e){var t;for(t=0;4>t;t++)r[n+t]=255&e,e>>>=8}function i(r,n,e){r[n]=e.hi>>24&255,r[n+1]=e.hi>>16&255,r[n+2]=e.hi>>8&255,r[n+3]=255&e.hi,r[n+4]=e.lo>>24&255,r[n+5]=e.lo>>16&255,r[n+6]=e.lo>>8&255,r[n+7]=255&e.lo}function a(r,n,e,t,o){var i,a=0;for(i=0;o>i;i++)a|=r[n+i]^e[t+i];return(1&a-1>>>8)-1}function f(r,n,e,t){return a(r,n,e,t,16)}function u(r,n,e,t){return a(r,n,e,t,32)}function c(r,t,i,a,f){var u,c,w,y=new Uint32Array(16),s=new Uint32Array(16),l=new Uint32Array(16),h=new Uint32Array(4);for(u=0;4>u;u++)s[5*u]=e(a,4*u),s[1+u]=e(i,4*u),s[6+u]=e(t,4*u),s[11+u]=e(i,16+4*u);for(u=0;16>u;u++)l[u]=s[u];for(u=0;20>u;u++){for(c=0;4>c;c++){for(w=0;4>w;w++)h[w]=s[(5*c+4*w)%16];for(h[1]^=n(h[0]+h[3]|0,7),h[2]^=n(h[1]+h[0]|0,9),h[3]^=n(h[2]+h[1]|0,13),h[0]^=n(h[3]+h[2]|0,18),w=0;4>w;w++)y[4*c+(c+w)%4]=h[w]}for(w=0;16>w;w++)s[w]=y[w]}if(f){for(u=0;16>u;u++)s[u]=s[u]+l[u]|0;for(u=0;4>u;u++)s[5*u]=s[5*u]-e(a,4*u)|0,s[6+u]=s[6+u]-e(t,4*u)|0;for(u=0;4>u;u++)o(r,4*u,s[5*u]),o(r,16+4*u,s[6+u])}else for(u=0;16>u;u++)o(r,4*u,s[u]+l[u]|0)}function w(r,n,e,t){return c(r,n,e,t,!1),0}function y(r,n,e,t){return c(r,n,e,t,!0),0}function s(r,n,e,t,o,i,a){var f,u,c=new Uint8Array(16),y=new Uint8Array(64);if(!o)return 0;for(u=0;16>u;u++)c[u]=0;for(u=0;8>u;u++)c[u]=i[u];for(;o>=64;){for(w(y,c,a,Br),u=0;64>u;u++)r[n+u]=(e?e[t+u]:0)^y[u];for(f=1,u=8;16>u;u++)f=f+(255&c[u])|0,c[u]=255&f,f>>>=8;o-=64,n+=64,e&&(t+=64)}if(o>0)for(w(y,c,a,Br),u=0;o>u;u++)r[n+u]=(e?e[t+u]:0)^y[u];return 0}function l(r,n,e,t,o){return s(r,n,null,0,e,t,o)}function h(r,n,e,t,o){var i=new Uint8Array(32);return y(i,t,o,Br),l(r,n,e,t.subarray(16),i)}function g(r,n,e,t,o,i,a){var f=new Uint8Array(32);return y(f,i,a,Br),s(r,n,e,t,o,i.subarray(16),f)}function v(r,n){var e,t=0;for(e=0;17>e;e++)t=t+(r[e]+n[e]|0)|0,r[e]=255&t,t>>>=8}function b(r,n,e,t,o,i){var a,f,u,c,w=new Uint32Array(17),y=new Uint32Array(17),s=new Uint32Array(17),l=new Uint32Array(17),h=new Uint32Array(17);for(u=0;17>u;u++)y[u]=s[u]=0;for(u=0;16>u;u++)y[u]=i[u];for(y[3]&=15,y[4]&=252,y[7]&=15,y[8]&=252,y[11]&=15,y[12]&=252,y[15]&=15;o>0;){for(u=0;17>u;u++)l[u]=0;for(u=0;16>u&&o>u;++u)l[u]=e[t+u];for(l[u]=1,t+=u,o-=u,v(s,l),f=0;17>f;f++)for(w[f]=0,u=0;17>u;u++)w[f]=w[f]+s[u]*(f>=u?y[f-u]:320*y[f+17-u]|0)|0|0;for(f=0;17>f;f++)s[f]=w[f];for(c=0,u=0;16>u;u++)c=c+s[u]|0,s[u]=255&c,c>>>=8;for(c=c+s[16]|0,s[16]=3&c,c=5*(c>>>2)|0,u=0;16>u;u++)c=c+s[u]|0,s[u]=255&c,c>>>=8;c=c+s[16]|0,s[16]=c}for(u=0;17>u;u++)h[u]=s[u];for(v(s,Sr),a=0|-(s[16]>>>7),u=0;17>u;u++)s[u]^=a&(h[u]^s[u]);for(u=0;16>u;u++)l[u]=i[u+16];for(l[16]=0,v(s,l),u=0;16>u;u++)r[n+u]=s[u];return 0}function p(r,n,e,t,o,i){var a=new Uint8Array(16);return b(a,0,e,t,o,i),f(r,n,a,0)}function _(r,n,e,t,o){var i;if(32>e)return-1;for(g(r,0,n,0,e,t,o),b(r,16,r,32,e-32,r),i=0;16>i;i++)r[i]=0;return 0}function A(r,n,e,t,o){var i,a=new Uint8Array(32);if(32>e)return-1;if(h(a,0,32,t,o),0!==p(n,16,n,32,e-32,a))return-1;for(g(r,0,n,0,e,t,o),i=0;32>i;i++)r[i]=0;return 0}function U(r,n){var e;for(e=0;16>e;e++)r[e]=0|n[e]}function E(r){var n,e;for(e=0;16>e;e++)r[e]+=65536,n=Math.floor(r[e]/65536),r[(e+1)*(15>e?1:0)]+=n-1+37*(n-1)*(15===e?1:0),r[e]-=65536*n}function d(r,n,e){for(var t,o=~(e-1),i=0;16>i;i++)t=o&(r[i]^n[i]),r[i]^=t,n[i]^=t}function x(r,n){var e,t,o,i=hr(),a=hr();for(e=0;16>e;e++)a[e]=n[e];for(E(a),E(a),E(a),t=0;2>t;t++){for(i[0]=a[0]-65517,e=1;15>e;e++)i[e]=a[e]-65535-(i[e-1]>>16&1),i[e-1]&=65535;i[15]=a[15]-32767-(i[14]>>16&1),o=i[15]>>16&1,i[14]&=65535,d(a,i,1-o)}for(e=0;16>e;e++)r[2*e]=255&a[e],r[2*e+1]=a[e]>>8}function m(r,n){var e=new Uint8Array(32),t=new Uint8Array(32);return x(e,r),x(t,n),u(e,0,t,0)}function B(r){var n=new Uint8Array(32);return x(n,r),1&n[0]}function S(r,n){var e;for(e=0;16>e;e++)r[e]=n[2*e]+(n[2*e+1]<<8);r[15]&=32767}function K(r,n,e){var t;for(t=0;16>t;t++)r[t]=n[t]+e[t]|0}function T(r,n,e){var t;for(t=0;16>t;t++)r[t]=n[t]-e[t]|0}function Y(r,n,e){var t,o,i=new Float64Array(31);for(t=0;31>t;t++)i[t]=0;for(t=0;16>t;t++)for(o=0;16>o;o++)i[t+o]+=n[t]*e[o];for(t=0;15>t;t++)i[t]+=38*i[t+16];for(t=0;16>t;t++)r[t]=i[t];E(r),E(r)}function L(r,n){Y(r,n,n)}function k(r,n){var e,t=hr();for(e=0;16>e;e++)t[e]=n[e];for(e=253;e>=0;e--)L(t,t),2!==e&&4!==e&&Y(t,t,n);for(e=0;16>e;e++)r[e]=t[e]}function z(r,n){var e,t=hr();for(e=0;16>e;e++)t[e]=n[e];for(e=250;e>=0;e--)L(t,t),1!==e&&Y(t,t,n);for(e=0;16>e;e++)r[e]=t[e]}function R(r,n,e){var t,o,i=new Uint8Array(32),a=new Float64Array(80),f=hr(),u=hr(),c=hr(),w=hr(),y=hr(),s=hr();for(o=0;31>o;o++)i[o]=n[o];for(i[31]=127&n[31]|64,i[0]&=248,S(a,e),o=0;16>o;o++)u[o]=a[o],w[o]=f[o]=c[o]=0;for(f[0]=w[0]=1,o=254;o>=0;--o)t=i[o>>>3]>>>(7&o)&1,d(f,u,t),d(c,w,t),K(y,f,c),T(f,f,c),K(c,u,w),T(u,u,w),L(w,y),L(s,f),Y(f,c,f),Y(c,u,y),K(y,f,c),T(f,f,c),L(u,f),T(c,w,s),Y(f,c,Ar),K(f,f,w),Y(c,c,f),Y(f,w,s),Y(w,u,a),L(u,y),d(f,u,t),d(c,w,t);for(o=0;16>o;o++)a[o+16]=f[o],a[o+32]=c[o],a[o+48]=u[o],a[o+64]=w[o];var l=a.subarray(32),h=a.subarray(16);return k(l,l),Y(h,h,l),x(r,h),0}function P(r,n){return R(r,n,br)}function O(r,n){return gr(n,32),P(r,n)}function F(r,n,e){var t=new Uint8Array(32);return R(t,e,n),y(r,vr,t,Br)}function N(r,n,e,t,o,i){var a=new Uint8Array(32);return F(a,o,i),Kr(r,n,e,t,a)}function C(r,n,e,t,o,i){var a=new Uint8Array(32);return F(a,o,i),Tr(r,n,e,t,a)}function M(){var r,n,e,t=0,o=0,i=0,a=0,f=65535;for(e=0;e>>16,i+=n&f,a+=n>>>16;return o+=t>>>16,i+=o>>>16,a+=i>>>16,new lr(i&f|a<<16,t&f|o<<16)}function G(r,n){return new lr(r.hi>>>n,r.lo>>>n|r.hi<<32-n)}function Z(){var r,n=0,e=0;for(r=0;rn?(e=r.hi>>>n|r.lo<>>n|r.hi<n&&(e=r.lo>>>n|r.hi<>>n|r.lo<a;a++)u[a]=w[a]=t(r,8*a);for(var s=0;e>=128;){for(a=0;16>a;a++)y[a]=t(n,8*a+s);for(a=0;80>a;a++){for(f=0;8>f;f++)c[f]=w[f];for(o=M(w[7],X(w[4]),q(w[4],w[5],w[6]),Yr[a],y[a%16]),c[7]=M(o,V(w[0]),I(w[0],w[1],w[2])),c[3]=M(c[3],o),f=0;8>f;f++)w[(f+1)%8]=c[f];if(a%16===15)for(f=0;16>f;f++)y[f]=M(y[f],y[(f+9)%16],D(y[(f+1)%16]),H(y[(f+14)%16]))}for(a=0;8>a;a++)w[a]=M(w[a],u[a]),u[a]=w[a];s+=128,e-=128}for(a=0;8>a;a++)i(r,8*a,u[a]);return e}function Q(r,n,e){var t,o=new Uint8Array(64),a=new Uint8Array(256),f=e;for(t=0;64>t;t++)o[t]=Lr[t];for(J(o,n,e),e%=128,t=0;256>t;t++)a[t]=0;for(t=0;e>t;t++)a[t]=n[f-e+t];for(a[e]=128,e=256-128*(112>e?1:0),a[e-9]=0,i(a,e-8,new lr(f/536870912|0,f<<3)),J(o,a,e),t=0;64>t;t++)r[t]=o[t];return 0}function W(r,n){var e=hr(),t=hr(),o=hr(),i=hr(),a=hr(),f=hr(),u=hr(),c=hr(),w=hr();T(e,r[1],r[0]),T(w,n[1],n[0]),Y(e,e,w),K(t,r[0],r[1]),K(w,n[0],n[1]),Y(t,t,w),Y(o,r[3],n[3]),Y(o,o,Er),Y(i,r[2],n[2]),K(i,i,i),T(a,t,e),T(f,i,o),K(u,i,o),K(c,t,e),Y(r[0],a,f),Y(r[1],c,u),Y(r[2],u,f),Y(r[3],a,c)}function $(r,n,e){var t;for(t=0;4>t;t++)d(r[t],n[t],e)}function rr(r,n){var e=hr(),t=hr(),o=hr();k(o,n[2]),Y(e,n[0],o),Y(t,n[1],o),x(r,t),r[31]^=B(e)<<7}function nr(r,n,e){var t,o;for(U(r[0],pr),U(r[1],_r),U(r[2],_r),U(r[3],pr),o=255;o>=0;--o)t=e[o/8|0]>>(7&o)&1,$(r,n,t),W(n,r),W(r,r),$(r,n,t)}function er(r,n){var e=[hr(),hr(),hr(),hr()];U(e[0],dr),U(e[1],xr),U(e[2],_r),Y(e[3],dr,xr),nr(r,e,n)}function tr(r,n,e){var t,o=new Uint8Array(64),i=[hr(),hr(),hr(),hr()];for(e||gr(n,32),Q(o,n,32),o[0]&=248,o[31]&=127,o[31]|=64,er(i,o),rr(r,i),t=0;32>t;t++)n[t+32]=r[t];return 0}function or(r,n){var e,t,o,i;for(t=63;t>=32;--t){for(e=0,o=t-32,i=t-12;i>o;++o)n[o]+=e-16*n[t]*kr[o-(t-32)],e=n[o]+128>>8,n[o]-=256*e;n[o]+=e,n[t]=0}for(e=0,o=0;32>o;o++)n[o]+=e-(n[31]>>4)*kr[o],e=n[o]>>8,n[o]&=255;for(o=0;32>o;o++)n[o]-=e*kr[o];for(t=0;32>t;t++)n[t+1]+=n[t]>>8,r[t]=255&n[t]}function ir(r){var n,e=new Float64Array(64);for(n=0;64>n;n++)e[n]=r[n];for(n=0;64>n;n++)r[n]=0;or(r,e)}function ar(r,n,e,t){var o,i,a=new Uint8Array(64),f=new Uint8Array(64),u=new Uint8Array(64),c=new Float64Array(64),w=[hr(),hr(),hr(),hr()];Q(a,t,32),a[0]&=248,a[31]&=127,a[31]|=64;var y=e+64;for(o=0;e>o;o++)r[64+o]=n[o];for(o=0;32>o;o++)r[32+o]=a[32+o];for(Q(u,r.subarray(32),e+32),ir(u),er(w,u),rr(r,w),o=32;64>o;o++)r[o]=t[o];for(Q(f,r,e+64),ir(f),o=0;64>o;o++)c[o]=0;for(o=0;32>o;o++)c[o]=u[o];for(o=0;32>o;o++)for(i=0;32>i;i++)c[o+i]+=f[o]*a[i];return or(r.subarray(32),c),y}function fr(r,n){var e=hr(),t=hr(),o=hr(),i=hr(),a=hr(),f=hr(),u=hr();return U(r[2],_r),S(r[1],n),L(o,r[1]),Y(i,o,Ur),T(o,o,r[2]),K(i,r[2],i),L(a,i),L(f,a),Y(u,f,a),Y(e,u,o),Y(e,e,i),z(e,e),Y(e,e,o),Y(e,e,i),Y(e,e,i),Y(r[0],e,i),L(t,r[0]),Y(t,t,i),m(t,o)&&Y(r[0],r[0],mr),L(t,r[0]),Y(t,t,i),m(t,o)?-1:(B(r[0])===n[31]>>7&&T(r[0],pr,r[0]),Y(r[3],r[0],r[1]),0)}function ur(r,n,e,t){var o,i,a=new Uint8Array(32),f=new Uint8Array(64),c=[hr(),hr(),hr(),hr()],w=[hr(),hr(),hr(),hr()];if(i=-1,64>e)return-1;if(fr(w,t))return-1;for(o=0;e>o;o++)r[o]=n[o];for(o=0;32>o;o++)r[o+32]=t[o];if(Q(f,r,e),ir(f),nr(c,w,f),er(w,n.subarray(32)),W(c,w),rr(a,c),e-=64,u(n,0,a,0)){for(o=0;e>o;o++)r[o]=0;return-1}for(o=0;e>o;o++)r[o]=n[o+64];return i=e}function cr(r,n){if(r.length!==zr)throw new Error("bad key size");if(n.length!==Rr)throw new Error("bad nonce size")}function wr(r,n){if(r.length!==Cr)throw new Error("bad public key size");if(n.length!==Mr)throw new Error("bad secret key size")}function yr(){var r,n;for(n=0;nt)return null;for(var o=new Uint8Array(t),i=0;it;t++)o[t]=n[t];for(t=0;t=0},r.sign.keyPair=function(){var r=new Uint8Array(Vr),n=new Uint8Array(Xr);return tr(r,n),{publicKey:r,secretKey:n}},r.sign.keyPair.fromSecretKey=function(r){if(yr(r),r.length!==Xr)throw new Error("bad secret key size");for(var n=new Uint8Array(Vr),e=0;et;t++)e[t]=r[t];return tr(n,e,!0),{publicKey:n,secretKey:e}},r.sign.publicKeyLength=Vr,r.sign.secretKeyLength=Xr,r.sign.seedLength=Dr,r.sign.signatureLength=Ir,r.hash=function(r){yr(r);var n=new Uint8Array(Hr);return Q(n,r,r.length),n},r.hash.hashLength=Hr,r.verify=function(r,n){return yr(r,n),0===r.length||0===n.length?!1:r.length!==n.length?!1:0===a(r,0,n,0,r.length)?!0:!1},r.setPRNG=function(r){gr=r},function(){var n="undefined"!=typeof self?self.crypto||self.msCrypto:null;if(n&&n.getRandomValues){var e=65536;r.setPRNG(function(r,t){var o,i=new Uint8Array(t);for(o=0;t>o;o+=e)n.getRandomValues(i.subarray(o,o+Math.min(t-o,e)));for(o=0;t>o;o++)r[o]=i[o];sr(i)})}else"undefined"!=typeof require&&(n=require("crypto"),n&&n.randomBytes&&r.setPRNG(function(r,e){var t,o=n.randomBytes(e);for(t=0;e>t;t++)r[t]=o[t];sr(o)}))}()}("undefined"!=typeof module&&module.exports?module.exports:self.nacl=self.nacl||{}); \ No newline at end of file diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/package.json index 147ea92c406fa1..9e31f630bca074 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/package.json +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/node_modules/tweetnacl/package.json @@ -2,45 +2,49 @@ "_args": [ [ { - "raw": "tweetnacl@~0.13.0", + "raw": "tweetnacl@~0.14.0", "scope": null, "escapedName": "tweetnacl", "name": "tweetnacl", - "rawSpec": "~0.13.0", - "spec": ">=0.13.0 <0.14.0", + "rawSpec": "~0.14.0", + "spec": ">=0.14.0 <0.15.0", "type": "range" }, "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk" ] ], - "_from": "tweetnacl@>=0.13.0 <0.14.0", - "_id": "tweetnacl@0.13.3", + "_from": "tweetnacl@>=0.14.0 <0.15.0", + "_id": "tweetnacl@0.14.3", "_inCache": true, - "_installable": true, "_location": "/request/http-signature/sshpk/tweetnacl", - "_nodeVersion": "4.2.3", + "_nodeVersion": "5.6.0", + "_npmOperationalInternal": { + "host": "packages-16-east.internal.npmjs.com", + "tmp": "tmp/tweetnacl-0.14.3.tgz_1459224951636_0.7403244483284652" + }, "_npmUser": { "name": "dchest", "email": "dmitry@codingrobots.com" }, - "_npmVersion": "2.14.7", + "_npmVersion": "3.7.3", "_phantomChildren": {}, "_requested": { - "raw": "tweetnacl@~0.13.0", + "raw": "tweetnacl@~0.14.0", "scope": null, "escapedName": "tweetnacl", "name": "tweetnacl", - "rawSpec": "~0.13.0", - "spec": ">=0.13.0 <0.14.0", + "rawSpec": "~0.14.0", + "spec": ">=0.14.0 <0.15.0", "type": "range" }, "_requiredBy": [ - "/request/http-signature/sshpk" + "/request/http-signature/sshpk", + "/request/http-signature/sshpk/bcrypt-pbkdf" ], - "_resolved": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.13.3.tgz", - "_shasum": "d628b56f3bcc3d5ae74ba9d4c1a704def5ab4b56", + "_resolved": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.14.3.tgz", + "_shasum": "3da382f670f25ded78d7b3d1792119bca0b7132d", "_shrinkwrap": null, - "_spec": "tweetnacl@~0.13.0", + "_spec": "tweetnacl@~0.14.0", "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk", "author": { "name": "TweetNaCl-js contributors" @@ -55,23 +59,24 @@ "dependencies": {}, "description": "Port of TweetNaCl cryptographic library to JavaScript", "devDependencies": { - "browserify": "^10.1.3", - "eslint": "^1.4.3", - "faucet": "0.0.1", + "browserify": "^13.0.0", + "eslint": "^2.2.0", + "faucet": "^0.0.1", "tap-browser-color": "^0.1.2", - "tape": "^4.0.0", - "testling": "^1.7.1", - "uglify-js": "^2.4.21" + "tape": "^4.4.0", + "tape-run": "^2.1.3", + "tweetnacl-util": "^0.13.3", + "uglify-js": "^2.6.1" }, "directories": { "test": "test" }, "dist": { - "shasum": "d628b56f3bcc3d5ae74ba9d4c1a704def5ab4b56", - "tarball": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.13.3.tgz" + "shasum": "3da382f670f25ded78d7b3d1792119bca0b7132d", + "tarball": "https://registry.npmjs.org/tweetnacl/-/tweetnacl-0.14.3.tgz" }, - "gitHead": "2bb422cb707fba4a5ec9654688564a4fb861b068", - "homepage": "https://dchest.github.io/tweetnacl-js", + "gitHead": "3eb4fc544a2a1d6c0a41b98b9906288ca8b087e4", + "homepage": "https://tweetnacl.js.org", "keywords": [ "crypto", "cryptography", @@ -86,7 +91,7 @@ "salsa20", "signatures" ], - "license": "Public domain", + "license": "SEE LICENSE IN COPYING.txt", "main": "nacl-fast.js", "maintainers": [ { @@ -103,27 +108,13 @@ }, "scripts": { "bench": "node test/benchmark/bench.js", - "browser": "browserify test/browser/init.js test/*.js | uglifyjs -c -m -o test/browser/_bundle.js 2>/dev/null", - "browser-quick": "browserify test/browser/init.js test/*.quick.js | uglifyjs -c -m -o test/browser/_bundle-quick.js 2>/dev/null", "build": "uglifyjs nacl.js -c -m -o nacl.min.js && uglifyjs nacl-fast.js -c -m -o nacl-fast.min.js", - "chrome": "browserify test/browser/testling_init.js test/*.js | testling -x google-chrome | faucet", - "firefox": "browserify test/browser/testling_init.js test/*.js | testling -x firefox | faucet", + "build-test-browser": "browserify test/browser/init.js test/*.js | uglifyjs -c -m -o test/browser/_bundle.js 2>/dev/null && browserify test/browser/init.js test/*.quick.js | uglifyjs -c -m -o test/browser/_bundle-quick.js 2>/dev/null", "lint": "eslint nacl.js nacl-fast.js test/*.js test/benchmark/*.js", - "test": "tape test/*.js | faucet", - "testall": "make -C test/c && tape test/*.js test/c/*.js | faucet", - "testling": "browserify test/browser/testling_init.js test/*.js | testling | faucet" - }, - "testling": { - "files": "test/*.js", - "browsers": [ - "chrome/22..latest", - "firefox/16..latest", - "safari/latest", - "opera/11.0..latest", - "iphone/6..latest", - "ipad/6..latest", - "android-browser/latest" - ] + "test": "npm run test-node-all && npm run test-browser", + "test-browser": "NACL_SRC=${NACL_SRC:='nacl.min.js'} && npm run build-test-browser && cat $NACL_SRC test/browser/_bundle.js | tape-run | faucet", + "test-node": "tape test/*.js | faucet", + "test-node-all": "make -C test/c && tape test/*.js test/c/*.js | faucet" }, - "version": "0.13.3" + "version": "0.14.3" } diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/package.json index 27d297637ebc2f..02ae0ac7647e07 100644 --- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/package.json +++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/sshpk/package.json @@ -14,20 +14,19 @@ ] ], "_from": "sshpk@>=1.7.0 <2.0.0", - "_id": "sshpk@1.9.2", + "_id": "sshpk@1.10.1", "_inCache": true, - "_installable": true, "_location": "/request/http-signature/sshpk", "_nodeVersion": "0.12.15", "_npmOperationalInternal": { "host": "packages-16-east.internal.npmjs.com", - "tmp": "tmp/sshpk-1.9.2.tgz_1469841656006_0.10793639998883009" + "tmp": "tmp/sshpk-1.10.1.tgz_1475095320582_0.4095200637821108" }, "_npmUser": { "name": "arekinath", "email": "alex@cooperi.net" }, - "_npmVersion": "2.15.8", + "_npmVersion": "3.10.3", "_phantomChildren": {}, "_requested": { "raw": "sshpk@^1.7.0", @@ -41,8 +40,8 @@ "_requiredBy": [ "/request/http-signature" ], - "_resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.9.2.tgz", - "_shasum": "3b41351bbad5c34ddf4bd8119937efee31a46765", + "_resolved": "https://registry.npmjs.org/sshpk/-/sshpk-1.10.1.tgz", + "_shasum": "30e1a5d329244974a1af61511339d595af6638b0", "_shrinkwrap": null, "_spec": "sshpk@^1.7.0", "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/http-signature", @@ -74,12 +73,13 @@ "dependencies": { "asn1": "~0.2.3", "assert-plus": "^1.0.0", + "bcrypt-pbkdf": "^1.0.0", "dashdash": "^1.12.0", "ecc-jsbn": "~0.1.1", "getpass": "^0.1.1", "jodid25519": "^1.0.0", "jsbn": "~0.1.0", - "tweetnacl": "~0.13.0" + "tweetnacl": "~0.14.0" }, "description": "A library for finding and using SSH public keys", "devDependencies": { @@ -94,13 +94,13 @@ "man": "./man/man1" }, "dist": { - "shasum": "3b41351bbad5c34ddf4bd8119937efee31a46765", - "tarball": "https://registry.npmjs.org/sshpk/-/sshpk-1.9.2.tgz" + "shasum": "30e1a5d329244974a1af61511339d595af6638b0", + "tarball": "https://registry.npmjs.org/sshpk/-/sshpk-1.10.1.tgz" }, "engines": { "node": ">=0.10.0" }, - "gitHead": "a8b794384822a52eea5ed3b2f192a780b7909609", + "gitHead": "4212272b3889f2df155d2aa8a1a5305fe7a7d3a5", "homepage": "https://github.com/arekinath/node-sshpk#readme", "license": "MIT", "main": "lib/index.js", @@ -117,10 +117,11 @@ ], "name": "sshpk", "optionalDependencies": { + "bcrypt-pbkdf": "^1.0.0", "ecc-jsbn": "~0.1.1", "jodid25519": "^1.0.0", "jsbn": "~0.1.0", - "tweetnacl": "~0.13.0" + "tweetnacl": "~0.14.0" }, "readme": "ERROR: No README data found!", "repository": { @@ -130,5 +131,5 @@ "scripts": { "test": "tape test/*.js" }, - "version": "1.9.2" + "version": "1.10.1" } diff --git a/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md b/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md index 63bd4ea0b40ce4..8c0383a61b98f5 100644 --- a/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md +++ b/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md @@ -1,3 +1,10 @@ +2.1.12 / 2016-09-18 +=================== + + * deps: mime-db@~1.24.0 + - Add new mime types + - Add `audio/mp3` + 2.1.11 / 2016-05-01 =================== diff --git a/deps/npm/node_modules/request/node_modules/mime-types/index.js b/deps/npm/node_modules/request/node_modules/mime-types/index.js index f7008b246d1e4c..9226ca58473eed 100644 --- a/deps/npm/node_modules/request/node_modules/mime-types/index.js +++ b/deps/npm/node_modules/request/node_modules/mime-types/index.js @@ -46,7 +46,7 @@ populateMaps(exports.extensions, exports.types) * @return {boolean|string} */ -function charset(type) { +function charset (type) { if (!type || typeof type !== 'string') { return false } @@ -74,7 +74,7 @@ function charset(type) { * @return {boolean|string} */ -function contentType(str) { +function contentType (str) { // TODO: should this even be in this module? if (!str || typeof str !== 'string') { return false @@ -104,7 +104,7 @@ function contentType(str) { * @return {boolean|string} */ -function extension(type) { +function extension (type) { if (!type || typeof type !== 'string') { return false } @@ -129,7 +129,7 @@ function extension(type) { * @return {boolean|string} */ -function lookup(path) { +function lookup (path) { if (!path || typeof path !== 'string') { return false } @@ -151,11 +151,11 @@ function lookup(path) { * @private */ -function populateMaps(extensions, types) { +function populateMaps (extensions, types) { // source preference (least -> most) var preference = ['nginx', 'apache', undefined, 'iana'] - Object.keys(db).forEach(function forEachMimeType(type) { + Object.keys(db).forEach(function forEachMimeType (type) { var mime = db[type] var exts = mime.extensions @@ -174,8 +174,8 @@ function populateMaps(extensions, types) { var from = preference.indexOf(db[types[extension]].source) var to = preference.indexOf(mime.source) - if (types[extension] !== 'application/octet-stream' - && from > to || (from === to && types[extension].substr(0, 12) === 'application/')) { + if (types[extension] !== 'application/octet-stream' && + from > to || (from === to && types[extension].substr(0, 12) === 'application/')) { // skip the remapping continue } diff --git a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md index d6705ac86d114f..d4796b55eeff2b 100644 --- a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md +++ b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md @@ -1,3 +1,27 @@ +1.24.0 / 2016-09-18 +=================== + + * Add `application/clue_info+xml` + * Add `application/geo+json` + * Add `application/lgr+xml` + * Add `application/vnd.amazon.mobi8-ebook` + * Add `application/vnd.chess-pgn` + * Add `application/vnd.comicbook+zip` + * Add `application/vnd.d2l.coursepackage1p0+zip` + * Add `application/vnd.espass-espass+zip` + * Add `application/vnd.nearst.inv+json` + * Add `application/vnd.oma.lwm2m+json` + * Add `application/vnd.oma.lwm2m+tlv` + * Add `application/vnd.quarantainenet` + * Add `application/vnd.rar` + * Add `audio/mp3` + * Add `image/dicom-rle` + * Add `image/emf` + * Add `image/jls` + * Add `image/wmf` + * Add `model/gltf+json` + * Add `text/vnd.ascii-art` + 1.23.0 / 2016-05-01 =================== diff --git a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json index 0a5a8a7bba5574..63b226f9c47d94 100644 --- a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json +++ b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json @@ -173,6 +173,9 @@ "application/cfw": { "source": "iana" }, + "application/clue_info+xml": { + "source": "iana" + }, "application/cms": { "source": "iana" }, @@ -357,6 +360,10 @@ "application/framework-attributes+xml": { "source": "iana" }, + "application/geo+json": { + "source": "iana", + "compressible": true + }, "application/gml+xml": { "source": "apache", "extensions": ["gml"] @@ -511,6 +518,9 @@ "compressible": true, "extensions": ["jsonld"] }, + "application/lgr+xml": { + "source": "iana" + }, "application/link-format": { "source": "iana" }, @@ -1316,6 +1326,9 @@ "source": "apache", "extensions": ["azw"] }, + "application/vnd.amazon.mobi8-ebook": { + "source": "iana" + }, "application/vnd.americandynamics.acc": { "source": "iana", "extensions": ["acc"] @@ -1446,6 +1459,9 @@ "source": "iana", "extensions": ["cdxml"] }, + "application/vnd.chess-pgn": { + "source": "iana" + }, "application/vnd.chipnuts.karaoke-mmd": { "source": "iana", "extensions": ["mmd"] @@ -1495,6 +1511,9 @@ "source": "iana", "compressible": true }, + "application/vnd.comicbook+zip": { + "source": "iana" + }, "application/vnd.commerce-battelle": { "source": "iana" }, @@ -1578,6 +1597,9 @@ "application/vnd.cybank": { "source": "iana" }, + "application/vnd.d2l.coursepackage1p0+zip": { + "source": "iana" + }, "application/vnd.dart": { "source": "iana", "compressible": true, @@ -1798,6 +1820,9 @@ "application/vnd.ericsson.quickcall": { "source": "iana" }, + "application/vnd.espass-espass+zip": { + "source": "iana" + }, "application/vnd.eszigno3+xml": { "source": "iana", "extensions": ["es3","et3"] @@ -2809,6 +2834,10 @@ "application/vnd.ncd.reference": { "source": "iana" }, + "application/vnd.nearst.inv+json": { + "source": "iana", + "compressible": true + }, "application/vnd.nervana": { "source": "iana" }, @@ -3115,6 +3144,13 @@ "application/vnd.oma.group-usage-list+xml": { "source": "iana" }, + "application/vnd.oma.lwm2m+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+tlv": { + "source": "iana" + }, "application/vnd.oma.pal+xml": { "source": "iana" }, @@ -3540,6 +3576,9 @@ "application/vnd.qualcomm.brew-app-res": { "source": "iana" }, + "application/vnd.quarantainenet": { + "source": "iana" + }, "application/vnd.quark.quarkxpress": { "source": "iana", "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"] @@ -3598,6 +3637,9 @@ "application/vnd.rapid": { "source": "iana" }, + "application/vnd.rar": { + "source": "iana" + }, "application/vnd.realvnc.bed": { "source": "iana", "extensions": ["bed"] @@ -5062,6 +5104,10 @@ "audio/mobile-xmf": { "source": "iana" }, + "audio/mp3": { + "compressible": false, + "extensions": ["mp3"] + }, "audio/mp4": { "source": "iana", "compressible": false, @@ -5425,7 +5471,7 @@ "extensions": ["otf"] }, "image/bmp": { - "source": "apache", + "source": "iana", "compressible": true, "extensions": ["bmp"] }, @@ -5433,6 +5479,12 @@ "source": "iana", "extensions": ["cgm"] }, + "image/dicom-rle": { + "source": "iana" + }, + "image/emf": { + "source": "iana" + }, "image/fits": { "source": "iana" }, @@ -5449,6 +5501,9 @@ "source": "iana", "extensions": ["ief"] }, + "image/jls": { + "source": "iana" + }, "image/jp2": { "source": "iana" }, @@ -5619,6 +5674,9 @@ "source": "apache", "extensions": ["webp"] }, + "image/wmf": { + "source": "iana" + }, "image/x-3ds": { "source": "apache", "extensions": ["3ds"] @@ -5765,6 +5823,10 @@ "message/vnd.wfa.wsc": { "source": "iana" }, + "model/gltf+json": { + "source": "iana", + "compressible": true + }, "model/iges": { "source": "iana", "compressible": false, @@ -6092,6 +6154,9 @@ "text/vnd.abc": { "source": "iana" }, + "text/vnd.ascii-art": { + "source": "iana" + }, "text/vnd.curl": { "source": "iana", "extensions": ["curl"] diff --git a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json index 8411c5ad0e3f7c..658681becdf5cb 100644 --- a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json +++ b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json @@ -2,49 +2,48 @@ "_args": [ [ { - "raw": "mime-db@~1.23.0", + "raw": "mime-db@~1.24.0", "scope": null, "escapedName": "mime-db", "name": "mime-db", - "rawSpec": "~1.23.0", - "spec": ">=1.23.0 <1.24.0", + "rawSpec": "~1.24.0", + "spec": ">=1.24.0 <1.25.0", "type": "range" }, "/Users/rebecca/code/npm/node_modules/request/node_modules/mime-types" ] ], - "_from": "mime-db@>=1.23.0 <1.24.0", - "_id": "mime-db@1.23.0", + "_from": "mime-db@>=1.24.0 <1.25.0", + "_id": "mime-db@1.24.0", "_inCache": true, - "_installable": true, "_location": "/request/mime-types/mime-db", - "_nodeVersion": "4.4.3", + "_nodeVersion": "4.5.0", "_npmOperationalInternal": { "host": "packages-16-east.internal.npmjs.com", - "tmp": "tmp/mime-db-1.23.0.tgz_1462163798086_0.43938886746764183" + "tmp": "tmp/mime-db-1.24.0.tgz_1474198792761_0.7161959335207939" }, "_npmUser": { "name": "dougwilson", "email": "doug@somethingdoug.com" }, - "_npmVersion": "2.15.1", + "_npmVersion": "2.15.9", "_phantomChildren": {}, "_requested": { - "raw": "mime-db@~1.23.0", + "raw": "mime-db@~1.24.0", "scope": null, "escapedName": "mime-db", "name": "mime-db", - "rawSpec": "~1.23.0", - "spec": ">=1.23.0 <1.24.0", + "rawSpec": "~1.24.0", + "spec": ">=1.24.0 <1.25.0", "type": "range" }, "_requiredBy": [ "/request/mime-types" ], - "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.23.0.tgz", - "_shasum": "a31b4070adaea27d732ea333740a64d0ec9a6659", + "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.24.0.tgz", + "_shasum": "e2d13f939f0016c6e4e9ad25a8652f126c467f0c", "_shrinkwrap": null, - "_spec": "mime-db@~1.23.0", + "_spec": "mime-db@~1.24.0", "_where": "/Users/rebecca/code/npm/node_modules/request/node_modules/mime-types", "bugs": { "url": "https://github.com/jshttp/mime-db/issues" @@ -68,20 +67,20 @@ "dependencies": {}, "description": "Media Type Database", "devDependencies": { - "bluebird": "3.3.5", + "bluebird": "3.4.6", "co": "4.6.0", "cogent": "1.0.1", - "csv-parse": "1.1.0", + "csv-parse": "1.1.7", "gnode": "0.1.2", - "istanbul": "0.4.3", + "istanbul": "0.4.5", "mocha": "1.21.5", - "raw-body": "2.1.6", + "raw-body": "2.1.7", "stream-to-array": "2.3.0" }, "directories": {}, "dist": { - "shasum": "a31b4070adaea27d732ea333740a64d0ec9a6659", - "tarball": "https://registry.npmjs.org/mime-db/-/mime-db-1.23.0.tgz" + "shasum": "e2d13f939f0016c6e4e9ad25a8652f126c467f0c", + "tarball": "https://registry.npmjs.org/mime-db/-/mime-db-1.24.0.tgz" }, "engines": { "node": ">= 0.6" @@ -93,7 +92,7 @@ "db.json", "index.js" ], - "gitHead": "ba0d99fd05b3bfdc2ebcd78f858c25cb7db6af41", + "gitHead": "9dd00b34556a8cdd6f3385f09d4989298c4b86e1", "homepage": "https://github.com/jshttp/mime-db#readme", "keywords": [ "mime", @@ -130,5 +129,5 @@ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", "update": "npm run fetch && npm run build" }, - "version": "1.23.0" + "version": "1.24.0" } diff --git a/deps/npm/node_modules/request/node_modules/mime-types/package.json b/deps/npm/node_modules/request/node_modules/mime-types/package.json index dae8f5a70a0c2e..140951c792a707 100644 --- a/deps/npm/node_modules/request/node_modules/mime-types/package.json +++ b/deps/npm/node_modules/request/node_modules/mime-types/package.json @@ -14,20 +14,19 @@ ] ], "_from": "mime-types@>=2.1.7 <2.2.0", - "_id": "mime-types@2.1.11", + "_id": "mime-types@2.1.12", "_inCache": true, - "_installable": true, "_location": "/request/mime-types", - "_nodeVersion": "4.4.3", + "_nodeVersion": "4.5.0", "_npmOperationalInternal": { "host": "packages-12-west.internal.npmjs.com", - "tmp": "tmp/mime-types-2.1.11.tgz_1462165365027_0.7217204745393246" + "tmp": "tmp/mime-types-2.1.12.tgz_1474237415119_0.03028594213537872" }, "_npmUser": { "name": "dougwilson", "email": "doug@somethingdoug.com" }, - "_npmVersion": "2.15.1", + "_npmVersion": "2.15.9", "_phantomChildren": {}, "_requested": { "raw": "mime-types@~2.1.7", @@ -42,8 +41,8 @@ "/request", "/request/form-data" ], - "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.11.tgz", - "_shasum": "c259c471bda808a85d6cd193b430a5fae4473b3c", + "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.12.tgz", + "_shasum": "152ba256777020dd4663f54c2e7bc26381e71729", "_shrinkwrap": null, "_spec": "mime-types@~2.1.7", "_where": "/Users/rebecca/code/npm/node_modules/request", @@ -67,17 +66,21 @@ } ], "dependencies": { - "mime-db": "~1.23.0" + "mime-db": "~1.24.0" }, "description": "The ultimate javascript content-type utility.", "devDependencies": { - "istanbul": "0.4.3", + "eslint": "3.5.0", + "eslint-config-standard": "6.0.1", + "eslint-plugin-promise": "2.0.1", + "eslint-plugin-standard": "2.0.0", + "istanbul": "0.4.5", "mocha": "1.21.5" }, "directories": {}, "dist": { - "shasum": "c259c471bda808a85d6cd193b430a5fae4473b3c", - "tarball": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.11.tgz" + "shasum": "152ba256777020dd4663f54c2e7bc26381e71729", + "tarball": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.12.tgz" }, "engines": { "node": ">= 0.6" @@ -87,7 +90,7 @@ "LICENSE", "index.js" ], - "gitHead": "298ffcf490a5d6e60edea7bf7a69036df04846b1", + "gitHead": "7193a9094e2efe31da93988350bb0b32ab18b1ea", "homepage": "https://github.com/jshttp/mime-types#readme", "keywords": [ "mime", @@ -116,9 +119,10 @@ "url": "git+https://github.com/jshttp/mime-types.git" }, "scripts": { + "lint": "eslint **/*.js", "test": "mocha --reporter spec test/test.js", "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/test.js", "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot test/test.js" }, - "version": "2.1.11" + "version": "2.1.12" } diff --git a/deps/npm/node_modules/request/package.json b/deps/npm/node_modules/request/package.json index 8e1c5b8a118203..822499736605cc 100644 --- a/deps/npm/node_modules/request/package.json +++ b/deps/npm/node_modules/request/package.json @@ -2,58 +2,55 @@ "_args": [ [ { - "raw": "request@~2.74.0", + "raw": "request@2.75.0", "scope": null, "escapedName": "request", "name": "request", - "rawSpec": "~2.74.0", - "spec": ">=2.74.0 <2.75.0", - "type": "range" + "rawSpec": "2.75.0", + "spec": "2.75.0", + "type": "version" }, "/Users/rebecca/code/npm" ] ], - "_from": "request@>=2.74.0 <2.75.0", - "_id": "request@2.74.0", + "_from": "request@2.75.0", + "_id": "request@2.75.0", "_inCache": true, - "_installable": true, "_location": "/request", - "_nodeVersion": "6.2.2", + "_nodeVersion": "6.5.0", "_npmOperationalInternal": { "host": "packages-16-east.internal.npmjs.com", - "tmp": "tmp/request-2.74.0.tgz_1469231082306_0.13140005595050752" + "tmp": "tmp/request-2.75.0.tgz_1474151606844_0.8052814984694123" }, "_npmUser": { "name": "simov", "email": "simeonvelichkov@gmail.com" }, - "_npmVersion": "2.15.6", + "_npmVersion": "2.15.9", "_phantomChildren": { "ansi-regex": "2.0.0", - "inherits": "2.0.1", + "inherits": "2.0.3", "strip-ansi": "3.0.1" }, "_requested": { - "raw": "request@~2.74.0", + "raw": "request@2.75.0", "scope": null, "escapedName": "request", "name": "request", - "rawSpec": "~2.74.0", - "spec": ">=2.74.0 <2.75.0", - "type": "range" + "rawSpec": "2.75.0", + "spec": "2.75.0", + "type": "version" }, "_requiredBy": [ "#USER", "/", "/node-gyp", - "/npm-registry-client", - "/npm-registry-couchapp/couchapp", - "/npm-registry-couchapp/couchapp/nano" + "/npm-registry-client" ], - "_resolved": "https://registry.npmjs.org/request/-/request-2.74.0.tgz", - "_shasum": "7693ca768bbb0ea5c8ce08c084a45efa05b892ab", + "_resolved": "https://registry.npmjs.org/request/-/request-2.75.0.tgz", + "_shasum": "d2b8268a286da13eaa5d01adf5d18cc90f657d93", "_shrinkwrap": null, - "_spec": "request@~2.74.0", + "_spec": "request@2.75.0", "_where": "/Users/rebecca/code/npm", "author": { "name": "Mikeal Rogers", @@ -70,7 +67,7 @@ "combined-stream": "~1.0.5", "extend": "~3.0.0", "forever-agent": "~0.6.1", - "form-data": "~1.0.0-rc4", + "form-data": "~2.0.0", "har-validator": "~2.0.6", "hawk": "~3.1.3", "http-signature": "~1.1.0", @@ -101,7 +98,7 @@ "karma-cli": "^1.0.0", "karma-coverage": "^1.0.0", "karma-phantomjs-launcher": "^1.0.0", - "karma-tap": "^2.0.1", + "karma-tap": "^3.0.1", "phantomjs-prebuilt": "^2.1.3", "rimraf": "^2.2.8", "server-destroy": "^1.0.1", @@ -110,13 +107,20 @@ }, "directories": {}, "dist": { - "shasum": "7693ca768bbb0ea5c8ce08c084a45efa05b892ab", - "tarball": "https://registry.npmjs.org/request/-/request-2.74.0.tgz" + "shasum": "d2b8268a286da13eaa5d01adf5d18cc90f657d93", + "tarball": "https://registry.npmjs.org/request/-/request-2.75.0.tgz" }, "engines": { "node": ">=0.8.0" }, - "gitHead": "76e82351cbc21049441b1763c6f2bbd504fa8f5a", + "gitHead": "e9f09c2832073858d6d988ba82a2895f36efa92d", + "greenkeeper": { + "ignore": [ + "eslint", + "hawk", + "har-validator" + ] + }, "homepage": "https://github.com/request/request#readme", "license": "Apache-2.0", "main": "index.js", @@ -158,5 +162,5 @@ "util", "utility" ], - "version": "2.74.0" + "version": "2.75.0" } diff --git a/deps/npm/node_modules/request/request.js b/deps/npm/node_modules/request/request.js index 8267c125375af4..96a71b6ed5efd3 100644 --- a/deps/npm/node_modules/request/request.js +++ b/deps/npm/node_modules/request/request.js @@ -958,6 +958,10 @@ Request.prototype.onRequestResponse = function (response) { }) responseContent.on('data', function (chunk) { + if (self.timing && !self.responseStarted) { + self.responseStartTime = (new Date()).getTime() + response.responseStartTime = self.responseStartTime + } self._destdata = true self.emit('data', chunk) }) diff --git a/deps/npm/node_modules/sorted-object/LICENSE.txt b/deps/npm/node_modules/sorted-object/LICENSE.txt index 4a323deb518f3a..2edd064bf5507a 100644 --- a/deps/npm/node_modules/sorted-object/LICENSE.txt +++ b/deps/npm/node_modules/sorted-object/LICENSE.txt @@ -1,3 +1,7 @@ +Dual licensed under WTFPL and MIT: + +--- + Copyright © 2014–2016 Domenic Denicola This work is free. You can redistribute it and/or modify it under the @@ -17,3 +21,27 @@ as published by Sam Hocevar. See below for more details. TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION 0. You just DO WHAT THE FUCK YOU WANT TO. + +--- + +The MIT License (MIT) + +Copyright © 2014–2016 Domenic Denicola + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/deps/npm/node_modules/sorted-object/README.md b/deps/npm/node_modules/sorted-object/README.md deleted file mode 100644 index d3f12a27885d6d..00000000000000 --- a/deps/npm/node_modules/sorted-object/README.md +++ /dev/null @@ -1,20 +0,0 @@ -# Get a Version of an Object with Sorted Keys - -Although objects in JavaScript are theoretically unsorted, in practice most engines use insertion order—at least, ignoring numeric keys. This manifests itself most prominently when dealing with an object's JSON serialization. - -So, for example, you might be trying to serialize some object to a JSON file. But every time you write it, it ends up being output in a different order, depending on how you created it in the first place! This makes for some ugly diffs. - -**sorted-object** gives you the answer. Just use this package to create a version of your object with its keys sorted before serializing, and you'll get a consistent order every time. - -```js -var sortedObject = require("sorted-object"); - -var objectToSerialize = generateStuffNondeterministically(); - -// Before: -fs.writeFileSync("dest.json", JSON.stringify(objectToSerialize)); - -// After: -var sortedVersion = sortedObject(objectToSerialize); -fs.writeFileSync("dest.json", JSON.stringify(sortedVersion)); -``` diff --git a/deps/npm/node_modules/sorted-object/package.json b/deps/npm/node_modules/sorted-object/package.json index 60a8356bac177b..c4bb99f2b324e8 100644 --- a/deps/npm/node_modules/sorted-object/package.json +++ b/deps/npm/node_modules/sorted-object/package.json @@ -1,45 +1,54 @@ { "_args": [ [ - "sorted-object@latest", + { + "raw": "sorted-object@2.0.1", + "scope": null, + "escapedName": "sorted-object", + "name": "sorted-object", + "rawSpec": "2.0.1", + "spec": "2.0.1", + "type": "version" + }, "/Users/rebecca/code/npm" ] ], - "_from": "sorted-object@latest", - "_id": "sorted-object@2.0.0", + "_from": "sorted-object@2.0.1", + "_id": "sorted-object@2.0.1", "_inCache": true, - "_installable": true, "_location": "/sorted-object", - "_nodeVersion": "5.7.1", + "_nodeVersion": "6.2.2", "_npmOperationalInternal": { "host": "packages-12-west.internal.npmjs.com", - "tmp": "tmp/sorted-object-2.0.0.tgz_1457910693572_0.6718082851730287" + "tmp": "tmp/sorted-object-2.0.1.tgz_1473550768215_0.1242613298818469" }, "_npmUser": { - "email": "d@domenic.me", - "name": "domenic" + "name": "domenic", + "email": "d@domenic.me" }, - "_npmVersion": "3.6.0", + "_npmVersion": "3.9.5", "_phantomChildren": {}, "_requested": { - "name": "sorted-object", - "raw": "sorted-object@latest", - "rawSpec": "latest", + "raw": "sorted-object@2.0.1", "scope": null, - "spec": "latest", - "type": "tag" + "escapedName": "sorted-object", + "name": "sorted-object", + "rawSpec": "2.0.1", + "spec": "2.0.1", + "type": "version" }, "_requiredBy": [ + "#USER", "/" ], - "_resolved": "https://registry.npmjs.org/sorted-object/-/sorted-object-2.0.0.tgz", - "_shasum": "1cfea981609047d8043807a490a9d99b317faf7f", + "_resolved": "https://registry.npmjs.org/sorted-object/-/sorted-object-2.0.1.tgz", + "_shasum": "7d631f4bd3a798a24af1dffcfbfe83337a5df5fc", "_shrinkwrap": null, - "_spec": "sorted-object@latest", + "_spec": "sorted-object@2.0.1", "_where": "/Users/rebecca/code/npm", "author": { - "email": "d@domenic.me", "name": "Domenic Denicola", + "email": "d@domenic.me", "url": "https://domenic.me/" }, "bugs": { @@ -53,25 +62,25 @@ }, "directories": {}, "dist": { - "shasum": "1cfea981609047d8043807a490a9d99b317faf7f", - "tarball": "http://registry.npmjs.org/sorted-object/-/sorted-object-2.0.0.tgz" + "shasum": "7d631f4bd3a798a24af1dffcfbfe83337a5df5fc", + "tarball": "https://registry.npmjs.org/sorted-object/-/sorted-object-2.0.1.tgz" }, "files": [ "lib/" ], - "gitHead": "3cbdde212c8ceef219fbb8fa7805bfc38b94aa90", + "gitHead": "87105deb13d4f4151b2abd1a78d27a5216e3e79d", "homepage": "https://github.com/domenic/sorted-object#readme", "keywords": [ "sort", "keys", "object" ], - "license": "WTFPL", + "license": "(WTFPL OR MIT)", "main": "lib/sorted-object.js", "maintainers": [ { - "email": "domenic@domenicdenicola.com", - "name": "domenic" + "name": "domenic", + "email": "domenic@domenicdenicola.com" } ], "name": "sorted-object", @@ -85,5 +94,5 @@ "lint": "eslint .", "test": "tape test/tests.js" }, - "version": "2.0.0" + "version": "2.0.1" } diff --git a/deps/npm/package.json b/deps/npm/package.json index 55659aab66248a..c1df08e43d4d8b 100644 --- a/deps/npm/package.json +++ b/deps/npm/package.json @@ -1,5 +1,5 @@ { - "version": "3.10.8", + "version": "3.10.9", "name": "npm", "description": "a package manager for JavaScript", "keywords": [ @@ -35,19 +35,19 @@ "ansistyles": "~0.1.3", "aproba": "~1.0.4", "archy": "~1.0.0", - "asap": "~2.0.4", + "asap": "~2.0.5", "chownr": "~1.0.1", "cmd-shim": "~2.0.2", "columnify": "~1.5.4", - "config-chain": "~1.1.10", + "config-chain": "~1.1.11", "dezalgo": "~1.0.3", "editor": "~1.0.0", "fs-vacuum": "~1.2.9", "fs-write-stream-atomic": "~1.0.8", "fstream": "~1.0.10", "fstream-npm": "~1.2.0", - "glob": "~7.0.6", - "graceful-fs": "~4.1.6", + "glob": "~7.1.0", + "graceful-fs": "~4.1.9", "has-unicode": "~2.0.1", "hosted-git-info": "~2.1.5", "iferr": "~0.1.5", @@ -55,7 +55,7 @@ "inherits": "~2.0.3", "ini": "~1.3.4", "init-package-json": "~1.9.4", - "lockfile": "~1.0.1", + "lockfile": "~1.0.2", "lodash._baseuniq": "~4.6.0", "lodash.clonedeep": "~4.5.0", "lodash.union": "~4.6.0", @@ -73,9 +73,9 @@ "npm-user-validate": "~0.1.5", "npmlog": "~4.0.0", "once": "~1.4.0", - "opener": "~1.4.1", + "opener": "~1.4.2", "osenv": "~0.1.3", - "path-is-inside": "~1.0.1", + "path-is-inside": "~1.0.2", "read": "~1.0.7", "read-cmd-shim": "~1.0.1", "read-installed": "~4.0.3", @@ -83,13 +83,13 @@ "read-package-tree": "~5.1.5", "readable-stream": "~2.1.5", "realize-package-specifier": "~3.0.3", - "request": "~2.74.0", + "request": "~2.75.0", "retry": "~0.10.0", "rimraf": "~2.5.4", "semver": "~5.3.0", "sha": "~2.0.1", "slide": "~1.1.6", - "sorted-object": "~2.0.0", + "sorted-object": "~2.0.1", "strip-ansi": "~3.0.1", "tar": "~2.2.1", "text-table": "~0.2.0", @@ -195,8 +195,8 @@ "require-inject": "~1.4.0", "sprintf-js": "~1.0.3", "standard": "~6.0.8", - "tacks": "~1.2.1", - "tap": "~7.0.0" + "tacks": "~1.2.2", + "tap": "~7.1.2" }, "scripts": { "dumpconf": "env | grep npm | sort | uniq", diff --git a/deps/npm/scripts/changelog.js b/deps/npm/scripts/changelog.js index c60c6c664baea8..abbec4b4e9e17d 100644 --- a/deps/npm/scripts/changelog.js +++ b/deps/npm/scripts/changelog.js @@ -25,7 +25,7 @@ function shortname (url) { if (repo !== 'npm/npm') { return `${repo}#${id}` } else { - return `${id}` + return `#${id}` } } @@ -90,7 +90,7 @@ function main () { } else if (m = line.match(/^Credit: @(.*)/)) { if (!commit.credit) commit.credit = [] commit.credit.push(m[1]) - } else if (m = line.match(/^Fixes: (.*)/)) { + } else if (m = line.match(/^Fixes: #?(.*?)/)) { commit.fixes = m[1] } else if (m = line.match(/^Reviewed-By: @(.*)/)) { commit.reviewed = m[1] diff --git a/deps/npm/scripts/dep-update b/deps/npm/scripts/dep-update new file mode 100755 index 00000000000000..a0aaed7dbcd55a --- /dev/null +++ b/deps/npm/scripts/dep-update @@ -0,0 +1,6 @@ +#!/bin/bash +node . install --save $1@$2 &&\ +git add node_modules/$1/ package.json &&\ +git commit -m"$1@$2" &&\ +node . repo $1 &&\ +git commit --amend diff --git a/deps/npm/scripts/dev-dep-update b/deps/npm/scripts/dev-dep-update new file mode 100755 index 00000000000000..6058cce9427317 --- /dev/null +++ b/deps/npm/scripts/dev-dep-update @@ -0,0 +1,6 @@ +#!/bin/bash +node . install --save --save-dev $1@$2 &&\ +git add package.json &&\ +git commit -m"$1@$2" &&\ +node . repo $1 &&\ +git commit --amend diff --git a/deps/npm/test/tap/bitbucket-https-url-with-creds-package.js b/deps/npm/test/tap/bitbucket-https-url-with-creds-package.js index e5a4142ef3277d..7268b504004fad 100644 --- a/deps/npm/test/tap/bitbucket-https-url-with-creds-package.js +++ b/deps/npm/test/tap/bitbucket-https-url-with-creds-package.js @@ -34,10 +34,10 @@ test('bitbucket-https-url-with-creds-package', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/bitbucket-https-url-with-creds.js b/deps/npm/test/tap/bitbucket-https-url-with-creds.js index 4e9d14d7e01a17..846e3ae74141e5 100644 --- a/deps/npm/test/tap/bitbucket-https-url-with-creds.js +++ b/deps/npm/test/tap/bitbucket-https-url-with-creds.js @@ -31,10 +31,10 @@ test('bitbucket-https-url-with-creds', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/bitbucket-shortcut-package.js b/deps/npm/test/tap/bitbucket-shortcut-package.js index 69cfe6c2059203..37fe57950c2ea5 100644 --- a/deps/npm/test/tap/bitbucket-shortcut-package.js +++ b/deps/npm/test/tap/bitbucket-shortcut-package.js @@ -35,10 +35,10 @@ test('bitbucket-shortcut', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/bitbucket-shortcut.js b/deps/npm/test/tap/bitbucket-shortcut.js index a9b60f8b56818a..a708d84972556a 100644 --- a/deps/npm/test/tap/bitbucket-shortcut.js +++ b/deps/npm/test/tap/bitbucket-shortcut.js @@ -32,10 +32,10 @@ test('bitbucket-shortcut', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/gist-short-shortcut-package.js b/deps/npm/test/tap/gist-short-shortcut-package.js index 02457b4dc9e599..c15e1df7e205a6 100644 --- a/deps/npm/test/tap/gist-short-shortcut-package.js +++ b/deps/npm/test/tap/gist-short-shortcut-package.js @@ -35,10 +35,10 @@ test('gist-short-shortcut-package', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/gist-short-shortcut.js b/deps/npm/test/tap/gist-short-shortcut.js index 58dcf78e8d2229..c7d217f9a9ed1e 100644 --- a/deps/npm/test/tap/gist-short-shortcut.js +++ b/deps/npm/test/tap/gist-short-shortcut.js @@ -32,10 +32,10 @@ test('gist-shortcut', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/gist-shortcut-package.js b/deps/npm/test/tap/gist-shortcut-package.js index 370476ac80771f..e35ab71e840876 100644 --- a/deps/npm/test/tap/gist-shortcut-package.js +++ b/deps/npm/test/tap/gist-shortcut-package.js @@ -35,10 +35,10 @@ test('gist-shortcut-package', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/gist-shortcut.js b/deps/npm/test/tap/gist-shortcut.js index e975a09b3e72c4..3b48e47009dcf2 100644 --- a/deps/npm/test/tap/gist-shortcut.js +++ b/deps/npm/test/tap/gist-shortcut.js @@ -32,10 +32,10 @@ test('gist-shortcut', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/git-races.js b/deps/npm/test/tap/git-races.js index 6bbfe78bd79ca9..f275455cd04d70 100644 --- a/deps/npm/test/tap/git-races.js +++ b/deps/npm/test/tap/git-races.js @@ -60,9 +60,12 @@ function cleanup () { var npm = requireInject.installGlobally('../../lib/npm.js', { 'child_process': { 'execFile': function (cmd, args, options, cb) { + // on win 32, the following prefix is added in utils/git.js + // $ git -c core.longpaths=true clone + var i = process.platform === 'win32' ? 2 : 0 // If it's a clone we swap any requests for any of the urls we're mocking // with the path to the bare repo - if (args[0] === 'clone') { + if (args[i] === 'clone') { var m2 = args.length - 2 var m1 = args.length - 1 if (testrepos[args[m2]]) { @@ -72,7 +75,7 @@ var npm = requireInject.installGlobally('../../lib/npm.js', { execFile(cmd, args, options, cb) // here, we intercept npm validating the remote origin url on one of the // clones we've done previously and return the original url that was requested - } else if (args[0] === 'config' && args[1] === '--get' && args[2] === 'remote.origin.url') { + } else if (args[i] === 'config' && args[i + 1] === '--get' && args[i + 2] === 'remote.origin.url') { process.nextTick(function () { cb(null, testurls[options.cwd], '') }) diff --git a/deps/npm/test/tap/github-shortcut-package.js b/deps/npm/test/tap/github-shortcut-package.js index 13c6806b01c812..e1a4b306cc19c2 100644 --- a/deps/npm/test/tap/github-shortcut-package.js +++ b/deps/npm/test/tap/github-shortcut-package.js @@ -35,10 +35,10 @@ test('github-shortcut-package', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/gitlab-shortcut-package.js b/deps/npm/test/tap/gitlab-shortcut-package.js index 76cd7f911bb277..335bc4d60ac78b 100644 --- a/deps/npm/test/tap/gitlab-shortcut-package.js +++ b/deps/npm/test/tap/gitlab-shortcut-package.js @@ -34,10 +34,10 @@ test('gitlab-shortcut-package', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/gitlab-shortcut.js b/deps/npm/test/tap/gitlab-shortcut.js index 96da268ee03c05..dcba064bc11ce9 100644 --- a/deps/npm/test/tap/gitlab-shortcut.js +++ b/deps/npm/test/tap/gitlab-shortcut.js @@ -31,10 +31,10 @@ test('gitlab-shortcut', function (t) { 'child_process': { 'execFile': function (cmd, args, options, cb) { process.nextTick(function () { - if (args[0] !== 'clone') return cb(null, '', '') + if (args.indexOf('clone') === -1) return cb(null, '', '') var cloneUrl = cloneUrls.shift() if (cloneUrl) { - t.is(args[3], cloneUrl[0], cloneUrl[1]) + t.is(args[args.length - 2], cloneUrl[0], cloneUrl[1]) } else { t.fail('too many attempts to clone') } diff --git a/deps/npm/test/tap/install-bin-null.js b/deps/npm/test/tap/install-bin-null.js new file mode 100644 index 00000000000000..f45528a75acf45 --- /dev/null +++ b/deps/npm/test/tap/install-bin-null.js @@ -0,0 +1,91 @@ +var fs = require('graceful-fs') +var path = require('path') + +var mkdirp = require('mkdirp') +var osenv = require('osenv') +var rimraf = require('rimraf') +var test = require('tap').test + +var common = require('../common-tap.js') + +var pkg = path.join(__dirname, 'install-bin-null') + +var EXEC_OPTS = { cwd: pkg } + +var parentPkg = { + name: 'parent-package', + version: '0.0.0', + dependencies: { + 'child-package-a': 'file:./child-package-a', + 'child-package-b': 'file:./child-package-b' + } +} + +var childPkgA = { + name: 'child-package-a', + version: '0.0.0', + bin: 'index.js' +} + +var childPkgB = { + name: 'child-package-b', + version: '0.0.0', + dependencies: { + 'grandchild-package': 'file:../grandchild-package' + } +} + +var grandchildPkg = { + name: 'grandchild-package', + version: '0.0.0', + bin: null +} + +var pkgs = [childPkgA, childPkgB, grandchildPkg] + +test('the grandchild has bin:null', function (t) { + setup() + common.npm(['install'], EXEC_OPTS, function (err, code, stdout, stderr) { + t.ifErr(err, 'npm link finished without error') + t.equal(code, 0, 'exited ok') + t.ok(stdout, 'output indicating success') + t.notOk(stderr, 'no output stderr') + t.end() + }) +}) + +test('cleanup', function (t) { + cleanup() + t.end() +}) + +function cleanup () { + process.chdir(osenv.tmpdir()) + rimraf.sync(pkg) +} + +function setup () { + cleanup() + mkdirp.sync(pkg) + fs.writeFileSync( + path.join(pkg, 'package.json'), + JSON.stringify(parentPkg, null, 2) + ) + pkgs.forEach(function (json) { + process.chdir(mkPkg(json)) + }) + fs.writeFileSync( + path.join(pkg, childPkgA.name, 'index.js'), + '' + ) +} + +function mkPkg (json) { + var pkgPath = path.resolve(pkg, json.name) + mkdirp.sync(pkgPath) + fs.writeFileSync( + path.join(pkgPath, 'package.json'), + JSON.stringify(json, null, 2) + ) + return pkgPath +} diff --git a/deps/npm/test/tap/shrinkwrap-lifecycle-cwd.js b/deps/npm/test/tap/shrinkwrap-lifecycle-cwd.js new file mode 100644 index 00000000000000..8d5210c4048d5b --- /dev/null +++ b/deps/npm/test/tap/shrinkwrap-lifecycle-cwd.js @@ -0,0 +1,89 @@ +'use strict' +var path = require('path') +var test = require('tap').test +var mr = require('npm-registry-mock') +var Tacks = require('tacks') +var File = Tacks.File +var Dir = Tacks.Dir +var extend = Object.assign || require('util')._extend +var common = require('../common-tap.js') + +var basedir = path.join(__dirname, path.basename(__filename, '.js')) +var testdir = path.join(basedir, 'testdir') +var cachedir = path.join(basedir, 'cache') +var globaldir = path.join(basedir, 'global') +var tmpdir = path.join(basedir, 'tmp') +var escapeArg = require('../../lib/utils/escape-arg.js') + +var conf = { + cwd: testdir, + env: extend({ + npm_config_cache: cachedir, + npm_config_tmp: tmpdir, + npm_config_prefix: globaldir, + npm_config_registry: common.registry, + npm_config_loglevel: 'warn' + }, process.env) +} + +var server +var fixture = new Tacks(Dir({ + cache: Dir(), + global: Dir(), + tmp: Dir(), + testdir: Dir({ + node_modules: Dir({}), + 'package.json': File({ + name: '13252', + version: '1.0.0', + scripts: { + // add this to the end of the command to preserve the debug log: + // || mv npm-debug.log real-debug.log + // removed for windows compat reasons + abc: escapeArg(common.nodeBin) + ' ' + escapeArg(common.bin) + ' shrinkwrap', + shrinkwrap: escapeArg(common.nodeBin) + ' scripts/shrinkwrap.js' + } + }), + scripts: Dir({ + 'shrinkwrap.js': File( + 'console.log("OK " + process.cwd())' + ) + }) + }) +})) + +function setup () { + cleanup() + fixture.create(basedir) +} + +function cleanup () { + fixture.remove(basedir) +} + +test('setup', function (t) { + setup() + mr({port: common.port, throwOnUnmatched: true}, function (err, s) { + if (err) throw err + server = s + t.done() + }) +}) + +test('shrinkwrap-lifecycle-cwd', function (t) { + common.npm(['run', 'abc'], conf, function (err, code, stdout, stderr) { + if (err) throw err + t.is(code, 0, 'command ran ok') + t.comment(stdout.trim()) + t.comment(stderr.trim()) + t.match(stdout.trim(), 'OK ' + testdir, 'got output from lifecycle script') + t.is(stderr.trim().length, 0, 'no errors') + t.done() + }) +}) + +test('cleanup', function (t) { + server.close() + cleanup() + t.done() +}) diff --git a/deps/npm/test/tap/tagged-version-matching.js b/deps/npm/test/tap/tagged-version-matching.js new file mode 100644 index 00000000000000..f7d51d90b7e122 --- /dev/null +++ b/deps/npm/test/tap/tagged-version-matching.js @@ -0,0 +1,162 @@ +'use strict' +var path = require('path') +var test = require('tap').test +var Tacks = require('tacks') +var File = Tacks.File +var Dir = Tacks.Dir +var extend = Object.assign || require('util')._extend +var common = require('../common-tap.js') + +var basedir = path.join(__dirname, path.basename(__filename, '.js')) +var testdir = path.join(basedir, 'testdir') +var cachedir = path.join(basedir, 'cache') +var globaldir = path.join(basedir, 'global') +var tmpdir = path.join(basedir, 'tmp') + +var conf = { + cwd: testdir, + env: extend({ + npm_config_cache: cachedir, + npm_config_tmp: tmpdir, + npm_config_prefix: globaldir, + npm_config_registry: common.registry, + npm_config_loglevel: 'warn' + }, process.env) +} + +var fixture = new Tacks(Dir({ + cache: Dir(), + global: Dir(), + tmp: Dir(), + testdir: Dir({ + node_modules: Dir({ + example: Dir({ + 'package.json': File({ + _from: 'example', + _id: 'example@1.0.0', + _requested: { + raw: 'example@file:example', + scope: null, + escapedName: 'example', + name: 'example', + rawSpec: 'file:example', + type: 'directory' + }, + dependencies: { + tagdep: 'latest', + gitdep: 'npm/example-gitdep' + }, + name: 'example', + version: '1.0.0' + }) + }), + gitdep: Dir({ + 'package.json': File({ + _from: 'npm/example-gitdep', + _id: 'gitdep@1.0.0', + _requested: { + raw: 'gitdep@git://github.com/npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709', + scope: null, + escapedName: 'gitdep', + name: 'gitdep', + rawSpec: 'git://github.com/npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709', + spec: 'git://github.com/npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709', + type: 'hosted', + hosted: { + type: 'github', + ssh: 'git@github.com:npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709', + sshUrl: 'git+ssh://git@github.com/npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709', + httpsUrl: 'git+https://github.com/npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709', + gitUrl: 'git://github.com/npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709', + shortcut: 'github:npm/example-gitdep#da39a3ee5e6b4b0d3255bfef95601890afd80709', + directUrl: 'https://raw-githubusercontent-com-gh.computerqwq.top/npm/example-gitdep/da39a3ee5e6b4b0d3255bfef95601890afd80709/package.json' + } + }, + name: 'gitdep', + version: '1.0.0' + }) + }), + tagdep: Dir({ + 'package.json': File({ + _from: 'tagdep@latest', + _id: 'tagdep@1.0.0', + _requested: { + raw: 'tagdep@https://registry.example.com/tagdep/-/tagdep-1.0.0.tgz', + scope: null, + escapedName: 'tagdep', + name: 'tagdep', + rawSpec: 'https://registry.example.com/tagdep/-/tagdep-1.0.0.tgz', + spec: 'https://registry.example.com/tagdep/-/tagdep-1.0.0.tgz', + type: 'remote' + }, + name: 'tagdep', + version: '1.0.0' + }) + }) + }), + 'npm-shrinkwrap.json': File({ + name: 'tagged-version-matching', + version: '1.0.0', + dependencies: { + tagdep: { + version: '1.0.0', + from: 'tagdep@latest', + resolved: 'https://registry.example.com/tagdep/-/tagdep-1.0.0.tgz' + }, + example: { + version: '1.0.0', + from: 'example' + }, + gitdep: { + version: '1.0.0', + from: 'npm/example-gitdep', + resolved: 'git://github.com/npm/example-gitdep.git#da39a3ee5e6b4b0d3255bfef95601890afd80709' + } + } + }), + 'package.json': File({ + name: 'tagged-version-matching', + version: '1.0.0', + dependencies: { + example: 'file:example', + gitdep: 'npm/example-gitdep' + } + }) + }) +})) + +function setup () { + cleanup() + fixture.create(basedir) +} + +function cleanup () { + fixture.remove(basedir) +} + +test('setup', function (t) { + setup() + t.done() +}) + +test('tagged-version-matching', function (t) { + common.npm(['ls', '--json'], conf, function (err, code, stdout, stderr) { + if (err) throw err + t.is(code, 0, 'command ran ok') + if (stderr.trim()) t.comment(stderr.trim()) + var result = JSON.parse(stdout.trim()) + var problems = result.problems || [] + // Original PR: https://github.com/npm/npm/pull/13941 + // Original issue: https://github.com/npm/npm/issues/13496 + // Original issue: https://github.com/npm/npm/issues/11736 + t.is(problems.length, 0, 'no problems') + t.ok(!problems.some(function (err) { return /missing: tagdep/.test(err) }), 'tagged dependency matched ok') + t.ok(!problems.some(function (err) { return /missing: gitdep/.test(err) }), 'git dependency matched ok') + t.done() + }) +}) + +test('cleanup', function (t) { + cleanup() + t.done() +}) diff --git a/deps/npm/test/tap/upgrade-lifecycles.js b/deps/npm/test/tap/upgrade-lifecycles.js new file mode 100644 index 00000000000000..f15fe0038e1d06 --- /dev/null +++ b/deps/npm/test/tap/upgrade-lifecycles.js @@ -0,0 +1,89 @@ +'use strict' +var path = require('path') +var test = require('tap').test +var Tacks = require('tacks') +var File = Tacks.File +var Dir = Tacks.Dir +var extend = Object.assign || require('util')._extend +var common = require('../common-tap.js') + +var basedir = path.join(__dirname, path.basename(__filename, '.js')) +var testdir = path.join(basedir, 'testdir') +var cachedir = path.join(basedir, 'cache') +var globaldir = path.join(basedir, 'global') +var tmpdir = path.join(basedir, 'tmp') + +var conf = { + cwd: testdir, + env: extend({ + npm_config_cache: cachedir, + npm_config_tmp: tmpdir, + npm_config_prefix: globaldir, + npm_config_registry: common.registry, + npm_config_loglevel: 'warn' + }, process.env) +} + +var cycler = { + name: 'cycler', + version: '1.0.0', + scripts: { + uninstall: 'echo #UNINSTALL#', + install: 'echo #INSTALL#' + } +} + +var fixture = new Tacks(Dir({ + cache: Dir(), + global: Dir(), + tmp: Dir(), + testdir: Dir({ + 'cycler': Dir({ + 'package.json': File(cycler) + }), + node_modules: Dir({ + 'cycler': Dir({ + 'package.json': File(cycler) + }) + }), + 'package.json': File({ + name: 'upgrade-lifecycles', + version: '1.0.0', + dependencies: { + 'cycler': 'file:cycler' + } + }) + }) +})) + +function setup () { + cleanup() + fixture.create(basedir) +} + +function cleanup () { + fixture.remove(basedir) +} + +test('setup', function (t) { + setup() + t.done() +}) + +test('upgrade-lifecycles', function (t) { + common.npm(['install', 'file:cycler'], conf, function (err, code, stdout, stderr) { + if (err) throw err + t.is(code, 0, 'command ran ok') + + t.comment(stdout.trim()) + t.comment(stderr.trim()) + t.match(stdout, /#INSTALL#/, 'ran install lifecycle') + t.match(stdout, /#UNINSTALL#/, 'ran uninstall lifecycle') + t.done() + }) +}) + +test('cleanup', function (t) { + cleanup() + t.done() +}) diff --git a/deps/npm/test/tap/version-sub-directory-shrinkwrap.js b/deps/npm/test/tap/version-sub-directory-shrinkwrap.js new file mode 100644 index 00000000000000..0455b62ab7536a --- /dev/null +++ b/deps/npm/test/tap/version-sub-directory-shrinkwrap.js @@ -0,0 +1,80 @@ +var common = require('../common-tap.js') +var fs = require('fs') +var path = require('path') + +var mkdirp = require('mkdirp') +var osenv = require('osenv') +var rimraf = require('rimraf') +var test = require('tap').test + +var npm = require('../../lib/npm.js') + +var pkg = path.resolve(__dirname, 'version-sub-directory') +var subDirectory = path.resolve(pkg, 'sub-directory') +var packagePath = path.resolve(pkg, 'package.json') +var shrinkwrapPath = path.resolve(pkg, 'npm-shrinkwrap.json') +var cache = path.resolve(pkg, 'cache') + +var json = { name: 'cat', version: '0.1.2' } + +test('npm version from a subdirectory', function (t) { + setup() + npmLoad() + + function npmLoad () { + npm.load({ cache: cache }, function () { + common.makeGitRepo({ + path: pkg, + added: ['package.json', 'npm-shrinkwrap.json'] + }, version) + }) + } + + function version (er, stdout, stderr) { + t.ifError(er, 'git repo initialized without issue') + t.notOk(stderr, 'no error output') + npm.config.set('sign-git-tag', false) + npm.commands.version(['patch'], checkVersion) + } + + function checkVersion (er) { + var newShrinkwrap = JSON.parse(fs.readFileSync(shrinkwrapPath)) + t.is(newShrinkwrap.version, '0.1.3', 'shrinkwrap has right version') + var newPackage = JSON.parse(fs.readFileSync(packagePath)) + t.is(newPackage.version, '0.1.3', 'package.json has right version') + var git = require('../../lib/utils/git.js') + t.ifError(er, 'version command ran without error') + git.whichAndExec( + ['log'], + { cwd: pkg, env: process.env }, + checkCommit + ) + } + + function checkCommit (er, log, stderr) { + t.ifError(er, 'git log ran without issue') + t.notOk(stderr, 'no error output') + t.ok(log.match(/0\.1\.3/g), 'commited from subdirectory') + t.end() + } +}) + +test('cleanup', function (t) { + cleanup() + t.end() +}) + +function cleanup () { + // windows fix for locked files + process.chdir(osenv.tmpdir()) + rimraf.sync(pkg) +} + +function setup () { + cleanup() + mkdirp.sync(cache) + mkdirp.sync(subDirectory) + process.chdir(subDirectory) + fs.writeFileSync(packagePath, JSON.stringify(json), 'utf8') + fs.writeFileSync(shrinkwrapPath, JSON.stringify(json), 'utf8') +} diff --git a/deps/npm/test/tap/view.js b/deps/npm/test/tap/view.js index e80031b1c2d447..371e1d922de460 100644 --- a/deps/npm/test/tap/view.js +++ b/deps/npm/test/tap/view.js @@ -11,6 +11,8 @@ var t2dir = path.resolve(tmp, 'view-local-notmine') var t3dir = path.resolve(tmp, 'view-local-mine') var mr = require('npm-registry-mock') +var server + test('setup', function (t) { mkdirp.sync(t1dir) mkdirp.sync(t2dir) @@ -29,7 +31,11 @@ test('setup', function (t) { }), 'utf8') t.pass('created fixtures') - t.end() + + mr({ port: common.port, plugin: plugin }, function (er, s) { + server = s + t.end() + }) }) function plugin (server) { @@ -84,294 +90,293 @@ test('npm view . with no package.json', function (t) { test('npm view . with no published package', function (t) { process.chdir(t3dir) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - '.', - '--registry=' + common.registry - ], { cwd: t3dir }, function (err, code, stdout, stderr) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 1, 'exit not ok') - t.similar(stderr, /version not found/m) - s.close() - t.end() - }) + common.npm([ + 'view', + '.', + '--registry=' + common.registry + ], { cwd: t3dir }, function (err, code, stdout, stderr) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 1, 'exit not ok') + t.similar(stderr, /version not found/m) + t.end() }) }) test('npm view .', function (t) { process.chdir(t2dir) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - '.', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - var re = new RegExp("name: 'test-repo-url-https'") - t.similar(stdout, re) - s.close() - t.end() - }) + common.npm([ + 'view', + '.', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + var re = new RegExp("name: 'test-repo-url-https'") + t.similar(stdout, re) + t.end() }) }) test('npm view . select fields', function (t) { process.chdir(t2dir) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - '.', - 'main', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - t.equal(stdout.trim(), 'index.js', 'should print `index.js`') - s.close() - t.end() - }) + common.npm([ + 'view', + '.', + 'main', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), 'index.js', 'should print `index.js`') + t.end() }) }) test('npm view .@', function (t) { process.chdir(t2dir) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - '.@0.0.0', - 'version', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - t.equal(stdout.trim(), '0.0.0', 'should print `0.0.0`') - s.close() - t.end() - }) + common.npm([ + 'view', + '.@0.0.0', + 'version', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), '0.0.0', 'should print `0.0.0`') + t.end() }) }) test('npm view .@ version --json', function (t) { process.chdir(t2dir) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - '.@0.0.0', - 'version', - '--json', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - t.equal(stdout.trim(), '"0.0.0"', 'should print `"0.0.0"`') - s.close() - t.end() - }) + common.npm([ + 'view', + '.@0.0.0', + 'version', + '--json', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), '"0.0.0"', 'should print `"0.0.0"`') + t.end() }) }) test('npm view . --json author name version', function (t) { process.chdir(t2dir) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - '.', - 'author', - 'name', - 'version', - '--json', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - var expected = JSON.stringify({ - author: 'Evan Lucas ', - name: 'test-repo-url-https', - version: '0.0.1' - }, null, 2) - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - t.equal(stdout.trim(), expected, 'should print ' + expected) - s.close() - t.end() - }) + common.npm([ + 'view', + '.', + 'author', + 'name', + 'version', + '--json', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + var expected = JSON.stringify({ + author: 'Evan Lucas ', + name: 'test-repo-url-https', + version: '0.0.1' + }, null, 2) + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), expected, 'should print ' + expected) + t.end() }) }) test('npm view .@ --json author name version', function (t) { process.chdir(t2dir) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - '.@0.0.0', - 'author', - 'name', - 'version', - '--json', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - var expected = JSON.stringify({ - author: 'Evan Lucas ', - name: 'test-repo-url-https', - version: '0.0.0' - }, null, 2) - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - t.equal(stdout.trim(), expected, 'should print ' + expected) - s.close() - t.end() - }) + common.npm([ + 'view', + '.@0.0.0', + 'author', + 'name', + 'version', + '--json', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + var expected = JSON.stringify({ + author: 'Evan Lucas ', + name: 'test-repo-url-https', + version: '0.0.0' + }, null, 2) + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), expected, 'should print ' + expected) + t.end() }) }) test('npm view ', function (t) { - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - 'underscore', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - var re = new RegExp("name: 'underscore'") - t.similar(stdout, re, 'should have name `underscore`') - s.close() - t.end() - }) + common.npm([ + 'view', + 'underscore', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + var re = new RegExp("name: 'underscore'") + t.similar(stdout, re, 'should have name `underscore`') + t.end() }) }) test('npm view --global', function (t) { - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - 'underscore', - '--global', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - var re = new RegExp("name: 'underscore'") - t.similar(stdout, re, 'should have name `underscore`') - s.close() - t.end() - }) + common.npm([ + 'view', + 'underscore', + '--global', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + var re = new RegExp("name: 'underscore'") + t.similar(stdout, re, 'should have name `underscore`') + t.end() }) }) test('npm view @ versions', function (t) { - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - 'underscore@^1.5.0', - 'versions', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - var re = new RegExp('1.5.0') - t.similar(stdout, re, 'should have version `1.5.0`') - s.close() - t.end() - }) + common.npm([ + 'view', + 'underscore@^1.5.0', + 'versions', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + var re = new RegExp('1.5.0') + t.similar(stdout, re, 'should have version `1.5.0`') + t.end() + }) +}) + +test('npm view @ version --json', function (t) { + common.npm([ + 'view', + 'underscore@~1.5.0', + 'version', + '--json', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), JSON.stringify([ + '1.5.0', + '1.5.1' + ], null, 2), 'should have three versions') + t.end() }) }) test('npm view --json', function (t) { t.plan(3) - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - 'underscore', - '--json', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - s.close() - try { - var out = JSON.parse(stdout.trim()) - t.similar(out, { - maintainers: ['jashkenas '] - }, 'should have the same maintainer') - } catch (er) { - t.fail('Unable to parse JSON') - } - }) + common.npm([ + 'view', + 'underscore', + '--json', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + try { + var out = JSON.parse(stdout.trim()) + t.similar(out, { + maintainers: ['jashkenas '] + }, 'should have the same maintainer') + } catch (er) { + t.fail('Unable to parse JSON') + } + }) +}) + +test('npm view @', function (t) { + common.npm([ + 'view', + 'underscore@12345', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), '', 'should return empty') + t.end() + }) +}) + +test('npm view @ --json', function (t) { + common.npm([ + 'view', + 'underscore@12345', + '--json', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), '', 'should return empty') + t.end() }) }) test('npm view ', function (t) { - mr({ port: common.port, plugin: plugin }, function (er, s) { - common.npm([ - 'view', - 'underscore', - 'homepage', - '--registry=' + common.registry - ], { cwd: t2dir }, function (err, code, stdout) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 0, 'exit ok') - t.equal(stdout.trim(), 'http://underscorejs.org', - 'homepage should equal `http://underscorejs.org`') - s.close() - t.end() - }) + common.npm([ + 'view', + 'underscore', + 'homepage', + '--registry=' + common.registry + ], { cwd: t2dir }, function (err, code, stdout) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 0, 'exit ok') + t.equal(stdout.trim(), 'http://underscorejs.org', + 'homepage should equal `http://underscorejs.org`') + t.end() }) }) test('npm view with invalid package name', function (t) { var invalidName = 'InvalidPackage' - var obj = {} - obj['/' + invalidName] = [404, {'error': 'not found'}] - - mr({ port: common.port, mocks: { 'get': obj } }, function (er, s) { - common.npm([ - 'view', - invalidName, - '--registry=' + common.registry - ], {}, function (err, code, stdout, stderr) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 1, 'exit not ok') - - t.similar(stderr, new RegExp('is not in the npm registry'), - 'Package should NOT be found') - - t.dissimilar(stderr, new RegExp('use the name yourself!'), - 'Suggestion should not be there') - - t.similar(stderr, new RegExp('name can no longer contain capital letters'), - 'Suggestion about Capital letter should be there') - - s.close() - t.end() - }) + + server.get('/' + invalidName).reply('404', {'error': 'not found'}) + common.npm([ + 'view', + invalidName, + '--registry=' + common.registry + ], {}, function (err, code, stdout, stderr) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 1, 'exit not ok') + + t.similar(stderr, new RegExp('is not in the npm registry'), + 'Package should NOT be found') + + t.dissimilar(stderr, new RegExp('use the name yourself!'), + 'Suggestion should not be there') + + t.similar(stderr, new RegExp('name can no longer contain capital letters'), + 'Suggestion about Capital letter should be there') + + t.end() }) }) test('npm view with valid but non existent package name', function (t) { - mr({ port: common.port, mocks: { - 'get': { - '/valid-but-non-existent-package': [404, {'error': 'not found'}] - } - }}, function (er, s) { - common.npm([ - 'view', - 'valid-but-non-existent-package', - '--registry=' + common.registry - ], {}, function (err, code, stdout, stderr) { - t.ifError(err, 'view command finished successfully') - t.equal(code, 1, 'exit not ok') - - t.similar(stderr, - new RegExp("'valid-but-non-existent-package' is not in the npm registry\."), - 'Package should NOT be found') - - t.similar(stderr, new RegExp('use the name yourself!'), - 'Suggestion should be there') - - s.close() - t.end() - }) + server.get('/valid-but-non-existent-package').reply(404, {'error': 'not found'}) + common.npm([ + 'view', + 'valid-but-non-existent-package', + '--registry=' + common.registry + ], {}, function (err, code, stdout, stderr) { + t.ifError(err, 'view command finished successfully') + t.equal(code, 1, 'exit not ok') + + t.similar(stderr, + new RegExp("'valid-but-non-existent-package' is not in the npm registry\."), + 'Package should NOT be found') + + t.similar(stderr, new RegExp('use the name yourself!'), + 'Suggestion should be there') + + t.end() }) }) @@ -381,5 +386,6 @@ test('cleanup', function (t) { rimraf.sync(t2dir) rimraf.sync(t3dir) t.pass('cleaned up') + server.close() t.end() }) diff --git a/deps/v8/build/standalone.gypi b/deps/v8/build/standalone.gypi index 6c88409dbee892..a9123cbae0343c 100644 --- a/deps/v8/build/standalone.gypi +++ b/deps/v8/build/standalone.gypi @@ -33,6 +33,7 @@ 'includes': ['toolchain.gypi'], 'variables': { 'component%': 'static_library', + 'force_dynamic_crt%': 0, 'clang_xcode%': 0, # Track where uninitialized memory originates from. From fastest to # slowest: 0 - no tracking, 1 - track only the initial allocation site, 2 diff --git a/deps/v8/build/toolchain.gypi b/deps/v8/build/toolchain.gypi index 519779edb4f503..faecf8e43d5168 100644 --- a/deps/v8/build/toolchain.gypi +++ b/deps/v8/build/toolchain.gypi @@ -39,7 +39,6 @@ 'ubsan_vptr%': 0, 'v8_target_arch%': '<(target_arch)', 'v8_host_byteorder%': 'Size(); AllocationAlignment alignment = old_object->RequiredAlignment(); AllocationResult allocation; + AllocationSpace space_allocated_in = space_to_allocate_; if (space_to_allocate_ == NEW_SPACE) { if (size > kMaxLabObjectSize) { allocation = @@ -1684,11 +1685,12 @@ class MarkCompactCollector::EvacuateNewSpaceVisitor final } if (allocation.IsRetry() || (space_to_allocate_ == OLD_SPACE)) { allocation = AllocateInOldSpace(size, alignment); + space_allocated_in = OLD_SPACE; } bool ok = allocation.To(target_object); DCHECK(ok); USE(ok); - return space_to_allocate_; + return space_allocated_in; } inline bool NewLocalAllocationBuffer() { diff --git a/deps/v8/src/lookup.h b/deps/v8/src/lookup.h index abd073284d4a82..3fbd9b41002f92 100644 --- a/deps/v8/src/lookup.h +++ b/deps/v8/src/lookup.h @@ -179,6 +179,7 @@ class LookupIterator final BASE_EMBEDDED { Handle GetReceiver() const { return receiver_; } Handle GetStoreTarget() const { + DCHECK(receiver->IsJSObject()); if (receiver_->IsJSGlobalProxy()) { Map* map = JSGlobalProxy::cast(*receiver_)->map(); if (map->has_hidden_prototype()) { diff --git a/deps/v8/src/objects.cc b/deps/v8/src/objects.cc index 51993f3f329ca5..fa45a091b12dfc 100644 --- a/deps/v8/src/objects.cc +++ b/deps/v8/src/objects.cc @@ -4214,11 +4214,20 @@ Maybe Object::SetPropertyInternal(LookupIterator* it, return JSProxy::SetProperty(it->GetHolder(), it->GetName(), value, it->GetReceiver(), language_mode); - case LookupIterator::INTERCEPTOR: + case LookupIterator::INTERCEPTOR: { + Handle store_target_map; + if (it->GetReceiver()->IsJSObject()) { + store_target_map = handle(it->GetStoreTarget()->map(), it->isolate()); + } if (it->HolderIsReceiverOrHiddenPrototype()) { Maybe result = JSObject::SetPropertyWithInterceptor(it, should_throw, value); if (result.IsNothing() || result.FromJust()) return result; + Utils::ApiCheck(store_target_map.is_null() || + *store_target_map == it->GetStoreTarget()->map(), + it->IsElement() ? "v8::IndexedPropertySetterCallback" + : "v8::NamedPropertySetterCallback", + "Interceptor silently changed store target."); } else { Maybe maybe_attributes = JSObject::GetPropertyAttributesWithInterceptor(it); @@ -4227,10 +4236,16 @@ Maybe Object::SetPropertyInternal(LookupIterator* it, if ((maybe_attributes.FromJust() & READ_ONLY) != 0) { return WriteToReadOnlyProperty(it, value, should_throw); } + Utils::ApiCheck(store_target_map.is_null() || + *store_target_map == it->GetStoreTarget()->map(), + it->IsElement() ? "v8::IndexedPropertySetterCallback" + : "v8::NamedPropertySetterCallback", + "Interceptor silently changed store target."); *found = false; return Nothing(); } break; + } case LookupIterator::ACCESSOR: { if (it->IsReadOnly()) { diff --git a/deps/v8/src/parsing/parser.cc b/deps/v8/src/parsing/parser.cc index 7fd6d5b302b0d0..48837f0ad62e27 100644 --- a/deps/v8/src/parsing/parser.cc +++ b/deps/v8/src/parsing/parser.cc @@ -2923,40 +2923,40 @@ TryStatement* Parser::ParseTryStatement(bool* ok) { catch_scope = NewScope(scope_, CATCH_SCOPE); catch_scope->set_start_position(scanner()->location().beg_pos); - ExpressionClassifier pattern_classifier(this); - Expression* pattern = ParsePrimaryExpression(&pattern_classifier, CHECK_OK); - ValidateBindingPattern(&pattern_classifier, CHECK_OK); - - const AstRawString* name = ast_value_factory()->dot_catch_string(); - bool is_simple = pattern->IsVariableProxy(); - if (is_simple) { - auto proxy = pattern->AsVariableProxy(); - scope_->RemoveUnresolved(proxy); - name = proxy->raw_name(); - } - - catch_variable = catch_scope->DeclareLocal(name, VAR, kCreatedInitialized, - Variable::NORMAL); - - Expect(Token::RPAREN, CHECK_OK); - { CollectExpressionsInTailPositionToListScope collect_expressions_in_tail_position_scope( function_state_, &expressions_in_tail_position_in_catch_block); BlockState block_state(&scope_, catch_scope); - // TODO(adamk): Make a version of ParseBlock that takes a scope and - // a block. catch_block = factory()->NewBlock(nullptr, 16, false, RelocInfo::kNoPosition); - Scope* block_scope = NewScope(scope_, BLOCK_SCOPE); + // Create a block scope to hold any lexical declarations created + // as part of destructuring the catch parameter. + Scope* block_scope = NewScope(scope_, BLOCK_SCOPE); block_scope->set_start_position(scanner()->location().beg_pos); { BlockState block_state(&scope_, block_scope); Target target(&this->target_stack_, catch_block); + ExpressionClassifier pattern_classifier(this); + Expression* pattern = + ParsePrimaryExpression(&pattern_classifier, CHECK_OK); + ValidateBindingPattern(&pattern_classifier, CHECK_OK); + + const AstRawString* name = ast_value_factory()->dot_catch_string(); + bool is_simple = pattern->IsVariableProxy(); + if (is_simple) { + auto proxy = pattern->AsVariableProxy(); + scope_->RemoveUnresolved(proxy); + name = proxy->raw_name(); + } + catch_variable = catch_scope->DeclareLocal( + name, VAR, kCreatedInitialized, Variable::NORMAL); + + Expect(Token::RPAREN, CHECK_OK); + if (!is_simple) { DeclarationDescriptor descriptor; descriptor.declaration_kind = DeclarationDescriptor::NORMAL; @@ -2978,6 +2978,8 @@ TryStatement* Parser::ParseTryStatement(bool* ok) { catch_block->statements()->Add(init_block, zone()); } + // TODO(adamk): This should call ParseBlock in order to properly + // add an additional block scope for the catch body. Expect(Token::LBRACE, CHECK_OK); while (peek() != Token::RBRACE) { Statement* stat = ParseStatementListItem(CHECK_OK); @@ -4445,9 +4447,6 @@ Block* Parser::BuildParameterInitializationBlock( // TODO(adamk): Should this be RelocInfo::kNoPosition, since // it's just copying from a temp var to the real param var? descriptor.initialization_pos = parameter.pattern->position(); - // The initializer position which will end up in, - // Variable::initializer_position(), used for hole check elimination. - int initializer_position = parameter.pattern->position(); Expression* initial_value = factory()->NewVariableProxy(parameters.scope->parameter(i)); if (parameter.initializer != nullptr) { @@ -4465,7 +4464,6 @@ Block* Parser::BuildParameterInitializationBlock( condition, parameter.initializer, initial_value, RelocInfo::kNoPosition); descriptor.initialization_pos = parameter.initializer->position(); - initializer_position = parameter.initializer_end_position; } Scope* param_scope = scope_; @@ -4490,7 +4488,7 @@ Block* Parser::BuildParameterInitializationBlock( { BlockState block_state(&scope_, param_scope); DeclarationParsingResult::Declaration decl( - parameter.pattern, initializer_position, initial_value); + parameter.pattern, parameter.initializer_end_position, initial_value); PatternRewriter::DeclareAndInitializeVariables(param_block, &descriptor, &decl, nullptr, CHECK_OK); } diff --git a/deps/v8/test/cctest/test-api-interceptors.cc b/deps/v8/test/cctest/test-api-interceptors.cc index a1894fad1adce4..c1aa0d69269964 100644 --- a/deps/v8/test/cctest/test-api-interceptors.cc +++ b/deps/v8/test/cctest/test-api-interceptors.cc @@ -3245,6 +3245,25 @@ THREADED_TEST(Regress149912) { CompileRun("Number.prototype.__proto__ = new Bug; var x = 0; x.foo();"); } +THREADED_TEST(Regress625155) { + LocalContext context; + v8::HandleScope scope(context->GetIsolate()); + Local templ = FunctionTemplate::New(context->GetIsolate()); + AddInterceptor(templ, EmptyInterceptorGetter, EmptyInterceptorSetter); + context->Global() + ->Set(context.local(), v8_str("Bug"), + templ->GetFunction(context.local()).ToLocalChecked()) + .FromJust(); + CompileRun( + "Number.prototype.__proto__ = new Bug;" + "var x;" + "x = 0xdead;" + "x.boom = 0;" + "x = 's';" + "x.boom = 0;" + "x = 1.5;" + "x.boom = 0;"); +} THREADED_TEST(Regress125988) { v8::HandleScope scope(CcTest::isolate()); diff --git a/deps/v8/test/mjsunit/regress/regress-5106.js b/deps/v8/test/mjsunit/regress/regress-5106.js new file mode 100644 index 00000000000000..52d550a8784068 --- /dev/null +++ b/deps/v8/test/mjsunit/regress/regress-5106.js @@ -0,0 +1,29 @@ +// Copyright 2016 the V8 project authors. All rights reserved. +// Use of this source code is governed by a BSD-style license that can be +// found in the LICENSE file. + +function* g1() { + try { + throw {}; + } catch ({a = class extends (yield) {}}) { + } +} +g1().next(); // crashes without fix + +function* g2() { + let x = function(){}; + try { + throw {}; + } catch ({b = class extends x {}}) { + } +} +g2().next(); // crashes without fix + +function* g3() { + let x = 42; + try { + throw {}; + } catch ({c = (function() { return x })()}) { + } +} +g3().next(); // throws a ReferenceError without fix diff --git a/deps/v8/test/mjsunit/regress/regress-5454.js b/deps/v8/test/mjsunit/regress/regress-5454.js new file mode 100644 index 00000000000000..ca6a9433b24025 --- /dev/null +++ b/deps/v8/test/mjsunit/regress/regress-5454.js @@ -0,0 +1,11 @@ +// Copyright 2016 the V8 project authors. All rights reserved. +// Use of this source code is governed by a BSD-style license that can be +// found in the LICENSE file. + +assertThrows(function(...[b = !b]) { }, ReferenceError); +assertThrows(() => (function([b = !b]) { })([]), ReferenceError); +assertThrows(() => (function({b = !b}) { })({}), ReferenceError); + +assertThrows((...[b = !b]) => { }, ReferenceError); +assertThrows(() => (([b = !b]) => { })([]), ReferenceError); +assertThrows(() => (({b = !b}) => { })({}), ReferenceError); diff --git a/doc/api/buffer.md b/doc/api/buffer.md index ac2c1e1b6752f0..0e945db427ee88 100644 --- a/doc/api/buffer.md +++ b/doc/api/buffer.md @@ -124,7 +124,7 @@ $ node --zero-fill-buffers ``` -### What makes [`Buffer.allocUnsafe()`] and [`Buffer.allocUnsafeSlow()`] "unsafe"? +### What makes `Buffer.allocUnsafe()` and `Buffer.allocUnsafeSlow()` "unsafe"? When calling [`Buffer.allocUnsafe()`] and [`Buffer.allocUnsafeSlow()`], the segment of allocated memory is *uninitialized* (it is not zeroed-out). While @@ -1811,12 +1811,13 @@ added: v0.1.90 --> * `encoding` {String} The character encoding to decode to. **Default:** `'utf8'` -* `start` {Integer} Where to start decoding. **Default:** `0` -* `end` {Integer} Where to stop decoding (not inclusive). **Default:** [`buf.length`] +* `start` {Integer} The byte offset to start decoding at. **Default:** `0` +* `end` {Integer} The byte offset to stop decoding at (not inclusive). + **Default:** [`buf.length`] * Return: {String} -Decodes `buf` to a string according to the specified character encoding in `encoding`. -`start` and `end` may be passed to decode only a subset of `buf`. +Decodes `buf` to a string according to the specified character encoding in +`encoding`. `start` and `end` may be passed to decode only a subset of `buf`. Examples: @@ -1829,19 +1830,22 @@ for (var i = 0 ; i < 26 ; i++) { } // Prints: abcdefghijklmnopqrstuvwxyz -console.log(buf.toString('ascii')); +console.log(buf1.toString('ascii')); // Prints: abcde -console.log(buf.toString('ascii', 0, 5)); +console.log(buf1.toString('ascii', 0, 5)); const buf2 = Buffer.from('tést'); -// Prints: tés -console.log(buf.toString('utf8', 0, 3)); +// Prints: 74c3a97374 +console.log(buf2.toString('hex')); + +// Prints: té +console.log(buf2.toString('utf8', 0, 3)); -// Prints: tés -console.log(buf.toString(undefined, 0, 3)); +// Prints: té +console.log(buf2.toString(undefined, 0, 3)); ``` ### buf.toJSON() @@ -2392,7 +2396,7 @@ console.log(buf); [`Buffer.from(array)`]: #buffer_class_method_buffer_from_array [`Buffer.from(arrayBuffer)`]: #buffer_class_method_buffer_from_arraybuffer_byteoffset_length [`Buffer.from(buffer)`]: #buffer_class_method_buffer_from_buffer -[`Buffer.from(string)`]: #buffer_class_method_buffer_from_str_encoding +[`Buffer.from(string)`]: #buffer_class_method_buffer_from_string_encoding [`Buffer.poolSize`]: #buffer_class_property_buffer_poolsize [`RangeError`]: errors.html#errors_class_rangeerror [`util.inspect()`]: util.html#util_util_inspect_object_options diff --git a/doc/api/child_process.md b/doc/api/child_process.md index ae3d18fd080886..1cf30f440e5d71 100644 --- a/doc/api/child_process.md +++ b/doc/api/child_process.md @@ -575,7 +575,7 @@ added: v0.11.12 * `input` {String|Buffer} The value which will be passed as stdin to the spawned process - supplying this value will override `stdio[0]` - * `stdio` {Array} Child's stdio configuration. (Default: `'pipe'`) + * `stdio` {String | Array} Child's stdio configuration. (Default: `'pipe'`) - `stderr` by default will be output to the parent process' stderr unless `stdio` is specified * `env` {Object} Environment key-value pairs @@ -613,7 +613,7 @@ added: v0.11.12 * `input` {String|Buffer} The value which will be passed as stdin to the spawned process - supplying this value will override `stdio[0]` - * `stdio` {Array} Child's stdio configuration. (Default: `'pipe'`) + * `stdio` {String | Array} Child's stdio configuration. (Default: `'pipe'`) - `stderr` by default will be output to the parent process' stderr unless `stdio` is specified * `env` {Object} Environment key-value pairs @@ -657,7 +657,7 @@ added: v0.11.12 * `input` {String|Buffer} The value which will be passed as stdin to the spawned process - supplying this value will override `stdio[0]` - * `stdio` {Array} Child's stdio configuration. + * `stdio` {String | Array} Child's stdio configuration. * `env` {Object} Environment key-value pairs * `uid` {Number} Sets the user identity of the process. (See setuid(2).) * `gid` {Number} Sets the group identity of the process. (See setgid(2).) @@ -1046,7 +1046,7 @@ this occurs. added: v0.1.90 --> -* {Stream.Readable} +* {stream.Readable} A `Readable Stream` that represents the child process's `stderr`. @@ -1061,7 +1061,7 @@ the same value. added: v0.1.90 --> -* {Stream.Writable} +* {stream.Writable} A `Writable Stream` that represents the child process's `stdin`. @@ -1119,7 +1119,7 @@ assert.equal(child.stdio[2], child.stderr); added: v0.1.90 --> -* {Stream.Readable} +* {stream.Readable} A `Readable Stream` that represents the child process's `stdout`. diff --git a/doc/api/crypto.md b/doc/api/crypto.md index 8b99eed1e27e0b..ebe247c2761e20 100644 --- a/doc/api/crypto.md +++ b/doc/api/crypto.md @@ -992,7 +992,7 @@ thrown. ## `crypto` module methods and properties -## crypto.constants +### crypto.constants @@ -1241,18 +1241,18 @@ input.on('readable', () => { added: v0.1.92 --> -Creates and returns a `Sign` object that uses the given `algorithm`. On -recent OpenSSL releases, `openssl list-public-key-algorithms` will -display the available signing algorithms. One example is `'RSA-SHA256'`. +Creates and returns a `Sign` object that uses the given `algorithm`. +Use [`crypto.getHashes()`][] to obtain an array of names of the available +signing algorithms. ### crypto.createVerify(algorithm) -Creates and returns a `Verify` object that uses the given algorithm. On -recent OpenSSL releases, `openssl list-public-key-algorithms` will -display the available signing algorithms. One example is `'RSA-SHA256'`. +Creates and returns a `Verify` object that uses the given algorithm. +Use [`crypto.getHashes()`][] to obtain an array of names of the available +signing algorithms. ### crypto.getCiphers() -Returns an array with the names of the supported hash algorithms. +Returns an array of the names of the supported hash algorithms, +such as `RSA-SHA256`. Example: @@ -1632,20 +1633,20 @@ the `crypto`, `tls`, and `https` modules and are generally specific to OpenSSL. SSL_OP_ALL Applies multiple bug workarounds within OpenSSL. See - https://www.openssl.org/docs/manmaster/ssl/SSL_CTX_set_options.html for + https://www.openssl.org/docs/man1.0.2/ssl/SSL_CTX_set_options.html for detail. SSL_OP_ALLOW_UNSAFE_LEGACY_RENEGOTIATION Allows legacy insecure renegotiation between OpenSSL and unpatched clients or servers. See - https://www.openssl.org/docs/manmaster/ssl/SSL_CTX_set_options.html. + https://www.openssl.org/docs/man1.0.2/ssl/SSL_CTX_set_options.html. SSL_OP_CIPHER_SERVER_PREFERENCE Uses the server's preferences instead of the clients when selecting a cipher. See - https://www.openssl.org/docs/manmaster/ssl/SSL_CTX_set_options.html. + https://www.openssl.org/docs/man1.0.2/ssl/SSL_CTX_set_options.html. SSL_OP_CISCO_ANYCONNECT @@ -1948,7 +1949,7 @@ the `crypto`, `tls`, and `https` modules and are generally specific to OpenSSL. [`ecdh.generateKeys()`]: #crypto_ecdh_generatekeys_encoding_format [`ecdh.setPrivateKey()`]: #crypto_ecdh_setprivatekey_private_key_encoding [`ecdh.setPublicKey()`]: #crypto_ecdh_setpublickey_public_key_encoding -[`EVP_BytesToKey`]: https://www.openssl.org/docs/crypto/EVP_BytesToKey.html +[`EVP_BytesToKey`]: https://www.openssl.org/docs/man1.0.2/crypto/EVP_BytesToKey.html [`hash.digest()`]: #crypto_hash_digest_encoding [`hash.update()`]: #crypto_hash_update_data_input_encoding [`hmac.digest()`]: #crypto_hmac_digest_encoding @@ -1963,8 +1964,8 @@ the `crypto`, `tls`, and `https` modules and are generally specific to OpenSSL. [initialization vector]: https://en.wikipedia.org/wiki/Initialization_vector [NIST SP 800-131A]: http://nvlpubs.nist.gov/nistpubs/SpecialPublications/NIST.SP.800-131Ar1.pdf [NIST SP 800-132]: http://csrc.nist.gov/publications/nistpubs/800-132/nist-sp800-132.pdf -[OpenSSL cipher list format]: https://www.openssl.org/docs/apps/ciphers.html#CIPHER-LIST-FORMAT -[OpenSSL's SPKAC implementation]: https://www.openssl.org/docs/apps/spkac.html +[OpenSSL cipher list format]: https://www.openssl.org/docs/man1.0.2/apps/ciphers.html#CIPHER-LIST-FORMAT +[OpenSSL's SPKAC implementation]: https://www.openssl.org/docs/man1.0.2/apps/spkac.html [publicly trusted list of CAs]: https://mxr.mozilla.org/mozilla/source/security/nss/lib/ckfw/builtins/certdata.txt [RFC 2412]: https://www.rfc-editor.org/rfc/rfc2412.txt [RFC 3526]: https://www.rfc-editor.org/rfc/rfc3526.txt diff --git a/doc/api/errors.md b/doc/api/errors.md index 5ede6e6e38ea45..28f1858a1ded57 100644 --- a/doc/api/errors.md +++ b/doc/api/errors.md @@ -449,13 +449,15 @@ added properties. ### Class: System Error #### error.code -#### error.errno Returns a string representing the error code, which is always `E` followed by a sequence of capital letters, and may be referenced in `man 2 intro`. -The properties `error.code` and `error.errno` are aliases of one another and -return the same value. +#### error.errno + +Returns a number corresponding to the **negated** error code, which may be +referenced in `man 2 intro`. For example, an `ENOENT` error has an `errno` of +`-2` because the error code for `ENOENT` is `2`. #### error.syscall diff --git a/doc/api/fs.md b/doc/api/fs.md index 5cb4b9f422e9fb..863b697446e50e 100644 --- a/doc/api/fs.md +++ b/doc/api/fs.md @@ -129,7 +129,7 @@ See more details in [`fs.watch()`][]. The `filename` argument may not be provided depending on operating system support. If `filename` is provided, it will be provided as a `Buffer` if -`fs.watch()` is called with it's `encoding` option set to `'buffer'`, otherwise +`fs.watch()` is called with its `encoding` option set to `'buffer'`, otherwise `filename` will be a string. ```js @@ -867,7 +867,7 @@ added: v0.1.95 * `callback` {Function} Asynchronous fstat(2). The callback gets two arguments `(err, stats)` where -`stats` is a [`fs.Stats`][] object. `fstat()` is identical to [`stat()`][], +`stats` is an [`fs.Stats`][] object. `fstat()` is identical to [`stat()`][], except that the file to be stat-ed is specified by the file descriptor `fd`. ## fs.fstatSync(fd) @@ -877,7 +877,7 @@ added: v0.1.95 * `fd` {Integer} -Synchronous fstat(2). Returns an instance of `fs.Stats`. +Synchronous fstat(2). Returns an instance of [`fs.Stats`][]. ## fs.fsync(fd, callback) +* `options` {Object} Options containing connection details. Check + [`net.createConnection()`][] for the format of the options +* `callback` {Function} Callback function that receives the created socket +* Returns: {net.Socket} + Produces a socket/stream to be used for HTTP requests. By default, this function is the same as [`net.createConnection()`][]. However, @@ -156,6 +161,8 @@ terminates them. added: v0.11.4 --> +* {Object} + An object which contains arrays of sockets currently awaiting use by the Agent when HTTP KeepAlive is used. Do not modify. @@ -164,24 +171,26 @@ the Agent when HTTP KeepAlive is used. Do not modify. added: v0.11.4 --> +* `options` {Object} A set of options providing information for name generation + * `host` {String} A domain name or IP address of the server to issue the request to + * `port` {Number} Port of remote server + * `localAddress` {String} Local interface to bind for network connections + when issuing the request +* Returns: {String} + Get a unique name for a set of request options, to determine whether a connection can be reused. In the http agent, this returns `host:port:localAddress`. In the https agent, the name includes the CA, cert, ciphers, and other HTTPS/TLS-specific options that determine socket reusability. -Options: - -- `host`: A domain name or IP address of the server to issue the request to. -- `port`: Port of remote server. -- `localAddress`: Local interface to bind for network connections when issuing - the request. - ### agent.maxFreeSockets +* {Number} + By default set to 256. For Agents supporting HTTP KeepAlive, this sets the maximum number of sockets that will be left open in the free state. @@ -191,6 +200,8 @@ state. added: v0.3.6 --> +* {Number} + By default set to Infinity. Determines how many concurrent sockets the agent can have open per origin. Origin is either a 'host:port' or 'host:port:localAddress' combination. @@ -200,6 +211,8 @@ can have open per origin. Origin is either a 'host:port' or added: v0.5.9 --> +* {Object} + An object which contains queues of requests that have not yet been assigned to sockets. Do not modify. @@ -208,6 +221,8 @@ sockets. Do not modify. added: v0.3.6 --> +* {Object} + An object which contains arrays of sockets currently in use by the Agent. Do not modify. @@ -250,8 +265,6 @@ The request implements the [Writable Stream][] interface. This is an added: v1.4.1 --> -`function () { }` - Emitted when the request has been aborted by the client. This event is only emitted on the first call to `abort()`. @@ -260,37 +273,23 @@ emitted on the first call to `abort()`. added: v0.3.8 --> -`function () { }` - Emitted when the request has been aborted by the server and the network socket has closed. -### Event: 'checkExpectation' - - -`function (request, response) { }` - -Emitted each time a request with an http Expect header is received, where the -value is not 100-continue. If this event isn't listened for, the server will -automatically respond with a 417 Expectation Failed as appropriate. - -Note that when this event is emitted and handled, the `request` event will -not be emitted. - ### Event: 'connect' -`function (response, socket, head) { }` +* `response` {http.IncomingMessage} +* `socket` {net.Socket} +* `head` {Buffer} Emitted each time a server responds to a request with a `CONNECT` method. If this event isn't being listened for, clients receiving a `CONNECT` method will have their connections closed. -A client server pair that show you how to listen for the `'connect'` event. +A client and server pair that shows you how to listen for the `'connect'` event: ```js const http = require('http'); @@ -352,8 +351,6 @@ proxy.listen(1337, '127.0.0.1', () => { added: v0.3.2 --> -`function () { }` - Emitted when the server sends a '100 Continue' HTTP response, usually because the request contained 'Expect: 100-continue'. This is an instruction that the client should send the request body. @@ -363,17 +360,17 @@ the client should send the request body. added: v0.1.0 --> -`function (response) { }` +* `response` {http.IncomingMessage} Emitted when a response is received to this request. This event is emitted only -once. The `response` argument will be an instance of [`http.IncomingMessage`][]. +once. ### Event: 'socket' -`function (socket) { }` +* `socket` {net.Socket} Emitted after a socket is assigned to this request. @@ -382,7 +379,9 @@ Emitted after a socket is assigned to this request. added: v0.1.94 --> -`function (response, socket, head) { }` +* `response` {http.IncomingMessage} +* `socket` {net.Socket} +* `head` {Buffer} Emitted each time a server responds to a request with an upgrade. If this event isn't being listened for, clients receiving an upgrade header will have @@ -444,6 +443,10 @@ in the response to be dropped and the socket to be destroyed. added: v0.1.90 --> +* `data` {String | Buffer} +* `encoding` {String} +* `callback` {Function} + Finishes sending the request. If any parts of the body are unsent, it will flush them to the stream. If the request is chunked, this will send the terminating `'0\r\n\r\n'`. @@ -474,6 +477,8 @@ the optimization and kickstart the request. added: v0.5.9 --> +* `noDelay` {Boolean} + Once a socket is assigned to this request and is connected [`socket.setNoDelay()`][] will be called. @@ -482,6 +487,9 @@ Once a socket is assigned to this request and is connected added: v0.5.9 --> +* `enable` {Boolean} +* `initialDelay` {Number} + Once a socket is assigned to this request and is connected [`socket.setKeepAlive()`][] will be called. @@ -490,12 +498,12 @@ Once a socket is assigned to this request and is connected added: v0.5.9 --> -Once a socket is assigned to this request and is connected -[`socket.setTimeout()`][] will be called. - * `timeout` {Number} Milliseconds before a request is considered to be timed out. * `callback` {Function} Optional function to be called when a timeout occurs. Same as binding to the `timeout` event. +Once a socket is assigned to this request and is connected +[`socket.setTimeout()`][] will be called. + Returns `request`. ### request.write(chunk[, encoding][, callback]) @@ -503,14 +511,16 @@ Returns `request`. added: v0.1.29 --> +* `chunk` {String | Buffer} +* `encoding` {String} +* `callback` {Function} + Sends a chunk of the body. By calling this method many times, the user can stream a request body to a server--in that case it is suggested to use the `['Transfer-Encoding', 'chunked']` header line when creating the request. -The `chunk` argument should be a [`Buffer`][] or a string. - The `encoding` argument is optional and only applies when `chunk` is a string. Defaults to `'utf8'`. @@ -531,18 +541,34 @@ This class inherits from [`net.Server`][] and has the following additional even added: v0.3.0 --> -`function (request, response) { }` +* `request` {http.IncomingMessage} +* `response` {http.ServerResponse} -Emitted each time a request with an http Expect: 100-continue is received. +Emitted each time a request with an HTTP `Expect: 100-continue` is received. If this event isn't listened for, the server will automatically respond -with a 100 Continue as appropriate. +with a `100 Continue` as appropriate. Handling this event involves calling [`response.writeContinue()`][] if the client should continue to send the request body, or generating an appropriate HTTP response (e.g., 400 Bad Request) if the client should not continue to send the request body. -Note that when this event is emitted and handled, the `'request'` event will +Note that when this event is emitted and handled, the [`'request'`][] event will +not be emitted. + +### Event: 'checkExpectation' + + +* `request` {http.ClientRequest} +* `response` {http.ServerResponse} + +Emitted each time a request with an HTTP `Expect` header is received, where the +value is not `100-continue`. If this event isn't listened for, the server will +automatically respond with a `417 Expectation Failed` as appropriate. + +Note that when this event is emitted and handled, the [`'request'`][] event will not be emitted. ### Event: 'clientError' @@ -550,7 +576,8 @@ not be emitted. added: v0.1.94 --> -`function (exception, socket) { }` +* `exception` {Error} +* `socket` {net.Socket} If a client connection emits an `'error'` event, it will be forwarded here. Listener of this event is responsible for closing/destroying the underlying @@ -583,8 +610,6 @@ ensure the response is a properly formatted HTTP response message. added: v0.1.4 --> -`function () { }` - Emitted when the server closes. ### Event: 'connect' @@ -592,18 +617,15 @@ Emitted when the server closes. added: v0.7.0 --> -`function (request, socket, head) { }` +* `request` {http.IncomingMessage} Arguments for the HTTP request, as it is in + the [`'request'`][] event +* `socket` {net.Socket} Network socket between the server and client +* `head` {Buffer} The first packet of the tunneling stream (may be empty) -Emitted each time a client requests a http `CONNECT` method. If this event isn't +Emitted each time a client requests an HTTP `CONNECT` method. If this event isn't listened for, then clients requesting a `CONNECT` method will have their connections closed. -* `request` is the arguments for the http request, as it is in the request - event. -* `socket` is the network socket between the server and client. -* `head` is an instance of Buffer, the first packet of the tunneling stream, - this may be empty. - After this event is emitted, the request's socket will not have a `'data'` event listener, meaning you will need to bind to it in order to handle data sent to the server on that socket. @@ -613,7 +635,7 @@ sent to the server on that socket. added: v0.1.0 --> -`function (socket) { }` +* `socket` {net.Socket} When a new TCP stream is established. `socket` is an object of type [`net.Socket`][]. Usually users will not want to access this event. In @@ -626,30 +648,26 @@ accessed at `request.connection`. added: v0.1.0 --> -`function (request, response) { }` +* `request` {http.IncomingMessage} +* `response` {http.ServerResponse} Emitted each time there is a request. Note that there may be multiple requests per connection (in the case of keep-alive connections). - `request` is an instance of [`http.IncomingMessage`][] and `response` is -an instance of [`http.ServerResponse`][]. ### Event: 'upgrade' -`function (request, socket, head) { }` +* `request` {http.IncomingMessage} Arguments for the HTTP request, as it is in + the [`'request'`][] event +* `socket` {net.Socket} Network socket between the server and client +* `head` {Buffer} The first packet of the upgraded stream (may be empty) -Emitted each time a client requests a http upgrade. If this event isn't +Emitted each time a client requests an HTTP upgrade. If this event isn't listened for, then clients requesting an upgrade will have their connections closed. -* `request` is the arguments for the http request, as it is in the request - event. -* `socket` is the network socket between the server and client. -* `head` is an instance of Buffer, the first packet of the upgraded stream, - this may be empty. - After this event is emitted, the request's socket will not have a `'data'` event listener, meaning you will need to bind to it in order to handle data sent to the server on that socket. @@ -659,6 +677,8 @@ sent to the server on that socket. added: v0.1.90 --> +* `callback` {Function} + Stops the server from accepting new connections. See [`net.Server.close()`][]. ### server.listen(handle[, callback]) @@ -691,6 +711,9 @@ subsequent call will *re-open* the server using the provided options. added: v0.1.90 --> +* `path` {String} +* `callback` {Function} + Start a UNIX socket server listening for connections on the given `path`. This function is asynchronous. `callback` will be added as a listener for the @@ -704,6 +727,11 @@ subsequent call will *re-open* the server using the provided options. added: v0.1.90 --> +* `port` {Number} +* `hostname` {String} +* `backlog` {Number} +* `callback` {Function} + Begin accepting connections on the specified `port` and `hostname`. If the `hostname` is omitted, the server will accept connections on any IPv6 address (`::`) when IPv6 is available, or any IPv4 address (`0.0.0.0`) otherwise. @@ -713,7 +741,7 @@ after the `'listening'` event has been emitted. To listen to a unix socket, supply a filename instead of port and hostname. -Backlog is the maximum length of the queue of pending connections. +`backlog` is the maximum length of the queue of pending connections. The actual length will be determined by your OS through sysctl settings such as `tcp_max_syn_backlog` and `somaxconn` on linux. The default value of this parameter is 511 (not 512). @@ -729,6 +757,8 @@ subsequent call will *re-open* the server using the provided options. added: v5.7.0 --> +* {Boolean} + A Boolean indicating whether or not the server is listening for connections. @@ -737,6 +767,8 @@ connections. added: v0.7.0 --> +* {Number} + Limits maximum incoming headers count, equal to 1000 by default. If set to 0 - no limit will be applied. @@ -784,8 +816,8 @@ connections. added: v0.1.17 --> -This object is created internally by a HTTP server--not by the user. It is -passed as the second parameter to the `'request'` event. +This object is created internally by an HTTP server--not by the user. It is +passed as the second parameter to the [`'request'`][] event. The response implements, but does not inherit from, the [Writable Stream][] interface. This is an [`EventEmitter`][] with the following events: @@ -795,8 +827,6 @@ interface. This is an [`EventEmitter`][] with the following events: added: v0.6.7 --> -`function () { }` - Indicates that the underlying connection was terminated before [`response.end()`][] was called or able to flush. @@ -805,8 +835,6 @@ Indicates that the underlying connection was terminated before added: v0.3.6 --> -`function () { }` - Emitted when the response has been sent. More specifically, this event is emitted when the last segment of the response headers and body have been handed off to the operating system for transmission over the network. It @@ -819,6 +847,8 @@ After this event, no more events will be emitted on the response object. added: v0.3.0 --> +* `headers` {Object} + This method adds HTTP trailing headers (a header but at the end of the message) to the response. @@ -845,6 +875,10 @@ will result in a [`TypeError`][] being thrown. added: v0.1.90 --> +* `data` {String | Buffer} +* `encoding` {String} +* `callback` {Function} + This method signals to the server that all of the response headers and body have been sent; that server should consider this message complete. The method, `response.end()`, MUST be called on each response. @@ -860,6 +894,8 @@ is finished. added: v0.0.2 --> +* {Boolean} + Boolean value that indicates whether the response has completed. Starts as `false`. After [`response.end()`][] executes, the value will be `true`. @@ -868,6 +904,9 @@ as `false`. After [`response.end()`][] executes, the value will be `true`. added: v0.4.0 --> +* `name` {String} +* Returns: {String} + Reads out a header that's already been queued but not sent to the client. Note that the name is case insensitive. This can only be called before headers get implicitly flushed. @@ -883,6 +922,8 @@ var contentType = response.getHeader('content-type'); added: v0.9.3 --> +* {Boolean} + Boolean (read-only). True if headers were sent, false otherwise. ### response.removeHeader(name) @@ -890,6 +931,8 @@ Boolean (read-only). True if headers were sent, false otherwise. added: v0.4.0 --> +* `name` {String} + Removes a header that's queued for implicit sending. Example: @@ -903,6 +946,8 @@ response.removeHeader('Content-Encoding'); added: v0.7.5 --> +* {Boolean} + When true, the Date header will be automatically generated and sent in the response if it is not already present in the headers. Defaults to true. @@ -914,6 +959,9 @@ in responses. added: v0.4.0 --> +* `name` {String} +* `value` {String} + Sets a single header value for implicit headers. If this header already exists in the to-be-sent headers, its value will be replaced. Use an array of strings here if you need to send multiple headers with the same name. @@ -972,6 +1020,8 @@ Returns `response`. added: v0.4.0 --> +* {Number} + When using implicit headers (not calling [`response.writeHead()`][] explicitly), this property controls the status code that will be sent to the client when the headers get flushed. @@ -990,6 +1040,8 @@ status code which was sent out. added: v0.11.8 --> +* {String} + When using implicit headers (not calling [`response.writeHead()`][] explicitly), this property controls the status message that will be sent to the client when the headers get flushed. If this is left as `undefined` then the standard message for the status @@ -1009,6 +1061,11 @@ status message which was sent out. added: v0.1.29 --> +* `chunk` {String | Buffer} +* `encoding` {String} +* `callback` {Function} +* Returns: {Boolean} + If this method is called and [`response.writeHead()`][] has not been called, it will switch to implicit header mode and flush the implicit headers. @@ -1046,6 +1103,10 @@ the request body should be sent. See the [`'checkContinue'`][] event on `Server` added: v0.1.30 --> +* `statusCode` {Number} +* `statusMessage` {String} +* `headers` {Object} + Sends a response header to the request. The status code is a 3-digit HTTP status code, like `404`. The last argument, `headers`, are the response headers. Optionally one can give a human-readable `statusMessage` as the second @@ -1096,7 +1157,7 @@ added: v0.1.17 --> An `IncomingMessage` object is created by [`http.Server`][] or -[`http.ClientRequest`][] and passed as the first argument to the `'request'` +[`http.ClientRequest`][] and passed as the first argument to the [`'request'`][] and [`'response'`][] event respectively. It may be used to access response status, headers and data. @@ -1108,8 +1169,6 @@ following additional events, methods, and properties. added: v0.3.8 --> -`function () { }` - Emitted when the request has been aborted by the client and the network socket has closed. @@ -1118,8 +1177,6 @@ socket has closed. added: v0.4.2 --> -`function () { }` - Indicates that the underlying connection was closed. Just like `'end'`, this event occurs only once per response. @@ -1139,6 +1196,8 @@ to any listeners on the event. added: v0.1.5 --> +* {Object} + The request/response headers object. Key-value pairs of header names and values. Header names are lower-cased. @@ -1168,6 +1227,8 @@ header name: added: v0.1.1 --> +* {String} + In case of server request, the HTTP version sent by the client. In the case of client response, the HTTP version of the connected-to server. Probably either `'1.1'` or `'1.0'`. @@ -1180,6 +1241,8 @@ Also `message.httpVersionMajor` is the first integer and added: v0.1.1 --> +* {String} + **Only valid for request obtained from [`http.Server`][].** The request method as a string. Read only. Example: @@ -1190,6 +1253,8 @@ The request method as a string. Read only. Example: added: v0.11.6 --> +* {Array} + The raw request/response headers list exactly as they were received. Note that the keys and values are in the same list. It is *not* a @@ -1217,6 +1282,8 @@ console.log(request.rawHeaders); added: v0.11.6 --> +* {Array} + The raw request/response trailer keys and values exactly as they were received. Only populated at the `'end'` event. @@ -1237,6 +1304,8 @@ Returns `message`. added: v0.1.1 --> +* {Number} + **Only valid for response obtained from [`http.ClientRequest`][].** The 3-digit HTTP response status code. E.G. `404`. @@ -1246,6 +1315,8 @@ The 3-digit HTTP response status code. E.G. `404`. added: v0.11.10 --> +* {String} + **Only valid for response obtained from [`http.ClientRequest`][].** The HTTP response status message (reason phrase). E.G. `OK` or `Internal Server Error`. @@ -1255,6 +1326,8 @@ The HTTP response status message (reason phrase). E.G. `OK` or `Internal Server added: v0.3.0 --> +* {net.Socket} + The [`net.Socket`][] object associated with the connection. With HTTPS support, use [`request.socket.getPeerCertificate()`][] to obtain the @@ -1265,6 +1338,8 @@ client's authentication details. added: v0.3.0 --> +* {Object} + The request/response trailers object. Only populated at the `'end'` event. ### message.url @@ -1272,6 +1347,8 @@ The request/response trailers object. Only populated at the `'end'` event. added: v0.1.90 --> +* {String} + **Only valid for request obtained from [`http.Server`][].** Request URL string. This contains only the URL that is @@ -1354,27 +1431,64 @@ connected to. added: v0.1.13 --> +* Returns: {http.Server} + Returns a new instance of [`http.Server`][]. The `requestListener` is a function which is automatically -added to the `'request'` event. +added to the [`'request'`][] event. ## http.get(options[, callback]) +* `options` {Object} +* `callback` {Function} +* Returns: {http.ClientRequest} + Since most requests are GET requests without bodies, Node.js provides this -convenience method. The only difference between this method and [`http.request()`][] -is that it sets the method to GET and calls `req.end()` automatically. +convenience method. The only difference between this method and +[`http.request()`][] is that it sets the method to GET and calls `req.end()` +automatically. Note that response data must be consumed in the callback +for reasons stated in [`http.ClientRequest`][] section. -Example: +The `callback` is invoked with a single argument that is an instance of +[`http.IncomingMessage`][] + +JSON Fetching Example: ```js -http.get('http://www.google.com/index.html', (res) => { - console.log(`Got response: ${res.statusCode}`); - // consume response body - res.resume(); +http.get('http://nodejs.org/dist/index.json', (res) => { + const statusCode = res.statusCode; + const contentType = res.headers['content-type']; + + let error; + if (statusCode !== 200) { + error = new Error(`Request Failed.\n` + + `Status Code: ${statusCode}`); + } else if (!/^application\/json/.test(contentType)) { + error = new Error(`Invalid content-type.\n` + + `Expected application/json but received ${contentType}`); + } + if (error) { + console.log(error.message); + // consume response data to free up memory + res.resume(); + return; + } + + res.setEncoding('utf8'); + let rawData = ''; + res.on('data', (chunk) => rawData += chunk); + res.on('end', () => { + try { + let parsedData = JSON.parse(rawData); + console.log(parsedData); + } catch (e) { + console.log(e.message); + } + }); }).on('error', (e) => { console.log(`Got error: ${e.message}`); }); @@ -1385,7 +1499,9 @@ http.get('http://www.google.com/index.html', (res) => { added: v0.5.9 --> -Global instance of Agent which is used as the default for all http client +* {http.Agent} + +Global instance of Agent which is used as the default for all HTTP client requests. ## http.request(options[, callback]) @@ -1393,46 +1509,47 @@ requests. added: v0.3.6 --> +* `options` {Object} + * `protocol` {String} Protocol to use. Defaults to `'http:'`. + * `host` {String} A domain name or IP address of the server to issue the request to. + Defaults to `'localhost'`. + * `hostname` {String} Alias for `host`. To support [`url.parse()`][] `hostname` is + preferred over `host`. + * `family` {Number} IP address family to use when resolving `host` and `hostname`. + Valid values are `4` or `6`. When unspecified, both IP v4 and v6 will be + used. + * `port` {Number} Port of remote server. Defaults to 80. + * `localAddress` {String} Local interface to bind for network connections. + * `socketPath` {String} Unix Domain Socket (use one of host:port or socketPath). + * `method` {String} A string specifying the HTTP request method. Defaults to `'GET'`. + * `path` {String} Request path. Defaults to `'/'`. Should include query string if any. + E.G. `'/index.html?page=12'`. An exception is thrown when the request path + contains illegal characters. Currently, only spaces are rejected but that + may change in the future. + * `headers` {Object} An object containing request headers. + * `auth` {String} Basic authentication i.e. `'user:password'` to compute an + Authorization header. + * `agent` {String} Controls [`Agent`][] behavior. When an Agent is used request will + default to `Connection: keep-alive`. Possible values: + * `undefined` (default): use [`http.globalAgent`][] for this host and port. + * `Agent` object: explicitly use the passed in `Agent`. + * `false`: opts out of connection pooling with an Agent, defaults request to + `Connection: close`. + * `createConnection` {Function} A function that produces a socket/stream to use for the + request when the `agent` option is not used. This can be used to avoid + creating a custom Agent class just to override the default `createConnection` + function. See [`agent.createConnection()`][] for more details. + * `timeout` {Integer}: A number specifying the socket timeout in milliseconds. + This will set the timeout before the socket is connected. +* `callback` {Function} +* Returns: {http.ClientRequest} + Node.js maintains several connections per server to make HTTP requests. This function allows one to transparently issue requests. `options` can be an object or a string. If `options` is a string, it is automatically parsed with [`url.parse()`][]. -Options: - -- `protocol`: Protocol to use. Defaults to `'http:'`. -- `host`: A domain name or IP address of the server to issue the request to. - Defaults to `'localhost'`. -- `hostname`: Alias for `host`. To support [`url.parse()`][] `hostname` is - preferred over `host`. -- `family`: IP address family to use when resolving `host` and `hostname`. - Valid values are `4` or `6`. When unspecified, both IP v4 and v6 will be - used. -- `port`: Port of remote server. Defaults to 80. -- `localAddress`: Local interface to bind for network connections. -- `socketPath`: Unix Domain Socket (use one of host:port or socketPath). -- `method`: A string specifying the HTTP request method. Defaults to `'GET'`. -- `path`: Request path. Defaults to `'/'`. Should include query string if any. - E.G. `'/index.html?page=12'`. An exception is thrown when the request path - contains illegal characters. Currently, only spaces are rejected but that - may change in the future. -- `headers`: An object containing request headers. -- `auth`: Basic authentication i.e. `'user:password'` to compute an - Authorization header. -- `agent`: Controls [`Agent`][] behavior. When an Agent is used request will - default to `Connection: keep-alive`. Possible values: - - `undefined` (default): use [`http.globalAgent`][] for this host and port. - - `Agent` object: explicitly use the passed in `Agent`. - - `false`: opts out of connection pooling with an Agent, defaults request to - `Connection: close`. -- `createConnection`: A function that produces a socket/stream to use for the - request when the `agent` option is not used. This can be used to avoid - creating a custom Agent class just to override the default `createConnection` - function. See [`agent.createConnection()`][] for more details. -- `timeout`: A number specifying the socket timeout in milliseconds. - This will set the timeout before the socket is connected. - The optional `callback` parameter will be added as a one time listener for the [`'response'`][] event. @@ -1505,10 +1622,10 @@ There are a few special headers that should be noted. [`'checkContinue'`]: #http_event_checkcontinue [`'listening'`]: net.html#net_event_listening +[`'request'`]: #http_event_request [`'response'`]: #http_event_response [`Agent`]: #http_class_http_agent [`agent.createConnection()`]: #http_agent_createconnection_options_callback -[`Buffer`]: buffer.html#buffer_buffer [`destroy()`]: #http_agent_destroy [`EventEmitter`]: events.html#events_class_eventemitter [`http.Agent`]: #http_class_http_agent @@ -1517,7 +1634,6 @@ There are a few special headers that should be noted. [`http.IncomingMessage`]: #http_class_http_incomingmessage [`http.request()`]: #http_http_request_options_callback [`http.Server`]: #http_class_http_server -[`http.ServerResponse`]: #http_class_http_serverresponse [`message.headers`]: #http_message_headers [`net.createConnection()`]: net.html#net_net_createconnection_options_connectlistener [`net.Server`]: net.html#net_class_net_server diff --git a/doc/api/https.md b/doc/api/https.md index bc0e4114c39761..3af6dedcd914e7 100644 --- a/doc/api/https.md +++ b/doc/api/https.md @@ -203,7 +203,7 @@ The following options from [`tls.connect()`][] can also be specified. However, a certificates in PEM format. If this is omitted several well known "root" CAs will be used, like VeriSign. These are used to authorize connections. - `ciphers`: A string describing the ciphers to use or exclude. Consult - for + for details on the format. - `rejectUnauthorized`: If `true`, the server certificate is verified against the list of supplied CAs. An `'error'` event is emitted if verification @@ -267,7 +267,7 @@ var req = https.request(options, (res) => { [`http.Server`]: http.html#http_class_http_server [`https.Agent`]: #https_class_https_agent [`https.request()`]: #https_https_request_options_callback -[`SSL_METHODS`]: https://www.openssl.org/docs/ssl/ssl.html#DEALING-WITH-PROTOCOL-METHODS +[`SSL_METHODS`]: https://www.openssl.org/docs/man1.0.2/ssl/ssl.html#DEALING-WITH-PROTOCOL-METHODS [`tls.connect()`]: tls.html#tls_tls_connect_options_callback [`tls.createServer()`]: tls.html#tls_tls_createserver_options_secureconnectionlistener [`url.parse()`]: url.html#url_url_parse_urlstring_parsequerystring_slashesdenotehost diff --git a/doc/api/modules.md b/doc/api/modules.md index 8de7071fe03082..66ac1ce22c2bca 100644 --- a/doc/api/modules.md +++ b/doc/api/modules.md @@ -4,9 +4,9 @@ -Node.js has a simple module loading system. In Node.js, files and modules are -in one-to-one correspondence. As an example, `foo.js` loads the module -`circle.js` in the same directory. +Node.js has a simple module loading system. In Node.js, files and modules +are in one-to-one correspondence (each file is treated as a separate module). +As an example, `foo.js` loads the module `circle.js` in the same directory. The contents of `foo.js`: diff --git a/doc/api/process.md b/doc/api/process.md index cda3bb95438086..89443daedab1cf 100644 --- a/doc/api/process.md +++ b/doc/api/process.md @@ -374,7 +374,7 @@ The `*-deprecation` command line flags only affect warnings that use the name Signal events will be emitted when the Node.js process receives a signal. Please -refer to sigaction(2) for a listing of standard POSIX signal names such as +refer to signal(7) for a listing of standard POSIX signal names such as `SIGINT`, `SIGHUP`, etc. The name of each event will be the uppercase common name for the signal (e.g. @@ -708,6 +708,16 @@ console.log(process.env.TEST); // => undefined ``` +On Windows operating systems, environment variables are case-insensitive. + +Example: + +```js +process.env.TEST = 1; +console.log(process.env.test); +// => 1 +``` + ## process.emitWarning(warning[, name][, ctor]) -The `process.setuid(id) method sets the user identity of the process. (See +The `process.setuid(id)` method sets the user identity of the process. (See setuid(2).) The `id` can be passed as either a numeric ID or a username string. If a username is specified, the method blocks while resolving the associated numeric ID. @@ -1720,3 +1728,5 @@ cases: [Readable]: stream.html [Child Process]: child_process.html [Cluster]: cluster.html +[`process.exitCode`]: #processexitcode-1 +[LTS]: https://github.com/nodejs/LTS/ diff --git a/doc/api/stream.md b/doc/api/stream.md index 61520c8cedc433..ee378c9f66425b 100644 --- a/doc/api/stream.md +++ b/doc/api/stream.md @@ -19,14 +19,14 @@ The `stream` module can be accessed using: const stream = require('stream'); ``` -While it is important for all Node.js users to understand how streams works, +While it is important for all Node.js users to understand how streams work, the `stream` module itself is most useful for developers that are creating new types of stream instances. Developer's who are primarily *consuming* stream objects will rarely (if ever) have need to use the `stream` module directly. -## Organization of this document +## Organization of this Document -This document is divided into two primary sections and third section for +This document is divided into two primary sections with a third section for additional notes. The first section explains the elements of the stream API that are required to *use* streams within an application. The second section explains the elements of the API that are required to *implement* new types of streams. @@ -48,7 +48,7 @@ There are four fundamental stream types within Node.js: All streams created by Node.js APIs operate exclusively on strings and `Buffer` objects. It is possible, however, for stream implementations to work with other -types of JavaScript values (with the exception of `null` which serves a special +types of JavaScript values (with the exception of `null`, which serves a special purpose within streams). Such streams are considered to operate in "object mode". @@ -87,7 +87,7 @@ total size of the internal write buffer is below the threshold set by the size of the internal buffer reaches or exceeds the `highWaterMark`, `false` will be returned. -A key goal of the `stream` API, and in particular the [`stream.pipe()`] method, +A key goal of the `stream` API, particularly the [`stream.pipe()`] method, is to limit the buffering of data to acceptable levels such that sources and destinations of differing speeds will not overwhelm the available memory. @@ -98,8 +98,8 @@ appropriate and efficient flow of data. For example, [`net.Socket`][] instances are [Duplex][] streams whose Readable side allows consumption of data received *from* the socket and whose Writable side allows writing data *to* the socket. Because data may be written to the socket at a faster or slower rate than data -is received, it is important each side operate (and buffer) independently of -the other. +is received, it is important for each side to operate (and buffer) independently +of the other. ## API for Stream Consumers @@ -1061,7 +1061,7 @@ Examples of Transform streams include: The `stream` module API has been designed to make it possible to easily -implement streams using JavaScript's prototypical inheritance model. +implement streams using JavaScript's prototypal inheritance model. First, a stream developer would declare a new JavaScript class that extends one of the four basic stream classes (`stream.Writable`, `stream.Readable`, diff --git a/doc/api/tls.md b/doc/api/tls.md index c7daa8f181820e..6180d91b667e67 100644 --- a/doc/api/tls.md +++ b/doc/api/tls.md @@ -535,7 +535,7 @@ that first defined the cipher. For example: `{ name: 'AES256-SHA', version: 'TLSv1/SSLv3' }` See `SSL_CIPHER_get_name()` and `SSL_CIPHER_get_version()` in -https://www.openssl.org/docs/manmaster/ssl/SSL_CIPHER_get_name.html for more +https://www.openssl.org/docs/man1.0.2/ssl/SSL_CIPHER_get_name.html for more information. ### tlsSocket.getEphemeralKeyInfo() @@ -611,7 +611,7 @@ Example responses include: * `TLSv1.2` * `unknown` -See https://www.openssl.org/docs/manmaster/ssl/SSL_get_version.html for more +See https://www.openssl.org/docs/man1.0.2/ssl/SSL_get_version.html for more information. ### tlsSocket.getSession() @@ -936,7 +936,7 @@ added: v0.11.13 CRLs (Certificate Revocation List). * `ciphers` {string} A string describing the ciphers to use or exclude. Consult - + for details on the format. * `honorCipherOrder` {boolean} If `true`, when a cipher is being selected, the server's preferences will be used instead of the client preferences. @@ -1252,7 +1252,7 @@ secure_socket = tls.TLSSocket(socket, options); where `secure_socket` has the same API as `pair.cleartext`. -[OpenSSL cipher list format documentation]: https://www.openssl.org/docs/apps/ciphers.html#CIPHER-LIST-FORMAT +[OpenSSL cipher list format documentation]: https://www.openssl.org/docs/man1.0.2/apps/ciphers.html#CIPHER-LIST-FORMAT [Chrome's 'modern cryptography' setting]: https://www.chromium.org/Home/chromium-security/education/tls#TOC-Cipher-Suites [specific attacks affecting larger AES key sizes]: https://www.schneier.com/blog/archives/2009/07/another_new_aes.html [`crypto.getCurves()`]: crypto.html#crypto_crypto_getcurves @@ -1266,9 +1266,9 @@ where `secure_socket` has the same API as `pair.cleartext`. [`'secureConnection'`]: #tls_event_secureconnection [Perfect Forward Secrecy]: #tls_perfect_forward_secrecy [Stream]: stream.html#stream_stream -[SSL_METHODS]: https://www.openssl.org/docs/ssl/ssl.html#DEALING-WITH-PROTOCOL-METHODS +[SSL_METHODS]: https://www.openssl.org/docs/man1.0.2/ssl/ssl.html#DEALING-WITH-PROTOCOL-METHODS [tls.Server]: #tls_class_tls_server -[SSL_CTX_set_timeout]: https://www.openssl.org/docs/ssl/SSL_CTX_set_timeout.html +[SSL_CTX_set_timeout]: https://www.openssl.org/docs/man1.0.2/ssl/SSL_CTX_set_timeout.html [Forward secrecy]: https://en.wikipedia.org/wiki/Perfect_forward_secrecy [DHE]: https://en.wikipedia.org/wiki/Diffie%E2%80%93Hellman_key_exchange [ECDHE]: https://en.wikipedia.org/wiki/Elliptic_curve_Diffie%E2%80%93Hellman diff --git a/doc/api/util.md b/doc/api/util.md index 3ffefa3f87fe31..57ed7269f68b87 100644 --- a/doc/api/util.md +++ b/doc/api/util.md @@ -286,13 +286,31 @@ invoke and use the result of when inspecting the object: ```js const util = require('util'); -const obj = { name: 'nate' }; -obj[util.inspect.custom] = function(depth) { - return `{${this.name}}`; -}; +class Box { + constructor(value) { + this.value = value; + } -util.inspect(obj); - // "{nate}" + inspect(depth, options) { + if (depth < 0) { + return options.stylize('[Box]', 'special'); + } + + const newOptions = Object.assign({}, options, { + depth: options.depth === null ? null : options.depth - 1 + }); + + // Five space padding because that's the size of "Box< ". + const padding = ' '.repeat(5); + const inner = util.inspect(this.value, newOptions).replace(/\n/g, '\n' + padding); + return options.stylize('Box', 'special') + '< ' + inner + ' >'; + } +} + +const box = new Box(true); + +util.inspect(box); + // "Box< true >" ``` Custom `[util.inspect.custom](depth, opts)` functions typically return a string diff --git a/doc/api/vm.md b/doc/api/vm.md index be3a490336b62b..a62923c2a1a317 100644 --- a/doc/api/vm.md +++ b/doc/api/vm.md @@ -297,7 +297,7 @@ console.log(Debug.findScript(process.exit).name); // 'internal/process.js' implementation and may change (or even be removed) without prior warning. The `Debug` object can also be made available using the V8-specific -`--expose_debug_as=` [command line option][cli.md]. +`--expose_debug_as=` [command line option][]. ## vm.runInNewContext(code[, sandbox][, options]) `foo${bar /* comment */ }${baz}` + return getTemplateLiteral(currentNode.left, textBeforeNode, textBeforePlus + textAfterPlus).slice(0, -1) + + getTemplateLiteral(currentNode.right, null, textAfterNode).slice(1); + } + if (rightStartsWithCurly) { + + // Otherwise, if the right side of the expression starts with a template curly, add the text there. + // 'foo' /* comment */ + `${bar}baz` --> `foo${ /* comment */ bar}baz` + return getTemplateLiteral(currentNode.left, textBeforeNode, null).slice(0, -1) + + getTemplateLiteral(currentNode.right, textBeforePlus + textAfterPlus, textAfterNode).slice(1); + } + + // Otherwise, these nodes should not be combined into a template curly, since there is nowhere to put + // the text between them. + return `${getTemplateLiteral(currentNode.left, textBeforeNode, null)}${textBeforePlus}+${textAfterPlus}${getTemplateLiteral(currentNode.right, textAfterNode, null)}`; + } + + return `\`\${${textBeforeNode || ""}${sourceCode.getText(currentNode)}${textAfterNode || ""}}\``; + } + /** * Reports if a given node is string concatenation with non string literals. * @@ -88,9 +206,13 @@ module.exports = { done[topBinaryExpr.range[0]] = true; if (hasNonStringLiteral(topBinaryExpr)) { - context.report( - topBinaryExpr, - "Unexpected string concatenation."); + context.report({ + node: topBinaryExpr, + message: "Unexpected string concatenation.", + fix(fixer) { + return fixer.replaceText(topBinaryExpr, getTemplateLiteral(topBinaryExpr, null, null)); + } + }); } } diff --git a/tools/eslint/lib/rules/quote-props.js b/tools/eslint/lib/rules/quote-props.js index 88a634278edc49..2129ce6aa99b87 100644 --- a/tools/eslint/lib/rules/quote-props.js +++ b/tools/eslint/lib/rules/quote-props.js @@ -61,7 +61,9 @@ module.exports = { maxItems: 2 } ] - } + }, + + fixable: "code" }, create(context) { @@ -74,7 +76,8 @@ module.exports = { MESSAGE_UNNECESSARY = "Unnecessarily quoted property '{{property}}' found.", MESSAGE_UNQUOTED = "Unquoted property '{{property}}' found.", MESSAGE_NUMERIC = "Unquoted number literal '{{property}}' used as key.", - MESSAGE_RESERVED = "Unquoted reserved word '{{property}}' used as key."; + MESSAGE_RESERVED = "Unquoted reserved word '{{property}}' used as key.", + sourceCode = context.getSourceCode(); /** @@ -100,6 +103,31 @@ module.exports = { (tokens[0].type === "Numeric" && !skipNumberLiterals && String(+tokens[0].value) === tokens[0].value)); } + /** + * Returns a string representation of a property node with quotes removed + * @param {ASTNode} key Key AST Node, which may or may not be quoted + * @returns {string} A replacement string for this property + */ + function getUnquotedKey(key) { + return key.type === "Identifier" ? key.name : key.value; + } + + /** + * Returns a string representation of a property node with quotes added + * @param {ASTNode} key Key AST Node, which may or may not be quoted + * @returns {string} A replacement string for this property + */ + function getQuotedKey(key) { + if (key.type === "Literal" && typeof key.value === "string") { + + // If the key is already a string literal, don't replace the quotes with double quotes. + return sourceCode.getText(key); + } + + // Otherwise, the key is either an identifier or a number literal. + return `"${key.type === "Identifier" ? key.name : key.value}"`; + } + /** * Ensures that a property's key is quoted only when necessary * @param {ASTNode} node Property AST node @@ -131,12 +159,27 @@ module.exports = { } if (CHECK_UNNECESSARY && areQuotesRedundant(key.value, tokens, NUMBERS)) { - context.report(node, MESSAGE_UNNECESSARY, {property: key.value}); + context.report({ + node, + message: MESSAGE_UNNECESSARY, + data: {property: key.value}, + fix: fixer => fixer.replaceText(key, getUnquotedKey(key)) + }); } } else if (KEYWORDS && key.type === "Identifier" && isKeyword(key.name)) { - context.report(node, MESSAGE_RESERVED, {property: key.name}); + context.report({ + node, + message: MESSAGE_RESERVED, + data: {property: key.name}, + fix: fixer => fixer.replaceText(key, getQuotedKey(key)) + }); } else if (NUMBERS && key.type === "Literal" && typeof key.value === "number") { - context.report(node, MESSAGE_NUMERIC, {property: key.value}); + context.report({ + node, + message: MESSAGE_NUMERIC, + data: {property: key.value}, + fix: fixer => fixer.replaceText(key, getQuotedKey(key)) + }); } } @@ -149,8 +192,11 @@ module.exports = { const key = node.key; if (!node.method && !node.computed && !node.shorthand && !(key.type === "Literal" && typeof key.value === "string")) { - context.report(node, MESSAGE_UNQUOTED, { - property: key.name || key.value + context.report({ + node, + message: MESSAGE_UNQUOTED, + data: {property: key.name || key.value}, + fix: fixer => fixer.replaceText(key, getQuotedKey(key)) }); } } @@ -162,8 +208,9 @@ module.exports = { * @returns {void} */ function checkConsistency(node, checkQuotesRedundancy) { - let quotes = false, - lackOfQuotes = false, + const quotedProps = [], + unquotedProps = []; + let keywordKeyName = null, necessaryQuotes = false; node.properties.forEach(function(property) { @@ -176,7 +223,7 @@ module.exports = { if (key.type === "Literal" && typeof key.value === "string") { - quotes = true; + quotedProps.push(property); if (checkQuotesRedundancy) { try { @@ -189,21 +236,40 @@ module.exports = { necessaryQuotes = necessaryQuotes || !areQuotesRedundant(key.value, tokens) || KEYWORDS && isKeyword(tokens[0].value); } } else if (KEYWORDS && checkQuotesRedundancy && key.type === "Identifier" && isKeyword(key.name)) { + unquotedProps.push(property); necessaryQuotes = true; - context.report(node, "Properties should be quoted as '{{property}}' is a reserved word.", {property: key.name}); + keywordKeyName = key.name; } else { - lackOfQuotes = true; - } - - if (quotes && lackOfQuotes) { - context.report(node, "Inconsistently quoted property '{{key}}' found.", { - key: key.name || key.value - }); + unquotedProps.push(property); } }); - if (checkQuotesRedundancy && quotes && !necessaryQuotes) { - context.report(node, "Properties shouldn't be quoted as all quotes are redundant."); + if (checkQuotesRedundancy && quotedProps.length && !necessaryQuotes) { + quotedProps.forEach(property => { + context.report({ + node: property, + message: "Properties shouldn't be quoted as all quotes are redundant.", + fix: fixer => fixer.replaceText(property.key, getUnquotedKey(property.key)) + }); + }); + } else if (unquotedProps.length && keywordKeyName) { + unquotedProps.forEach(property => { + context.report({ + node: property, + message: "Properties should be quoted as '{{property}}' is a reserved word.", + data: {property: keywordKeyName}, + fix: fixer => fixer.replaceText(property.key, getQuotedKey(property.key)) + }); + }); + } else if (quotedProps.length && unquotedProps.length) { + unquotedProps.forEach(property => { + context.report({ + node: property, + message: "Inconsistently quoted property '{{key}}' found.", + data: {key: property.key.name || property.key.value}, + fix: fixer => fixer.replaceText(property.key, getQuotedKey(property.key)) + }); + }); } } diff --git a/tools/eslint/lib/rules/quotes.js b/tools/eslint/lib/rules/quotes.js index 29ef600c423142..90e68289e05662 100644 --- a/tools/eslint/lib/rules/quotes.js +++ b/tools/eslint/lib/rules/quotes.js @@ -123,12 +123,26 @@ module.exports = { /** * Determines if a given node is part of JSX syntax. - * @param {ASTNode} node The node to check. - * @returns {boolean} True if the node is a JSX node, false if not. + * + * This function returns `true` in the following cases: + * + * - `
` ... If the literal is an attribute value, the parent of the literal is `JSXAttribute`. + * - `
foo
` ... If the literal is a text content, the parent of the literal is `JSXElement`. + * + * In particular, this function returns `false` in the following cases: + * + * - `
` + * - `
{"foo"}
` + * + * In both cases, inside of the braces is handled as normal JavaScript. + * The braces are `JSXExpressionContainer` nodes. + * + * @param {ASTNode} node The Literal node to check. + * @returns {boolean} True if the node is a part of JSX, false if not. * @private */ - function isJSXElement(node) { - return node.type.indexOf("JSX") === 0; + function isJSXLiteral(node) { + return node.parent.type === "JSXAttribute" || node.parent.type === "JSXElement"; } /** @@ -215,7 +229,7 @@ module.exports = { if (settings && typeof val === "string") { isValid = (quoteOption === "backtick" && isAllowedAsNonBacktick(node)) || - isJSXElement(node.parent) || + isJSXLiteral(node) || astUtils.isSurroundedBy(rawVal, settings.quote); if (!isValid && avoidEscape) { diff --git a/tools/eslint/lib/rules/semi.js b/tools/eslint/lib/rules/semi.js index 7fc80ab8dabfd6..2f28f1614d1a42 100644 --- a/tools/eslint/lib/rules/semi.js +++ b/tools/eslint/lib/rules/semi.js @@ -53,7 +53,7 @@ module.exports = { create(context) { - const OPT_OUT_PATTERN = /[\[\(\/\+\-]/; // One of [(/+- + const OPT_OUT_PATTERN = /^[-[(\/+]$/; // One of [(/+-, but not ++ or -- const options = context.options[1]; const never = context.options[0] === "never", exceptOneLine = options && options.omitLastInOneLineBlock === true, diff --git a/tools/eslint/lib/rules/sort-keys.js b/tools/eslint/lib/rules/sort-keys.js index b3aeb81d8e0ee0..e42375d6bcc59f 100644 --- a/tools/eslint/lib/rules/sort-keys.js +++ b/tools/eslint/lib/rules/sort-keys.js @@ -1,5 +1,5 @@ /** - * @fileoverview Rule to requires object keys to be sorted + * @fileoverview Rule to require object keys to be sorted * @author Toru Nagashima */ @@ -74,7 +74,7 @@ const isValidOrders = { module.exports = { meta: { docs: { - description: "requires object keys to be sorted", + description: "require object keys to be sorted", category: "Stylistic Issues", recommended: false }, diff --git a/tools/eslint/lib/rules/space-before-function-paren.js b/tools/eslint/lib/rules/space-before-function-paren.js index 04c169a78624cc..c62413a37cd829 100644 --- a/tools/eslint/lib/rules/space-before-function-paren.js +++ b/tools/eslint/lib/rules/space-before-function-paren.js @@ -32,6 +32,9 @@ module.exports = { }, named: { enum: ["always", "never", "ignore"] + }, + asyncArrow: { + enum: ["always", "never", "ignore"] } }, additionalProperties: false @@ -48,7 +51,9 @@ module.exports = { let requireAnonymousFunctionSpacing = true, forbidAnonymousFunctionSpacing = false, requireNamedFunctionSpacing = true, - forbidNamedFunctionSpacing = false; + forbidNamedFunctionSpacing = false, + requireArrowFunctionSpacing = false, + forbidArrowFunctionSpacing = false; if (typeof configuration === "object") { requireAnonymousFunctionSpacing = ( @@ -57,6 +62,8 @@ module.exports = { requireNamedFunctionSpacing = ( !configuration.named || configuration.named === "always"); forbidNamedFunctionSpacing = configuration.named === "never"; + requireArrowFunctionSpacing = configuration.asyncArrow === "always"; + forbidArrowFunctionSpacing = configuration.asyncArrow === "never"; } else if (configuration === "never") { requireAnonymousFunctionSpacing = false; forbidAnonymousFunctionSpacing = true; @@ -92,13 +99,31 @@ module.exports = { * @returns {void} */ function validateSpacingBeforeParentheses(node) { - const isNamed = isNamedFunction(node); - let rightToken; + const isArrow = node.type === "ArrowFunctionExpression"; + const isNamed = !isArrow && isNamedFunction(node); + const isAnonymousGenerator = node.generator && !isNamed; + const isNormalArrow = isArrow && !node.async; + const isArrowWithoutParens = isArrow && sourceCode.getFirstToken(node, 1).value !== "("; + let forbidSpacing, requireSpacing, rightToken; - if (node.generator && !isNamed) { + // isAnonymousGenerator → `generator-star-spacing` should warn it. E.g. `function* () {}` + // isNormalArrow → ignore always. + // isArrowWithoutParens → ignore always. E.g. `async a => a` + if (isAnonymousGenerator || isNormalArrow || isArrowWithoutParens) { return; } + if (isArrow) { + forbidSpacing = forbidArrowFunctionSpacing; + requireSpacing = requireArrowFunctionSpacing; + } else if (isNamed) { + forbidSpacing = forbidNamedFunctionSpacing; + requireSpacing = requireNamedFunctionSpacing; + } else { + forbidSpacing = forbidAnonymousFunctionSpacing; + requireSpacing = requireAnonymousFunctionSpacing; + } + rightToken = sourceCode.getFirstToken(node); while (rightToken.value !== "(") { rightToken = sourceCode.getTokenAfter(rightToken); @@ -107,7 +132,7 @@ module.exports = { const location = leftToken.loc.end; if (sourceCode.isSpaceBetweenTokens(leftToken, rightToken)) { - if ((isNamed && forbidNamedFunctionSpacing) || (!isNamed && forbidAnonymousFunctionSpacing)) { + if (forbidSpacing) { context.report({ node, loc: location, @@ -118,7 +143,7 @@ module.exports = { }); } } else { - if ((isNamed && requireNamedFunctionSpacing) || (!isNamed && requireAnonymousFunctionSpacing)) { + if (requireSpacing) { context.report({ node, loc: location, @@ -133,7 +158,8 @@ module.exports = { return { FunctionDeclaration: validateSpacingBeforeParentheses, - FunctionExpression: validateSpacingBeforeParentheses + FunctionExpression: validateSpacingBeforeParentheses, + ArrowFunctionExpression: validateSpacingBeforeParentheses, }; } }; diff --git a/tools/eslint/lib/rules/space-infix-ops.js b/tools/eslint/lib/rules/space-infix-ops.js index c99c32880682ef..9831e8e2af6085 100644 --- a/tools/eslint/lib/rules/space-infix-ops.js +++ b/tools/eslint/lib/rules/space-infix-ops.js @@ -11,7 +11,7 @@ module.exports = { meta: { docs: { - description: "require spacing around operators", + description: "require spacing around infix operators", category: "Stylistic Issues", recommended: false }, diff --git a/tools/eslint/lib/rules/space-unary-ops.js b/tools/eslint/lib/rules/space-unary-ops.js index da79c5c7563470..11c59c8274f358 100644 --- a/tools/eslint/lib/rules/space-unary-ops.js +++ b/tools/eslint/lib/rules/space-unary-ops.js @@ -176,6 +176,17 @@ module.exports = { checkUnaryWordOperatorForSpaces(node, tokens[0], tokens[1], word); } + /** + * Verifies AwaitExpressions satisfy spacing requirements + * @param {ASTNode} node AwaitExpression AST node + * @returns {void} + */ + function checkForSpacesAfterAwait(node) { + const tokens = sourceCode.getFirstTokens(node, 3); + + checkUnaryWordOperatorForSpaces(node, tokens[0], tokens[1], "await"); + } + /** * Verifies UnaryExpression, UpdateExpression and NewExpression have spaces before or after the operator * @param {ASTnode} node AST node @@ -291,7 +302,8 @@ module.exports = { UnaryExpression: checkForSpaces, UpdateExpression: checkForSpaces, NewExpression: checkForSpaces, - YieldExpression: checkForSpacesAfterYield + YieldExpression: checkForSpacesAfterYield, + AwaitExpression: checkForSpacesAfterAwait }; } diff --git a/tools/eslint/lib/rules/strict.js b/tools/eslint/lib/rules/strict.js index 6581ac1bfd07d9..1591bd871465d4 100644 --- a/tools/eslint/lib/rules/strict.js +++ b/tools/eslint/lib/rules/strict.js @@ -88,7 +88,9 @@ module.exports = { { enum: ["never", "global", "function", "safe"] } - ] + ], + + fixable: "code" }, create(context) { @@ -104,40 +106,59 @@ module.exports = { mode = ecmaFeatures.globalReturn ? "global" : "function"; } + /** + * Determines whether a reported error should be fixed, depending on the error type. + * @param {string} errorType The type of error + * @returns {boolean} `true` if the reported error should be fixed + */ + function shouldFix(errorType) { + return errorType === "multiple" || errorType === "unnecessary" || errorType === "module" || errorType === "implied" || errorType === "unnecessaryInClasses"; + } + + /** + * Gets a fixer function to remove a given 'use strict' directive. + * @param {ASTNode} node The directive that should be removed + * @returns {Function} A fixer function + */ + function getFixFunction(node) { + return fixer => fixer.remove(node); + } + /** * Report a slice of an array of nodes with a given message. * @param {ASTNode[]} nodes Nodes. * @param {string} start Index to start from. * @param {string} end Index to end before. * @param {string} message Message to display. + * @param {boolean} fix `true` if the directive should be fixed (i.e. removed) * @returns {void} */ - function reportSlice(nodes, start, end, message) { - let i; - - for (i = start; i < end; i++) { - context.report(nodes[i], message); - } + function reportSlice(nodes, start, end, message, fix) { + nodes.slice(start, end).forEach(node => { + context.report({node, message, fix: fix ? getFixFunction(node) : null}); + }); } /** * Report all nodes in an array with a given message. * @param {ASTNode[]} nodes Nodes. * @param {string} message Message to display. + * @param {boolean} fix `true` if the directive should be fixed (i.e. removed) * @returns {void} */ - function reportAll(nodes, message) { - reportSlice(nodes, 0, nodes.length, message); + function reportAll(nodes, message, fix) { + reportSlice(nodes, 0, nodes.length, message, fix); } /** * Report all nodes in an array, except the first, with a given message. * @param {ASTNode[]} nodes Nodes. * @param {string} message Message to display. + * @param {boolean} fix `true` if the directive should be fixed (i.e. removed) * @returns {void} */ - function reportAllExceptFirst(nodes, message) { - reportSlice(nodes, 1, nodes.length, message); + function reportAllExceptFirst(nodes, message, fix) { + reportSlice(nodes, 1, nodes.length, message, fix); } /** @@ -157,12 +178,12 @@ module.exports = { if (!isSimpleParameterList(node.params)) { context.report(useStrictDirectives[0], messages.nonSimpleParameterList); } else if (isParentStrict) { - context.report(useStrictDirectives[0], messages.unnecessary); + context.report({node: useStrictDirectives[0], message: messages.unnecessary, fix: getFixFunction(useStrictDirectives[0])}); } else if (isInClass) { - context.report(useStrictDirectives[0], messages.unnecessaryInClasses); + context.report({node: useStrictDirectives[0], message: messages.unnecessaryInClasses, fix: getFixFunction(useStrictDirectives[0])}); } - reportAllExceptFirst(useStrictDirectives, messages.multiple); + reportAllExceptFirst(useStrictDirectives, messages.multiple, true); } else if (isParentGlobal) { if (isSimpleParameterList(node.params)) { context.report(node, messages.function); @@ -198,10 +219,10 @@ module.exports = { enterFunctionInFunctionMode(node, useStrictDirectives); } else if (useStrictDirectives.length > 0) { if (isSimpleParameterList(node.params)) { - reportAll(useStrictDirectives, messages[mode]); + reportAll(useStrictDirectives, messages[mode], shouldFix(mode)); } else { context.report(useStrictDirectives[0], messages.nonSimpleParameterList); - reportAllExceptFirst(useStrictDirectives, messages.multiple); + reportAllExceptFirst(useStrictDirectives, messages.multiple, true); } } } @@ -218,9 +239,9 @@ module.exports = { if (node.body.length > 0 && useStrictDirectives.length === 0) { context.report(node, messages.global); } - reportAllExceptFirst(useStrictDirectives, messages.multiple); + reportAllExceptFirst(useStrictDirectives, messages.multiple, true); } else { - reportAll(useStrictDirectives, messages[mode]); + reportAll(useStrictDirectives, messages[mode], shouldFix(mode)); } }, FunctionDeclaration: enterFunction, diff --git a/tools/eslint/lib/rules/valid-jsdoc.js b/tools/eslint/lib/rules/valid-jsdoc.js index d6ebd24a4ac887..09fc684719a4af 100644 --- a/tools/eslint/lib/rules/valid-jsdoc.js +++ b/tools/eslint/lib/rules/valid-jsdoc.js @@ -165,7 +165,7 @@ module.exports = { } /** - * Check if return tag type is void or undefined + * Validate type for a given JSDoc node * @param {Object} jsdocNode JSDoc node * @param {Object} type JSDoc tag * @returns {void} @@ -192,7 +192,9 @@ module.exports = { elements = type.elements; break; case "FieldType": // Array.<{count: number, votes: number}> - typesToCheck.push(getCurrentExpectedTypes(type.value)); + if (type.value) { + typesToCheck.push(getCurrentExpectedTypes(type.value)); + } break; default: typesToCheck.push(getCurrentExpectedTypes(type)); diff --git a/tools/eslint/lib/rules/valid-typeof.js b/tools/eslint/lib/rules/valid-typeof.js index b13e2aefdd08c1..ed0a7c017955f2 100644 --- a/tools/eslint/lib/rules/valid-typeof.js +++ b/tools/eslint/lib/rules/valid-typeof.js @@ -34,6 +34,17 @@ module.exports = { const VALID_TYPES = ["symbol", "undefined", "object", "boolean", "number", "string", "function"], OPERATORS = ["==", "===", "!=", "!=="]; + const requireStringLiterals = context.options[0] && context.options[0].requireStringLiterals; + + /** + * Determines whether a node is a typeof expression. + * @param {ASTNode} node The node + * @returns {boolean} `true` if the node is a typeof expression + */ + function isTypeofExpression(node) { + return node.type === "UnaryExpression" && node.operator === "typeof"; + } + //-------------------------------------------------------------------------- // Public //-------------------------------------------------------------------------- @@ -41,17 +52,19 @@ module.exports = { return { UnaryExpression(node) { - if (node.operator === "typeof") { + if (isTypeofExpression(node)) { const parent = context.getAncestors().pop(); if (parent.type === "BinaryExpression" && OPERATORS.indexOf(parent.operator) !== -1) { const sibling = parent.left === node ? parent.right : parent.left; - if (sibling.type === "Literal") { - if (VALID_TYPES.indexOf(sibling.value) === -1) { + if (sibling.type === "Literal" || sibling.type === "TemplateLiteral" && !sibling.expressions.length) { + const value = sibling.type === "Literal" ? sibling.value : sibling.quasis[0].value.cooked; + + if (VALID_TYPES.indexOf(value) === -1) { context.report(sibling, "Invalid typeof comparison value."); } - } else if (context.options[0] && context.options[0].requireStringLiterals) { + } else if (requireStringLiterals && !isTypeofExpression(sibling)) { context.report(sibling, "Typeof comparisons should be to string literals."); } } diff --git a/tools/eslint/lib/rules/wrap-iife.js b/tools/eslint/lib/rules/wrap-iife.js index c648af82d2e208..bbbc79ab1fff25 100644 --- a/tools/eslint/lib/rules/wrap-iife.js +++ b/tools/eslint/lib/rules/wrap-iife.js @@ -5,6 +5,8 @@ "use strict"; +const astUtils = require("../ast-utils"); + //------------------------------------------------------------------------------ // Rule Definition //------------------------------------------------------------------------------ @@ -20,13 +22,25 @@ module.exports = { schema: [ { enum: ["outside", "inside", "any"] + }, + { + type: "object", + properties: { + functionPrototypeMethods: { + type: "boolean" + } + }, + additionalProperties: false } - ] + ], + + fixable: "code" }, create(context) { const style = context.options[0] || "outside"; + const includeFunctionPrototypeMethods = (context.options[1] && context.options[1].functionPrototypeMethods) || false; const sourceCode = context.getSourceCode(); @@ -44,20 +58,91 @@ module.exports = { nextToken && nextToken.value === ")"; } - return { + /** + * Get the function node from an IIFE + * @param {ASTNode} node node to evaluate + * @returns {ASTNode} node that is the function expression of the given IIFE, or null if none exist + */ + function getFunctionNodeFromIIFE(node) { + const callee = node.callee; + + if (callee.type === "FunctionExpression") { + return callee; + } + + if (includeFunctionPrototypeMethods && + callee.type === "MemberExpression" && + callee.object.type === "FunctionExpression" && + (astUtils.getStaticPropertyName(callee) === "call" || astUtils.getStaticPropertyName(callee) === "apply") + ) { + return callee.object; + } + + return null; + } + + return { CallExpression(node) { - if (node.callee.type === "FunctionExpression") { - const callExpressionWrapped = wrapped(node), - functionExpressionWrapped = wrapped(node.callee); - - if (!callExpressionWrapped && !functionExpressionWrapped) { - context.report(node, "Wrap an immediate function invocation in parentheses."); - } else if (style === "inside" && !functionExpressionWrapped) { - context.report(node, "Wrap only the function expression in parens."); - } else if (style === "outside" && !callExpressionWrapped) { - context.report(node, "Move the invocation into the parens that contain the function."); - } + const innerNode = getFunctionNodeFromIIFE(node); + + if (!innerNode) { + return; + } + + const callExpressionWrapped = wrapped(node), + functionExpressionWrapped = wrapped(innerNode); + + if (!callExpressionWrapped && !functionExpressionWrapped) { + context.report({ + node, + message: "Wrap an immediate function invocation in parentheses.", + fix(fixer) { + const nodeToSurround = style === "inside" ? innerNode : node; + + return fixer.replaceText(nodeToSurround, `(${sourceCode.getText(nodeToSurround)})`); + } + }); + } else if (style === "inside" && !functionExpressionWrapped) { + context.report({ + node, + message: "Wrap only the function expression in parens.", + fix(fixer) { + + /* + * The outer call expression will always be wrapped at this point. + * Replace the range between the end of the function expression and the end of the call expression. + * for example, in `(function(foo) {}(bar))`, the range `(bar))` should get replaced with `)(bar)`. + * Replace the parens from the outer expression, and parenthesize the function expression. + */ + const parenAfter = sourceCode.getTokenAfter(node); + + return fixer.replaceTextRange( + [innerNode.range[1], parenAfter.range[1]], + `)${sourceCode.getText().slice(innerNode.range[1], parenAfter.range[0])}` + ); + } + }); + } else if (style === "outside" && !callExpressionWrapped) { + context.report({ + node, + message: "Move the invocation into the parens that contain the function.", + fix(fixer) { + + /* + * The inner function expression will always be wrapped at this point. + * It's only necessary to replace the range between the end of the function expression + * and the call expression. For example, in `(function(foo) {})(bar)`, the range `)(bar)` + * should get replaced with `(bar))`. + */ + const parenAfter = sourceCode.getTokenAfter(innerNode); + + return fixer.replaceTextRange( + [parenAfter.range[0], node.range[1]], + `${sourceCode.getText().slice(parenAfter.range[1], node.range[1])})` + ); + } + }); } } }; diff --git a/tools/eslint/lib/rules/yoda.js b/tools/eslint/lib/rules/yoda.js index ab68db4e8a4dd5..e463a476ab6be4 100644 --- a/tools/eslint/lib/rules/yoda.js +++ b/tools/eslint/lib/rules/yoda.js @@ -141,7 +141,9 @@ module.exports = { }, additionalProperties: false } - ] + ], + + fixable: "code" }, create(context) { @@ -219,46 +221,57 @@ module.exports = { isParenWrapped()); } + const OPERATOR_FLIP_MAP = { + "===": "===", + "!==": "!==", + "==": "==", + "!=": "!=", + "<": ">", + ">": "<", + "<=": ">=", + ">=": "<=" + }; + + /** + * Returns a string representation of a BinaryExpression node with its sides/operator flipped around. + * @param {ASTNode} node The BinaryExpression node + * @returns {string} A string representation of the node with the sides and operator flipped + */ + function getFlippedString(node) { + const operatorToken = sourceCode.getTokensBetween(node.left, node.right).find(token => token.value === node.operator); + const textBeforeOperator = sourceCode.getText().slice(sourceCode.getTokenBefore(operatorToken).range[1], operatorToken.range[0]); + const textAfterOperator = sourceCode.getText().slice(operatorToken.range[1], sourceCode.getTokenAfter(operatorToken).range[0]); + const leftText = sourceCode.getText().slice(sourceCode.getFirstToken(node).range[0], sourceCode.getTokenBefore(operatorToken).range[1]); + const rightText = sourceCode.getText().slice(sourceCode.getTokenAfter(operatorToken).range[0], sourceCode.getLastToken(node).range[1]); + + return rightText + textBeforeOperator + OPERATOR_FLIP_MAP[operatorToken.value] + textAfterOperator + leftText; + } + //-------------------------------------------------------------------------- // Public //-------------------------------------------------------------------------- return { - BinaryExpression: always ? function(node) { - - // Comparisons must always be yoda-style: if ("blue" === color) - if ( - (node.right.type === "Literal" || looksLikeLiteral(node.right)) && - !(node.left.type === "Literal" || looksLikeLiteral(node.left)) && - !(!isEqualityOperator(node.operator) && onlyEquality) && - isComparisonOperator(node.operator) && - !(exceptRange && isRangeTest(context.getAncestors().pop())) - ) { - context.report({ - node, - message: "Expected literal to be on the left side of {{operator}}.", - data: { - operator: node.operator - } - }); - } - - } : function(node) { + BinaryExpression(node) { + const expectedLiteral = always ? node.left : node.right; + const expectedNonLiteral = always ? node.right : node.left; - // Comparisons must never be yoda-style (default) + // If `expectedLiteral` is not a literal, and `expectedNonLiteral` is a literal, raise an error. if ( - (node.left.type === "Literal" || looksLikeLiteral(node.left)) && - !(node.right.type === "Literal" || looksLikeLiteral(node.right)) && + (expectedNonLiteral.type === "Literal" || looksLikeLiteral(expectedNonLiteral)) && + !(expectedLiteral.type === "Literal" || looksLikeLiteral(expectedLiteral)) && !(!isEqualityOperator(node.operator) && onlyEquality) && isComparisonOperator(node.operator) && !(exceptRange && isRangeTest(context.getAncestors().pop())) ) { context.report({ node, - message: "Expected literal to be on the right side of {{operator}}.", + message: "Expected literal to be on the {{expectedSide}} side of {{operator}}.", data: { - operator: node.operator - } + operator: node.operator, + expectedSide: always ? "left" : "right" + }, + fix: fixer => fixer.replaceText(node, getFlippedString(node)) }); } diff --git a/tools/eslint/lib/testers/rule-tester.js b/tools/eslint/lib/testers/rule-tester.js index 04e64cf662248e..25b86993593c4a 100644 --- a/tools/eslint/lib/testers/rule-tester.js +++ b/tools/eslint/lib/testers/rule-tester.js @@ -182,13 +182,53 @@ RuleTester.resetDefaultConfig = function() { }; // default separators for testing -RuleTester.describe = (typeof describe === "function") ? describe : /* istanbul ignore next */ function(text, method) { - return method.apply(this); -}; +const DESCRIBE = Symbol("describe"); +const IT = Symbol("it"); + +RuleTester[DESCRIBE] = RuleTester[IT] = null; -RuleTester.it = (typeof it === "function") ? it : /* istanbul ignore next */ function(text, method) { +/** + * This is `it` or `describe` if those don't exist. + * @this {Mocha} + * @param {string} text - The description of the test case. + * @param {Function} method - The logic of the test case. + * @returns {any} Returned value of `method`. + */ +function defaultHandler(text, method) { return method.apply(this); -}; +} + +// If people use `mocha test.js --watch` command, `describe` and `it` function +// instances are different for each execution. So this should get fresh instance +// always. +Object.defineProperties(RuleTester, { + describe: { + get() { + return ( + RuleTester[DESCRIBE] || + (typeof describe === "function" ? describe : defaultHandler) + ); + }, + set(value) { + RuleTester[DESCRIBE] = value; + }, + configurable: true, + enumerable: true, + }, + it: { + get() { + return ( + RuleTester[IT] || + (typeof it === "function" ? it : defaultHandler) + ); + }, + set(value) { + RuleTester[IT] = value; + }, + configurable: true, + enumerable: true, + }, +}); RuleTester.prototype = { @@ -266,9 +306,9 @@ RuleTester.prototype = { if (validateSchema.errors) { throw new Error([ - "Schema for rule " + ruleName + " is invalid:" + `Schema for rule ${ruleName} is invalid:` ].concat(validateSchema.errors.map(function(error) { - return "\t" + error.field + ": " + error.message; + return `\t${error.field}: ${error.message}`; })).join("\n")); } } @@ -373,7 +413,7 @@ RuleTester.prototype = { */ function testInvalidTemplate(ruleName, item) { assert.ok(item.errors || item.errors === 0, - "Did not specify errors for an invalid test of " + ruleName); + `Did not specify errors for an invalid test of ${ruleName}`); const result = runRuleForItem(ruleName, item); const messages = result.messages; @@ -389,7 +429,7 @@ RuleTester.prototype = { item.errors.length, item.errors.length === 1 ? "" : "s", messages.length, util.inspect(messages))); for (let i = 0, l = item.errors.length; i < l; i++) { - assert.ok(!("fatal" in messages[i]), "A fatal parsing error occurred: " + messages[i].message); + assert.ok(!("fatal" in messages[i]), `A fatal parsing error occurred: ${messages[i].message}`); assert.equal(messages[i].ruleId, ruleName, "Error rule name should be the same as the name of the rule being tested"); if (typeof item.errors[i] === "string") { @@ -408,23 +448,23 @@ RuleTester.prototype = { } if (item.errors[i].type) { - assert.equal(messages[i].nodeType, item.errors[i].type, "Error type should be " + item.errors[i].type); + assert.equal(messages[i].nodeType, item.errors[i].type, `Error type should be ${item.errors[i].type}`); } if (item.errors[i].hasOwnProperty("line")) { - assert.equal(messages[i].line, item.errors[i].line, "Error line should be " + item.errors[i].line); + assert.equal(messages[i].line, item.errors[i].line, `Error line should be ${item.errors[i].line}`); } if (item.errors[i].hasOwnProperty("column")) { - assert.equal(messages[i].column, item.errors[i].column, "Error column should be " + item.errors[i].column); + assert.equal(messages[i].column, item.errors[i].column, `Error column should be ${item.errors[i].column}`); } if (item.errors[i].hasOwnProperty("endLine")) { - assert.equal(messages[i].endLine, item.errors[i].endLine, "Error endLine should be " + item.errors[i].endLine); + assert.equal(messages[i].endLine, item.errors[i].endLine, `Error endLine should be ${item.errors[i].endLine}`); } if (item.errors[i].hasOwnProperty("endColumn")) { - assert.equal(messages[i].endColumn, item.errors[i].endColumn, "Error endColumn should be " + item.errors[i].endColumn); + assert.equal(messages[i].endColumn, item.errors[i].endColumn, `Error endColumn should be ${item.errors[i].endColumn}`); } } else { diff --git a/tools/eslint/lib/timing.js b/tools/eslint/lib/timing.js index b9394af47cee69..627aa5f82f8118 100644 --- a/tools/eslint/lib/timing.js +++ b/tools/eslint/lib/timing.js @@ -66,7 +66,7 @@ function display(data) { .slice(0, 10); rows.forEach(function(row) { - row.push((row[1] * 100 / total).toFixed(1) + "%"); + row.push(`${(row[1] * 100 / total).toFixed(1)}%`); row[1] = row[1].toFixed(3); }); diff --git a/tools/eslint/lib/util/glob-util.js b/tools/eslint/lib/util/glob-util.js index 03d1a2bdd9cb25..cba2e694ad5238 100644 --- a/tools/eslint/lib/util/glob-util.js +++ b/tools/eslint/lib/util/glob-util.js @@ -50,9 +50,9 @@ function processPath(options) { let suffix = "/**"; if (extensions.length === 1) { - suffix += "/*." + extensions[0]; + suffix += `/*.${extensions[0]}`; } else { - suffix += "/*.{" + extensions.join(",") + "}"; + suffix += `/*.{${extensions.join(",")}}`; } /** diff --git a/tools/eslint/lib/util/module-resolver.js b/tools/eslint/lib/util/module-resolver.js index d59413c505c123..40c107a70e82bd 100644 --- a/tools/eslint/lib/util/module-resolver.js +++ b/tools/eslint/lib/util/module-resolver.js @@ -71,7 +71,7 @@ ModuleResolver.prototype = { const result = Module._findPath(name, lookupPaths); // eslint-disable-line no-underscore-dangle if (!result) { - throw new Error("Cannot find module '" + name + "'"); + throw new Error(`Cannot find module '${name}'`); } return result; diff --git a/tools/eslint/lib/util/node-event-generator.js b/tools/eslint/lib/util/node-event-generator.js index 92253f6ca23b6e..95d9132dd2f3b3 100644 --- a/tools/eslint/lib/util/node-event-generator.js +++ b/tools/eslint/lib/util/node-event-generator.js @@ -46,7 +46,7 @@ NodeEventGenerator.prototype = { * @returns {void} */ leaveNode: function leaveNode(node) { - this.emitter.emit(node.type + ":exit", node); + this.emitter.emit(`${node.type}:exit`, node); } }; diff --git a/tools/eslint/lib/util/npm-util.js b/tools/eslint/lib/util/npm-util.js index a910419403309d..e9131595e7e822 100644 --- a/tools/eslint/lib/util/npm-util.js +++ b/tools/eslint/lib/util/npm-util.js @@ -53,7 +53,7 @@ function installSyncSaveDev(packages) { if (Array.isArray(packages)) { packages = packages.join(" "); } - shell.exec("npm i --save-dev " + packages, {stdio: "inherit"}); + shell.exec(`npm i --save-dev ${packages}`, {stdio: "inherit"}); } /** diff --git a/tools/eslint/lib/util/source-code-util.js b/tools/eslint/lib/util/source-code-util.js index c96552f8f6646f..8e660e0961d330 100644 --- a/tools/eslint/lib/util/source-code-util.js +++ b/tools/eslint/lib/util/source-code-util.js @@ -36,7 +36,7 @@ function getSourceCodeOfFile(filename, options) { if (results && results.results[0] && results.results[0].messages[0] && results.results[0].messages[0].fatal) { const msg = results.results[0].messages[0]; - throw new Error("(" + filename + ":" + msg.line + ":" + msg.column + ") " + msg.message); + throw new Error(`(${filename}:${msg.line}:${msg.column}) ${msg.message}`); } const sourceCode = eslint.getSourceCode(); @@ -89,7 +89,7 @@ function getSourceCodeOfFiles(patterns, options, cb) { }, []); if (filenames.length === 0) { - debug("Did not find any files matching pattern(s): " + patterns); + debug(`Did not find any files matching pattern(s): ${patterns}`); } filenames.forEach(function(filename) { const sourceCode = getSourceCodeOfFile(filename, opts); diff --git a/tools/eslint/lib/util/xml-escape.js b/tools/eslint/lib/util/xml-escape.js index 2c3abd39d5b482..698abaf38eaecf 100644 --- a/tools/eslint/lib/util/xml-escape.js +++ b/tools/eslint/lib/util/xml-escape.js @@ -15,7 +15,7 @@ * @private */ module.exports = function(s) { - return ("" + s).replace(/[<>&"'\x00-\x1F\x7F\u0080-\uFFFF]/g, function(c) { // eslint-disable-line no-control-regex + return (`${s}`).replace(/[<>&"'\x00-\x1F\x7F\u0080-\uFFFF]/g, function(c) { // eslint-disable-line no-control-regex switch (c) { case "<": return "<"; @@ -28,7 +28,7 @@ module.exports = function(s) { case "'": return "'"; default: - return "&#" + c.charCodeAt(0) + ";"; + return `&#${c.charCodeAt(0)};`; } }); }; diff --git a/tools/eslint/node_modules/.bin/eslint b/tools/eslint/node_modules/.bin/eslint deleted file mode 120000 index 810e4bcb32af34..00000000000000 --- a/tools/eslint/node_modules/.bin/eslint +++ /dev/null @@ -1 +0,0 @@ -../eslint/bin/eslint.js \ No newline at end of file diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/.bin/acorn b/tools/eslint/node_modules/acorn-jsx/node_modules/.bin/acorn new file mode 120000 index 00000000000000..cf76760386200f --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/.bin/acorn @@ -0,0 +1 @@ +../acorn/bin/acorn \ No newline at end of file diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/.tern-project b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/.tern-project new file mode 100644 index 00000000000000..6718ce07e1c8a0 --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/.tern-project @@ -0,0 +1,6 @@ +{ + "plugins": { + "node": true, + "es_modules": true + } +} \ No newline at end of file diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/AUTHORS b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/AUTHORS new file mode 100644 index 00000000000000..1b2061cd4b3021 --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/AUTHORS @@ -0,0 +1,59 @@ +List of Acorn contributors. Updated before every release. + +Adrian Rakovsky +Alistair Braidwood +Amila Welihinda +Andres Suarez +Angelo +Aparajita Fishman +Arian Stolwijk +Artem Govorov +Brandon Mills +Charles Hughes +Conrad Irwin +Daniel Tschinder +David Bonnet +Domenico Matteo +ForbesLindesay +Forbes Lindesay +Gilad Peleg +impinball +Ingvar Stepanyan +Jackson Ray Hamilton +Jesse McCarthy +Jiaxing Wang +Joel Kemp +Johannes Herr +Jordan Klassen +Jürg Lehni +keeyipchan +Keheliya Gallaba +Kevin Irish +Kevin Kwok +krator +Marijn Haverbeke +Martin Carlberg +Mathias Bynens +Mathieu 'p01' Henri +Matthew Bastien +Max Schaefer +Max Zerzouri +Mihai Bazon +Mike Rennie +Nicholas C. Zakas +Nick Fitzgerald +Olivier Thomann +Oskar Schöldström +Paul Harper +Peter Rust +PlNG +Prayag Verma +ReadmeCritic +r-e-d +Richard Gibson +Rich Harris +Rich-Harris +Sebastian McKenzie +Timothy Gu +Toru Nagashima +zsjforcn diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/async/LICENSE b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/LICENSE similarity index 94% rename from deps/npm/node_modules/request/node_modules/form-data/node_modules/async/LICENSE rename to tools/eslint/node_modules/acorn-jsx/node_modules/acorn/LICENSE index 8f29698588533b..a35ebf44fd859e 100644 --- a/deps/npm/node_modules/request/node_modules/form-data/node_modules/async/LICENSE +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/LICENSE @@ -1,4 +1,4 @@ -Copyright (c) 2010-2014 Caolan McMahon +Copyright (C) 2012-2016 by various contributors (see AUTHORS) Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/README.md b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/README.md new file mode 100644 index 00000000000000..6c53802b8a8792 --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/README.md @@ -0,0 +1,407 @@ +# Acorn + +[![Build Status](https://travis-ci.org/ternjs/acorn.svg?branch=master)](https://travis-ci.org/ternjs/acorn) +[![NPM version](https://img.shields.io/npm/v/acorn.svg)](https://www.npmjs.com/package/acorn) +[Author funding status: ![maintainer happiness](https://marijnhaverbeke.nl/fund/status_s.png?force)](https://marijnhaverbeke.nl/fund/) + +A tiny, fast JavaScript parser, written completely in JavaScript. + +## Community + +Acorn is open source software released under an +[MIT license](https://github.com/ternjs/acorn/blob/master/LICENSE). + +You are welcome to +[report bugs](https://github.com/ternjs/acorn/issues) or create pull +requests on [github](https://github.com/ternjs/acorn). For questions +and discussion, please use the +[Tern discussion forum](https://discuss.ternjs.net). + +## Installation + +The easiest way to install acorn is with [`npm`][npm]. + +[npm]: https://www.npmjs.com/ + +```sh +npm install acorn +``` + +Alternately, download the source. + +```sh +git clone https://github.com/ternjs/acorn.git +``` + +## Components + +When run in a CommonJS (node.js) or AMD environment, exported values +appear in the interfaces exposed by the individual files, as usual. +When loaded in the browser (Acorn works in any JS-enabled browser more +recent than IE5) without any kind of module management, a single +global object `acorn` will be defined, and all the exported properties +will be added to that. + +### Main parser + +This is implemented in `dist/acorn.js`, and is what you get when you +`require("acorn")` in node.js. + +**parse**`(input, options)` is used to parse a JavaScript program. +The `input` parameter is a string, `options` can be undefined or an +object setting some of the options listed below. The return value will +be an abstract syntax tree object as specified by the +[ESTree spec][estree]. + +When encountering a syntax error, the parser will raise a +`SyntaxError` object with a meaningful message. The error object will +have a `pos` property that indicates the character offset at which the +error occurred, and a `loc` object that contains a `{line, column}` +object referring to that same position. + +[estree]: https://github.com/estree/estree + +- **ecmaVersion**: Indicates the ECMAScript version to parse. Must be + either 3, 5, 6, or 7. This influences support for strict mode, the set + of reserved words, and support for new syntax features. Default is 6. + + **NOTE**: Only 'stage 4' (finalized) ECMAScript 7 features are being + implemented by Acorn. That means that most of the draft standard is + not yet being parsed. + +- **sourceType**: Indicate the mode the code should be parsed in. Can be + either `"script"` or `"module"`. + +- **onInsertedSemicolon**: If given a callback, that callback will be + called whenever a missing semicolon is inserted by the parser. The + callback will be given the character offset of the point where the + semicolon is inserted as argument, and if `locations` is on, also a + `{line, column}` object representing this position. + +- **onTrailingComma**: Like `onInsertedSemicolon`, but for trailing + commas. + +- **allowReserved**: If `false`, using a reserved word will generate + an error. Defaults to `true` for `ecmaVersion` 3, `false` for higher + versions. When given the value `"never"`, reserved words and + keywords can also not be used as property names (as in Internet + Explorer's old parser). + +- **allowReturnOutsideFunction**: By default, a return statement at + the top level raises an error. Set this to `true` to accept such + code. + +- **allowImportExportEverywhere**: By default, `import` and `export` + declarations can only appear at a program's top level. Setting this + option to `true` allows them anywhere where a statement is allowed. + +- **allowHashBang**: When this is enabled (off by default), if the + code starts with the characters `#!` (as in a shellscript), the + first line will be treated as a comment. + +- **locations**: When `true`, each node has a `loc` object attached + with `start` and `end` subobjects, each of which contains the + one-based line and zero-based column numbers in `{line, column}` + form. Default is `false`. + +- **onToken**: If a function is passed for this option, each found + token will be passed in same format as tokens returned from + `tokenizer().getToken()`. + + If array is passed, each found token is pushed to it. + + Note that you are not allowed to call the parser from the + callback—that will corrupt its internal state. + +- **onComment**: If a function is passed for this option, whenever a + comment is encountered the function will be called with the + following parameters: + + - `block`: `true` if the comment is a block comment, false if it + is a line comment. + - `text`: The content of the comment. + - `start`: Character offset of the start of the comment. + - `end`: Character offset of the end of the comment. + + When the `locations` options is on, the `{line, column}` locations + of the comment’s start and end are passed as two additional + parameters. + + If array is passed for this option, each found comment is pushed + to it as object in Esprima format: + + ```javascript + { + "type": "Line" | "Block", + "value": "comment text", + "start": Number, + "end": Number, + // If `locations` option is on: + "loc": { + "start": {line: Number, column: Number} + "end": {line: Number, column: Number} + }, + // If `ranges` option is on: + "range": [Number, Number] + } + ``` + + Note that you are not allowed to call the parser from the + callback—that will corrupt its internal state. + +- **ranges**: Nodes have their start and end characters offsets + recorded in `start` and `end` properties (directly on the node, + rather than the `loc` object, which holds line/column data. To also + add a [semi-standardized][range] `range` property holding a + `[start, end]` array with the same numbers, set the `ranges` option + to `true`. + +- **program**: It is possible to parse multiple files into a single + AST by passing the tree produced by parsing the first file as the + `program` option in subsequent parses. This will add the toplevel + forms of the parsed file to the "Program" (top) node of an existing + parse tree. + +- **sourceFile**: When the `locations` option is `true`, you can pass + this option to add a `source` attribute in every node’s `loc` + object. Note that the contents of this option are not examined or + processed in any way; you are free to use whatever format you + choose. + +- **directSourceFile**: Like `sourceFile`, but a `sourceFile` property + will be added (regardless of the `location` option) directly to the + nodes, rather than the `loc` object. + +- **preserveParens**: If this option is `true`, parenthesized expressions + are represented by (non-standard) `ParenthesizedExpression` nodes + that have a single `expression` property containing the expression + inside parentheses. + +[range]: https://bugzilla.mozilla.org/show_bug.cgi?id=745678 + +**parseExpressionAt**`(input, offset, options)` will parse a single +expression in a string, and return its AST. It will not complain if +there is more of the string left after the expression. + +**getLineInfo**`(input, offset)` can be used to get a `{line, +column}` object for a given program string and character offset. + +**tokenizer**`(input, options)` returns an object with a `getToken` +method that can be called repeatedly to get the next token, a `{start, +end, type, value}` object (with added `loc` property when the +`locations` option is enabled and `range` property when the `ranges` +option is enabled). When the token's type is `tokTypes.eof`, you +should stop calling the method, since it will keep returning that same +token forever. + +In ES6 environment, returned result can be used as any other +protocol-compliant iterable: + +```javascript +for (let token of acorn.tokenizer(str)) { + // iterate over the tokens +} + +// transform code to array of tokens: +var tokens = [...acorn.tokenizer(str)]; +``` + +**tokTypes** holds an object mapping names to the token type objects +that end up in the `type` properties of tokens. + +#### Note on using with [Escodegen][escodegen] + +Escodegen supports generating comments from AST, attached in +Esprima-specific format. In order to simulate same format in +Acorn, consider following example: + +```javascript +var comments = [], tokens = []; + +var ast = acorn.parse('var x = 42; // answer', { + // collect ranges for each node + ranges: true, + // collect comments in Esprima's format + onComment: comments, + // collect token ranges + onToken: tokens +}); + +// attach comments using collected information +escodegen.attachComments(ast, comments, tokens); + +// generate code +console.log(escodegen.generate(ast, {comment: true})); +// > 'var x = 42; // answer' +``` + +[escodegen]: https://github.com/estools/escodegen + +### dist/acorn_loose.js ### + +This file implements an error-tolerant parser. It exposes a single +function. The loose parser is accessible in node.js via `require("acorn/dist/acorn_loose")`. + +**parse_dammit**`(input, options)` takes the same arguments and +returns the same syntax tree as the `parse` function in `acorn.js`, +but never raises an error, and will do its best to parse syntactically +invalid code in as meaningful a way as it can. It'll insert identifier +nodes with name `"✖"` as placeholders in places where it can't make +sense of the input. Depends on `acorn.js`, because it uses the same +tokenizer. + +### dist/walk.js ### + +Implements an abstract syntax tree walker. Will store its interface in +`acorn.walk` when loaded without a module system. + +**simple**`(node, visitors, base, state)` does a 'simple' walk over +a tree. `node` should be the AST node to walk, and `visitors` an +object with properties whose names correspond to node types in the +[ESTree spec][estree]. The properties should contain functions +that will be called with the node object and, if applicable the state +at that point. The last two arguments are optional. `base` is a walker +algorithm, and `state` is a start state. The default walker will +simply visit all statements and expressions and not produce a +meaningful state. (An example of a use of state is to track scope at +each point in the tree.) + +**ancestor**`(node, visitors, base, state)` does a 'simple' walk over +a tree, building up an array of ancestor nodes (including the current node) +and passing the array to the callbacks as a third parameter. + +**recursive**`(node, state, functions, base)` does a 'recursive' +walk, where the walker functions are responsible for continuing the +walk on the child nodes of their target node. `state` is the start +state, and `functions` should contain an object that maps node types +to walker functions. Such functions are called with `(node, state, c)` +arguments, and can cause the walk to continue on a sub-node by calling +the `c` argument on it with `(node, state)` arguments. The optional +`base` argument provides the fallback walker functions for node types +that aren't handled in the `functions` object. If not given, the +default walkers will be used. + +**make**`(functions, base)` builds a new walker object by using the +walker functions in `functions` and filling in the missing ones by +taking defaults from `base`. + +**findNodeAt**`(node, start, end, test, base, state)` tries to +locate a node in a tree at the given start and/or end offsets, which +satisfies the predicate `test`. `start` and `end` can be either `null` +(as wildcard) or a number. `test` may be a string (indicating a node +type) or a function that takes `(nodeType, node)` arguments and +returns a boolean indicating whether this node is interesting. `base` +and `state` are optional, and can be used to specify a custom walker. +Nodes are tested from inner to outer, so if two nodes match the +boundaries, the inner one will be preferred. + +**findNodeAround**`(node, pos, test, base, state)` is a lot like +`findNodeAt`, but will match any node that exists 'around' (spanning) +the given position. + +**findNodeAfter**`(node, pos, test, base, state)` is similar to +`findNodeAround`, but will match all nodes *after* the given position +(testing outer nodes before inner nodes). + +## Command line interface + +The `bin/acorn` utility can be used to parse a file from the command +line. It accepts as arguments its input file and the following +options: + +- `--ecma3|--ecma5|--ecma6|--ecma7`: Sets the ECMAScript version to parse. Default is + version 5. + +- `--module`: Sets the parsing mode to `"module"`. Is set to `"script"` otherwise. + +- `--locations`: Attaches a "loc" object to each node with "start" and + "end" subobjects, each of which contains the one-based line and + zero-based column numbers in `{line, column}` form. + +- `--allow-hash-bang`: If the code starts with the characters #! (as in a shellscript), the first line will be treated as a comment. + +- `--compact`: No whitespace is used in the AST output. + +- `--silent`: Do not output the AST, just return the exit status. + +- `--help`: Print the usage information and quit. + +The utility spits out the syntax tree as JSON data. + +## Build system + +Acorn is written in ECMAScript 6, as a set of small modules, in the +project's `src` directory, and compiled down to bigger ECMAScript 3 +files in `dist` using [Browserify](http://browserify.org) and +[Babel](http://babeljs.io/). If you are already using Babel, you can +consider including the modules directly. + +The command-line test runner (`npm test`) uses the ES6 modules. The +browser-based test page (`test/index.html`) uses the compiled modules. +The `bin/build-acorn.js` script builds the latter from the former. + +If you are working on Acorn, you'll probably want to try the code out +directly, without an intermediate build step. In your scripts, you can +register the Babel require shim like this: + + require("babel-core/register") + +That will allow you to directly `require` the ES6 modules. + +## Plugins + +Acorn is designed support allow plugins which, within reasonable +bounds, redefine the way the parser works. Plugins can add new token +types and new tokenizer contexts (if necessary), and extend methods in +the parser object. This is not a clean, elegant API—using it requires +an understanding of Acorn's internals, and plugins are likely to break +whenever those internals are significantly changed. But still, it is +_possible_, in this way, to create parsers for JavaScript dialects +without forking all of Acorn. And in principle it is even possible to +combine such plugins, so that if you have, for example, a plugin for +parsing types and a plugin for parsing JSX-style XML literals, you +could load them both and parse code with both JSX tags and types. + +A plugin should register itself by adding a property to +`acorn.plugins`, which holds a function. Calling `acorn.parse`, a +`plugins` option can be passed, holding an object mapping plugin names +to configuration values (or just `true` for plugins that don't take +options). After the parser object has been created, the initialization +functions for the chosen plugins are called with `(parser, +configValue)` arguments. They are expected to use the `parser.extend` +method to extend parser methods. For example, the `readToken` method +could be extended like this: + +```javascript +parser.extend("readToken", function(nextMethod) { + return function(code) { + console.log("Reading a token!") + return nextMethod.call(this, code) + } +}) +``` + +The `nextMethod` argument passed to `extend`'s second argument is the +previous value of this method, and should usually be called through to +whenever the extended method does not handle the call itself. + +Similarly, the loose parser allows plugins to register themselves via +`acorn.pluginsLoose`. The extension mechanism is the same as for the +normal parser: + +```javascript +looseParser.extend("readToken", function(nextMethod) { + return function() { + console.log("Reading a token in the loose parser!") + return nextMethod.call(this) + } +}) +``` + +### Existing plugins + + - [`acorn-jsx`](https://github.com/RReverser/acorn-jsx): Parse [Facebook JSX syntax extensions](https://github.com/facebook/jsx) + - [`acorn-es7-plugin`](https://github.com/MatAtBread/acorn-es7-plugin/): Parse [async/await syntax proposal](https://github.com/tc39/ecmascript-asyncawait) + - [`acorn-object-spread`](https://github.com/UXtemple/acorn-object-spread): Parse [object spread syntax proposal](https://github.com/sebmarkbage/ecmascript-rest-spread) + - [`acorn-es7`](https://www.npmjs.com/package/acorn-es7): Parse [decorator syntax proposal](https://github.com/wycats/javascript-decorators) + - [`acorn-objj`](https://www.npmjs.com/package/acorn-objj): [Objective-J](http://www.cappuccino-project.org/learn/objective-j.html) language parser built as Acorn plugin diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/acorn b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/acorn new file mode 100755 index 00000000000000..cf4acd563179ad --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/acorn @@ -0,0 +1,65 @@ +#!/usr/bin/env node +'use strict'; + +var path = require('path'); +var fs = require('fs'); +var acorn = require('../dist/acorn.js'); + +var infile; +var forceFile; +var silent = false; +var compact = false; +var tokenize = false; +var options = {} + +function help(status) { + var print = (status == 0) ? console.log : console.error + print("usage: " + path.basename(process.argv[1]) + " [--ecma3|--ecma5|--ecma6|--ecma7]") + print(" [--tokenize] [--locations] [---allow-hash-bang] [--compact] [--silent] [--module] [--help] [--] [infile]") + process.exit(status) +} + +for (var i = 2; i < process.argv.length; ++i) { + var arg = process.argv[i] + if ((arg == "-" || arg[0] != "-") && !infile) infile = arg + else if (arg == "--" && !infile && i + 2 == process.argv.length) forceFile = infile = process.argv[++i] + else if (arg == "--ecma3") options.ecmaVersion = 3 + else if (arg == "--ecma5") options.ecmaVersion = 5 + else if (arg == "--ecma6") options.ecmaVersion = 6 + else if (arg == "--ecma7") options.ecmaVersion = 7 + else if (arg == "--locations") options.locations = true + else if (arg == "--allow-hash-bang") options.allowHashBang = true + else if (arg == "--silent") silent = true + else if (arg == "--compact") compact = true + else if (arg == "--help") help(0) + else if (arg == "--tokenize") tokenize = true + else if (arg == "--module") options.sourceType = 'module' + else help(1) +} + +function run(code) { + var result + if (!tokenize) { + try { result = acorn.parse(code, options) } + catch(e) { console.error(e.message); process.exit(1) } + } else { + result = [] + var tokenizer = acorn.tokenizer(code, options), token + while (true) { + try { token = tokenizer.getToken() } + catch(e) { console.error(e.message); process.exit(1) } + result.push(token) + if (token.type == acorn.tokTypes.eof) break + } + } + if (!silent) console.log(JSON.stringify(result, null, compact ? null : 2)) +} + +if (forceFile || infile && infile != "-") { + run(fs.readFileSync(infile, "utf8")) +} else { + var code = "" + process.stdin.resume() + process.stdin.on("data", function (chunk) { return code += chunk; }) + process.stdin.on("end", function () { return run(code); }) +} \ No newline at end of file diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/generate-identifier-regex.js b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/generate-identifier-regex.js new file mode 100644 index 00000000000000..100e8cf280fc56 --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/generate-identifier-regex.js @@ -0,0 +1,55 @@ +'use strict'; + +// Which Unicode version should be used? +var version = '9.0.0'; + +var start = require('unicode-' + version + '/Binary_Property/ID_Start/code-points.js') + .filter(function(ch) { return ch > 0x7f; }); +var last = -1; +var cont = [0x200c, 0x200d].concat(require('unicode-' + version + '/Binary_Property/ID_Continue/code-points.js') + .filter(function(ch) { return ch > 0x7f && search(start, ch, last + 1) == -1; })); + +function search(arr, ch, starting) { + for (var i = starting; arr[i] <= ch && i < arr.length; last = i++) + if (arr[i] === ch) + return i; + return -1; +} + +function pad(str, width) { + while (str.length < width) str = "0" + str; + return str; +} + +function esc(code) { + var hex = code.toString(16); + if (hex.length <= 2) return "\\x" + pad(hex, 2); + else return "\\u" + pad(hex, 4); +} + +function generate(chars) { + var astral = [], re = ""; + for (var i = 0, at = 0x10000; i < chars.length; i++) { + var from = chars[i], to = from; + while (i < chars.length - 1 && chars[i + 1] == to + 1) { + i++; + to++; + } + if (to <= 0xffff) { + if (from == to) re += esc(from); + else if (from + 1 == to) re += esc(from) + esc(to); + else re += esc(from) + "-" + esc(to); + } else { + astral.push(from - at, to - from); + at = to; + } + } + return {nonASCII: re, astral: astral}; +} + +var startData = generate(start), contData = generate(cont); + +console.log("let nonASCIIidentifierStartChars = \"" + startData.nonASCII + "\""); +console.log("let nonASCIIidentifierChars = \"" + contData.nonASCII + "\""); +console.log("const astralIdentifierStartCodes = " + JSON.stringify(startData.astral)); +console.log("const astralIdentifierCodes = " + JSON.stringify(contData.astral)); diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/update_authors.sh b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/update_authors.sh new file mode 100755 index 00000000000000..466c8db5867cba --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/bin/update_authors.sh @@ -0,0 +1,6 @@ +# Combine existing list of authors with everyone known in git, sort, add header. +tail --lines=+3 AUTHORS > AUTHORS.tmp +git log --format='%aN' | grep -v abraidwood >> AUTHORS.tmp +echo -e "List of Acorn contributors. Updated before every release.\n" > AUTHORS +sort -u AUTHORS.tmp >> AUTHORS +rm -f AUTHORS.tmp diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/dist/.keep b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/dist/.keep new file mode 100644 index 00000000000000..e69de29bb2d1d6 diff --git a/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/dist/acorn.es.js b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/dist/acorn.es.js new file mode 100644 index 00000000000000..4460957fd78f1a --- /dev/null +++ b/tools/eslint/node_modules/acorn-jsx/node_modules/acorn/dist/acorn.es.js @@ -0,0 +1,3112 @@ +// Reserved word lists for various dialects of the language + +var reservedWords = { + 3: "abstract boolean byte char class double enum export extends final float goto implements import int interface long native package private protected public short static super synchronized throws transient volatile", + 5: "class enum extends super const export import", + 6: "enum", + 7: "enum", + strict: "implements interface let package private protected public static yield", + strictBind: "eval arguments" +} + +// And the keywords + +var ecma5AndLessKeywords = "break case catch continue debugger default do else finally for function if return switch throw try var while with null true false instanceof typeof void delete new in this" + +var keywords = { + 5: ecma5AndLessKeywords, + 6: ecma5AndLessKeywords + " const class extends export import super" +} + +// ## Character categories + +// Big ugly regular expressions that match characters in the +// whitespace, identifier, and identifier-start categories. These +// are only applied when a character is found to actually have a +// code point above 128. +// Generated by `bin/generate-identifier-regex.js`. + +var nonASCIIidentifierStartChars = "\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0370-\u0374\u0376\u0377\u037a-\u037d\u037f\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u048a-\u052f\u0531-\u0556\u0559\u0561-\u0587\u05d0-\u05ea\u05f0-\u05f2\u0620-\u064a\u066e\u066f\u0671-\u06d3\u06d5\u06e5\u06e6\u06ee\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u07f4\u07f5\u07fa\u0800-\u0815\u081a\u0824\u0828\u0840-\u0858\u08a0-\u08b4\u08b6-\u08bd\u0904-\u0939\u093d\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc\u09dd\u09df-\u09e1\u09f0\u09f1\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0\u0ae1\u0af9\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3d\u0b5c\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c39\u0c3d\u0c58-\u0c5a\u0c60\u0c61\u0c80\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cde\u0ce0\u0ce1\u0cf1\u0cf2\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d54-\u0d56\u0d5f-\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32\u0e33\u0e40-\u0e46\u0e81\u0e82\u0e84\u0e87\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa\u0eab\u0ead-\u0eb0\u0eb2\u0eb3\u0ebd\u0ec0-\u0ec4\u0ec6\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065\u1066\u106e-\u1070\u1075-\u1081\u108e\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u13a0-\u13f5\u13f8-\u13fd\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f8\u1700-\u170c\u170e-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17d7\u17dc\u1820-\u1877\u1880-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191e\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19b0-\u19c9\u1a00-\u1a16\u1a20-\u1a54\u1aa7\u1b05-\u1b33\u1b45-\u1b4b\u1b83-\u1ba0\u1bae\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c7d\u1c80-\u1c88\u1ce9-\u1cec\u1cee-\u1cf1\u1cf5\u1cf6\u1d00-\u1dbf\u1e00-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u2071\u207f\u2090-\u209c\u2102\u2107\u210a-\u2113\u2115\u2118-\u211d\u2124\u2126\u2128\u212a-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cee\u2cf2\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303c\u3041-\u3096\u309b-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312d\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fd5\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua61f\ua62a\ua62b\ua640-\ua66e\ua67f-\ua69d\ua6a0-\ua6ef\ua717-\ua71f\ua722-\ua788\ua78b-\ua7ae\ua7b0-\ua7b7\ua7f7-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua8fd\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9cf\ua9e0-\ua9e4\ua9e6-\ua9ef\ua9fa-\ua9fe\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa76\uaa7a\uaa7e-\uaaaf\uaab1\uaab5\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadd\uaae0-\uaaea\uaaf2-\uaaf4\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uab30-\uab5a\uab5c-\uab65\uab70-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe70-\ufe74\ufe76-\ufefc\uff21-\uff3a\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc" +var nonASCIIidentifierChars = "\u200c\u200d\xb7\u0300-\u036f\u0387\u0483-\u0487\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u0669\u0670\u06d6-\u06dc\u06df-\u06e4\u06e7\u06e8\u06ea-\u06ed\u06f0-\u06f9\u0711\u0730-\u074a\u07a6-\u07b0\u07c0-\u07c9\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0859-\u085b\u08d4-\u08e1\u08e3-\u0903\u093a-\u093c\u093e-\u094f\u0951-\u0957\u0962\u0963\u0966-\u096f\u0981-\u0983\u09bc\u09be-\u09c4\u09c7\u09c8\u09cb-\u09cd\u09d7\u09e2\u09e3\u09e6-\u09ef\u0a01-\u0a03\u0a3c\u0a3e-\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a66-\u0a71\u0a75\u0a81-\u0a83\u0abc\u0abe-\u0ac5\u0ac7-\u0ac9\u0acb-\u0acd\u0ae2\u0ae3\u0ae6-\u0aef\u0b01-\u0b03\u0b3c\u0b3e-\u0b44\u0b47\u0b48\u0b4b-\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b66-\u0b6f\u0b82\u0bbe-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcd\u0bd7\u0be6-\u0bef\u0c00-\u0c03\u0c3e-\u0c44\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0c66-\u0c6f\u0c81-\u0c83\u0cbc\u0cbe-\u0cc4\u0cc6-\u0cc8\u0cca-\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0ce6-\u0cef\u0d01-\u0d03\u0d3e-\u0d44\u0d46-\u0d48\u0d4a-\u0d4d\u0d57\u0d62\u0d63\u0d66-\u0d6f\u0d82\u0d83\u0dca\u0dcf-\u0dd4\u0dd6\u0dd8-\u0ddf\u0de6-\u0def\u0df2\u0df3\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0e50-\u0e59\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0ed0-\u0ed9\u0f18\u0f19\u0f20-\u0f29\u0f35\u0f37\u0f39\u0f3e\u0f3f\u0f71-\u0f84\u0f86\u0f87\u0f8d-\u0f97\u0f99-\u0fbc\u0fc6\u102b-\u103e\u1040-\u1049\u1056-\u1059\u105e-\u1060\u1062-\u1064\u1067-\u106d\u1071-\u1074\u1082-\u108d\u108f-\u109d\u135d-\u135f\u1369-\u1371\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b4-\u17d3\u17dd\u17e0-\u17e9\u180b-\u180d\u1810-\u1819\u18a9\u1920-\u192b\u1930-\u193b\u1946-\u194f\u19d0-\u19da\u1a17-\u1a1b\u1a55-\u1a5e\u1a60-\u1a7c\u1a7f-\u1a89\u1a90-\u1a99\u1ab0-\u1abd\u1b00-\u1b04\u1b34-\u1b44\u1b50-\u1b59\u1b6b-\u1b73\u1b80-\u1b82\u1ba1-\u1bad\u1bb0-\u1bb9\u1be6-\u1bf3\u1c24-\u1c37\u1c40-\u1c49\u1c50-\u1c59\u1cd0-\u1cd2\u1cd4-\u1ce8\u1ced\u1cf2-\u1cf4\u1cf8\u1cf9\u1dc0-\u1df5\u1dfb-\u1dff\u203f\u2040\u2054\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2cef-\u2cf1\u2d7f\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua620-\ua629\ua66f\ua674-\ua67d\ua69e\ua69f\ua6f0\ua6f1\ua802\ua806\ua80b\ua823-\ua827\ua880\ua881\ua8b4-\ua8c5\ua8d0-\ua8d9\ua8e0-\ua8f1\ua900-\ua909\ua926-\ua92d\ua947-\ua953\ua980-\ua983\ua9b3-\ua9c0\ua9d0-\ua9d9\ua9e5\ua9f0-\ua9f9\uaa29-\uaa36\uaa43\uaa4c\uaa4d\uaa50-\uaa59\uaa7b-\uaa7d\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uaaeb-\uaaef\uaaf5\uaaf6\uabe3-\uabea\uabec\uabed\uabf0-\uabf9\ufb1e\ufe00-\ufe0f\ufe20-\ufe2f\ufe33\ufe34\ufe4d-\ufe4f\uff10-\uff19\uff3f" + +var nonASCIIidentifierStart = new RegExp("[" + nonASCIIidentifierStartChars + "]") +var nonASCIIidentifier = new RegExp("[" + nonASCIIidentifierStartChars + nonASCIIidentifierChars + "]") + +nonASCIIidentifierStartChars = nonASCIIidentifierChars = null + +// These are a run-length and offset encoded representation of the +// >0xffff code points that are a valid part of identifiers. The +// offset starts at 0x10000, and each pair of numbers represents an +// offset to the next range, and then a size of the range. They were +// generated by bin/generate-identifier-regex.js +var astralIdentifierStartCodes = [0,11,2,25,2,18,2,1,2,14,3,13,35,122,70,52,268,28,4,48,48,31,17,26,6,37,11,29,3,35,5,7,2,4,43,157,19,35,5,35,5,39,9,51,157,310,10,21,11,7,153,5,3,0,2,43,2,1,4,0,3,22,11,22,10,30,66,18,2,1,11,21,11,25,71,55,7,1,65,0,16,3,2,2,2,26,45,28,4,28,36,7,2,27,28,53,11,21,11,18,14,17,111,72,56,50,14,50,785,52,76,44,33,24,27,35,42,34,4,0,13,47,15,3,22,0,2,0,36,17,2,24,85,6,2,0,2,3,2,14,2,9,8,46,39,7,3,1,3,21,2,6,2,1,2,4,4,0,19,0,13,4,159,52,19,3,54,47,21,1,2,0,185,46,42,3,37,47,21,0,60,42,86,25,391,63,32,0,449,56,264,8,2,36,18,0,50,29,881,921,103,110,18,195,2749,1070,4050,582,8634,568,8,30,114,29,19,47,17,3,32,20,6,18,881,68,12,0,67,12,65,0,32,6124,20,754,9486,1,3071,106,6,12,4,8,8,9,5991,84,2,70,2,1,3,0,3,1,3,3,2,11,2,0,2,6,2,64,2,3,3,7,2,6,2,27,2,3,2,4,2,0,4,6,2,339,3,24,2,24,2,30,2,24,2,30,2,24,2,30,2,24,2,30,2,24,2,7,4149,196,60,67,1213,3,2,26,2,1,2,0,3,0,2,9,2,3,2,0,2,0,7,0,5,0,2,0,2,0,2,2,2,1,2,0,3,0,2,0,2,0,2,0,2,0,2,1,2,0,3,3,2,6,2,3,2,3,2,0,2,9,2,16,6,2,2,4,2,16,4421,42710,42,4148,12,221,3,5761,10591,541] +var astralIdentifierCodes = [509,0,227,0,150,4,294,9,1368,2,2,1,6,3,41,2,5,0,166,1,1306,2,54,14,32,9,16,3,46,10,54,9,7,2,37,13,2,9,52,0,13,2,49,13,10,2,4,9,83,11,7,0,161,11,6,9,7,3,57,0,2,6,3,1,3,2,10,0,11,1,3,6,4,4,193,17,10,9,87,19,13,9,214,6,3,8,28,1,83,16,16,9,82,12,9,9,84,14,5,9,423,9,838,7,2,7,17,9,57,21,2,13,19882,9,135,4,60,6,26,9,1016,45,17,3,19723,1,5319,4,4,5,9,7,3,6,31,3,149,2,1418,49,513,54,5,49,9,0,15,0,23,4,2,14,1361,6,2,16,3,6,2,1,2,4,2214,6,110,6,6,9,792487,239] + +// This has a complexity linear to the value of the code. The +// assumption is that looking up astral identifier characters is +// rare. +function isInAstralSet(code, set) { + var pos = 0x10000 + for (var i = 0; i < set.length; i += 2) { + pos += set[i] + if (pos > code) return false + pos += set[i + 1] + if (pos >= code) return true + } +} + +// Test whether a given character code starts an identifier. + +function isIdentifierStart(code, astral) { + if (code < 65) return code === 36 + if (code < 91) return true + if (code < 97) return code === 95 + if (code < 123) return true + if (code <= 0xffff) return code >= 0xaa && nonASCIIidentifierStart.test(String.fromCharCode(code)) + if (astral === false) return false + return isInAstralSet(code, astralIdentifierStartCodes) +} + +// Test whether a given character is part of an identifier. + +function isIdentifierChar(code, astral) { + if (code < 48) return code === 36 + if (code < 58) return true + if (code < 65) return false + if (code < 91) return true + if (code < 97) return code === 95 + if (code < 123) return true + if (code <= 0xffff) return code >= 0xaa && nonASCIIidentifier.test(String.fromCharCode(code)) + if (astral === false) return false + return isInAstralSet(code, astralIdentifierStartCodes) || isInAstralSet(code, astralIdentifierCodes) +} + +// ## Token types + +// The assignment of fine-grained, information-carrying type objects +// allows the tokenizer to store the information it has about a +// token in a way that is very cheap for the parser to look up. + +// All token type variables start with an underscore, to make them +// easy to recognize. + +// The `beforeExpr` property is used to disambiguate between regular +// expressions and divisions. It is set on all token types that can +// be followed by an expression (thus, a slash after them would be a +// regular expression). +// +// The `startsExpr` property is used to check if the token ends a +// `yield` expression. It is set on all token types that either can +// directly start an expression (like a quotation mark) or can +// continue an expression (like the body of a string). +// +// `isLoop` marks a keyword as starting a loop, which is important +// to know when parsing a label, in order to allow or disallow +// continue jumps to that label. + +var TokenType = function TokenType(label, conf) { + if ( conf === void 0 ) conf = {}; + + this.label = label + this.keyword = conf.keyword + this.beforeExpr = !!conf.beforeExpr + this.startsExpr = !!conf.startsExpr + this.isLoop = !!conf.isLoop + this.isAssign = !!conf.isAssign + this.prefix = !!conf.prefix + this.postfix = !!conf.postfix + this.binop = conf.binop || null + this.updateContext = null +}; + +function binop(name, prec) { + return new TokenType(name, {beforeExpr: true, binop: prec}) +} +var beforeExpr = {beforeExpr: true}; +var startsExpr = {startsExpr: true}; +// Map keyword names to token types. + +var keywordTypes = {} + +// Succinct definitions of keyword token types +function kw(name, options) { + if ( options === void 0 ) options = {}; + + options.keyword = name + return keywordTypes[name] = new TokenType(name, options) +} + +var tt = { + num: new TokenType("num", startsExpr), + regexp: new TokenType("regexp", startsExpr), + string: new TokenType("string", startsExpr), + name: new TokenType("name", startsExpr), + eof: new TokenType("eof"), + + // Punctuation token types. + bracketL: new TokenType("[", {beforeExpr: true, startsExpr: true}), + bracketR: new TokenType("]"), + braceL: new TokenType("{", {beforeExpr: true, startsExpr: true}), + braceR: new TokenType("}"), + parenL: new TokenType("(", {beforeExpr: true, startsExpr: true}), + parenR: new TokenType(")"), + comma: new TokenType(",", beforeExpr), + semi: new TokenType(";", beforeExpr), + colon: new TokenType(":", beforeExpr), + dot: new TokenType("."), + question: new TokenType("?", beforeExpr), + arrow: new TokenType("=>", beforeExpr), + template: new TokenType("template"), + ellipsis: new TokenType("...", beforeExpr), + backQuote: new TokenType("`", startsExpr), + dollarBraceL: new TokenType("${", {beforeExpr: true, startsExpr: true}), + + // Operators. These carry several kinds of properties to help the + // parser use them properly (the presence of these properties is + // what categorizes them as operators). + // + // `binop`, when present, specifies that this operator is a binary + // operator, and will refer to its precedence. + // + // `prefix` and `postfix` mark the operator as a prefix or postfix + // unary operator. + // + // `isAssign` marks all of `=`, `+=`, `-=` etcetera, which act as + // binary operators with a very low precedence, that should result + // in AssignmentExpression nodes. + + eq: new TokenType("=", {beforeExpr: true, isAssign: true}), + assign: new TokenType("_=", {beforeExpr: true, isAssign: true}), + incDec: new TokenType("++/--", {prefix: true, postfix: true, startsExpr: true}), + prefix: new TokenType("prefix", {beforeExpr: true, prefix: true, startsExpr: true}), + logicalOR: binop("||", 1), + logicalAND: binop("&&", 2), + bitwiseOR: binop("|", 3), + bitwiseXOR: binop("^", 4), + bitwiseAND: binop("&", 5), + equality: binop("==/!=", 6), + relational: binop("", 7), + bitShift: binop("<>", 8), + plusMin: new TokenType("+/-", {beforeExpr: true, binop: 9, prefix: true, startsExpr: true}), + modulo: binop("%", 10), + star: binop("*", 10), + slash: binop("/", 10), + starstar: new TokenType("**", {beforeExpr: true}), + + // Keyword token types. + _break: kw("break"), + _case: kw("case", beforeExpr), + _catch: kw("catch"), + _continue: kw("continue"), + _debugger: kw("debugger"), + _default: kw("default", beforeExpr), + _do: kw("do", {isLoop: true, beforeExpr: true}), + _else: kw("else", beforeExpr), + _finally: kw("finally"), + _for: kw("for", {isLoop: true}), + _function: kw("function", startsExpr), + _if: kw("if"), + _return: kw("return", beforeExpr), + _switch: kw("switch"), + _throw: kw("throw", beforeExpr), + _try: kw("try"), + _var: kw("var"), + _const: kw("const"), + _while: kw("while", {isLoop: true}), + _with: kw("with"), + _new: kw("new", {beforeExpr: true, startsExpr: true}), + _this: kw("this", startsExpr), + _super: kw("super", startsExpr), + _class: kw("class"), + _extends: kw("extends", beforeExpr), + _export: kw("export"), + _import: kw("import"), + _null: kw("null", startsExpr), + _true: kw("true", startsExpr), + _false: kw("false", startsExpr), + _in: kw("in", {beforeExpr: true, binop: 7}), + _instanceof: kw("instanceof", {beforeExpr: true, binop: 7}), + _typeof: kw("typeof", {beforeExpr: true, prefix: true, startsExpr: true}), + _void: kw("void", {beforeExpr: true, prefix: true, startsExpr: true}), + _delete: kw("delete", {beforeExpr: true, prefix: true, startsExpr: true}) +} + +// Matches a whole line break (where CRLF is considered a single +// line break). Used to count lines. + +var lineBreak = /\r\n?|\n|\u2028|\u2029/ +var lineBreakG = new RegExp(lineBreak.source, "g") + +function isNewLine(code) { + return code === 10 || code === 13 || code === 0x2028 || code == 0x2029 +} + +var nonASCIIwhitespace = /[\u1680\u180e\u2000-\u200a\u202f\u205f\u3000\ufeff]/ + +var skipWhiteSpace = /(?:\s|\/\/.*|\/\*[^]*?\*\/)*/g + +function isArray(obj) { + return Object.prototype.toString.call(obj) === "[object Array]" +} + +// Checks if an object has a property. + +function has(obj, propName) { + return Object.prototype.hasOwnProperty.call(obj, propName) +} + +// These are used when `options.locations` is on, for the +// `startLoc` and `endLoc` properties. + +var Position = function Position(line, col) { + this.line = line + this.column = col +}; + +Position.prototype.offset = function offset (n) { + return new Position(this.line, this.column + n) +}; + +var SourceLocation = function SourceLocation(p, start, end) { + this.start = start + this.end = end + if (p.sourceFile !== null) this.source = p.sourceFile +}; + +// The `getLineInfo` function is mostly useful when the +// `locations` option is off (for performance reasons) and you +// want to find the line/column position for a given character +// offset. `input` should be the code string that the offset refers +// into. + +function getLineInfo(input, offset) { + for (var line = 1, cur = 0;;) { + lineBreakG.lastIndex = cur + var match = lineBreakG.exec(input) + if (match && match.index < offset) { + ++line + cur = match.index + match[0].length + } else { + return new Position(line, offset - cur) + } + } +} + +// A second optional argument can be given to further configure +// the parser process. These options are recognized: + +var defaultOptions = { + // `ecmaVersion` indicates the ECMAScript version to parse. Must + // be either 3, or 5, or 6. This influences support for strict + // mode, the set of reserved words, support for getters and + // setters and other features. The default is 6. + ecmaVersion: 6, + // Source type ("script" or "module") for different semantics + sourceType: "script", + // `onInsertedSemicolon` can be a callback that will be called + // when a semicolon is automatically inserted. It will be passed + // th position of the comma as an offset, and if `locations` is + // enabled, it is given the location as a `{line, column}` object + // as second argument. + onInsertedSemicolon: null, + // `onTrailingComma` is similar to `onInsertedSemicolon`, but for + // trailing commas. + onTrailingComma: null, + // By default, reserved words are only enforced if ecmaVersion >= 5. + // Set `allowReserved` to a boolean value to explicitly turn this on + // an off. When this option has the value "never", reserved words + // and keywords can also not be used as property names. + allowReserved: null, + // When enabled, a return at the top level is not considered an + // error. + allowReturnOutsideFunction: false, + // When enabled, import/export statements are not constrained to + // appearing at the top of the program. + allowImportExportEverywhere: false, + // When enabled, hashbang directive in the beginning of file + // is allowed and treated as a line comment. + allowHashBang: false, + // When `locations` is on, `loc` properties holding objects with + // `start` and `end` properties in `{line, column}` form (with + // line being 1-based and column 0-based) will be attached to the + // nodes. + locations: false, + // A function can be passed as `onToken` option, which will + // cause Acorn to call that function with object in the same + // format as tokens returned from `tokenizer().getToken()`. Note + // that you are not allowed to call the parser from the + // callback—that will corrupt its internal state. + onToken: null, + // A function can be passed as `onComment` option, which will + // cause Acorn to call that function with `(block, text, start, + // end)` parameters whenever a comment is skipped. `block` is a + // boolean indicating whether this is a block (`/* */`) comment, + // `text` is the content of the comment, and `start` and `end` are + // character offsets that denote the start and end of the comment. + // When the `locations` option is on, two more parameters are + // passed, the full `{line, column}` locations of the start and + // end of the comments. Note that you are not allowed to call the + // parser from the callback—that will corrupt its internal state. + onComment: null, + // Nodes have their start and end characters offsets recorded in + // `start` and `end` properties (directly on the node, rather than + // the `loc` object, which holds line/column data. To also add a + // [semi-standardized][range] `range` property holding a `[start, + // end]` array with the same numbers, set the `ranges` option to + // `true`. + // + // [range]: https://bugzilla.mozilla.org/show_bug.cgi?id=745678 + ranges: false, + // It is possible to parse multiple files into a single AST by + // passing the tree produced by parsing the first file as + // `program` option in subsequent parses. This will add the + // toplevel forms of the parsed file to the `Program` (top) node + // of an existing parse tree. + program: null, + // When `locations` is on, you can pass this to record the source + // file in every node's `loc` object. + sourceFile: null, + // This value, if given, is stored in every node, whether + // `locations` is on or off. + directSourceFile: null, + // When enabled, parenthesized expressions are represented by + // (non-standard) ParenthesizedExpression nodes + preserveParens: false, + plugins: {} +} + +// Interpret and default an options object + +function getOptions(opts) { + var options = {} + for (var opt in defaultOptions) + options[opt] = opts && has(opts, opt) ? opts[opt] : defaultOptions[opt] + if (options.allowReserved == null) + options.allowReserved = options.ecmaVersion < 5 + + if (isArray(options.onToken)) { + var tokens = options.onToken + options.onToken = function (token) { return tokens.push(token); } + } + if (isArray(options.onComment)) + options.onComment = pushComment(options, options.onComment) + + return options +} + +function pushComment(options, array) { + return function (block, text, start, end, startLoc, endLoc) { + var comment = { + type: block ? 'Block' : 'Line', + value: text, + start: start, + end: end + } + if (options.locations) + comment.loc = new SourceLocation(this, startLoc, endLoc) + if (options.ranges) + comment.range = [start, end] + array.push(comment) + } +} + +// Registered plugins +var plugins = {} + +function keywordRegexp(words) { + return new RegExp("^(" + words.replace(/ /g, "|") + ")$") +} + +var Parser = function Parser(options, input, startPos) { + this.options = options = getOptions(options) + this.sourceFile = options.sourceFile + this.keywords = keywordRegexp(keywords[options.ecmaVersion >= 6 ? 6 : 5]) + var reserved = options.allowReserved ? "" : + reservedWords[options.ecmaVersion] + (options.sourceType == "module" ? " await" : "") + this.reservedWords = keywordRegexp(reserved) + var reservedStrict = (reserved ? reserved + " " : "") + reservedWords.strict + this.reservedWordsStrict = keywordRegexp(reservedStrict) + this.reservedWordsStrictBind = keywordRegexp(reservedStrict + " " + reservedWords.strictBind) + this.input = String(input) + + // Used to signal to callers of `readWord1` whether the word + // contained any escape sequences. This is needed because words with + // escape sequences must not be interpreted as keywords. + this.containsEsc = false + + // Load plugins + this.loadPlugins(options.plugins) + + // Set up token state + + // The current position of the tokenizer in the input. + if (startPos) { + this.pos = startPos + this.lineStart = Math.max(0, this.input.lastIndexOf("\n", startPos)) + this.curLine = this.input.slice(0, this.lineStart).split(lineBreak).length + } else { + this.pos = this.lineStart = 0 + this.curLine = 1 + } + + // Properties of the current token: + // Its type + this.type = tt.eof + // For tokens that include more information than their type, the value + this.value = null + // Its start and end offset + this.start = this.end = this.pos + // And, if locations are used, the {line, column} object + // corresponding to those offsets + this.startLoc = this.endLoc = this.curPosition() + + // Position information for the previous token + this.lastTokEndLoc = this.lastTokStartLoc = null + this.lastTokStart = this.lastTokEnd = this.pos + + // The context stack is used to superficially track syntactic + // context to predict whether a regular expression is allowed in a + // given position. + this.context = this.initialContext() + this.exprAllowed = true + + // Figure out if it's a module code. + this.strict = this.inModule = options.sourceType === "module" + + // Used to signify the start of a potential arrow function + this.potentialArrowAt = -1 + + // Flags to track whether we are in a function, a generator. + this.inFunction = this.inGenerator = false + // Labels in scope. + this.labels = [] + + // If enabled, skip leading hashbang line. + if (this.pos === 0 && options.allowHashBang && this.input.slice(0, 2) === '#!') + this.skipLineComment(2) +}; + +// DEPRECATED Kept for backwards compatibility until 3.0 in case a plugin uses them +Parser.prototype.isKeyword = function isKeyword (word) { return this.keywords.test(word) }; +Parser.prototype.isReservedWord = function isReservedWord (word) { return this.reservedWords.test(word) }; + +Parser.prototype.extend = function extend (name, f) { + this[name] = f(this[name]) +}; + +Parser.prototype.loadPlugins = function loadPlugins (pluginConfigs) { + var this$1 = this; + + for (var name in pluginConfigs) { + var plugin = plugins[name] + if (!plugin) throw new Error("Plugin '" + name + "' not found") + plugin(this$1, pluginConfigs[name]) + } +}; + +Parser.prototype.parse = function parse () { + var node = this.options.program || this.startNode() + this.nextToken() + return this.parseTopLevel(node) +}; + +var pp = Parser.prototype + +// ## Parser utilities + +// Test whether a statement node is the string literal `"use strict"`. + +pp.isUseStrict = function(stmt) { + return this.options.ecmaVersion >= 5 && stmt.type === "ExpressionStatement" && + stmt.expression.type === "Literal" && + stmt.expression.raw.slice(1, -1) === "use strict" +} + +// Predicate that tests whether the next token is of the given +// type, and if yes, consumes it as a side effect. + +pp.eat = function(type) { + if (this.type === type) { + this.next() + return true + } else { + return false + } +} + +// Tests whether parsed token is a contextual keyword. + +pp.isContextual = function(name) { + return this.type === tt.name && this.value === name +} + +// Consumes contextual keyword if possible. + +pp.eatContextual = function(name) { + return this.value === name && this.eat(tt.name) +} + +// Asserts that following token is given contextual keyword. + +pp.expectContextual = function(name) { + if (!this.eatContextual(name)) this.unexpected() +} + +// Test whether a semicolon can be inserted at the current position. + +pp.canInsertSemicolon = function() { + return this.type === tt.eof || + this.type === tt.braceR || + lineBreak.test(this.input.slice(this.lastTokEnd, this.start)) +} + +pp.insertSemicolon = function() { + if (this.canInsertSemicolon()) { + if (this.options.onInsertedSemicolon) + this.options.onInsertedSemicolon(this.lastTokEnd, this.lastTokEndLoc) + return true + } +} + +// Consume a semicolon, or, failing that, see if we are allowed to +// pretend that there is a semicolon at this position. + +pp.semicolon = function() { + if (!this.eat(tt.semi) && !this.insertSemicolon()) this.unexpected() +} + +pp.afterTrailingComma = function(tokType) { + if (this.type == tokType) { + if (this.options.onTrailingComma) + this.options.onTrailingComma(this.lastTokStart, this.lastTokStartLoc) + this.next() + return true + } +} + +// Expect a token of a given type. If found, consume it, otherwise, +// raise an unexpected token error. + +pp.expect = function(type) { + this.eat(type) || this.unexpected() +} + +// Raise an unexpected token error. + +pp.unexpected = function(pos) { + this.raise(pos != null ? pos : this.start, "Unexpected token") +} + +var DestructuringErrors = function DestructuringErrors() { + this.shorthandAssign = 0 + this.trailingComma = 0 +}; + +pp.checkPatternErrors = function(refDestructuringErrors, andThrow) { + var trailing = refDestructuringErrors && refDestructuringErrors.trailingComma + if (!andThrow) return !!trailing + if (trailing) this.raise(trailing, "Comma is not permitted after the rest element") +} + +pp.checkExpressionErrors = function(refDestructuringErrors, andThrow) { + var pos = refDestructuringErrors && refDestructuringErrors.shorthandAssign + if (!andThrow) return !!pos + if (pos) this.raise(pos, "Shorthand property assignments are valid only in destructuring patterns") +} + +var pp$1 = Parser.prototype + +// ### Statement parsing + +// Parse a program. Initializes the parser, reads any number of +// statements, and wraps them in a Program node. Optionally takes a +// `program` argument. If present, the statements will be appended +// to its body instead of creating a new node. + +pp$1.parseTopLevel = function(node) { + var this$1 = this; + + var first = true + if (!node.body) node.body = [] + while (this.type !== tt.eof) { + var stmt = this$1.parseStatement(true, true) + node.body.push(stmt) + if (first) { + if (this$1.isUseStrict(stmt)) this$1.setStrict(true) + first = false + } + } + this.next() + if (this.options.ecmaVersion >= 6) { + node.sourceType = this.options.sourceType + } + return this.finishNode(node, "Program") +} + +var loopLabel = {kind: "loop"}; +var switchLabel = {kind: "switch"}; +pp$1.isLet = function() { + if (this.type !== tt.name || this.options.ecmaVersion < 6 || this.value != "let") return false + skipWhiteSpace.lastIndex = this.pos + var skip = skipWhiteSpace.exec(this.input) + var next = this.pos + skip[0].length, nextCh = this.input.charCodeAt(next) + if (nextCh === 91 || nextCh == 123) return true // '{' and '[' + if (isIdentifierStart(nextCh, true)) { + for (var pos = next + 1; isIdentifierChar(this.input.charCodeAt(pos), true); ++pos) {} + var ident = this.input.slice(next, pos) + if (!this.isKeyword(ident)) return true + } + return false +} + +// Parse a single statement. +// +// If expecting a statement and finding a slash operator, parse a +// regular expression literal. This is to handle cases like +// `if (foo) /blah/.exec(foo)`, where looking at the previous token +// does not help. + +pp$1.parseStatement = function(declaration, topLevel) { + var starttype = this.type, node = this.startNode(), kind + + if (this.isLet()) { + starttype = tt._var + kind = "let" + } + + // Most types of statements are recognized by the keyword they + // start with. Many are trivial to parse, some require a bit of + // complexity. + + switch (starttype) { + case tt._break: case tt._continue: return this.parseBreakContinueStatement(node, starttype.keyword) + case tt._debugger: return this.parseDebuggerStatement(node) + case tt._do: return this.parseDoStatement(node) + case tt._for: return this.parseForStatement(node) + case tt._function: + if (!declaration && this.options.ecmaVersion >= 6) this.unexpected() + return this.parseFunctionStatement(node) + case tt._class: + if (!declaration) this.unexpected() + return this.parseClass(node, true) + case tt._if: return this.parseIfStatement(node) + case tt._return: return this.parseReturnStatement(node) + case tt._switch: return this.parseSwitchStatement(node) + case tt._throw: return this.parseThrowStatement(node) + case tt._try: return this.parseTryStatement(node) + case tt._const: case tt._var: + kind = kind || this.value + if (!declaration && kind != "var") this.unexpected() + return this.parseVarStatement(node, kind) + case tt._while: return this.parseWhileStatement(node) + case tt._with: return this.parseWithStatement(node) + case tt.braceL: return this.parseBlock() + case tt.semi: return this.parseEmptyStatement(node) + case tt._export: + case tt._import: + if (!this.options.allowImportExportEverywhere) { + if (!topLevel) + this.raise(this.start, "'import' and 'export' may only appear at the top level") + if (!this.inModule) + this.raise(this.start, "'import' and 'export' may appear only with 'sourceType: module'") + } + return starttype === tt._import ? this.parseImport(node) : this.parseExport(node) + + // If the statement does not start with a statement keyword or a + // brace, it's an ExpressionStatement or LabeledStatement. We + // simply start parsing an expression, and afterwards, if the + // next token is a colon and the expression was a simple + // Identifier node, we switch to interpreting it as a label. + default: + var maybeName = this.value, expr = this.parseExpression() + if (starttype === tt.name && expr.type === "Identifier" && this.eat(tt.colon)) + return this.parseLabeledStatement(node, maybeName, expr) + else return this.parseExpressionStatement(node, expr) + } +} + +pp$1.parseBreakContinueStatement = function(node, keyword) { + var this$1 = this; + + var isBreak = keyword == "break" + this.next() + if (this.eat(tt.semi) || this.insertSemicolon()) node.label = null + else if (this.type !== tt.name) this.unexpected() + else { + node.label = this.parseIdent() + this.semicolon() + } + + // Verify that there is an actual destination to break or + // continue to. + for (var i = 0; i < this.labels.length; ++i) { + var lab = this$1.labels[i] + if (node.label == null || lab.name === node.label.name) { + if (lab.kind != null && (isBreak || lab.kind === "loop")) break + if (node.label && isBreak) break + } + } + if (i === this.labels.length) this.raise(node.start, "Unsyntactic " + keyword) + return this.finishNode(node, isBreak ? "BreakStatement" : "ContinueStatement") +} + +pp$1.parseDebuggerStatement = function(node) { + this.next() + this.semicolon() + return this.finishNode(node, "DebuggerStatement") +} + +pp$1.parseDoStatement = function(node) { + this.next() + this.labels.push(loopLabel) + node.body = this.parseStatement(false) + this.labels.pop() + this.expect(tt._while) + node.test = this.parseParenExpression() + if (this.options.ecmaVersion >= 6) + this.eat(tt.semi) + else + this.semicolon() + return this.finishNode(node, "DoWhileStatement") +} + +// Disambiguating between a `for` and a `for`/`in` or `for`/`of` +// loop is non-trivial. Basically, we have to parse the init `var` +// statement or expression, disallowing the `in` operator (see +// the second parameter to `parseExpression`), and then check +// whether the next token is `in` or `of`. When there is no init +// part (semicolon immediately after the opening parenthesis), it +// is a regular `for` loop. + +pp$1.parseForStatement = function(node) { + this.next() + this.labels.push(loopLabel) + this.expect(tt.parenL) + if (this.type === tt.semi) return this.parseFor(node, null) + var isLet = this.isLet() + if (this.type === tt._var || this.type === tt._const || isLet) { + var init$1 = this.startNode(), kind = isLet ? "let" : this.value + this.next() + this.parseVar(init$1, true, kind) + this.finishNode(init$1, "VariableDeclaration") + if ((this.type === tt._in || (this.options.ecmaVersion >= 6 && this.isContextual("of"))) && init$1.declarations.length === 1 && + !(kind !== "var" && init$1.declarations[0].init)) + return this.parseForIn(node, init$1) + return this.parseFor(node, init$1) + } + var refDestructuringErrors = new DestructuringErrors + var init = this.parseExpression(true, refDestructuringErrors) + if (this.type === tt._in || (this.options.ecmaVersion >= 6 && this.isContextual("of"))) { + this.checkPatternErrors(refDestructuringErrors, true) + this.toAssignable(init) + this.checkLVal(init) + return this.parseForIn(node, init) + } else { + this.checkExpressionErrors(refDestructuringErrors, true) + } + return this.parseFor(node, init) +} + +pp$1.parseFunctionStatement = function(node) { + this.next() + return this.parseFunction(node, true) +} + +pp$1.parseIfStatement = function(node) { + this.next() + node.test = this.parseParenExpression() + node.consequent = this.parseStatement(false) + node.alternate = this.eat(tt._else) ? this.parseStatement(false) : null + return this.finishNode(node, "IfStatement") +} + +pp$1.parseReturnStatement = function(node) { + if (!this.inFunction && !this.options.allowReturnOutsideFunction) + this.raise(this.start, "'return' outside of function") + this.next() + + // In `return` (and `break`/`continue`), the keywords with + // optional arguments, we eagerly look for a semicolon or the + // possibility to insert one. + + if (this.eat(tt.semi) || this.insertSemicolon()) node.argument = null + else { node.argument = this.parseExpression(); this.semicolon() } + return this.finishNode(node, "ReturnStatement") +} + +pp$1.parseSwitchStatement = function(node) { + var this$1 = this; + + this.next() + node.discriminant = this.parseParenExpression() + node.cases = [] + this.expect(tt.braceL) + this.labels.push(switchLabel) + + // Statements under must be grouped (by label) in SwitchCase + // nodes. `cur` is used to keep the node that we are currently + // adding statements to. + + for (var cur, sawDefault = false; this.type != tt.braceR;) { + if (this$1.type === tt._case || this$1.type === tt._default) { + var isCase = this$1.type === tt._case + if (cur) this$1.finishNode(cur, "SwitchCase") + node.cases.push(cur = this$1.startNode()) + cur.consequent = [] + this$1.next() + if (isCase) { + cur.test = this$1.parseExpression() + } else { + if (sawDefault) this$1.raiseRecoverable(this$1.lastTokStart, "Multiple default clauses") + sawDefault = true + cur.test = null + } + this$1.expect(tt.colon) + } else { + if (!cur) this$1.unexpected() + cur.consequent.push(this$1.parseStatement(true)) + } + } + if (cur) this.finishNode(cur, "SwitchCase") + this.next() // Closing brace + this.labels.pop() + return this.finishNode(node, "SwitchStatement") +} + +pp$1.parseThrowStatement = function(node) { + this.next() + if (lineBreak.test(this.input.slice(this.lastTokEnd, this.start))) + this.raise(this.lastTokEnd, "Illegal newline after throw") + node.argument = this.parseExpression() + this.semicolon() + return this.finishNode(node, "ThrowStatement") +} + +// Reused empty array added for node fields that are always empty. + +var empty = [] + +pp$1.parseTryStatement = function(node) { + this.next() + node.block = this.parseBlock() + node.handler = null + if (this.type === tt._catch) { + var clause = this.startNode() + this.next() + this.expect(tt.parenL) + clause.param = this.parseBindingAtom() + this.checkLVal(clause.param, true) + this.expect(tt.parenR) + clause.body = this.parseBlock() + node.handler = this.finishNode(clause, "CatchClause") + } + node.finalizer = this.eat(tt._finally) ? this.parseBlock() : null + if (!node.handler && !node.finalizer) + this.raise(node.start, "Missing catch or finally clause") + return this.finishNode(node, "TryStatement") +} + +pp$1.parseVarStatement = function(node, kind) { + this.next() + this.parseVar(node, false, kind) + this.semicolon() + return this.finishNode(node, "VariableDeclaration") +} + +pp$1.parseWhileStatement = function(node) { + this.next() + node.test = this.parseParenExpression() + this.labels.push(loopLabel) + node.body = this.parseStatement(false) + this.labels.pop() + return this.finishNode(node, "WhileStatement") +} + +pp$1.parseWithStatement = function(node) { + if (this.strict) this.raise(this.start, "'with' in strict mode") + this.next() + node.object = this.parseParenExpression() + node.body = this.parseStatement(false) + return this.finishNode(node, "WithStatement") +} + +pp$1.parseEmptyStatement = function(node) { + this.next() + return this.finishNode(node, "EmptyStatement") +} + +pp$1.parseLabeledStatement = function(node, maybeName, expr) { + var this$1 = this; + + for (var i = 0; i < this.labels.length; ++i) + if (this$1.labels[i].name === maybeName) this$1.raise(expr.start, "Label '" + maybeName + "' is already declared") + var kind = this.type.isLoop ? "loop" : this.type === tt._switch ? "switch" : null + for (var i$1 = this.labels.length - 1; i$1 >= 0; i$1--) { + var label = this$1.labels[i$1] + if (label.statementStart == node.start) { + label.statementStart = this$1.start + label.kind = kind + } else break + } + this.labels.push({name: maybeName, kind: kind, statementStart: this.start}) + node.body = this.parseStatement(true) + this.labels.pop() + node.label = expr + return this.finishNode(node, "LabeledStatement") +} + +pp$1.parseExpressionStatement = function(node, expr) { + node.expression = expr + this.semicolon() + return this.finishNode(node, "ExpressionStatement") +} + +// Parse a semicolon-enclosed block of statements, handling `"use +// strict"` declarations when `allowStrict` is true (used for +// function bodies). + +pp$1.parseBlock = function(allowStrict) { + var this$1 = this; + + var node = this.startNode(), first = true, oldStrict + node.body = [] + this.expect(tt.braceL) + while (!this.eat(tt.braceR)) { + var stmt = this$1.parseStatement(true) + node.body.push(stmt) + if (first && allowStrict && this$1.isUseStrict(stmt)) { + oldStrict = this$1.strict + this$1.setStrict(this$1.strict = true) + } + first = false + } + if (oldStrict === false) this.setStrict(false) + return this.finishNode(node, "BlockStatement") +} + +// Parse a regular `for` loop. The disambiguation code in +// `parseStatement` will already have parsed the init statement or +// expression. + +pp$1.parseFor = function(node, init) { + node.init = init + this.expect(tt.semi) + node.test = this.type === tt.semi ? null : this.parseExpression() + this.expect(tt.semi) + node.update = this.type === tt.parenR ? null : this.parseExpression() + this.expect(tt.parenR) + node.body = this.parseStatement(false) + this.labels.pop() + return this.finishNode(node, "ForStatement") +} + +// Parse a `for`/`in` and `for`/`of` loop, which are almost +// same from parser's perspective. + +pp$1.parseForIn = function(node, init) { + var type = this.type === tt._in ? "ForInStatement" : "ForOfStatement" + this.next() + node.left = init + node.right = this.parseExpression() + this.expect(tt.parenR) + node.body = this.parseStatement(false) + this.labels.pop() + return this.finishNode(node, type) +} + +// Parse a list of variable declarations. + +pp$1.parseVar = function(node, isFor, kind) { + var this$1 = this; + + node.declarations = [] + node.kind = kind + for (;;) { + var decl = this$1.startNode() + this$1.parseVarId(decl) + if (this$1.eat(tt.eq)) { + decl.init = this$1.parseMaybeAssign(isFor) + } else if (kind === "const" && !(this$1.type === tt._in || (this$1.options.ecmaVersion >= 6 && this$1.isContextual("of")))) { + this$1.unexpected() + } else if (decl.id.type != "Identifier" && !(isFor && (this$1.type === tt._in || this$1.isContextual("of")))) { + this$1.raise(this$1.lastTokEnd, "Complex binding patterns require an initialization value") + } else { + decl.init = null + } + node.declarations.push(this$1.finishNode(decl, "VariableDeclarator")) + if (!this$1.eat(tt.comma)) break + } + return node +} + +pp$1.parseVarId = function(decl) { + decl.id = this.parseBindingAtom() + this.checkLVal(decl.id, true) +} + +// Parse a function declaration or literal (depending on the +// `isStatement` parameter). + +pp$1.parseFunction = function(node, isStatement, allowExpressionBody) { + this.initFunction(node) + if (this.options.ecmaVersion >= 6) + node.generator = this.eat(tt.star) + var oldInGen = this.inGenerator + this.inGenerator = node.generator + if (isStatement || this.type === tt.name) + node.id = this.parseIdent() + this.parseFunctionParams(node) + this.parseFunctionBody(node, allowExpressionBody) + this.inGenerator = oldInGen + return this.finishNode(node, isStatement ? "FunctionDeclaration" : "FunctionExpression") +} + +pp$1.parseFunctionParams = function(node) { + this.expect(tt.parenL) + node.params = this.parseBindingList(tt.parenR, false, false, true) +} + +// Parse a class declaration or literal (depending on the +// `isStatement` parameter). + +pp$1.parseClass = function(node, isStatement) { + var this$1 = this; + + this.next() + this.parseClassId(node, isStatement) + this.parseClassSuper(node) + var classBody = this.startNode() + var hadConstructor = false + classBody.body = [] + this.expect(tt.braceL) + while (!this.eat(tt.braceR)) { + if (this$1.eat(tt.semi)) continue + var method = this$1.startNode() + var isGenerator = this$1.eat(tt.star) + var isMaybeStatic = this$1.type === tt.name && this$1.value === "static" + this$1.parsePropertyName(method) + method.static = isMaybeStatic && this$1.type !== tt.parenL + if (method.static) { + if (isGenerator) this$1.unexpected() + isGenerator = this$1.eat(tt.star) + this$1.parsePropertyName(method) + } + method.kind = "method" + var isGetSet = false + if (!method.computed) { + var key = method.key; + if (!isGenerator && key.type === "Identifier" && this$1.type !== tt.parenL && (key.name === "get" || key.name === "set")) { + isGetSet = true + method.kind = key.name + key = this$1.parsePropertyName(method) + } + if (!method.static && (key.type === "Identifier" && key.name === "constructor" || + key.type === "Literal" && key.value === "constructor")) { + if (hadConstructor) this$1.raise(key.start, "Duplicate constructor in the same class") + if (isGetSet) this$1.raise(key.start, "Constructor can't have get/set modifier") + if (isGenerator) this$1.raise(key.start, "Constructor can't be a generator") + method.kind = "constructor" + hadConstructor = true + } + } + this$1.parseClassMethod(classBody, method, isGenerator) + if (isGetSet) { + var paramCount = method.kind === "get" ? 0 : 1 + if (method.value.params.length !== paramCount) { + var start = method.value.start + if (method.kind === "get") + this$1.raiseRecoverable(start, "getter should have no params") + else + this$1.raiseRecoverable(start, "setter should have exactly one param") + } + if (method.kind === "set" && method.value.params[0].type === "RestElement") + this$1.raise(method.value.params[0].start, "Setter cannot use rest params") + } + } + node.body = this.finishNode(classBody, "ClassBody") + return this.finishNode(node, isStatement ? "ClassDeclaration" : "ClassExpression") +} + +pp$1.parseClassMethod = function(classBody, method, isGenerator) { + method.value = this.parseMethod(isGenerator) + classBody.body.push(this.finishNode(method, "MethodDefinition")) +} + +pp$1.parseClassId = function(node, isStatement) { + node.id = this.type === tt.name ? this.parseIdent() : isStatement ? this.unexpected() : null +} + +pp$1.parseClassSuper = function(node) { + node.superClass = this.eat(tt._extends) ? this.parseExprSubscripts() : null +} + +// Parses module export declaration. + +pp$1.parseExport = function(node) { + var this$1 = this; + + this.next() + // export * from '...' + if (this.eat(tt.star)) { + this.expectContextual("from") + node.source = this.type === tt.string ? this.parseExprAtom() : this.unexpected() + this.semicolon() + return this.finishNode(node, "ExportAllDeclaration") + } + if (this.eat(tt._default)) { // export default ... + var parens = this.type == tt.parenL + var expr = this.parseMaybeAssign() + var needsSemi = true + if (!parens && (expr.type == "FunctionExpression" || + expr.type == "ClassExpression")) { + needsSemi = false + if (expr.id) { + expr.type = expr.type == "FunctionExpression" + ? "FunctionDeclaration" + : "ClassDeclaration" + } + } + node.declaration = expr + if (needsSemi) this.semicolon() + return this.finishNode(node, "ExportDefaultDeclaration") + } + // export var|const|let|function|class ... + if (this.shouldParseExportStatement()) { + node.declaration = this.parseStatement(true) + node.specifiers = [] + node.source = null + } else { // export { x, y as z } [from '...'] + node.declaration = null + node.specifiers = this.parseExportSpecifiers() + if (this.eatContextual("from")) { + node.source = this.type === tt.string ? this.parseExprAtom() : this.unexpected() + } else { + // check for keywords used as local names + for (var i = 0; i < node.specifiers.length; i++) { + if (this$1.keywords.test(node.specifiers[i].local.name) || this$1.reservedWords.test(node.specifiers[i].local.name)) { + this$1.unexpected(node.specifiers[i].local.start) + } + } + + node.source = null + } + this.semicolon() + } + return this.finishNode(node, "ExportNamedDeclaration") +} + +pp$1.shouldParseExportStatement = function() { + return this.type.keyword || this.isLet() +} + +// Parses a comma-separated list of module exports. + +pp$1.parseExportSpecifiers = function() { + var this$1 = this; + + var nodes = [], first = true + // export { x, y as z } [from '...'] + this.expect(tt.braceL) + while (!this.eat(tt.braceR)) { + if (!first) { + this$1.expect(tt.comma) + if (this$1.afterTrailingComma(tt.braceR)) break + } else first = false + + var node = this$1.startNode() + node.local = this$1.parseIdent(this$1.type === tt._default) + node.exported = this$1.eatContextual("as") ? this$1.parseIdent(true) : node.local + nodes.push(this$1.finishNode(node, "ExportSpecifier")) + } + return nodes +} + +// Parses import declaration. + +pp$1.parseImport = function(node) { + this.next() + // import '...' + if (this.type === tt.string) { + node.specifiers = empty + node.source = this.parseExprAtom() + } else { + node.specifiers = this.parseImportSpecifiers() + this.expectContextual("from") + node.source = this.type === tt.string ? this.parseExprAtom() : this.unexpected() + } + this.semicolon() + return this.finishNode(node, "ImportDeclaration") +} + +// Parses a comma-separated list of module imports. + +pp$1.parseImportSpecifiers = function() { + var this$1 = this; + + var nodes = [], first = true + if (this.type === tt.name) { + // import defaultObj, { x, y as z } from '...' + var node = this.startNode() + node.local = this.parseIdent() + this.checkLVal(node.local, true) + nodes.push(this.finishNode(node, "ImportDefaultSpecifier")) + if (!this.eat(tt.comma)) return nodes + } + if (this.type === tt.star) { + var node$1 = this.startNode() + this.next() + this.expectContextual("as") + node$1.local = this.parseIdent() + this.checkLVal(node$1.local, true) + nodes.push(this.finishNode(node$1, "ImportNamespaceSpecifier")) + return nodes + } + this.expect(tt.braceL) + while (!this.eat(tt.braceR)) { + if (!first) { + this$1.expect(tt.comma) + if (this$1.afterTrailingComma(tt.braceR)) break + } else first = false + + var node$2 = this$1.startNode() + node$2.imported = this$1.parseIdent(true) + if (this$1.eatContextual("as")) { + node$2.local = this$1.parseIdent() + } else { + node$2.local = node$2.imported + if (this$1.isKeyword(node$2.local.name)) this$1.unexpected(node$2.local.start) + if (this$1.reservedWordsStrict.test(node$2.local.name)) this$1.raise(node$2.local.start, "The keyword '" + node$2.local.name + "' is reserved") + } + this$1.checkLVal(node$2.local, true) + nodes.push(this$1.finishNode(node$2, "ImportSpecifier")) + } + return nodes +} + +var pp$2 = Parser.prototype + +// Convert existing expression atom to assignable pattern +// if possible. + +pp$2.toAssignable = function(node, isBinding) { + var this$1 = this; + + if (this.options.ecmaVersion >= 6 && node) { + switch (node.type) { + case "Identifier": + case "ObjectPattern": + case "ArrayPattern": + break + + case "ObjectExpression": + node.type = "ObjectPattern" + for (var i = 0; i < node.properties.length; i++) { + var prop = node.properties[i] + if (prop.kind !== "init") this$1.raise(prop.key.start, "Object pattern can't contain getter or setter") + this$1.toAssignable(prop.value, isBinding) + } + break + + case "ArrayExpression": + node.type = "ArrayPattern" + this.toAssignableList(node.elements, isBinding) + break + + case "AssignmentExpression": + if (node.operator === "=") { + node.type = "AssignmentPattern" + delete node.operator + // falls through to AssignmentPattern + } else { + this.raise(node.left.end, "Only '=' operator can be used for specifying default value.") + break + } + + case "AssignmentPattern": + if (node.right.type === "YieldExpression") + this.raise(node.right.start, "Yield expression cannot be a default value") + break + + case "ParenthesizedExpression": + node.expression = this.toAssignable(node.expression, isBinding) + break + + case "MemberExpression": + if (!isBinding) break + + default: + this.raise(node.start, "Assigning to rvalue") + } + } + return node +} + +// Convert list of expression atoms to binding list. + +pp$2.toAssignableList = function(exprList, isBinding) { + var this$1 = this; + + var end = exprList.length + if (end) { + var last = exprList[end - 1] + if (last && last.type == "RestElement") { + --end + } else if (last && last.type == "SpreadElement") { + last.type = "RestElement" + var arg = last.argument + this.toAssignable(arg, isBinding) + if (arg.type !== "Identifier" && arg.type !== "MemberExpression" && arg.type !== "ArrayPattern") + this.unexpected(arg.start) + --end + } + + if (isBinding && last && last.type === "RestElement" && last.argument.type !== "Identifier") + this.unexpected(last.argument.start) + } + for (var i = 0; i < end; i++) { + var elt = exprList[i] + if (elt) this$1.toAssignable(elt, isBinding) + } + return exprList +} + +// Parses spread element. + +pp$2.parseSpread = function(refDestructuringErrors) { + var node = this.startNode() + this.next() + node.argument = this.parseMaybeAssign(false, refDestructuringErrors) + return this.finishNode(node, "SpreadElement") +} + +pp$2.parseRest = function(allowNonIdent) { + var node = this.startNode() + this.next() + + // RestElement inside of a function parameter must be an identifier + if (allowNonIdent) node.argument = this.type === tt.name ? this.parseIdent() : this.unexpected() + else node.argument = this.type === tt.name || this.type === tt.bracketL ? this.parseBindingAtom() : this.unexpected() + + return this.finishNode(node, "RestElement") +} + +// Parses lvalue (assignable) atom. + +pp$2.parseBindingAtom = function() { + if (this.options.ecmaVersion < 6) return this.parseIdent() + switch (this.type) { + case tt.name: + return this.parseIdent() + + case tt.bracketL: + var node = this.startNode() + this.next() + node.elements = this.parseBindingList(tt.bracketR, true, true) + return this.finishNode(node, "ArrayPattern") + + case tt.braceL: + return this.parseObj(true) + + default: + this.unexpected() + } +} + +pp$2.parseBindingList = function(close, allowEmpty, allowTrailingComma, allowNonIdent) { + var this$1 = this; + + var elts = [], first = true + while (!this.eat(close)) { + if (first) first = false + else this$1.expect(tt.comma) + if (allowEmpty && this$1.type === tt.comma) { + elts.push(null) + } else if (allowTrailingComma && this$1.afterTrailingComma(close)) { + break + } else if (this$1.type === tt.ellipsis) { + var rest = this$1.parseRest(allowNonIdent) + this$1.parseBindingListItem(rest) + elts.push(rest) + if (this$1.type === tt.comma) this$1.raise(this$1.start, "Comma is not permitted after the rest element") + this$1.expect(close) + break + } else { + var elem = this$1.parseMaybeDefault(this$1.start, this$1.startLoc) + this$1.parseBindingListItem(elem) + elts.push(elem) + } + } + return elts +} + +pp$2.parseBindingListItem = function(param) { + return param +} + +// Parses assignment pattern around given atom if possible. + +pp$2.parseMaybeDefault = function(startPos, startLoc, left) { + left = left || this.parseBindingAtom() + if (this.options.ecmaVersion < 6 || !this.eat(tt.eq)) return left + var node = this.startNodeAt(startPos, startLoc) + node.left = left + node.right = this.parseMaybeAssign() + return this.finishNode(node, "AssignmentPattern") +} + +// Verify that a node is an lval — something that can be assigned +// to. + +pp$2.checkLVal = function(expr, isBinding, checkClashes) { + var this$1 = this; + + switch (expr.type) { + case "Identifier": + if (this.strict && this.reservedWordsStrictBind.test(expr.name)) + this.raiseRecoverable(expr.start, (isBinding ? "Binding " : "Assigning to ") + expr.name + " in strict mode") + if (checkClashes) { + if (has(checkClashes, expr.name)) + this.raiseRecoverable(expr.start, "Argument name clash") + checkClashes[expr.name] = true + } + break + + case "MemberExpression": + if (isBinding) this.raiseRecoverable(expr.start, (isBinding ? "Binding" : "Assigning to") + " member expression") + break + + case "ObjectPattern": + for (var i = 0; i < expr.properties.length; i++) + this$1.checkLVal(expr.properties[i].value, isBinding, checkClashes) + break + + case "ArrayPattern": + for (var i$1 = 0; i$1 < expr.elements.length; i$1++) { + var elem = expr.elements[i$1] + if (elem) this$1.checkLVal(elem, isBinding, checkClashes) + } + break + + case "AssignmentPattern": + this.checkLVal(expr.left, isBinding, checkClashes) + break + + case "RestElement": + this.checkLVal(expr.argument, isBinding, checkClashes) + break + + case "ParenthesizedExpression": + this.checkLVal(expr.expression, isBinding, checkClashes) + break + + default: + this.raise(expr.start, (isBinding ? "Binding" : "Assigning to") + " rvalue") + } +} + +var pp$3 = Parser.prototype + +// Check if property name clashes with already added. +// Object/class getters and setters are not allowed to clash — +// either with each other or with an init property — and in +// strict mode, init properties are also not allowed to be repeated. + +pp$3.checkPropClash = function(prop, propHash) { + if (this.options.ecmaVersion >= 6 && (prop.computed || prop.method || prop.shorthand)) + return + var key = prop.key; + var name + switch (key.type) { + case "Identifier": name = key.name; break + case "Literal": name = String(key.value); break + default: return + } + var kind = prop.kind; + if (this.options.ecmaVersion >= 6) { + if (name === "__proto__" && kind === "init") { + if (propHash.proto) this.raiseRecoverable(key.start, "Redefinition of __proto__ property") + propHash.proto = true + } + return + } + name = "$" + name + var other = propHash[name] + if (other) { + var isGetSet = kind !== "init" + if ((this.strict || isGetSet) && other[kind] || !(isGetSet ^ other.init)) + this.raiseRecoverable(key.start, "Redefinition of property") + } else { + other = propHash[name] = { + init: false, + get: false, + set: false + } + } + other[kind] = true +} + +// ### Expression parsing + +// These nest, from the most general expression type at the top to +// 'atomic', nondivisible expression types at the bottom. Most of +// the functions will simply let the function(s) below them parse, +// and, *if* the syntactic construct they handle is present, wrap +// the AST node that the inner parser gave them in another node. + +// Parse a full expression. The optional arguments are used to +// forbid the `in` operator (in for loops initalization expressions) +// and provide reference for storing '=' operator inside shorthand +// property assignment in contexts where both object expression +// and object pattern might appear (so it's possible to raise +// delayed syntax error at correct position). + +pp$3.parseExpression = function(noIn, refDestructuringErrors) { + var this$1 = this; + + var startPos = this.start, startLoc = this.startLoc + var expr = this.parseMaybeAssign(noIn, refDestructuringErrors) + if (this.type === tt.comma) { + var node = this.startNodeAt(startPos, startLoc) + node.expressions = [expr] + while (this.eat(tt.comma)) node.expressions.push(this$1.parseMaybeAssign(noIn, refDestructuringErrors)) + return this.finishNode(node, "SequenceExpression") + } + return expr +} + +// Parse an assignment expression. This includes applications of +// operators like `+=`. + +pp$3.parseMaybeAssign = function(noIn, refDestructuringErrors, afterLeftParse) { + if (this.inGenerator && this.isContextual("yield")) return this.parseYield() + + var ownDestructuringErrors = false + if (!refDestructuringErrors) { + refDestructuringErrors = new DestructuringErrors + ownDestructuringErrors = true + } + var startPos = this.start, startLoc = this.startLoc + if (this.type == tt.parenL || this.type == tt.name) + this.potentialArrowAt = this.start + var left = this.parseMaybeConditional(noIn, refDestructuringErrors) + if (afterLeftParse) left = afterLeftParse.call(this, left, startPos, startLoc) + if (this.type.isAssign) { + this.checkPatternErrors(refDestructuringErrors, true) + if (!ownDestructuringErrors) DestructuringErrors.call(refDestructuringErrors) + var node = this.startNodeAt(startPos, startLoc) + node.operator = this.value + node.left = this.type === tt.eq ? this.toAssignable(left) : left + refDestructuringErrors.shorthandAssign = 0 // reset because shorthand default was used correctly + this.checkLVal(left) + this.next() + node.right = this.parseMaybeAssign(noIn) + return this.finishNode(node, "AssignmentExpression") + } else { + if (ownDestructuringErrors) this.checkExpressionErrors(refDestructuringErrors, true) + } + return left +} + +// Parse a ternary conditional (`?:`) operator. + +pp$3.parseMaybeConditional = function(noIn, refDestructuringErrors) { + var startPos = this.start, startLoc = this.startLoc + var expr = this.parseExprOps(noIn, refDestructuringErrors) + if (this.checkExpressionErrors(refDestructuringErrors)) return expr + if (this.eat(tt.question)) { + var node = this.startNodeAt(startPos, startLoc) + node.test = expr + node.consequent = this.parseMaybeAssign() + this.expect(tt.colon) + node.alternate = this.parseMaybeAssign(noIn) + return this.finishNode(node, "ConditionalExpression") + } + return expr +} + +// Start the precedence parser. + +pp$3.parseExprOps = function(noIn, refDestructuringErrors) { + var startPos = this.start, startLoc = this.startLoc + var expr = this.parseMaybeUnary(refDestructuringErrors, false) + if (this.checkExpressionErrors(refDestructuringErrors)) return expr + return this.parseExprOp(expr, startPos, startLoc, -1, noIn) +} + +// Parse binary operators with the operator precedence parsing +// algorithm. `left` is the left-hand side of the operator. +// `minPrec` provides context that allows the function to stop and +// defer further parser to one of its callers when it encounters an +// operator that has a lower precedence than the set it is parsing. + +pp$3.parseExprOp = function(left, leftStartPos, leftStartLoc, minPrec, noIn) { + var prec = this.type.binop + if (prec != null && (!noIn || this.type !== tt._in)) { + if (prec > minPrec) { + var logical = this.type === tt.logicalOR || this.type === tt.logicalAND + var op = this.value + this.next() + var startPos = this.start, startLoc = this.startLoc + var right = this.parseExprOp(this.parseMaybeUnary(null, false), startPos, startLoc, prec, noIn) + var node = this.buildBinary(leftStartPos, leftStartLoc, left, right, op, logical) + return this.parseExprOp(node, leftStartPos, leftStartLoc, minPrec, noIn) + } + } + return left +} + +pp$3.buildBinary = function(startPos, startLoc, left, right, op, logical) { + var node = this.startNodeAt(startPos, startLoc) + node.left = left + node.operator = op + node.right = right + return this.finishNode(node, logical ? "LogicalExpression" : "BinaryExpression") +} + +// Parse unary operators, both prefix and postfix. + +pp$3.parseMaybeUnary = function(refDestructuringErrors, sawUnary) { + var this$1 = this; + + var startPos = this.start, startLoc = this.startLoc, expr + if (this.type.prefix) { + var node = this.startNode(), update = this.type === tt.incDec + node.operator = this.value + node.prefix = true + this.next() + node.argument = this.parseMaybeUnary(null, true) + this.checkExpressionErrors(refDestructuringErrors, true) + if (update) this.checkLVal(node.argument) + else if (this.strict && node.operator === "delete" && + node.argument.type === "Identifier") + this.raiseRecoverable(node.start, "Deleting local variable in strict mode") + else sawUnary = true + expr = this.finishNode(node, update ? "UpdateExpression" : "UnaryExpression") + } else { + expr = this.parseExprSubscripts(refDestructuringErrors) + if (this.checkExpressionErrors(refDestructuringErrors)) return expr + while (this.type.postfix && !this.canInsertSemicolon()) { + var node$1 = this$1.startNodeAt(startPos, startLoc) + node$1.operator = this$1.value + node$1.prefix = false + node$1.argument = expr + this$1.checkLVal(expr) + this$1.next() + expr = this$1.finishNode(node$1, "UpdateExpression") + } + } + + if (!sawUnary && this.eat(tt.starstar)) + return this.buildBinary(startPos, startLoc, expr, this.parseMaybeUnary(null, false), "**", false) + else + return expr +} + +// Parse call, dot, and `[]`-subscript expressions. + +pp$3.parseExprSubscripts = function(refDestructuringErrors) { + var startPos = this.start, startLoc = this.startLoc + var expr = this.parseExprAtom(refDestructuringErrors) + var skipArrowSubscripts = expr.type === "ArrowFunctionExpression" && this.input.slice(this.lastTokStart, this.lastTokEnd) !== ")" + if (this.checkExpressionErrors(refDestructuringErrors) || skipArrowSubscripts) return expr + return this.parseSubscripts(expr, startPos, startLoc) +} + +pp$3.parseSubscripts = function(base, startPos, startLoc, noCalls) { + var this$1 = this; + + for (;;) { + if (this$1.eat(tt.dot)) { + var node = this$1.startNodeAt(startPos, startLoc) + node.object = base + node.property = this$1.parseIdent(true) + node.computed = false + base = this$1.finishNode(node, "MemberExpression") + } else if (this$1.eat(tt.bracketL)) { + var node$1 = this$1.startNodeAt(startPos, startLoc) + node$1.object = base + node$1.property = this$1.parseExpression() + node$1.computed = true + this$1.expect(tt.bracketR) + base = this$1.finishNode(node$1, "MemberExpression") + } else if (!noCalls && this$1.eat(tt.parenL)) { + var node$2 = this$1.startNodeAt(startPos, startLoc) + node$2.callee = base + node$2.arguments = this$1.parseExprList(tt.parenR, false) + base = this$1.finishNode(node$2, "CallExpression") + } else if (this$1.type === tt.backQuote) { + var node$3 = this$1.startNodeAt(startPos, startLoc) + node$3.tag = base + node$3.quasi = this$1.parseTemplate() + base = this$1.finishNode(node$3, "TaggedTemplateExpression") + } else { + return base + } + } +} + +// Parse an atomic expression — either a single token that is an +// expression, an expression started by a keyword like `function` or +// `new`, or an expression wrapped in punctuation like `()`, `[]`, +// or `{}`. + +pp$3.parseExprAtom = function(refDestructuringErrors) { + var node, canBeArrow = this.potentialArrowAt == this.start + switch (this.type) { + case tt._super: + if (!this.inFunction) + this.raise(this.start, "'super' outside of function or class") + + case tt._this: + var type = this.type === tt._this ? "ThisExpression" : "Super" + node = this.startNode() + this.next() + return this.finishNode(node, type) + + case tt.name: + var startPos = this.start, startLoc = this.startLoc + var id = this.parseIdent(this.type !== tt.name) + if (canBeArrow && !this.canInsertSemicolon() && this.eat(tt.arrow)) + return this.parseArrowExpression(this.startNodeAt(startPos, startLoc), [id]) + return id + + case tt.regexp: + var value = this.value + node = this.parseLiteral(value.value) + node.regex = {pattern: value.pattern, flags: value.flags} + return node + + case tt.num: case tt.string: + return this.parseLiteral(this.value) + + case tt._null: case tt._true: case tt._false: + node = this.startNode() + node.value = this.type === tt._null ? null : this.type === tt._true + node.raw = this.type.keyword + this.next() + return this.finishNode(node, "Literal") + + case tt.parenL: + return this.parseParenAndDistinguishExpression(canBeArrow) + + case tt.bracketL: + node = this.startNode() + this.next() + node.elements = this.parseExprList(tt.bracketR, true, true, refDestructuringErrors) + return this.finishNode(node, "ArrayExpression") + + case tt.braceL: + return this.parseObj(false, refDestructuringErrors) + + case tt._function: + node = this.startNode() + this.next() + return this.parseFunction(node, false) + + case tt._class: + return this.parseClass(this.startNode(), false) + + case tt._new: + return this.parseNew() + + case tt.backQuote: + return this.parseTemplate() + + default: + this.unexpected() + } +} + +pp$3.parseLiteral = function(value) { + var node = this.startNode() + node.value = value + node.raw = this.input.slice(this.start, this.end) + this.next() + return this.finishNode(node, "Literal") +} + +pp$3.parseParenExpression = function() { + this.expect(tt.parenL) + var val = this.parseExpression() + this.expect(tt.parenR) + return val +} + +pp$3.parseParenAndDistinguishExpression = function(canBeArrow) { + var this$1 = this; + + var startPos = this.start, startLoc = this.startLoc, val + if (this.options.ecmaVersion >= 6) { + this.next() + + var innerStartPos = this.start, innerStartLoc = this.startLoc + var exprList = [], first = true + var refDestructuringErrors = new DestructuringErrors, spreadStart, innerParenStart + while (this.type !== tt.parenR) { + first ? first = false : this$1.expect(tt.comma) + if (this$1.type === tt.ellipsis) { + spreadStart = this$1.start + exprList.push(this$1.parseParenItem(this$1.parseRest())) + break + } else { + if (this$1.type === tt.parenL && !innerParenStart) { + innerParenStart = this$1.start + } + exprList.push(this$1.parseMaybeAssign(false, refDestructuringErrors, this$1.parseParenItem)) + } + } + var innerEndPos = this.start, innerEndLoc = this.startLoc + this.expect(tt.parenR) + + if (canBeArrow && !this.canInsertSemicolon() && this.eat(tt.arrow)) { + this.checkPatternErrors(refDestructuringErrors, true) + if (innerParenStart) this.unexpected(innerParenStart) + return this.parseParenArrowList(startPos, startLoc, exprList) + } + + if (!exprList.length) this.unexpected(this.lastTokStart) + if (spreadStart) this.unexpected(spreadStart) + this.checkExpressionErrors(refDestructuringErrors, true) + + if (exprList.length > 1) { + val = this.startNodeAt(innerStartPos, innerStartLoc) + val.expressions = exprList + this.finishNodeAt(val, "SequenceExpression", innerEndPos, innerEndLoc) + } else { + val = exprList[0] + } + } else { + val = this.parseParenExpression() + } + + if (this.options.preserveParens) { + var par = this.startNodeAt(startPos, startLoc) + par.expression = val + return this.finishNode(par, "ParenthesizedExpression") + } else { + return val + } +} + +pp$3.parseParenItem = function(item) { + return item +} + +pp$3.parseParenArrowList = function(startPos, startLoc, exprList) { + return this.parseArrowExpression(this.startNodeAt(startPos, startLoc), exprList) +} + +// New's precedence is slightly tricky. It must allow its argument to +// be a `[]` or dot subscript expression, but not a call — at least, +// not without wrapping it in parentheses. Thus, it uses the noCalls +// argument to parseSubscripts to prevent it from consuming the +// argument list. + +var empty$1 = [] + +pp$3.parseNew = function() { + var node = this.startNode() + var meta = this.parseIdent(true) + if (this.options.ecmaVersion >= 6 && this.eat(tt.dot)) { + node.meta = meta + node.property = this.parseIdent(true) + if (node.property.name !== "target") + this.raiseRecoverable(node.property.start, "The only valid meta property for new is new.target") + if (!this.inFunction) + this.raiseRecoverable(node.start, "new.target can only be used in functions") + return this.finishNode(node, "MetaProperty") + } + var startPos = this.start, startLoc = this.startLoc + node.callee = this.parseSubscripts(this.parseExprAtom(), startPos, startLoc, true) + if (this.eat(tt.parenL)) node.arguments = this.parseExprList(tt.parenR, false) + else node.arguments = empty$1 + return this.finishNode(node, "NewExpression") +} + +// Parse template expression. + +pp$3.parseTemplateElement = function() { + var elem = this.startNode() + elem.value = { + raw: this.input.slice(this.start, this.end).replace(/\r\n?/g, '\n'), + cooked: this.value + } + this.next() + elem.tail = this.type === tt.backQuote + return this.finishNode(elem, "TemplateElement") +} + +pp$3.parseTemplate = function() { + var this$1 = this; + + var node = this.startNode() + this.next() + node.expressions = [] + var curElt = this.parseTemplateElement() + node.quasis = [curElt] + while (!curElt.tail) { + this$1.expect(tt.dollarBraceL) + node.expressions.push(this$1.parseExpression()) + this$1.expect(tt.braceR) + node.quasis.push(curElt = this$1.parseTemplateElement()) + } + this.next() + return this.finishNode(node, "TemplateLiteral") +} + +// Parse an object literal or binding pattern. + +pp$3.parseObj = function(isPattern, refDestructuringErrors) { + var this$1 = this; + + var node = this.startNode(), first = true, propHash = {} + node.properties = [] + this.next() + while (!this.eat(tt.braceR)) { + if (!first) { + this$1.expect(tt.comma) + if (this$1.afterTrailingComma(tt.braceR)) break + } else first = false + + var prop = this$1.startNode(), isGenerator, startPos, startLoc + if (this$1.options.ecmaVersion >= 6) { + prop.method = false + prop.shorthand = false + if (isPattern || refDestructuringErrors) { + startPos = this$1.start + startLoc = this$1.startLoc + } + if (!isPattern) + isGenerator = this$1.eat(tt.star) + } + this$1.parsePropertyName(prop) + this$1.parsePropertyValue(prop, isPattern, isGenerator, startPos, startLoc, refDestructuringErrors) + this$1.checkPropClash(prop, propHash) + node.properties.push(this$1.finishNode(prop, "Property")) + } + return this.finishNode(node, isPattern ? "ObjectPattern" : "ObjectExpression") +} + +pp$3.parsePropertyValue = function(prop, isPattern, isGenerator, startPos, startLoc, refDestructuringErrors) { + if (this.eat(tt.colon)) { + prop.value = isPattern ? this.parseMaybeDefault(this.start, this.startLoc) : this.parseMaybeAssign(false, refDestructuringErrors) + prop.kind = "init" + } else if (this.options.ecmaVersion >= 6 && this.type === tt.parenL) { + if (isPattern) this.unexpected() + prop.kind = "init" + prop.method = true + prop.value = this.parseMethod(isGenerator) + } else if (this.options.ecmaVersion >= 5 && !prop.computed && prop.key.type === "Identifier" && + (prop.key.name === "get" || prop.key.name === "set") && + (this.type != tt.comma && this.type != tt.braceR)) { + if (isGenerator || isPattern) this.unexpected() + prop.kind = prop.key.name + this.parsePropertyName(prop) + prop.value = this.parseMethod(false) + var paramCount = prop.kind === "get" ? 0 : 1 + if (prop.value.params.length !== paramCount) { + var start = prop.value.start + if (prop.kind === "get") + this.raiseRecoverable(start, "getter should have no params") + else + this.raiseRecoverable(start, "setter should have exactly one param") + } + if (prop.kind === "set" && prop.value.params[0].type === "RestElement") + this.raiseRecoverable(prop.value.params[0].start, "Setter cannot use rest params") + } else if (this.options.ecmaVersion >= 6 && !prop.computed && prop.key.type === "Identifier") { + if (this.keywords.test(prop.key.name) || + (this.strict ? this.reservedWordsStrictBind : this.reservedWords).test(prop.key.name) || + (this.inGenerator && prop.key.name == "yield")) + this.raiseRecoverable(prop.key.start, "'" + prop.key.name + "' can not be used as shorthand property") + prop.kind = "init" + if (isPattern) { + prop.value = this.parseMaybeDefault(startPos, startLoc, prop.key) + } else if (this.type === tt.eq && refDestructuringErrors) { + if (!refDestructuringErrors.shorthandAssign) + refDestructuringErrors.shorthandAssign = this.start + prop.value = this.parseMaybeDefault(startPos, startLoc, prop.key) + } else { + prop.value = prop.key + } + prop.shorthand = true + } else this.unexpected() +} + +pp$3.parsePropertyName = function(prop) { + if (this.options.ecmaVersion >= 6) { + if (this.eat(tt.bracketL)) { + prop.computed = true + prop.key = this.parseMaybeAssign() + this.expect(tt.bracketR) + return prop.key + } else { + prop.computed = false + } + } + return prop.key = this.type === tt.num || this.type === tt.string ? this.parseExprAtom() : this.parseIdent(true) +} + +// Initialize empty function node. + +pp$3.initFunction = function(node) { + node.id = null + if (this.options.ecmaVersion >= 6) { + node.generator = false + node.expression = false + } +} + +// Parse object or class method. + +pp$3.parseMethod = function(isGenerator) { + var node = this.startNode(), oldInGen = this.inGenerator + this.inGenerator = isGenerator + this.initFunction(node) + this.expect(tt.parenL) + node.params = this.parseBindingList(tt.parenR, false, false) + if (this.options.ecmaVersion >= 6) + node.generator = isGenerator + this.parseFunctionBody(node, false) + this.inGenerator = oldInGen + return this.finishNode(node, "FunctionExpression") +} + +// Parse arrow function expression with given parameters. + +pp$3.parseArrowExpression = function(node, params) { + var oldInGen = this.inGenerator + this.inGenerator = false + this.initFunction(node) + node.params = this.toAssignableList(params, true) + this.parseFunctionBody(node, true) + this.inGenerator = oldInGen + return this.finishNode(node, "ArrowFunctionExpression") +} + +// Parse function body and check parameters. + +pp$3.parseFunctionBody = function(node, isArrowFunction) { + var isExpression = isArrowFunction && this.type !== tt.braceL + + if (isExpression) { + node.body = this.parseMaybeAssign() + node.expression = true + } else { + // Start a new scope with regard to labels and the `inFunction` + // flag (restore them to their old value afterwards). + var oldInFunc = this.inFunction, oldLabels = this.labels + this.inFunction = true; this.labels = [] + node.body = this.parseBlock(true) + node.expression = false + this.inFunction = oldInFunc; this.labels = oldLabels + } + + // If this is a strict mode function, verify that argument names + // are not repeated, and it does not try to bind the words `eval` + // or `arguments`. + var useStrict = (!isExpression && node.body.body.length && this.isUseStrict(node.body.body[0])) ? node.body.body[0] : null; + if (this.strict || useStrict) { + var oldStrict = this.strict + this.strict = true + if (node.id) + this.checkLVal(node.id, true) + this.checkParams(node, useStrict) + this.strict = oldStrict + } else if (isArrowFunction) { + this.checkParams(node, useStrict) + } +} + +// Checks function params for various disallowed patterns such as using "eval" +// or "arguments" and duplicate parameters. + +pp$3.checkParams = function(node, useStrict) { + var this$1 = this; + + var nameHash = {} + for (var i = 0; i < node.params.length; i++) { + if (useStrict && this$1.options.ecmaVersion >= 7 && node.params[i].type !== "Identifier") + this$1.raiseRecoverable(useStrict.start, "Illegal 'use strict' directive in function with non-simple parameter list"); + this$1.checkLVal(node.params[i], true, nameHash) + } +} + +// Parses a comma-separated list of expressions, and returns them as +// an array. `close` is the token type that ends the list, and +// `allowEmpty` can be turned on to allow subsequent commas with +// nothing in between them to be parsed as `null` (which is needed +// for array literals). + +pp$3.parseExprList = function(close, allowTrailingComma, allowEmpty, refDestructuringErrors) { + var this$1 = this; + + var elts = [], first = true + while (!this.eat(close)) { + if (!first) { + this$1.expect(tt.comma) + if (allowTrailingComma && this$1.afterTrailingComma(close)) break + } else first = false + + var elt + if (allowEmpty && this$1.type === tt.comma) + elt = null + else if (this$1.type === tt.ellipsis) { + elt = this$1.parseSpread(refDestructuringErrors) + if (this$1.type === tt.comma && refDestructuringErrors && !refDestructuringErrors.trailingComma) { + refDestructuringErrors.trailingComma = this$1.lastTokStart + } + } else + elt = this$1.parseMaybeAssign(false, refDestructuringErrors) + elts.push(elt) + } + return elts +} + +// Parse the next token as an identifier. If `liberal` is true (used +// when parsing properties), it will also convert keywords into +// identifiers. + +pp$3.parseIdent = function(liberal) { + var node = this.startNode() + if (liberal && this.options.allowReserved == "never") liberal = false + if (this.type === tt.name) { + if (!liberal && (this.strict ? this.reservedWordsStrict : this.reservedWords).test(this.value) && + (this.options.ecmaVersion >= 6 || + this.input.slice(this.start, this.end).indexOf("\\") == -1)) + this.raiseRecoverable(this.start, "The keyword '" + this.value + "' is reserved") + if (!liberal && this.inGenerator && this.value === "yield") + this.raiseRecoverable(this.start, "Can not use 'yield' as identifier inside a generator") + node.name = this.value + } else if (liberal && this.type.keyword) { + node.name = this.type.keyword + } else { + this.unexpected() + } + this.next() + return this.finishNode(node, "Identifier") +} + +// Parses yield expression inside generator. + +pp$3.parseYield = function() { + var node = this.startNode() + this.next() + if (this.type == tt.semi || this.canInsertSemicolon() || (this.type != tt.star && !this.type.startsExpr)) { + node.delegate = false + node.argument = null + } else { + node.delegate = this.eat(tt.star) + node.argument = this.parseMaybeAssign() + } + return this.finishNode(node, "YieldExpression") +} + +var pp$4 = Parser.prototype + +// This function is used to raise exceptions on parse errors. It +// takes an offset integer (into the current `input`) to indicate +// the location of the error, attaches the position to the end +// of the error message, and then raises a `SyntaxError` with that +// message. + +pp$4.raise = function(pos, message) { + var loc = getLineInfo(this.input, pos) + message += " (" + loc.line + ":" + loc.column + ")" + var err = new SyntaxError(message) + err.pos = pos; err.loc = loc; err.raisedAt = this.pos + throw err +} + +pp$4.raiseRecoverable = pp$4.raise + +pp$4.curPosition = function() { + if (this.options.locations) { + return new Position(this.curLine, this.pos - this.lineStart) + } +} + +var Node = function Node(parser, pos, loc) { + this.type = "" + this.start = pos + this.end = 0 + if (parser.options.locations) + this.loc = new SourceLocation(parser, loc) + if (parser.options.directSourceFile) + this.sourceFile = parser.options.directSourceFile + if (parser.options.ranges) + this.range = [pos, 0] +}; + +// Start an AST node, attaching a start offset. + +var pp$5 = Parser.prototype + +pp$5.startNode = function() { + return new Node(this, this.start, this.startLoc) +} + +pp$5.startNodeAt = function(pos, loc) { + return new Node(this, pos, loc) +} + +// Finish an AST node, adding `type` and `end` properties. + +function finishNodeAt(node, type, pos, loc) { + node.type = type + node.end = pos + if (this.options.locations) + node.loc.end = loc + if (this.options.ranges) + node.range[1] = pos + return node +} + +pp$5.finishNode = function(node, type) { + return finishNodeAt.call(this, node, type, this.lastTokEnd, this.lastTokEndLoc) +} + +// Finish node at given position + +pp$5.finishNodeAt = function(node, type, pos, loc) { + return finishNodeAt.call(this, node, type, pos, loc) +} + +var TokContext = function TokContext(token, isExpr, preserveSpace, override) { + this.token = token + this.isExpr = !!isExpr + this.preserveSpace = !!preserveSpace + this.override = override +}; + +var types = { + b_stat: new TokContext("{", false), + b_expr: new TokContext("{", true), + b_tmpl: new TokContext("${", true), + p_stat: new TokContext("(", false), + p_expr: new TokContext("(", true), + q_tmpl: new TokContext("`", true, true, function (p) { return p.readTmplToken(); }), + f_expr: new TokContext("function", true) +} + +var pp$6 = Parser.prototype + +pp$6.initialContext = function() { + return [types.b_stat] +} + +pp$6.braceIsBlock = function(prevType) { + if (prevType === tt.colon) { + var parent = this.curContext() + if (parent === types.b_stat || parent === types.b_expr) + return !parent.isExpr + } + if (prevType === tt._return) + return lineBreak.test(this.input.slice(this.lastTokEnd, this.start)) + if (prevType === tt._else || prevType === tt.semi || prevType === tt.eof || prevType === tt.parenR) + return true + if (prevType == tt.braceL) + return this.curContext() === types.b_stat + return !this.exprAllowed +} + +pp$6.updateContext = function(prevType) { + var update, type = this.type + if (type.keyword && prevType == tt.dot) + this.exprAllowed = false + else if (update = type.updateContext) + update.call(this, prevType) + else + this.exprAllowed = type.beforeExpr +} + +// Token-specific context update code + +tt.parenR.updateContext = tt.braceR.updateContext = function() { + if (this.context.length == 1) { + this.exprAllowed = true + return + } + var out = this.context.pop() + if (out === types.b_stat && this.curContext() === types.f_expr) { + this.context.pop() + this.exprAllowed = false + } else if (out === types.b_tmpl) { + this.exprAllowed = true + } else { + this.exprAllowed = !out.isExpr + } +} + +tt.braceL.updateContext = function(prevType) { + this.context.push(this.braceIsBlock(prevType) ? types.b_stat : types.b_expr) + this.exprAllowed = true +} + +tt.dollarBraceL.updateContext = function() { + this.context.push(types.b_tmpl) + this.exprAllowed = true +} + +tt.parenL.updateContext = function(prevType) { + var statementParens = prevType === tt._if || prevType === tt._for || prevType === tt._with || prevType === tt._while + this.context.push(statementParens ? types.p_stat : types.p_expr) + this.exprAllowed = true +} + +tt.incDec.updateContext = function() { + // tokExprAllowed stays unchanged +} + +tt._function.updateContext = function(prevType) { + if (prevType.beforeExpr && prevType !== tt.semi && prevType !== tt._else && + !((prevType === tt.colon || prevType === tt.braceL) && this.curContext() === types.b_stat)) + this.context.push(types.f_expr) + this.exprAllowed = false +} + +tt.backQuote.updateContext = function() { + if (this.curContext() === types.q_tmpl) + this.context.pop() + else + this.context.push(types.q_tmpl) + this.exprAllowed = false +} + +// Object type used to represent tokens. Note that normally, tokens +// simply exist as properties on the parser object. This is only +// used for the onToken callback and the external tokenizer. + +var Token = function Token(p) { + this.type = p.type + this.value = p.value + this.start = p.start + this.end = p.end + if (p.options.locations) + this.loc = new SourceLocation(p, p.startLoc, p.endLoc) + if (p.options.ranges) + this.range = [p.start, p.end] +}; + +// ## Tokenizer + +var pp$7 = Parser.prototype + +// Are we running under Rhino? +var isRhino = typeof Packages == "object" && Object.prototype.toString.call(Packages) == "[object JavaPackage]" + +// Move to the next token + +pp$7.next = function() { + if (this.options.onToken) + this.options.onToken(new Token(this)) + + this.lastTokEnd = this.end + this.lastTokStart = this.start + this.lastTokEndLoc = this.endLoc + this.lastTokStartLoc = this.startLoc + this.nextToken() +} + +pp$7.getToken = function() { + this.next() + return new Token(this) +} + +// If we're in an ES6 environment, make parsers iterable +if (typeof Symbol !== "undefined") + pp$7[Symbol.iterator] = function () { + var self = this + return {next: function () { + var token = self.getToken() + return { + done: token.type === tt.eof, + value: token + } + }} + } + +// Toggle strict mode. Re-reads the next number or string to please +// pedantic tests (`"use strict"; 010;` should fail). + +pp$7.setStrict = function(strict) { + var this$1 = this; + + this.strict = strict + if (this.type !== tt.num && this.type !== tt.string) return + this.pos = this.start + if (this.options.locations) { + while (this.pos < this.lineStart) { + this$1.lineStart = this$1.input.lastIndexOf("\n", this$1.lineStart - 2) + 1 + --this$1.curLine + } + } + this.nextToken() +} + +pp$7.curContext = function() { + return this.context[this.context.length - 1] +} + +// Read a single token, updating the parser object's token-related +// properties. + +pp$7.nextToken = function() { + var curContext = this.curContext() + if (!curContext || !curContext.preserveSpace) this.skipSpace() + + this.start = this.pos + if (this.options.locations) this.startLoc = this.curPosition() + if (this.pos >= this.input.length) return this.finishToken(tt.eof) + + if (curContext.override) return curContext.override(this) + else this.readToken(this.fullCharCodeAtPos()) +} + +pp$7.readToken = function(code) { + // Identifier or keyword. '\uXXXX' sequences are allowed in + // identifiers, so '\' also dispatches to that. + if (isIdentifierStart(code, this.options.ecmaVersion >= 6) || code === 92 /* '\' */) + return this.readWord() + + return this.getTokenFromCode(code) +} + +pp$7.fullCharCodeAtPos = function() { + var code = this.input.charCodeAt(this.pos) + if (code <= 0xd7ff || code >= 0xe000) return code + var next = this.input.charCodeAt(this.pos + 1) + return (code << 10) + next - 0x35fdc00 +} + +pp$7.skipBlockComment = function() { + var this$1 = this; + + var startLoc = this.options.onComment && this.curPosition() + var start = this.pos, end = this.input.indexOf("*/", this.pos += 2) + if (end === -1) this.raise(this.pos - 2, "Unterminated comment") + this.pos = end + 2 + if (this.options.locations) { + lineBreakG.lastIndex = start + var match + while ((match = lineBreakG.exec(this.input)) && match.index < this.pos) { + ++this$1.curLine + this$1.lineStart = match.index + match[0].length + } + } + if (this.options.onComment) + this.options.onComment(true, this.input.slice(start + 2, end), start, this.pos, + startLoc, this.curPosition()) +} + +pp$7.skipLineComment = function(startSkip) { + var this$1 = this; + + var start = this.pos + var startLoc = this.options.onComment && this.curPosition() + var ch = this.input.charCodeAt(this.pos+=startSkip) + while (this.pos < this.input.length && ch !== 10 && ch !== 13 && ch !== 8232 && ch !== 8233) { + ++this$1.pos + ch = this$1.input.charCodeAt(this$1.pos) + } + if (this.options.onComment) + this.options.onComment(false, this.input.slice(start + startSkip, this.pos), start, this.pos, + startLoc, this.curPosition()) +} + +// Called at the start of the parse and after every token. Skips +// whitespace and comments, and. + +pp$7.skipSpace = function() { + var this$1 = this; + + loop: while (this.pos < this.input.length) { + var ch = this$1.input.charCodeAt(this$1.pos) + switch (ch) { + case 32: case 160: // ' ' + ++this$1.pos + break + case 13: + if (this$1.input.charCodeAt(this$1.pos + 1) === 10) { + ++this$1.pos + } + case 10: case 8232: case 8233: + ++this$1.pos + if (this$1.options.locations) { + ++this$1.curLine + this$1.lineStart = this$1.pos + } + break + case 47: // '/' + switch (this$1.input.charCodeAt(this$1.pos + 1)) { + case 42: // '*' + this$1.skipBlockComment() + break + case 47: + this$1.skipLineComment(2) + break + default: + break loop + } + break + default: + if (ch > 8 && ch < 14 || ch >= 5760 && nonASCIIwhitespace.test(String.fromCharCode(ch))) { + ++this$1.pos + } else { + break loop + } + } + } +} + +// Called at the end of every token. Sets `end`, `val`, and +// maintains `context` and `exprAllowed`, and skips the space after +// the token, so that the next one's `start` will point at the +// right position. + +pp$7.finishToken = function(type, val) { + this.end = this.pos + if (this.options.locations) this.endLoc = this.curPosition() + var prevType = this.type + this.type = type + this.value = val + + this.updateContext(prevType) +} + +// ### Token reading + +// This is the function that is called to fetch the next token. It +// is somewhat obscure, because it works in character codes rather +// than characters, and because operator parsing has been inlined +// into it. +// +// All in the name of speed. +// +pp$7.readToken_dot = function() { + var next = this.input.charCodeAt(this.pos + 1) + if (next >= 48 && next <= 57) return this.readNumber(true) + var next2 = this.input.charCodeAt(this.pos + 2) + if (this.options.ecmaVersion >= 6 && next === 46 && next2 === 46) { // 46 = dot '.' + this.pos += 3 + return this.finishToken(tt.ellipsis) + } else { + ++this.pos + return this.finishToken(tt.dot) + } +} + +pp$7.readToken_slash = function() { // '/' + var next = this.input.charCodeAt(this.pos + 1) + if (this.exprAllowed) {++this.pos; return this.readRegexp()} + if (next === 61) return this.finishOp(tt.assign, 2) + return this.finishOp(tt.slash, 1) +} + +pp$7.readToken_mult_modulo_exp = function(code) { // '%*' + var next = this.input.charCodeAt(this.pos + 1) + var size = 1 + var tokentype = code === 42 ? tt.star : tt.modulo + + // exponentiation operator ** and **= + if (this.options.ecmaVersion >= 7 && next === 42) { + ++size + tokentype = tt.starstar + next = this.input.charCodeAt(this.pos + 2) + } + + if (next === 61) return this.finishOp(tt.assign, size + 1) + return this.finishOp(tokentype, size) +} + +pp$7.readToken_pipe_amp = function(code) { // '|&' + var next = this.input.charCodeAt(this.pos + 1) + if (next === code) return this.finishOp(code === 124 ? tt.logicalOR : tt.logicalAND, 2) + if (next === 61) return this.finishOp(tt.assign, 2) + return this.finishOp(code === 124 ? tt.bitwiseOR : tt.bitwiseAND, 1) +} + +pp$7.readToken_caret = function() { // '^' + var next = this.input.charCodeAt(this.pos + 1) + if (next === 61) return this.finishOp(tt.assign, 2) + return this.finishOp(tt.bitwiseXOR, 1) +} + +pp$7.readToken_plus_min = function(code) { // '+-' + var next = this.input.charCodeAt(this.pos + 1) + if (next === code) { + if (next == 45 && this.input.charCodeAt(this.pos + 2) == 62 && + lineBreak.test(this.input.slice(this.lastTokEnd, this.pos))) { + // A `-->` line comment + this.skipLineComment(3) + this.skipSpace() + return this.nextToken() + } + return this.finishOp(tt.incDec, 2) + } + if (next === 61) return this.finishOp(tt.assign, 2) + return this.finishOp(tt.plusMin, 1) +} + +pp$7.readToken_lt_gt = function(code) { // '<>' + var next = this.input.charCodeAt(this.pos + 1) + var size = 1 + if (next === code) { + size = code === 62 && this.input.charCodeAt(this.pos + 2) === 62 ? 3 : 2 + if (this.input.charCodeAt(this.pos + size) === 61) return this.finishOp(tt.assign, size + 1) + return this.finishOp(tt.bitShift, size) + } + if (next == 33 && code == 60 && this.input.charCodeAt(this.pos + 2) == 45 && + this.input.charCodeAt(this.pos + 3) == 45) { + if (this.inModule) this.unexpected() + // `` line comment + this.skipLineComment(3) + this.skipSpace() + return this.nextToken() + } + return this.finishOp(tt.incDec, 2) + } + if (next === 61) return this.finishOp(tt.assign, 2) + return this.finishOp(tt.plusMin, 1) + } + + pp$7.readToken_lt_gt = function(code) { // '<>' + var next = this.input.charCodeAt(this.pos + 1) + var size = 1 + if (next === code) { + size = code === 62 && this.input.charCodeAt(this.pos + 2) === 62 ? 3 : 2 + if (this.input.charCodeAt(this.pos + size) === 61) return this.finishOp(tt.assign, size + 1) + return this.finishOp(tt.bitShift, size) + } + if (next == 33 && code == 60 && this.input.charCodeAt(this.pos + 2) == 45 && + this.input.charCodeAt(this.pos + 3) == 45) { + if (this.inModule) this.unexpected() + // `` line comment + this.skipLineComment(3) + this.skipSpace() + return this.nextToken() + } + return this.finishOp(tt.incDec, 2) + } + if (next === 61) return this.finishOp(tt.assign, 2) + return this.finishOp(tt.plusMin, 1) +} + +pp.readToken_lt_gt = function(code) { // '<>' + let next = this.input.charCodeAt(this.pos + 1) + let size = 1 + if (next === code) { + size = code === 62 && this.input.charCodeAt(this.pos + 2) === 62 ? 3 : 2 + if (this.input.charCodeAt(this.pos + size) === 61) return this.finishOp(tt.assign, size + 1) + return this.finishOp(tt.bitShift, size) + } + if (next == 33 && code == 60 && this.input.charCodeAt(this.pos + 2) == 45 && + this.input.charCodeAt(this.pos + 3) == 45) { + if (this.inModule) this.unexpected() + // `